mirror of
https://github.com/Bubberstation/Bubberstation.git
synced 2026-02-06 06:19:24 +00:00
It's the year of the rat sisters, and now it's time to cut out those pesky C3s in your life! Why It's Good For The Game Rhig and Troph are no brainers considering they're on the same level of ease2make as the C2s and have no downside. They will still be good but they have some C2 component now. Kinda minor compared to the others but I'll see how it plays out. Changelog 🆑 balance: Helbital now is more simple to use and is based off not crit/softcrit/hardcrit. You want to be in hardcrit for the best brute healing. tweak: Troph has now been converted into a C2 with tweaks, now named Probital. Same recipe. Downside is stamina damage tweak: Rhig has now been converted into a C2 with tweaks, now named Hercuri. Same Recipe. Downside is it can cool to dangerous levels. /🆑
471 lines
16 KiB
Plaintext
471 lines
16 KiB
Plaintext
/* First aid storage
|
|
* Contains:
|
|
* First Aid Kits
|
|
* Pill Bottles
|
|
* Dice Pack (in a pill bottle)
|
|
*/
|
|
|
|
/*
|
|
* First Aid Kits
|
|
*/
|
|
/obj/item/storage/firstaid
|
|
name = "first-aid kit"
|
|
desc = "It's an emergency medical kit for those serious boo-boos."
|
|
icon_state = "firstaid"
|
|
lefthand_file = 'icons/mob/inhands/equipment/medical_lefthand.dmi'
|
|
righthand_file = 'icons/mob/inhands/equipment/medical_righthand.dmi'
|
|
throw_speed = 3
|
|
throw_range = 7
|
|
var/empty = FALSE
|
|
var/damagetype_healed //defines damage type of the medkit. General ones stay null. Used for medibot healing bonuses
|
|
|
|
/obj/item/storage/firstaid/regular
|
|
icon_state = "firstaid"
|
|
desc = "A first aid kit with the ability to heal common types of injuries."
|
|
|
|
/obj/item/storage/firstaid/regular/suicide_act(mob/living/carbon/user)
|
|
user.visible_message("<span class='suicide'>[user] begins giving [user.p_them()]self aids with \the [src]! It looks like [user.p_theyre()] trying to commit suicide!</span>")
|
|
return BRUTELOSS
|
|
|
|
/obj/item/storage/firstaid/regular/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/stack/medical/gauze = 1,
|
|
/obj/item/stack/medical/suture = 2,
|
|
/obj/item/stack/medical/mesh = 2,
|
|
/obj/item/reagent_containers/hypospray/medipen = 1)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/medical
|
|
name = "medical aid kit"
|
|
icon_state = "firstaid_surgery"
|
|
item_state = "firstaid"
|
|
desc = "A high capacity aid kit for doctors, full of medical supplies and basic surgical equipment"
|
|
|
|
/obj/item/storage/firstaid/medical/ComponentInitialize()
|
|
. = ..()
|
|
var/datum/component/storage/STR = GetComponent(/datum/component/storage)
|
|
STR.max_w_class = WEIGHT_CLASS_NORMAL //holds the same equipment as a medibelt
|
|
STR.max_items = 12
|
|
STR.max_combined_w_class = 24
|
|
STR.set_holdable(list(
|
|
/obj/item/healthanalyzer,
|
|
/obj/item/dnainjector,
|
|
/obj/item/reagent_containers/dropper,
|
|
/obj/item/reagent_containers/glass/beaker,
|
|
/obj/item/reagent_containers/glass/bottle,
|
|
/obj/item/reagent_containers/pill,
|
|
/obj/item/reagent_containers/syringe,
|
|
/obj/item/reagent_containers/medigel,
|
|
/obj/item/lighter,
|
|
/obj/item/storage/fancy/cigarettes,
|
|
/obj/item/storage/pill_bottle,
|
|
/obj/item/stack/medical,
|
|
/obj/item/flashlight/pen,
|
|
/obj/item/extinguisher/mini,
|
|
/obj/item/reagent_containers/hypospray,
|
|
/obj/item/sensor_device,
|
|
/obj/item/radio,
|
|
/obj/item/clothing/gloves/,
|
|
/obj/item/lazarus_injector,
|
|
/obj/item/bikehorn/rubberducky,
|
|
/obj/item/clothing/mask/surgical,
|
|
/obj/item/clothing/mask/breath,
|
|
/obj/item/clothing/mask/breath/medical,
|
|
/obj/item/surgical_drapes, //for true paramedics
|
|
/obj/item/scalpel,
|
|
/obj/item/circular_saw,
|
|
/obj/item/surgicaldrill,
|
|
/obj/item/retractor,
|
|
/obj/item/cautery,
|
|
/obj/item/hemostat,
|
|
/obj/item/geiger_counter,
|
|
/obj/item/clothing/neck/stethoscope,
|
|
/obj/item/stamp,
|
|
/obj/item/clothing/glasses,
|
|
/obj/item/wrench/medical,
|
|
/obj/item/clothing/mask/muzzle,
|
|
/obj/item/storage/bag/chemistry,
|
|
/obj/item/storage/bag/bio,
|
|
/obj/item/reagent_containers/blood,
|
|
/obj/item/tank/internals/emergency_oxygen,
|
|
/obj/item/gun/syringe/syndicate,
|
|
/obj/item/implantcase,
|
|
/obj/item/implant,
|
|
/obj/item/implanter,
|
|
/obj/item/pinpointer/crew,
|
|
/obj/item/holosign_creator/medical
|
|
))
|
|
|
|
/obj/item/storage/firstaid/medical/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/stack/medical/gauze = 1,
|
|
/obj/item/stack/medical/suture = 2,
|
|
/obj/item/stack/medical/mesh = 2,
|
|
/obj/item/reagent_containers/hypospray/medipen = 1,
|
|
/obj/item/surgical_drapes = 1,
|
|
/obj/item/scalpel = 1,
|
|
/obj/item/hemostat = 1,
|
|
/obj/item/cautery = 1,
|
|
/obj/item/healthanalyzer = 1)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/ancient
|
|
icon_state = "firstaid"
|
|
desc = "A first aid kit with the ability to heal common types of injuries."
|
|
|
|
/obj/item/storage/firstaid/ancient/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/stack/medical/gauze = 1,
|
|
/obj/item/stack/medical/bruise_pack = 3,
|
|
/obj/item/stack/medical/ointment= 3)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/fire
|
|
name = "burn treatment kit"
|
|
desc = "A specialized medical kit for when the toxins lab <i>-spontaneously-</i> burns down."
|
|
icon_state = "ointment"
|
|
item_state = "firstaid-ointment"
|
|
damagetype_healed = BURN
|
|
|
|
/obj/item/storage/firstaid/fire/suicide_act(mob/living/carbon/user)
|
|
user.visible_message("<span class='suicide'>[user] begins rubbing \the [src] against [user.p_them()]self! It looks like [user.p_theyre()] trying to start a fire!</span>")
|
|
return FIRELOSS
|
|
|
|
/obj/item/storage/firstaid/fire/Initialize(mapload)
|
|
. = ..()
|
|
icon_state = pick("ointment","firefirstaid")
|
|
|
|
/obj/item/storage/firstaid/fire/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/reagent_containers/pill/patch/aiuri = 3,
|
|
/obj/item/reagent_containers/spray/hercuri = 1,
|
|
/obj/item/reagent_containers/hypospray/medipen/oxandrolone = 1,
|
|
/obj/item/reagent_containers/hypospray/medipen = 1)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/toxin
|
|
name = "toxin treatment kit"
|
|
desc = "Used to treat toxic blood content and radiation poisoning."
|
|
icon_state = "antitoxin"
|
|
item_state = "firstaid-toxin"
|
|
damagetype_healed = TOX
|
|
|
|
/obj/item/storage/firstaid/toxin/suicide_act(mob/living/carbon/user)
|
|
user.visible_message("<span class='suicide'>[user] begins licking the lead paint off \the [src]! It looks like [user.p_theyre()] trying to commit suicide!</span>")
|
|
return TOXLOSS
|
|
|
|
/obj/item/storage/firstaid/toxin/Initialize(mapload)
|
|
. = ..()
|
|
icon_state = pick("antitoxin","antitoxfirstaid","antitoxfirstaid2")
|
|
|
|
/obj/item/storage/firstaid/toxin/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/storage/pill_bottle/multiver/less = 1,
|
|
/obj/item/reagent_containers/syringe/syriniver = 3,
|
|
/obj/item/storage/pill_bottle/potassiodide = 1,
|
|
/obj/item/reagent_containers/hypospray/medipen/penacid = 1)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/o2
|
|
name = "oxygen deprivation treatment kit"
|
|
desc = "A box full of oxygen goodies."
|
|
icon_state = "o2"
|
|
item_state = "firstaid-o2"
|
|
damagetype_healed = OXY
|
|
|
|
/obj/item/storage/firstaid/o2/suicide_act(mob/living/carbon/user)
|
|
user.visible_message("<span class='suicide'>[user] begins hitting [user.p_their()] neck with \the [src]! It looks like [user.p_theyre()] trying to commit suicide!</span>")
|
|
return OXYLOSS
|
|
|
|
/obj/item/storage/firstaid/o2/Initialize(mapload)
|
|
. = ..()
|
|
icon_state = pick("o2","o2second")
|
|
|
|
/obj/item/storage/firstaid/o2/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/reagent_containers/syringe/convermol = 3,
|
|
/obj/item/reagent_containers/hypospray/medipen/salbutamol = 1,
|
|
/obj/item/reagent_containers/hypospray/medipen = 1,
|
|
/obj/item/storage/pill_bottle/iron = 1)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/brute
|
|
name = "brute trauma treatment kit"
|
|
desc = "A first aid kit for when you get toolboxed."
|
|
icon_state = "brute"
|
|
item_state = "firstaid-brute"
|
|
damagetype_healed = BRUTE
|
|
|
|
/obj/item/storage/firstaid/brute/suicide_act(mob/living/carbon/user)
|
|
user.visible_message("<span class='suicide'>[user] begins beating [user.p_them()]self over the head with \the [src]! It looks like [user.p_theyre()] trying to commit suicide!</span>")
|
|
return BRUTELOSS
|
|
|
|
/obj/item/storage/firstaid/brute/Initialize(mapload)
|
|
. = ..()
|
|
icon_state = pick("brute","brute2")
|
|
|
|
/obj/item/storage/firstaid/brute/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/reagent_containers/pill/patch/libital = 3,
|
|
/obj/item/stack/medical/gauze = 1,
|
|
/obj/item/storage/pill_bottle/C2/probital = 1,
|
|
/obj/item/reagent_containers/hypospray/medipen/salacid = 1)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/advanced
|
|
name = "advanced first aid kit"
|
|
desc = "An advanced kit to help deal with advanced wounds."
|
|
icon_state = "radfirstaid"
|
|
item_state = "firstaid-rad"
|
|
custom_premium_price = 1100
|
|
|
|
/obj/item/storage/firstaid/advanced/PopulateContents()
|
|
if(empty)
|
|
return
|
|
var/static/items_inside = list(
|
|
/obj/item/reagent_containers/pill/patch/instabitaluri = 3,
|
|
/obj/item/reagent_containers/hypospray/medipen/atropine = 2,
|
|
/obj/item/stack/medical/gauze = 1,
|
|
/obj/item/storage/pill_bottle/penacid = 1)
|
|
generate_items_inside(items_inside,src)
|
|
|
|
/obj/item/storage/firstaid/tactical
|
|
name = "combat medical kit"
|
|
desc = "I hope you've got insurance."
|
|
icon_state = "bezerk"
|
|
|
|
/obj/item/storage/firstaid/tactical/ComponentInitialize()
|
|
. = ..()
|
|
var/datum/component/storage/STR = GetComponent(/datum/component/storage)
|
|
STR.max_w_class = WEIGHT_CLASS_NORMAL
|
|
|
|
/obj/item/storage/firstaid/tactical/PopulateContents()
|
|
if(empty)
|
|
return
|
|
new /obj/item/stack/medical/gauze(src)
|
|
new /obj/item/defibrillator/compact/combat/loaded(src)
|
|
new /obj/item/reagent_containers/hypospray/combat(src)
|
|
new /obj/item/reagent_containers/pill/patch/libital(src)
|
|
new /obj/item/reagent_containers/pill/patch/libital(src)
|
|
new /obj/item/reagent_containers/pill/patch/aiuri(src)
|
|
new /obj/item/reagent_containers/pill/patch/aiuri(src)
|
|
new /obj/item/clothing/glasses/hud/health/night(src)
|
|
|
|
//medibot assembly
|
|
/obj/item/storage/firstaid/attackby(obj/item/bodypart/S, mob/user, params)
|
|
if((!istype(S, /obj/item/bodypart/l_arm/robot)) && (!istype(S, /obj/item/bodypart/r_arm/robot)))
|
|
return ..()
|
|
|
|
//Making a medibot!
|
|
if(contents.len >= 1)
|
|
to_chat(user, "<span class='warning'>You need to empty [src] out first!</span>")
|
|
return
|
|
|
|
var/obj/item/bot_assembly/medbot/A = new
|
|
if(istype(src, /obj/item/storage/firstaid/fire))
|
|
A.set_skin("ointment")
|
|
else if(istype(src, /obj/item/storage/firstaid/toxin))
|
|
A.set_skin("tox")
|
|
else if(istype(src, /obj/item/storage/firstaid/o2))
|
|
A.set_skin("o2")
|
|
else if(istype(src, /obj/item/storage/firstaid/brute))
|
|
A.set_skin("brute")
|
|
user.put_in_hands(A)
|
|
to_chat(user, "<span class='notice'>You add [S] to [src].</span>")
|
|
A.robot_arm = S.type
|
|
A.firstaid = type
|
|
qdel(S)
|
|
qdel(src)
|
|
|
|
/*
|
|
* Pill Bottles
|
|
*/
|
|
|
|
/obj/item/storage/pill_bottle
|
|
name = "pill bottle"
|
|
desc = "It's an airtight container for storing medication."
|
|
icon_state = "pill_canister"
|
|
icon = 'icons/obj/chemical.dmi'
|
|
item_state = "contsolid"
|
|
lefthand_file = 'icons/mob/inhands/equipment/medical_lefthand.dmi'
|
|
righthand_file = 'icons/mob/inhands/equipment/medical_righthand.dmi'
|
|
w_class = WEIGHT_CLASS_SMALL
|
|
|
|
/obj/item/storage/pill_bottle/ComponentInitialize()
|
|
. = ..()
|
|
var/datum/component/storage/STR = GetComponent(/datum/component/storage)
|
|
STR.allow_quick_gather = TRUE
|
|
STR.click_gather = TRUE
|
|
STR.set_holdable(list(/obj/item/reagent_containers/pill, /obj/item/dice))
|
|
|
|
/obj/item/storage/pill_bottle/suicide_act(mob/user)
|
|
user.visible_message("<span class='suicide'>[user] is trying to get the cap off [src]! It looks like [user.p_theyre()] trying to commit suicide!</span>")
|
|
return (TOXLOSS)
|
|
|
|
/obj/item/storage/pill_bottle/multiver
|
|
name = "bottle of multiver pills"
|
|
desc = "Contains pills used to counter toxins."
|
|
|
|
/obj/item/storage/pill_bottle/multiver/PopulateContents()
|
|
for(var/i in 1 to 7)
|
|
new /obj/item/reagent_containers/pill/multiver(src)
|
|
|
|
/obj/item/storage/pill_bottle/multiver/less
|
|
|
|
/obj/item/storage/pill_bottle/multiver/less/PopulateContents()
|
|
for(var/i in 1 to 3)
|
|
new /obj/item/reagent_containers/pill/multiver(src)
|
|
|
|
/obj/item/storage/pill_bottle/epinephrine
|
|
name = "bottle of epinephrine pills"
|
|
desc = "Contains pills used to stabilize patients."
|
|
|
|
/obj/item/storage/pill_bottle/epinephrine/PopulateContents()
|
|
for(var/i in 1 to 7)
|
|
new /obj/item/reagent_containers/pill/epinephrine(src)
|
|
|
|
/obj/item/storage/pill_bottle/mutadone
|
|
name = "bottle of mutadone pills"
|
|
desc = "Contains pills used to treat genetic abnormalities."
|
|
|
|
/obj/item/storage/pill_bottle/mutadone/PopulateContents()
|
|
for(var/i in 1 to 7)
|
|
new /obj/item/reagent_containers/pill/mutadone(src)
|
|
|
|
/obj/item/storage/pill_bottle/potassiodide
|
|
name = "bottle of potassium iodide pills"
|
|
desc = "Contains pills used to reduce radiation damage."
|
|
|
|
/obj/item/storage/pill_bottle/potassiodide/PopulateContents()
|
|
for(var/i in 1 to 3)
|
|
new /obj/item/reagent_containers/pill/potassiodide(src)
|
|
|
|
/obj/item/storage/pill_bottle/C2/probital
|
|
name = "bottle of probital pills"
|
|
desc = "Contains pills used to treat brute damage.The tag in the bottle states 'Eat before ingesting, may cause fatigue'."
|
|
|
|
/obj/item/storage/pill_bottle/C2/probital/PopulateContents()
|
|
for(var/i in 1 to 4)
|
|
new /obj/item/reagent_containers/pill/C2/probital(src)
|
|
|
|
/obj/item/storage/pill_bottle/iron
|
|
name = "bottle of iron pills"
|
|
desc = "Contains pills used to reduce blood loss slowly.The tag in the bottle states 'Only take one each five minutes'."
|
|
|
|
/obj/item/storage/pill_bottle/iron/PopulateContents()
|
|
for(var/i in 1 to 4)
|
|
new /obj/item/reagent_containers/pill/iron(src)
|
|
|
|
/obj/item/storage/pill_bottle/mannitol
|
|
name = "bottle of mannitol pills"
|
|
desc = "Contains pills used to treat brain damage."
|
|
|
|
/obj/item/storage/pill_bottle/mannitol/PopulateContents()
|
|
for(var/i in 1 to 7)
|
|
new /obj/item/reagent_containers/pill/mannitol(src)
|
|
|
|
/obj/item/storage/pill_bottle/stimulant
|
|
name = "bottle of stimulant pills"
|
|
desc = "Guaranteed to give you that extra burst of energy during a long shift!"
|
|
|
|
/obj/item/storage/pill_bottle/stimulant/PopulateContents()
|
|
for(var/i in 1 to 5)
|
|
new /obj/item/reagent_containers/pill/stimulant(src)
|
|
|
|
/obj/item/storage/pill_bottle/mining
|
|
name = "bottle of patches"
|
|
desc = "Contains patches used to treat brute and burn damage."
|
|
|
|
/obj/item/storage/pill_bottle/mining/PopulateContents()
|
|
new /obj/item/reagent_containers/pill/patch/aiuri(src)
|
|
for(var/i in 1 to 3)
|
|
new /obj/item/reagent_containers/pill/patch/libital(src)
|
|
|
|
/obj/item/storage/pill_bottle/zoom
|
|
name = "suspicious pill bottle"
|
|
desc = "The label is pretty old and almost unreadable, you recognize some chemical compounds."
|
|
|
|
/obj/item/storage/pill_bottle/zoom/PopulateContents()
|
|
for(var/i in 1 to 5)
|
|
new /obj/item/reagent_containers/pill/zoom(src)
|
|
|
|
/obj/item/storage/pill_bottle/happy
|
|
name = "suspicious pill bottle"
|
|
desc = "There is a smiley on the top."
|
|
|
|
/obj/item/storage/pill_bottle/happy/PopulateContents()
|
|
for(var/i in 1 to 5)
|
|
new /obj/item/reagent_containers/pill/happy(src)
|
|
|
|
/obj/item/storage/pill_bottle/lsd
|
|
name = "suspicious pill bottle"
|
|
desc = "There is a crude drawing which could be either a mushroom, or a deformed moon."
|
|
|
|
/obj/item/storage/pill_bottle/lsd/PopulateContents()
|
|
for(var/i in 1 to 5)
|
|
new /obj/item/reagent_containers/pill/lsd(src)
|
|
|
|
/obj/item/storage/pill_bottle/aranesp
|
|
name = "suspicious pill bottle"
|
|
desc = "The label has 'fuck disablers' hastily scrawled in black marker."
|
|
|
|
/obj/item/storage/pill_bottle/aranesp/PopulateContents()
|
|
for(var/i in 1 to 5)
|
|
new /obj/item/reagent_containers/pill/aranesp(src)
|
|
|
|
/obj/item/storage/pill_bottle/psicodine
|
|
name = "bottle of psicodine pills"
|
|
desc = "Contains pills used to treat mental distress and traumas."
|
|
|
|
/obj/item/storage/pill_bottle/psicodine/PopulateContents()
|
|
for(var/i in 1 to 7)
|
|
new /obj/item/reagent_containers/pill/psicodine(src)
|
|
|
|
/obj/item/storage/pill_bottle/penacid
|
|
name = "bottle of pentetic acid pills"
|
|
desc = "Contains pills to expunge radiation and toxins."
|
|
|
|
/obj/item/storage/pill_bottle/penacid/PopulateContents()
|
|
for(var/i in 1 to 3)
|
|
new /obj/item/reagent_containers/pill/penacid(src)
|
|
|
|
|
|
/obj/item/storage/pill_bottle/neurine
|
|
name = "bottle of neurine pills"
|
|
desc = "Contains pills to treat non-severe mental traumas."
|
|
|
|
/obj/item/storage/pill_bottle/neurine/PopulateContents()
|
|
for(var/i in 1 to 5)
|
|
new /obj/item/reagent_containers/pill/neurine(src)
|
|
|
|
/obj/item/storage/pill_bottle/floorpill
|
|
name = "bottle of floorpills"
|
|
desc = "An old pill bottle. It smells musty."
|
|
|
|
/obj/item/storage/pill_bottle/floorpill/Initialize()
|
|
. = ..()
|
|
var/obj/item/reagent_containers/pill/P = locate() in src
|
|
name = "bottle of [P.name]s"
|
|
|
|
/obj/item/storage/pill_bottle/floorpill/PopulateContents()
|
|
for(var/i in 1 to rand(1,7))
|
|
new /obj/item/reagent_containers/pill/floorpill(src)
|
|
|
|
/obj/item/storage/pill_bottle/floorpill/full/PopulateContents()
|
|
for(var/i in 1 to 7)
|
|
new /obj/item/reagent_containers/pill/floorpill(src)
|