Merge branch 'bleeding-edge-freeze' of https://github.com/Baystation12/Baystation12 into bleeding-edge-freeze

Conflicts:
	code/controllers/master_controller.dm
	code/modules/mob/new_player/sprite_accessories.dm
	code/modules/reagents/Chemistry-Reagents.dm
	code/setup.dm
	icons/mob/human_face.dmi

Signed-off-by: Cael_Aislinn <cael_aislinn@yahoo.com.au>
This commit is contained in:
Cael_Aislinn
2013-02-01 23:41:16 +10:00
235 changed files with 37105 additions and 26723 deletions

View File

@@ -133,6 +133,7 @@
#include "code\datums\spells\ethereal_jaunt.dm" #include "code\datums\spells\ethereal_jaunt.dm"
#include "code\datums\spells\explosion.dm" #include "code\datums\spells\explosion.dm"
#include "code\datums\spells\genetic.dm" #include "code\datums\spells\genetic.dm"
#include "code\datums\spells\horsemask.dm"
#include "code\datums\spells\inflict_handler.dm" #include "code\datums\spells\inflict_handler.dm"
#include "code\datums\spells\knock.dm" #include "code\datums\spells\knock.dm"
#include "code\datums\spells\mind_transfer.dm" #include "code\datums\spells\mind_transfer.dm"
@@ -189,6 +190,7 @@
#include "code\game\gamemodes\cult\ritual.dm" #include "code\game\gamemodes\cult\ritual.dm"
#include "code\game\gamemodes\cult\runes.dm" #include "code\game\gamemodes\cult\runes.dm"
#include "code\game\gamemodes\cult\talisman.dm" #include "code\game\gamemodes\cult\talisman.dm"
#include "code\game\gamemodes\events\biomass.dm"
#include "code\game\gamemodes\events\black_hole.dm" #include "code\game\gamemodes\events\black_hole.dm"
#include "code\game\gamemodes\events\clang.dm" #include "code\game\gamemodes\events\clang.dm"
#include "code\game\gamemodes\events\dust.dm" #include "code\game\gamemodes\events\dust.dm"
@@ -217,7 +219,6 @@
#include "code\game\gamemodes\wizard\rightandwrong.dm" #include "code\game\gamemodes\wizard\rightandwrong.dm"
#include "code\game\gamemodes\wizard\soulstone.dm" #include "code\game\gamemodes\wizard\soulstone.dm"
#include "code\game\gamemodes\wizard\spellbook.dm" #include "code\game\gamemodes\wizard\spellbook.dm"
#include "code\game\gamemodes\wizard\spells.dm"
#include "code\game\gamemodes\wizard\veilrender.dm" #include "code\game\gamemodes\wizard\veilrender.dm"
#include "code\game\gamemodes\wizard\wizard.dm" #include "code\game\gamemodes\wizard\wizard.dm"
#include "code\game\jobs\access.dm" #include "code\game\jobs\access.dm"
@@ -295,8 +296,6 @@
#include "code\game\machinery\bots\bots.dm" #include "code\game\machinery\bots\bots.dm"
#include "code\game\machinery\bots\cleanbot.dm" #include "code\game\machinery\bots\cleanbot.dm"
#include "code\game\machinery\bots\ed209bot.dm" #include "code\game\machinery\bots\ed209bot.dm"
#include "code\game\machinery\bots\farmbot.dm"
#include "code\game\machinery\bots\floorbot.dm"
#include "code\game\machinery\bots\medbot.dm" #include "code\game\machinery\bots\medbot.dm"
#include "code\game\machinery\bots\mulebot.dm" #include "code\game\machinery\bots\mulebot.dm"
#include "code\game\machinery\bots\secbot.dm" #include "code\game\machinery\bots\secbot.dm"
@@ -394,7 +393,6 @@
#include "code\game\objects\weapons.dm" #include "code\game\objects\weapons.dm"
#include "code\game\objects\closets\walllocker.dm" #include "code\game\objects\closets\walllocker.dm"
#include "code\game\objects\effects\aliens.dm" #include "code\game\objects\effects\aliens.dm"
#include "code\game\objects\effects\biomass_rift.dm"
#include "code\game\objects\effects\bump_teleporter.dm" #include "code\game\objects\effects\bump_teleporter.dm"
#include "code\game\objects\effects\effect_system.dm" #include "code\game\objects\effects\effect_system.dm"
#include "code\game\objects\effects\gibs.dm" #include "code\game\objects\effects\gibs.dm"
@@ -405,6 +403,7 @@
#include "code\game\objects\effects\misc.dm" #include "code\game\objects\effects\misc.dm"
#include "code\game\objects\effects\overlays.dm" #include "code\game\objects\effects\overlays.dm"
#include "code\game\objects\effects\portals.dm" #include "code\game\objects\effects\portals.dm"
#include "code\game\objects\effects\spiders.dm"
#include "code\game\objects\effects\step_triggers.dm" #include "code\game\objects\effects\step_triggers.dm"
#include "code\game\objects\effects\decals\cleanable.dm" #include "code\game\objects\effects\decals\cleanable.dm"
#include "code\game\objects\effects\decals\contraband.dm" #include "code\game\objects\effects\decals\contraband.dm"
@@ -512,7 +511,6 @@
#include "code\game\objects\items\weapons\implants\implantchair.dm" #include "code\game\objects\items\weapons\implants\implantchair.dm"
#include "code\game\objects\items\weapons\implants\implanter.dm" #include "code\game\objects\items\weapons\implants\implanter.dm"
#include "code\game\objects\items\weapons\implants\implantfreedom.dm" #include "code\game\objects\items\weapons\implants\implantfreedom.dm"
#include "code\game\objects\items\weapons\implants\implantnanoaug.dm"
#include "code\game\objects\items\weapons\implants\implantpad.dm" #include "code\game\objects\items\weapons\implants\implantpad.dm"
#include "code\game\objects\items\weapons\implants\implantuplink.dm" #include "code\game\objects\items\weapons\implants\implantuplink.dm"
#include "code\game\objects\items\weapons\melee\energy.dm" #include "code\game\objects\items\weapons\melee\energy.dm"
@@ -731,12 +729,14 @@
#include "code\modules\clothing\under\jobs\security.dm" #include "code\modules\clothing\under\jobs\security.dm"
#include "code\modules\customitems\item_defines.dm" #include "code\modules\customitems\item_defines.dm"
#include "code\modules\customitems\item_spawning.dm" #include "code\modules\customitems\item_spawning.dm"
#include "code\modules\destilery\main.dm"
#include "code\modules\detectivework\detective_work.dm" #include "code\modules\detectivework\detective_work.dm"
#include "code\modules\detectivework\evidence.dm" #include "code\modules\detectivework\evidence.dm"
#include "code\modules\detectivework\footprints_and_rag.dm" #include "code\modules\detectivework\footprints_and_rag.dm"
#include "code\modules\detectivework\scanner.dm" #include "code\modules\detectivework\scanner.dm"
#include "code\modules\events\alien_infestation.dm" #include "code\modules\events\alien_infestation.dm"
#include "code\modules\events\blob.dm" #include "code\modules\events\blob.dm"
#include "code\modules\events\brand_intelligence.dm"
#include "code\modules\events\carp_migration.dm" #include "code\modules\events\carp_migration.dm"
#include "code\modules\events\communications_blackout.dm" #include "code\modules\events\communications_blackout.dm"
#include "code\modules\events\disease_outbreak.dm" #include "code\modules\events\disease_outbreak.dm"
@@ -747,6 +747,7 @@
#include "code\modules\events\prison_break.dm" #include "code\modules\events\prison_break.dm"
#include "code\modules\events\radiation_storm.dm" #include "code\modules\events\radiation_storm.dm"
#include "code\modules\events\spacevine.dm" #include "code\modules\events\spacevine.dm"
#include "code\modules\events\spider_infestation.dm"
#include "code\modules\events\spontaneous_appendicitis.dm" #include "code\modules\events\spontaneous_appendicitis.dm"
#include "code\modules\flufftext\Dreaming.dm" #include "code\modules\flufftext\Dreaming.dm"
#include "code\modules\flufftext\Hallucination.dm" #include "code\modules\flufftext\Hallucination.dm"
@@ -922,11 +923,8 @@
#include "code\modules\mob\living\silicon\robot\robot_movement.dm" #include "code\modules\mob\living\silicon\robot\robot_movement.dm"
#include "code\modules\mob\living\silicon\robot\say.dm" #include "code\modules\mob\living\silicon\robot\say.dm"
#include "code\modules\mob\living\silicon\robot\wires.dm" #include "code\modules\mob\living\silicon\robot\wires.dm"
#include "code\modules\mob\living\simple_animal\clown.dm"
#include "code\modules\mob\living\simple_animal\constructs.dm" #include "code\modules\mob\living\simple_animal\constructs.dm"
#include "code\modules\mob\living\simple_animal\corpse.dm" #include "code\modules\mob\living\simple_animal\corpse.dm"
#include "code\modules\mob\living\simple_animal\head.dm"
#include "code\modules\mob\living\simple_animal\kobold.dm"
#include "code\modules\mob\living\simple_animal\parrot.dm" #include "code\modules\mob\living\simple_animal\parrot.dm"
#include "code\modules\mob\living\simple_animal\shade.dm" #include "code\modules\mob\living\simple_animal\shade.dm"
#include "code\modules\mob\living\simple_animal\simple_animal.dm" #include "code\modules\mob\living\simple_animal\simple_animal.dm"
@@ -934,6 +932,7 @@
#include "code\modules\mob\living\simple_animal\friendly\cat.dm" #include "code\modules\mob\living\simple_animal\friendly\cat.dm"
#include "code\modules\mob\living\simple_animal\friendly\corgi.dm" #include "code\modules\mob\living\simple_animal\friendly\corgi.dm"
#include "code\modules\mob\living\simple_animal\friendly\crab.dm" #include "code\modules\mob\living\simple_animal\friendly\crab.dm"
#include "code\modules\mob\living\simple_animal\friendly\farm_animals.dm"
#include "code\modules\mob\living\simple_animal\friendly\lizard.dm" #include "code\modules\mob\living\simple_animal\friendly\lizard.dm"
#include "code\modules\mob\living\simple_animal\friendly\mouse.dm" #include "code\modules\mob\living\simple_animal\friendly\mouse.dm"
#include "code\modules\mob\living\simple_animal\friendly\mushroom.dm" #include "code\modules\mob\living\simple_animal\friendly\mushroom.dm"
@@ -944,6 +943,7 @@
#include "code\modules\mob\living\simple_animal\hostile\carp.dm" #include "code\modules\mob\living\simple_animal\hostile\carp.dm"
#include "code\modules\mob\living\simple_animal\hostile\creature.dm" #include "code\modules\mob\living\simple_animal\hostile\creature.dm"
#include "code\modules\mob\living\simple_animal\hostile\faithless.dm" #include "code\modules\mob\living\simple_animal\hostile\faithless.dm"
#include "code\modules\mob\living\simple_animal\hostile\giant_spider.dm"
#include "code\modules\mob\living\simple_animal\hostile\hivebot.dm" #include "code\modules\mob\living\simple_animal\hostile\hivebot.dm"
#include "code\modules\mob\living\simple_animal\hostile\hostile.dm" #include "code\modules\mob\living\simple_animal\hostile\hostile.dm"
#include "code\modules\mob\living\simple_animal\hostile\mimic.dm" #include "code\modules\mob\living\simple_animal\hostile\mimic.dm"
@@ -951,6 +951,8 @@
#include "code\modules\mob\living\simple_animal\hostile\russian.dm" #include "code\modules\mob\living\simple_animal\hostile\russian.dm"
#include "code\modules\mob\living\simple_animal\hostile\syndicate.dm" #include "code\modules\mob\living\simple_animal\hostile\syndicate.dm"
#include "code\modules\mob\living\simple_animal\hostile\tree.dm" #include "code\modules\mob\living\simple_animal\hostile\tree.dm"
#include "code\modules\mob\living\simple_animal\hostile\retaliate\clown.dm"
#include "code\modules\mob\living\simple_animal\hostile\retaliate\retaliate.dm"
#include "code\modules\mob\new_player\hud.dm" #include "code\modules\mob\new_player\hud.dm"
#include "code\modules\mob\new_player\login.dm" #include "code\modules\mob\new_player\login.dm"
#include "code\modules\mob\new_player\logout.dm" #include "code\modules\mob\new_player\logout.dm"

View File

@@ -62,6 +62,9 @@ datum/air_group
proc/check_regroup() proc/check_regroup()
//Purpose: Checks to see if group processing should be turned back on //Purpose: Checks to see if group processing should be turned back on
//Returns: group_processing //Returns: group_processing
if(prevent_airgroup_regroup)
return 0
if(group_processing) return 1 if(group_processing) return 1
var/turf/simulated/sample = pick(members) var/turf/simulated/sample = pick(members)

View File

@@ -45,7 +45,6 @@
return igniting return igniting
//This is the icon for fire on turfs, also helps for nurturing small fires until they are full tile //This is the icon for fire on turfs, also helps for nurturing small fires until they are full tile
/obj/effect/hotspot /obj/effect/hotspot
anchored = 1 anchored = 1
@@ -98,12 +97,15 @@
var/turf/simulated/floor/location = loc var/turf/simulated/floor/location = loc
if(!istype(location)) if(!istype(location))
Kill() Kill()
return
if((temperature < FIRE_MINIMUM_TEMPERATURE_TO_EXIST) || (volume <= 1)) if((temperature < FIRE_MINIMUM_TEMPERATURE_TO_EXIST) || (volume <= 1))
Kill() Kill()
return
if(location.air.toxins < 0.5 || location.air.oxygen < 0.5) if(location.air.toxins < 0.5 || location.air.oxygen < 0.5)
Kill() Kill()
return
perform_exposure() perform_exposure()
@@ -130,7 +132,7 @@
if(temperature > location.max_fire_temperature_sustained) if(temperature > location.max_fire_temperature_sustained)
location.max_fire_temperature_sustained = temperature location.max_fire_temperature_sustained = temperature
if(temperature > location.heat_capacity) if(location.heat_capacity && temperature > location.heat_capacity)
location.to_be_destroyed = 1 location.to_be_destroyed = 1
/*if(prob(25)) /*if(prob(25))
location.ReplaceWithSpace() location.ReplaceWithSpace()
@@ -168,8 +170,9 @@
dir = pick(cardinal) dir = pick(cardinal)
return return
/*
/obj/effect/hotspot/Del() /obj/effect/hotspot/Del()
if (istype(loc, /turf/simulated)) if (istype(loc, /turf/simulated))
DestroyTurf() DestroyTurf()
..() ..()
return */

View File

@@ -23,11 +23,10 @@ What are the archived variables for?
volatile_fuel volatile_fuel
specific_heat = 30 specific_heat = 30
var var/moles = 0
moles = 0 var/specific_heat = 0
specific_heat = 0
moles_archived = 0 var/moles_archived = 0
/datum/gas_mixture /datum/gas_mixture

View File

@@ -1,6 +1,6 @@
//This file was auto-corrected by findeclaration.exe on 25.5.2012 20:42:31 //This file was auto-corrected by findeclaration.exe on 25.5.2012 20:42:31
atom/movable/var/pressure_resistance = 20 atom/movable/var/pressure_resistance = 5
atom/movable/var/last_forced_movement = 0 atom/movable/var/last_forced_movement = 0
atom/movable/proc/experience_pressure_difference(pressure_difference, direction) atom/movable/proc/experience_pressure_difference(pressure_difference, direction)
@@ -47,20 +47,21 @@ turf
turf turf
var/pressure_difference = 0 var/pressure_difference = 0
var/pressure_direction = 0 var/pressure_direction = 0
var/reporting_pressure_difference
//optimization vars //optimization vars
var/next_check = 0 //number of ticks before this tile updates var/next_check = 0 //number of ticks before this tile updates
var/check_delay = 0 //number of ticks between updates var/check_delay = 0 //number of ticks between updates
proc proc/high_pressure_movements()
high_pressure_movements() if(reporting_pressure_difference)
world << "pressure_difference = [pressure_difference]; pressure_direction = [pressure_direction]"
for(var/atom/movable/in_tile in src) for(var/atom/movable/in_tile in src)
in_tile.experience_pressure_difference(pressure_difference, pressure_direction) in_tile.experience_pressure_difference(pressure_difference, pressure_direction)
pressure_difference = 0 pressure_difference = 0
consider_pressure_difference(connection_difference, connection_direction) proc/consider_pressure_difference(connection_difference, connection_direction)
if(connection_difference < 0) if(connection_difference < 0)
connection_difference = -connection_difference connection_difference = -connection_difference
connection_direction = turn(connection_direction,180) connection_direction = turn(connection_direction,180)
@@ -71,9 +72,7 @@ turf
pressure_difference = connection_difference pressure_difference = connection_difference
pressure_direction = connection_direction pressure_direction = connection_direction
simulated turf/simulated/proc/consider_pressure_difference_space(connection_difference)
proc
consider_pressure_difference_space(connection_difference)
for(var/direction in cardinal) for(var/direction in cardinal)
if(direction&group_border) if(direction&group_border)
if(istype(get_step(src,direction),/turf/space)) if(istype(get_step(src,direction),/turf/space))
@@ -86,8 +85,7 @@ turf
return 1 return 1
turf turf/simulated
simulated
var/current_graphic = null var/current_graphic = null
@@ -108,22 +106,7 @@ turf
var/tmp/temperature_archived //USED ONLY FOR SOLIDS var/tmp/temperature_archived //USED ONLY FOR SOLIDS
var/tmp/being_superconductive = 0 var/tmp/being_superconductive = 0
proc/update_visuals(datum/gas_mixture/model)
proc
process_cell()
update_air_properties()
archive()
mimic_air_with_tile(turf/model)
share_air_with_tile(turf/simulated/sharer)
mimic_temperature_with_tile(turf/model)
share_temperature_with_tile(turf/simulated/sharer)
super_conduct()
update_visuals(datum/gas_mixture/model)
overlays.Cut() overlays.Cut()
var/siding_icon_state = return_siding_icon_state() var/siding_icon_state = return_siding_icon_state()
@@ -173,7 +156,7 @@ turf
else else
air_master.active_singletons.Remove(src) air_master.active_singletons.Remove(src)
if(active_hotspot) if(active_hotspot)
del(active_hotspot) active_hotspot.Kill()
if(blocks_air) if(blocks_air)
for(var/direction in list(NORTH, SOUTH, EAST, WEST)) for(var/direction in list(NORTH, SOUTH, EAST, WEST))
var/turf/simulated/tile = get_step(src,direction) var/turf/simulated/tile = get_step(src,direction)
@@ -203,17 +186,17 @@ turf
else return ..() else return ..()
archive() proc/archive()
if(air) //For open space like floors if(air) //For open space like floors
air.archive() air.archive()
temperature_archived = temperature temperature_archived = temperature
archived_cycle = air_master.current_cycle archived_cycle = air_master.current_cycle
share_air_with_tile(turf/simulated/T) proc/share_air_with_tile(turf/simulated/T)
return air.share(T.air) return air.share(T.air)
mimic_air_with_tile(turf/T) proc/mimic_air_with_tile(turf/T)
return air.mimic(T) return air.mimic(T)
return_air() return_air()
@@ -246,7 +229,7 @@ turf
else else
return ..() return ..()
update_air_properties()//OPTIMIZE proc/update_air_properties()//OPTIMIZE
air_check_directions = 0 air_check_directions = 0
for(var/direction in cardinal) for(var/direction in cardinal)
@@ -295,10 +278,11 @@ turf
else else
processing = 0 processing = 0
process_cell() proc/process_cell()
//this proc does all the heavy lifting for individual tile processing //this proc does all the heavy lifting for individual tile processing
//it shares with all of its neighbors, spreads fire, calls superconduction //it shares with all of its neighbors, spreads fire, calls superconduction
//and doesn't afraid of anything //and doesn't afraid of anything
//Comment by errorage: In other words, this is the proc that lags the game.
//check if we're skipping this tick //check if we're skipping this tick
if (next_check > 0) if (next_check > 0)
@@ -400,7 +384,7 @@ turf
return 1 return 1
super_conduct() proc/super_conduct()
var/conductivity_directions = 0 var/conductivity_directions = 0
if(blocks_air) if(blocks_air)
//Does not participate in air exchange, so will conduct heat across all four borders at this time //Does not participate in air exchange, so will conduct heat across all four borders at this time

View File

@@ -122,5 +122,5 @@ proc/assign_sec_to_department(var/mob/living/carbon/human/H)
hastie = A hastie = A
/obj/item/clothing/under/rank/security/med/New() /obj/item/clothing/under/rank/security/med/New()
var/obj/item/clothing/tie/armband/med/A = new /obj/item/clothing/tie/armband/med var/obj/item/clothing/tie/armband/medgreen/A = new /obj/item/clothing/tie/armband/medgreen
hastie = A hastie = A

View File

@@ -188,24 +188,29 @@
/proc/get_mobs_in_radio_ranges(var/list/obj/item/device/radio/radios) /proc/get_mobs_in_radio_ranges(var/list/obj/item/device/radio/radios)
. = list()
set background = 1
. = list()
// Returns a list of mobs who can hear any of the radios given in @radios // Returns a list of mobs who can hear any of the radios given in @radios
var/list/speaker_coverage = list() var/list/speaker_coverage = list()
for(var/obj/item/device/radio/R in radios) for(var/i = 1; i <= radios.len; i++)
var/obj/item/device/radio/R = radios[i]
if(R)
var/turf/speaker = get_turf(R) var/turf/speaker = get_turf(R)
if(speaker) if(speaker)
for(var/turf/T in hear(R.canhear_range,speaker)) for(var/turf/T in hear(R.canhear_range,speaker))
speaker_coverage[T] = T speaker_coverage[T] = T
// Try to find all the players who can hear the message // Try to find all the players who can hear the message
for(var/mob/M in player_list) for(var/i = 1; i <= player_list.len; i++)
var/mob/M = player_list[i]
if(M)
var/turf/ear = get_turf(M) var/turf/ear = get_turf(M)
if(ear) if(ear)
if(speaker_coverage[ear]) if(speaker_coverage[ear])
. |= M . |= M
return . return .
#define SIGN(X) ((X<0)?-1:1) #define SIGN(X) ((X<0)?-1:1)

View File

@@ -66,4 +66,14 @@ var/global/list/backbaglist = list("Nothing", "Backpack", "Satchel", "Satchel Al
for(var/T in paths) for(var/T in paths)
var/datum/surgery_step/S = new T var/datum/surgery_step/S = new T
surgery_steps += S surgery_steps += S
/* // Uncomment to debug chemical reaction list.
/client/verb/debug_chemical_list()
for (var/reaction in chemical_reactions_list)
. += "chemical_reactions_list\[\"[reaction]\"\] = \"[chemical_reactions_list[reaction]]\"\n"
if(islist(chemical_reactions_list[reaction]))
var/list/L = chemical_reactions_list[reaction]
for(var/t in L)
. += " has: [t]\n"
world << .
*/

View File

@@ -107,9 +107,14 @@
var/admin_legacy_system = 0 //Defines whether the server uses the legacy admin system with admins.txt or the SQL system. Config option in config.txt var/admin_legacy_system = 0 //Defines whether the server uses the legacy admin system with admins.txt or the SQL system. Config option in config.txt
var/ban_legacy_system = 0 //Defines whether the server uses the legacy banning system with the files in /data or the SQL system. Config option in config.txt var/ban_legacy_system = 0 //Defines whether the server uses the legacy banning system with the files in /data or the SQL system. Config option in config.txt
var/use_age_restriction_for_jobs = 0 //Do jobs use account age restrictions? --requires database
var/use_recursive_explosions //Defines whether the server uses recursive or circular explosions.
var/assistant_maint = 0 //Do assistants get maint access? var/assistant_maint = 0 //Do assistants get maint access?
var/gateway_delay = 18000 //How long the gateway takes before it activates. Default is half an hour. var/gateway_delay = 18000 //How long the gateway takes before it activates. Default is half an hour.
var/ghost_interaction = 0
/datum/configuration/New() /datum/configuration/New()
var/list/L = typesof(/datum/game_mode) - /datum/game_mode var/list/L = typesof(/datum/game_mode) - /datum/game_mode
@@ -162,9 +167,15 @@
if ("ban_legacy_system") if ("ban_legacy_system")
config.ban_legacy_system = 1 config.ban_legacy_system = 1
if ("use_age_restriction_for_jobs")
config.use_age_restriction_for_jobs = 1
if ("jobs_have_minimal_access") if ("jobs_have_minimal_access")
config.jobs_have_minimal_access = 1 config.jobs_have_minimal_access = 1
if ("use_recursive_explosions")
use_recursive_explosions = 1
if ("log_ooc") if ("log_ooc")
config.log_ooc = 1 config.log_ooc = 1
@@ -379,6 +390,9 @@
if("continuous_rounds") if("continuous_rounds")
config.continous_rounds = 1 config.continous_rounds = 1
if("ghost_interaction")
config.ghost_interaction = 1
else else
diary << "Unknown setting in configuration: '[name]'" diary << "Unknown setting in configuration: '[name]'"

View File

@@ -8,6 +8,9 @@ var/global/controller_iteration = 0
var/global/last_tick_timeofday = world.timeofday var/global/last_tick_timeofday = world.timeofday
var/global/last_tick_duration = 0 var/global/last_tick_duration = 0
var/global/air_processing_killed = 0
var/global/pipe_processing_killed = 0
datum/controller/game_controller datum/controller/game_controller
var/processing = 0 var/processing = 0
var/breather_ticks = 2 //a somewhat crude attempt to iron over the 'bumps' caused by high-cpu use by letting the MC have a breather for this many ticks after every loop var/breather_ticks = 2 //a somewhat crude attempt to iron over the 'bumps' caused by high-cpu use by letting the MC have a breather for this many ticks after every loop
@@ -113,14 +116,14 @@ datum/controller/game_controller/proc/process()
vote.process() vote.process()
//AIR //AIR
if(!air_processing_killed)
timer = world.timeofday timer = world.timeofday
last_thing_processed = air_master.type last_thing_processed = air_master.type
//air_master.process() air_master.tick()
air_cost = (world.timeofday - timer) / 10 // this might make atmos slower
// this might make atmos slower
// 1. atmos won't process if the game is generally lagged out(no deadlocks) // 1. atmos won't process if the game is generally lagged out(no deadlocks)
// 2. if the server frequently crashes during atmos processing we will know // 2. if the server frequently crashes during atmos processing we will knowif(!kill_air)
if(!kill_air)
//src.set_debug_state("Air Master") //src.set_debug_state("Air Master")
air_master.current_cycle++ air_master.current_cycle++
@@ -134,7 +137,6 @@ datum/controller/game_controller/proc/process()
air_master.failed_ticks = 0 air_master.failed_ticks = 0
air_cost = (world.timeofday - timer) / 10 air_cost = (world.timeofday - timer) / 10
sleep(breather_ticks) sleep(breather_ticks)
//SUN //SUN
@@ -147,109 +149,50 @@ datum/controller/game_controller/proc/process()
//MOBS //MOBS
timer = world.timeofday timer = world.timeofday
var/i = 1 process_mobs()
while(i<=mob_list.len)
var/mob/M = mob_list[i]
if(M)
last_thing_processed = M.type
M.Life()
i++
continue
mob_list.Cut(i,i+1)
mobs_cost = (world.timeofday - timer) / 10 mobs_cost = (world.timeofday - timer) / 10
sleep(breather_ticks) sleep(breather_ticks)
//DISEASES //DISEASES
timer = world.timeofday timer = world.timeofday
i = 1 process_diseases()
while(i<=active_diseases.len)
var/datum/disease/Disease = active_diseases[i]
if(Disease)
last_thing_processed = Disease.type
Disease.process()
i++
continue
active_diseases.Cut(i,i+1)
diseases_cost = (world.timeofday - timer) / 10 diseases_cost = (world.timeofday - timer) / 10
sleep(breather_ticks) sleep(breather_ticks)
//MACHINES //MACHINES
timer = world.timeofday timer = world.timeofday
i = 1 process_machines()
while(i<=machines.len)
var/obj/machinery/Machine = machines[i]
if(Machine)
last_thing_processed = Machine.type
if(Machine.process() != PROCESS_KILL)
if(Machine)
if(Machine.use_power)
Machine.auto_use_power()
i++
continue
machines.Cut(i,i+1)
machines_cost = (world.timeofday - timer) / 10 machines_cost = (world.timeofday - timer) / 10
sleep(breather_ticks) sleep(breather_ticks)
//OBJECTS //OBJECTS
timer = world.timeofday timer = world.timeofday
i = 1 process_objects()
while(i<=processing_objects.len)
var/obj/Object = processing_objects[i]
if(Object)
last_thing_processed = Object.type
Object.process()
i++
continue
processing_objects.Cut(i,i+1)
objects_cost = (world.timeofday - timer) / 10 objects_cost = (world.timeofday - timer) / 10
sleep(breather_ticks) sleep(breather_ticks)
//PIPENETS //PIPENETS
if(!pipe_processing_killed)
timer = world.timeofday timer = world.timeofday
last_thing_processed = /datum/pipe_network process_pipenets()
i = 1
while(i<=pipe_networks.len)
var/datum/pipe_network/Network = pipe_networks[i]
if(Network)
Network.process()
i++
continue
pipe_networks.Cut(i,i+1)
networks_cost = (world.timeofday - timer) / 10 networks_cost = (world.timeofday - timer) / 10
sleep(breather_ticks) sleep(breather_ticks)
//POWERNETS //POWERNETS
timer = world.timeofday timer = world.timeofday
last_thing_processed = /datum/powernet process_powernets()
i = 1
while(i<=powernets.len)
var/datum/powernet/Powernet = powernets[i]
if(Powernet)
Powernet.reset()
i++
continue
powernets.Cut(i,i+1)
powernets_cost = (world.timeofday - timer) / 10 powernets_cost = (world.timeofday - timer) / 10
sleep(breather_ticks) sleep(breather_ticks)
//EVENTS //EVENTS
timer = world.timeofday timer = world.timeofday
last_thing_processed = /datum/event process_events()
i = 1
while(i<=events.len)
var/datum/event/Event = events[i]
if(Event)
Event.process()
i++
continue
events.Cut(i,i+1)
checkEvent()
events_cost = (world.timeofday - timer) / 10 events_cost = (world.timeofday - timer) / 10
//TICKER //TICKER
@@ -268,6 +211,87 @@ datum/controller/game_controller/proc/process()
else else
sleep(10) sleep(10)
datum/controller/game_controller/proc/process_mobs()
var/i = 1
while(i<=mob_list.len)
var/mob/M = mob_list[i]
if(M)
last_thing_processed = M.type
M.Life()
i++
continue
mob_list.Cut(i,i+1)
datum/controller/game_controller/proc/process_diseases()
var/i = 1
while(i<=active_diseases.len)
var/datum/disease/Disease = active_diseases[i]
if(Disease)
last_thing_processed = Disease.type
Disease.process()
i++
continue
active_diseases.Cut(i,i+1)
datum/controller/game_controller/proc/process_machines()
var/i = 1
while(i<=machines.len)
var/obj/machinery/Machine = machines[i]
if(Machine)
last_thing_processed = Machine.type
if(Machine.process() != PROCESS_KILL)
if(Machine)
if(Machine.use_power)
Machine.auto_use_power()
i++
continue
machines.Cut(i,i+1)
datum/controller/game_controller/proc/process_objects()
var/i = 1
while(i<=processing_objects.len)
var/obj/Object = processing_objects[i]
if(Object)
last_thing_processed = Object.type
Object.process()
i++
continue
processing_objects.Cut(i,i+1)
datum/controller/game_controller/proc/process_pipenets()
last_thing_processed = /datum/pipe_network
var/i = 1
while(i<=pipe_networks.len)
var/datum/pipe_network/Network = pipe_networks[i]
if(Network)
Network.process()
i++
continue
pipe_networks.Cut(i,i+1)
datum/controller/game_controller/proc/process_powernets()
last_thing_processed = /datum/powernet
var/i = 1
while(i<=powernets.len)
var/datum/powernet/Powernet = powernets[i]
if(Powernet)
Powernet.reset()
i++
continue
powernets.Cut(i,i+1)
datum/controller/game_controller/proc/process_events()
last_thing_processed = /datum/event
var/i = 1
while(i<=events.len)
var/datum/event/Event = events[i]
if(Event)
Event.process()
i++
continue
events.Cut(i,i+1)
checkEvent()
datum/controller/game_controller/proc/Recover() //Mostly a placeholder for now. datum/controller/game_controller/proc/Recover() //Mostly a placeholder for now.
var/msg = "## DEBUG: [time2text(world.timeofday)] MC restarted. Reports:\n" var/msg = "## DEBUG: [time2text(world.timeofday)] MC restarted. Reports:\n"
for(var/varname in master_controller.vars) for(var/varname in master_controller.vars)

View File

@@ -62,12 +62,12 @@ var/list/diseases = typesof(/datum/disease) - /datum/disease
return return
spread = (cure_present?"Remissive":initial_spread) spread = (cure_present?"Remissive":initial_spread)
if(stage > max_stages) if(stage > max_stages)
stage = max_stages stage = max_stages
if(!cure_present && prob(stage_prob)) //now the disease shouldn't get back up to stage 4 in no time if(!cure_present && prob(stage_prob) && age > stage_minimum_age) //now the disease shouldn't get back up to stage 4 in no time
stage = min(stage + 1, max_stages) stage = min(stage + 1, max_stages)
age = 0
else if(cure_present && prob(cure_chance)) else if(cure_present && prob(cure_chance))
stage = max(stage - 1, 1) stage = max(stage - 1, 1)

View File

@@ -12,24 +12,23 @@
severity = "Medium" severity = "Medium"
longevity = 1000 longevity = 1000
hidden = list(0, 1) hidden = list(0, 1)
stage_minimum_age = 300 // at least 200 life ticks per stage stage_minimum_age = 160 // at least 200 life ticks per stage
/datum/disease/appendicitis/stage_act() /datum/disease/appendicitis/stage_act()
..() ..()
switch(stage) if(stage == 1)
if(1)
if(affected_mob.op_stage.appendix == 2.0) if(affected_mob.op_stage.appendix == 2.0)
// appendix is removed, can't get infected again // appendix is removed, can't get infected again
src.cure() src.cure()
if(prob(5)) if(prob(5))
affected_mob << "\red You feel a stinging pain in your abdomen!" affected_mob << "\red You feel a stinging pain in your abdomen!"
affected_mob.emote("me",1,"winces slightly.") affected_mob.emote("me",1,"winces slightly.")
if(2) if(stage > 1)
if(prob(3)) if(prob(3))
affected_mob << "\red You feel a stabbing pain in your abdomen!" affected_mob << "\red You feel a stabbing pain in your abdomen!"
affected_mob.emote("me",1,"winces painfully.") affected_mob.emote("me",1,"winces painfully.")
affected_mob.adjustToxLoss(1) affected_mob.adjustToxLoss(1)
if(3) if(stage > 2)
if(prob(1)) if(prob(1))
if (affected_mob.nutrition > 100) if (affected_mob.nutrition > 100)
var/mob/living/carbon/human/H = affected_mob var/mob/living/carbon/human/H = affected_mob
@@ -38,8 +37,7 @@
affected_mob << "\red You gag as you want to throw up, but there's nothing in your stomach!" affected_mob << "\red You gag as you want to throw up, but there's nothing in your stomach!"
affected_mob.Weaken(10) affected_mob.Weaken(10)
affected_mob.adjustToxLoss(3) affected_mob.adjustToxLoss(3)
if(stage > 3)
if(4)
if(prob(1) && ishuman(affected_mob)) if(prob(1) && ishuman(affected_mob))
var/mob/living/carbon/human/H = affected_mob var/mob/living/carbon/human/H = affected_mob
H << "\red Your abdomen is a world of pain!" H << "\red Your abdomen is a world of pain!"
@@ -50,5 +48,4 @@
var/datum/wound/W = new /datum/wound/internal_bleeding(25) var/datum/wound/W = new /datum/wound/internal_bleeding(25)
H.adjustToxLoss(25) H.adjustToxLoss(25)
groin.wounds += W groin.wounds += W
src.cure() src.cure()

View File

@@ -3,8 +3,8 @@
max_stages = 4 max_stages = 4
spread = "On contact" spread = "On contact"
spread_type = CONTACT_GENERAL spread_type = CONTACT_GENERAL
cure = "Spaceacillin & Alkysine" cure = "Alkysine"
cure_id = list("alkysine","spaceacillin") cure_id = list("alkysine")
agent = "Cryptococcus Cosmosis" agent = "Cryptococcus Cosmosis"
affected_species = list("Human") affected_species = list("Human")
curable = 0 curable = 0

View File

@@ -175,7 +175,7 @@
else if(W.damage_type == BURN) else if(W.damage_type == BURN)
burn_dam += W.damage burn_dam += W.damage
if(W.bleeding()) if(!(status & ORGAN_ROBOT) && W.bleeding())
status |= ORGAN_BLEEDING status |= ORGAN_BLEEDING
number_wounds += W.amount number_wounds += W.amount
@@ -273,6 +273,7 @@
if(germ_level > 0) if(germ_level > 0)
for(var/datum/wound/W in wounds) if(!W.bandaged && !W.salved) for(var/datum/wound/W in wounds) if(!W.bandaged && !W.salved)
W.germ_level = max(W.germ_level, germ_level) W.germ_level = max(W.germ_level, germ_level)
update_icon()
return return
proc/fracture() proc/fracture()
@@ -490,6 +491,7 @@
switch(type) switch(type)
if(CUT) if(CUT)
if(!(status & ORGAN_ROBOT))
src.status |= ORGAN_BLEEDING src.status |= ORGAN_BLEEDING
var/list/size_names = list(/datum/wound/cut, /datum/wound/deep_cut, /datum/wound/flesh_wound, /datum/wound/gaping_wound, /datum/wound/big_gaping_wound, /datum/wound/massive_wound) var/list/size_names = list(/datum/wound/cut, /datum/wound/deep_cut, /datum/wound/flesh_wound, /datum/wound/gaping_wound, /datum/wound/big_gaping_wound, /datum/wound/massive_wound)
wound_type = size_names[size] wound_type = size_names[size]
@@ -509,7 +511,7 @@
// Possibly trigger an internal wound, too. // Possibly trigger an internal wound, too.
var/local_damage = brute_dam + burn_dam + damage var/local_damage = brute_dam + burn_dam + damage
if(damage > 10 && type != BURN && local_damage > 20 && prob(damage)) if(damage > 10 && type != BURN && local_damage > 20 && prob(damage) && !(status & ORGAN_ROBOT))
var/datum/wound/internal_bleeding/I = new (15) var/datum/wound/internal_bleeding/I = new (15)
wounds += I wounds += I
owner.custom_pain("You feel something rip in your [display_name]!", 1) owner.custom_pain("You feel something rip in your [display_name]!", 1)

View File

@@ -46,11 +46,20 @@
usr <<"The spell matrix was unable to locate a suitable teleport destination for an unknown reason. Sorry." usr <<"The spell matrix was unable to locate a suitable teleport destination for an unknown reason. Sorry."
return return
var/attempt = 0 if(target && target.buckled)
target.buckled.unbuckle()
var/list/tempL = L
var/attempt = null
var/success = 0 var/success = 0
while(!success) while(tempL.len)
success = target.Move(pick(L)) attempt = pick(tempL)
if(attempt > 20) break //Failsafe success = target.Move(attempt)
if(!success)
tempL.Remove(attempt)
else
break
if(!success) if(!success)
target.loc = pick(L) target.loc = pick(L)

View File

@@ -0,0 +1,39 @@
/obj/effect/proc_holder/spell/targeted/horsemask
name = "Curse of the Horseman"
desc = "This spell triggers a curse on a target, causing them to wield an unremovable horse head mask. They will speak like a horse! Any masks they are wearing will be disintegrated. This spell does not require robes."
school = "transmutation"
charge_type = "recharge"
charge_max = 150
charge_counter = 0
clothes_req = 0
stat_allowed = 0
invocation = "KN'A FTAGHU, PUCK 'BTHNK!"
invocation_type = "shout"
range = 7
selection_type = "range"
var/list/compatible_mobs = list(/mob/living/carbon/human, /mob/living/carbon/monkey)
/obj/effect/proc_holder/spell/targeted/horsemask/cast(list/targets, mob/user = usr)
if(!targets.len)
user << "<span class='notice'>No target found in range.</span>"
return
var/mob/living/carbon/target = targets[1]
if(!(target.type in compatible_mobs))
user << "<span class='notice'>It'd be stupid to curse [target] with a horse's head!</span>"
return
if(!(target in oview(range)))//If they are not in overview after selection.
user << "<span class='notice'>They are too far away!</span>"
return
var/obj/item/clothing/mask/horsehead/magichead = new /obj/item/clothing/mask/horsehead
magichead.canremove = 0 //curses!
magichead.flags_inv = null //so you can still see their face
magichead.voicechange = 1 //NEEEEIIGHH
target.visible_message( "<span class='danger'>[target]'s face lights up in fire, and after the event a horse's head takes its place!</span>", \
"<span class='danger'>Your face burns up, and shortly after the fire you realise you have the face of a horse!</span>")
target.equip_to_slot(magichead, slot_wear_mask)
flick("e_flash", target.flash)

View File

@@ -25,8 +25,10 @@
target.gib() target.gib()
if("gib_brain") if("gib_brain")
if(ishuman(target) || ismonkey(target)) if(ishuman(target) || ismonkey(target))
var/obj/item/brain/B = new(target.loc) var/mob/living/carbon/C = target
B.transfer_identity(target) if(C.brain_op_stage != 4) // Their brain is already taken out
var/obj/item/brain/B = new(C.loc)
B.transfer_identity(C)
target.gib() target.gib()
if("disintegrate") if("disintegrate")
target.dust() target.dust()

View File

@@ -103,6 +103,8 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
/obj/item/weapon/reagent_containers/food/drinks/shaker, /obj/item/weapon/reagent_containers/food/drinks/shaker,
/obj/item/weapon/reagent_containers/food/drinks/bottle/patron, /obj/item/weapon/reagent_containers/food/drinks/bottle/patron,
/obj/item/weapon/reagent_containers/food/drinks/bottle/goldschlager, /obj/item/weapon/reagent_containers/food/drinks/bottle/goldschlager,
/obj/item/weapon/storage/fancy/cigarettes/dromedaryco,
/obj/item/weapon/lipstick/random,
/obj/item/weapon/reagent_containers/food/drinks/ale, /obj/item/weapon/reagent_containers/food/drinks/ale,
/obj/item/weapon/reagent_containers/food/drinks/ale, /obj/item/weapon/reagent_containers/food/drinks/ale,
/obj/item/weapon/reagent_containers/food/drinks/beer, /obj/item/weapon/reagent_containers/food/drinks/beer,
@@ -157,6 +159,7 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
/obj/item/weapon/caution, /obj/item/weapon/caution,
/obj/item/weapon/caution, /obj/item/weapon/caution,
/obj/item/weapon/caution, /obj/item/weapon/caution,
/obj/item/weapon/storage/bag/trash,
/obj/item/weapon/reagent_containers/spray/cleaner, /obj/item/weapon/reagent_containers/spray/cleaner,
/obj/item/weapon/reagent_containers/glass/rag, /obj/item/weapon/reagent_containers/glass/rag,
/obj/item/weapon/grenade/chem_grenade/cleaner, /obj/item/weapon/grenade/chem_grenade/cleaner,
@@ -224,7 +227,6 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
containertype = /obj/structure/largecrate/lisa containertype = /obj/structure/largecrate/lisa
containername = "Corgi Crate" containername = "Corgi Crate"
group = "Hydroponics" group = "Hydroponics"
/datum/supply_packs/hydroponics // -- Skie /datum/supply_packs/hydroponics // -- Skie
name = "Hydroponics Supply Crate" name = "Hydroponics Supply Crate"
contains = list(/obj/item/weapon/reagent_containers/spray/plantbgone, contains = list(/obj/item/weapon/reagent_containers/spray/plantbgone,
@@ -242,6 +244,35 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
access = access_hydroponics access = access_hydroponics
group = "Hydroponics" group = "Hydroponics"
//farm animals - useless and annoying, but potentially a good source of food
/datum/supply_packs/cow
name = "Cow Crate"
cost = 30
containertype = /obj/structure/largecrate/cow
containername = "Cow Crate"
access = access_hydroponics
/datum/supply_packs/goat
name = "Goat Crate"
cost = 25
containertype = /obj/structure/largecrate/goat
containername = "Goat Crate"
access = access_hydroponics
/datum/supply_packs/chicken
name = "Chicken Crate"
cost = 20
containertype = /obj/structure/largecrate/chick
containername = "Chicken Crate"
access = access_hydroponics
/datum/supply_packs/lisa
name = "Corgi Crate"
contains = list()
cost = 50
containertype = /obj/structure/largecrate/lisa
containername = "Corgi Crate"
/datum/supply_packs/seeds /datum/supply_packs/seeds
name = "Seeds Crate" name = "Seeds Crate"
contains = list(/obj/item/seeds/chiliseed, contains = list(/obj/item/seeds/chiliseed,
@@ -717,6 +748,7 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
/obj/item/weapon/reagent_containers/glass/paint/black, /obj/item/weapon/reagent_containers/glass/paint/black,
/obj/item/weapon/reagent_containers/glass/paint/white, /obj/item/weapon/reagent_containers/glass/paint/white,
/obj/item/weapon/reagent_containers/glass/paint/remover, /obj/item/weapon/reagent_containers/glass/paint/remover,
/obj/item/weapon/contraband/poster,
/obj/item/weapon/wrapping_paper, /obj/item/weapon/wrapping_paper,
/obj/item/weapon/wrapping_paper, /obj/item/weapon/wrapping_paper,
/obj/item/weapon/wrapping_paper) /obj/item/weapon/wrapping_paper)
@@ -727,10 +759,7 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
/datum/supply_packs/randomised/contraband /datum/supply_packs/randomised/contraband
num_contained = 5 num_contained = 5
contains = list(/obj/item/weapon/contraband/poster, contains = list(/obj/item/seeds/bloodtomatoseed,
/obj/item/weapon/storage/fancy/cigarettes/dromedaryco,
/obj/item/weapon/lipstick/random,
/obj/item/seeds/bloodtomatoseed,
/obj/item/weapon/storage/pill_bottle/zoom, /obj/item/weapon/storage/pill_bottle/zoom,
/obj/item/weapon/storage/pill_bottle/happy, /obj/item/weapon/storage/pill_bottle/happy,
/obj/item/weapon/reagent_containers/food/drinks/bottle/absinthe) /obj/item/weapon/reagent_containers/food/drinks/bottle/absinthe)

View File

@@ -249,23 +249,6 @@
/obj/item/mouse_drag_pointer = MOUSE_ACTIVE_POINTER /obj/item/mouse_drag_pointer = MOUSE_ACTIVE_POINTER
// TODO: robust mixology system! (and merge with beakers, maybe)
/obj/item/weapon/glass
name = "empty glass"
desc = "Emptysville."
icon = 'icons/obj/kitchen.dmi'
icon_state = "glass_empty"
item_state = "beaker"
flags = FPRINT | TABLEPASS | OPENCONTAINER
var/datum/substance/inside = null
throwforce = 5
g_amt = 100
New()
..()
src.pixel_x = rand(-5, 5)
src.pixel_y = rand(-5, 5)
/obj/item/weapon/beach_ball /obj/item/weapon/beach_ball
icon = 'icons/misc/beach.dmi' icon = 'icons/misc/beach.dmi'
icon_state = "ball" icon_state = "ball"

View File

@@ -1220,7 +1220,7 @@
force = round((5+potency/2.5), 1) force = round((5+potency/2.5), 1)
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is eating some of the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is eating some of the [src.name]! It looks like \he's trying to commit suicide.</b>"
return (BRUTELOSS|TOXLOSS) return (BRUTELOSS|TOXLOSS)
// ************************************* // *************************************
@@ -1291,7 +1291,7 @@
var/WeedKillStr = 2 var/WeedKillStr = 2
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is huffing the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is huffing the [src.name]! It looks like \he's trying to commit suicide.</b>"
return (TOXLOSS) return (TOXLOSS)
/obj/item/weapon/pestspray // -- Skie /obj/item/weapon/pestspray // -- Skie
@@ -1310,7 +1310,7 @@
var/PestKillStr = 2 var/PestKillStr = 2
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is huffing the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is huffing the [src.name]! It looks like \he's trying to commit suicide.</b>"
return (TOXLOSS) return (TOXLOSS)
/obj/item/weapon/minihoe // -- Numbers /obj/item/weapon/minihoe // -- Numbers

View File

@@ -169,7 +169,7 @@
desc = "A cane used by a true gentlemen. Or a clown." desc = "A cane used by a true gentlemen. Or a clown."
icon = 'icons/obj/weapons.dmi' icon = 'icons/obj/weapons.dmi'
icon_state = "cane" icon_state = "cane"
item_state = "cane" item_state = "stick"
flags = FPRINT | TABLEPASS| CONDUCT flags = FPRINT | TABLEPASS| CONDUCT
force = 5.0 force = 5.0
throwforce = 7.0 throwforce = 7.0
@@ -246,7 +246,7 @@
var/armed = 0 var/armed = 0
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is putting the [src] on \his head! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is putting the [src.name] on \his head! It looks like \he's trying to commit suicide.</b>"
return (BRUTELOSS) return (BRUTELOSS)
/obj/item/weapon/legcuffs/beartrap/attack_self(mob/user as mob) /obj/item/weapon/legcuffs/beartrap/attack_self(mob/user as mob)
@@ -366,20 +366,6 @@
m_amt = 100 m_amt = 100
origin_tech = "magnets=1" origin_tech = "magnets=1"
/obj/item/weapon/spellbook
name = "spell book"
desc = "The legendary book of spells of the wizard."
icon = 'icons/obj/library.dmi'
icon_state ="book"
throw_speed = 1
throw_range = 5
w_class = 1.0
flags = FPRINT | TABLEPASS
var/uses = 5.0
var/temp = null
var/max_uses = 5
var/op = 1
/obj/item/weapon/staff /obj/item/weapon/staff
name = "wizards staff" name = "wizards staff"
desc = "Apparently a staff used by the wizard." desc = "Apparently a staff used by the wizard."
@@ -448,7 +434,7 @@
attack_verb = list("whipped", "lashed", "disciplined", "tickled") attack_verb = list("whipped", "lashed", "disciplined", "tickled")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is strangling \himself with the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is strangling \himself with the [src.name]! It looks like \he's trying to commit suicide.</b>"
return (OXYLOSS) return (OXYLOSS)
/obj/item/weapon/module /obj/item/weapon/module

View File

@@ -598,7 +598,7 @@ proc/process_ghost_teleport_locs()
icon_state = "fpmaint" icon_state = "fpmaint"
/area/maintenance/fsmaint /area/maintenance/fsmaint
name = "Security Maintenance" name = "Dormitory Maintenance"
icon_state = "fsmaint" icon_state = "fsmaint"
/area/maintenance/fsmaint2 /area/maintenance/fsmaint2

View File

@@ -465,19 +465,19 @@ its easier to just keep the beam vertical.
for(var/obj/effect/decal/cleanable/blood/B in T.contents) for(var/obj/effect/decal/cleanable/blood/B in T.contents)
if(!B.blood_DNA[M.dna.unique_enzymes]) if(!B.blood_DNA[M.dna.unique_enzymes])
B.blood_DNA[M.dna.unique_enzymes] = M.dna.b_type B.blood_DNA[M.dna.unique_enzymes] = M.dna.b_type
for(var/datum/disease/D in M.viruses) /*for(var/datum/disease/D in M.viruses)
var/datum/disease/newDisease = D.Copy(1) var/datum/disease/newDisease = D.Copy(1)
B.viruses += newDisease B.viruses += newDisease
newDisease.holder = B newDisease.holder = B*/
return 1 //we bloodied the floor return 1 //we bloodied the floor
//if there isn't a blood decal already, make one. //if there isn't a blood decal already, make one.
var/obj/effect/decal/cleanable/blood/newblood = new /obj/effect/decal/cleanable/blood(T) var/obj/effect/decal/cleanable/blood/newblood = new /obj/effect/decal/cleanable/blood(T)
newblood.blood_DNA[M.dna.unique_enzymes] = M.dna.b_type newblood.blood_DNA[M.dna.unique_enzymes] = M.dna.b_type
for(var/datum/disease/D in M.viruses) /*for(var/datum/disease/D in M.viruses)
var/datum/disease/newDisease = D.Copy(1) var/datum/disease/newDisease = D.Copy(1)
newblood.viruses += newDisease newblood.viruses += newDisease
newDisease.holder = newblood newDisease.holder = newblood*/
return 1 //we bloodied the floor return 1 //we bloodied the floor
//adding blood to humans //adding blood to humans
@@ -499,10 +499,10 @@ its easier to just keep the beam vertical.
if(toxvomit) if(toxvomit)
this.icon_state = "vomittox_[pick(1,4)]" this.icon_state = "vomittox_[pick(1,4)]"
for(var/datum/disease/D in M.viruses) /*for(var/datum/disease/D in M.viruses)
var/datum/disease/newDisease = D.Copy(1) var/datum/disease/newDisease = D.Copy(1)
this.viruses += newDisease this.viruses += newDisease
newDisease.holder = this newDisease.holder = this*/
// Only adds blood on the floor -- Skie // Only adds blood on the floor -- Skie
/atom/proc/add_blood_floor(mob/living/carbon/M as mob) /atom/proc/add_blood_floor(mob/living/carbon/M as mob)
@@ -511,20 +511,20 @@ its easier to just keep the beam vertical.
var/turf/simulated/source1 = src var/turf/simulated/source1 = src
var/obj/effect/decal/cleanable/blood/this = new /obj/effect/decal/cleanable/blood(source1) var/obj/effect/decal/cleanable/blood/this = new /obj/effect/decal/cleanable/blood(source1)
this.blood_DNA[M.dna.unique_enzymes] = M.dna.b_type this.blood_DNA[M.dna.unique_enzymes] = M.dna.b_type
for(var/datum/disease/D in M.viruses) /*for(var/datum/disease/D in M.viruses)
var/datum/disease/newDisease = D.Copy(1) var/datum/disease/newDisease = D.Copy(1)
this.viruses += newDisease this.viruses += newDisease
newDisease.holder = this newDisease.holder = this*/
else if( istype(M, /mob/living/carbon/alien )) else if( istype(M, /mob/living/carbon/alien ))
if( istype(src, /turf/simulated) ) if( istype(src, /turf/simulated) )
var/turf/simulated/source2 = src var/turf/simulated/source2 = src
var/obj/effect/decal/cleanable/xenoblood/this = new /obj/effect/decal/cleanable/xenoblood(source2) var/obj/effect/decal/cleanable/xenoblood/this = new /obj/effect/decal/cleanable/xenoblood(source2)
this.blood_DNA["UNKNOWN BLOOD"] = "X*" this.blood_DNA["UNKNOWN BLOOD"] = "X*"
for(var/datum/disease/D in M.viruses) /*for(var/datum/disease/D in M.viruses)
var/datum/disease/newDisease = D.Copy(1) var/datum/disease/newDisease = D.Copy(1)
this.viruses += newDisease this.viruses += newDisease
newDisease.holder = this newDisease.holder = this*/
else if( istype(M, /mob/living/silicon/robot )) else if( istype(M, /mob/living/silicon/robot ))
if( istype(src, /turf/simulated) ) if( istype(src, /turf/simulated) )
@@ -1004,7 +1004,7 @@ var/using_new_click_proc = 0 //TODO ERRORAGE (This is temporary, while the DblCl
// world << "according to dblclick(), t5 is [t5]" // world << "according to dblclick(), t5 is [t5]"
// ------- ACTUALLY DETERMINING STUFF ------- // ------- ACTUALLY DETERMINING STUFF -------
if (((t5 || (W && (W.flags & 16))) && !( istype(src, /obj/screen) ))) if (((t5 || (W && (W.flags & USEDELAY))) && !( istype(src, /obj/screen) )))
// ------- ( CAN USE ITEM OR HAS 1 SECOND USE DELAY ) AND NOT CLICKING ON SCREEN ------- // ------- ( CAN USE ITEM OR HAS 1 SECOND USE DELAY ) AND NOT CLICKING ON SCREEN -------

View File

@@ -65,7 +65,7 @@
src.throwing = 1 src.throwing = 1
if(usr) if(usr)
if((HULK in usr.mutations) || (SUPRSTR in usr.augmentations)) if(HULK in usr.mutations)
src.throwing = 2 // really strong throw! src.throwing = 2 // really strong throw!
var/dist_x = abs(target.x - src.x) var/dist_x = abs(target.x - src.x)

View File

@@ -228,7 +228,7 @@ datum/radio_frequency
// log_admin("DEBUG: post_signal(source=[source] ([source.x], [source.y], [source.z]),filter=[filter]) frequency=[frequency], N_f=[N_f], N_nf=[N_nf]") // log_admin("DEBUG: post_signal(source=[source] ([source.x], [source.y], [source.z]),filter=[filter]) frequency=[frequency], N_f=[N_f], N_nf=[N_nf]")
del(signal) // del(signal)
add_listener(obj/device as obj, var/filter as text|null) add_listener(obj/device as obj, var/filter as text|null)
if (!filter) if (!filter)

View File

@@ -256,7 +256,7 @@
if(objectives.Find("eldergod")) if(objectives.Find("eldergod"))
cult_fail += eldergod //1 by default, 0 if the elder god has been summoned at least once cult_fail += eldergod //1 by default, 0 if the elder god has been summoned at least once
if(objectives.Find("sacrifice")) if(objectives.Find("sacrifice"))
if(!sacrificed.Find(sacrifice_target)) //if the target has been sacrificed, ignore this step. otherwise, add 1 to cult_fail if(sacrifice_target && !sacrificed.Find(sacrifice_target)) //if the target has been sacrificed, ignore this step. otherwise, add 1 to cult_fail
cult_fail++ cult_fail++
return cult_fail //if any objectives aren't met, failure return cult_fail //if any objectives aren't met, failure

View File

@@ -11,9 +11,7 @@
if(!event) if(!event)
//CARN: checks to see if random events are enabled. //CARN: checks to see if random events are enabled.
if(config.allow_random_events) if(config.allow_random_events)
if(prob(eventchance)) hadevent = event()
event()
hadevent = 1
else else
Holiday_Random_Event() Holiday_Random_Event()
else else
@@ -75,10 +73,21 @@
base_chance = 1.1 base_chance = 1.1
// Trigger the event based on how likely it currently is. // Trigger the event based on how likely it currently is.
if(!prob(chance * eventchance * base_chance / 100)) // "normal" event chance at 20 players if(!prob(chance * eventchance * base_chance / 100))
return 0 return 0
switch(picked_event) switch(picked_event)
if("Meteor")
command_alert("Meteors have been detected on collision course with the station.", "Meteor Alert")
for(var/mob/M in player_list)
if(!istype(M,/mob/new_player))
M << sound('sound/AI/meteors.ogg')
spawn(100)
meteor_wave()
spawn_meteors()
spawn(700)
meteor_wave()
spawn_meteors()
if("Space Ninja") if("Space Ninja")
//Handled in space_ninja.dm. Doesn't announce arrival, all sneaky-like. //Handled in space_ninja.dm. Doesn't announce arrival, all sneaky-like.
space_ninja_arrival() space_ninja_arrival()

View File

@@ -0,0 +1,174 @@
// BIOMASS (Note that this code is very similar to Space Vine code)
/obj/effect/biomass
name = "biomass"
desc = "Space barf from another dimension. It just keeps spreading!"
icon = 'icons/obj/biomass.dmi'
icon_state = "stage1"
anchored = 1
density = 0
layer = 5
pass_flags = PASSTABLE | PASSGRILLE
var/energy = 0
var/obj/effect/biomass_controller/master = null
New()
return
Del()
if(master)
master.vines -= src
master.growth_queue -= src
..()
/obj/effect/biomass/attackby(obj/item/weapon/W as obj, mob/user as mob)
if (!W || !user || !W.type) return
switch(W.type)
if(/obj/item/weapon/circular_saw) del src
if(/obj/item/weapon/kitchen/utensil/knife) del src
if(/obj/item/weapon/scalpel) del src
if(/obj/item/weapon/twohanded/fireaxe) del src
if(/obj/item/weapon/hatchet) del src
if(/obj/item/weapon/melee/energy) del src
//less effective weapons
if(/obj/item/weapon/wirecutters)
if(prob(25)) del src
if(/obj/item/weapon/shard)
if(prob(25)) del src
else //weapons with subtypes
if(istype(W, /obj/item/weapon/melee/energy/sword)) del src
else if(istype(W, /obj/item/weapon/weldingtool))
var/obj/item/weapon/weldingtool/WT = W
if(WT.remove_fuel(0, user)) del src
else
return
..()
/obj/effect/biomass_controller
var/list/obj/effect/biomass/vines = list()
var/list/growth_queue = list()
var/reached_collapse_size
var/reached_slowdown_size
//What this does is that instead of having the grow minimum of 1, required to start growing, the minimum will be 0,
//meaning if you get the biomasssss..s' size to something less than 20 plots, it won't grow anymore.
New()
if(!istype(src.loc,/turf/simulated/floor))
del(src)
spawn_biomass_piece(src.loc)
processing_objects.Add(src)
Del()
processing_objects.Remove(src)
..()
proc/spawn_biomass_piece(var/turf/location)
var/obj/effect/biomass/BM = new(location)
growth_queue += BM
vines += BM
BM.master = src
process()
if(!vines)
del(src) //space vines exterminated. Remove the controller
return
if(!growth_queue)
del(src) //Sanity check
return
if(vines.len >= 250 && !reached_collapse_size)
reached_collapse_size = 1
if(vines.len >= 30 && !reached_slowdown_size )
reached_slowdown_size = 1
var/maxgrowth = 0
if(reached_collapse_size)
maxgrowth = 0
else if(reached_slowdown_size)
if(prob(25))
maxgrowth = 1
else
maxgrowth = 0
else
maxgrowth = 4
var/length = min( 30 , vines.len / 5 )
var/i = 0
var/growth = 0
var/list/obj/effect/biomass/queue_end = list()
for( var/obj/effect/biomass/BM in growth_queue )
i++
queue_end += BM
growth_queue -= BM
if(BM.energy < 2) //If tile isn't fully grown
if(prob(20))
BM.grow()
if(BM.spread())
growth++
if(growth >= maxgrowth)
break
if(i >= length)
break
growth_queue = growth_queue + queue_end
/obj/effect/biomass/proc/grow()
if(!energy)
src.icon_state = "stage2"
energy = 1
src.opacity = 0
src.density = 0
layer = 5
else
src.icon_state = "stage3"
src.opacity = 0
src.density = 1
energy = 2
/obj/effect/biomass/proc/spread()
var/direction = pick(cardinal)
var/step = get_step(src,direction)
if(istype(step,/turf/simulated/floor))
var/turf/simulated/floor/F = step
if(!locate(/obj/effect/biomass,F))
if(F.Enter(src))
if(master)
master.spawn_biomass_piece( F )
return 1
return 0
/obj/effect/biomass/ex_act(severity)
switch(severity)
if(1.0)
del(src)
return
if(2.0)
if (prob(90))
del(src)
return
if(3.0)
if (prob(50))
del(src)
return
return
/obj/effect/biomass/temperature_expose(null, temp, volume) //hotspots kill biomass
del src
/proc/biomass_infestation()
spawn() //to stop the secrets panel hanging
var/list/turf/simulated/floor/turfs = list() //list of all the empty floor turfs in the hallway areas
for(var/areapath in typesof(/area/hallway))
var/area/hallway/A = locate(areapath)
for(var/turf/simulated/floor/F in A)
if(!F.contents.len)
turfs += F
if(turfs.len) //Pick a turf to spawn at if we can
var/turf/simulated/floor/T = pick(turfs)
new/obj/effect/biomass_controller(T) //spawn a controller at turf
message_admins("\blue Event: Biomass spawned at [T.loc.loc] ([T.x],[T.y],[T.z])")

View File

@@ -1428,7 +1428,7 @@ It is possible to destroy the net by the occupant or someone else.
return return
attack_hand() attack_hand()
if ((HULK in usr.mutations) || (SUPRSTR in usr.augmentations)) if (HULK in usr.mutations)
usr << text("\blue You easily destroy the energy net.") usr << text("\blue You easily destroy the energy net.")
for(var/mob/O in oviewers(src)) for(var/mob/O in oviewers(src))
O.show_message(text("\red [] rips the energy net apart!", usr), 1) O.show_message(text("\red [] rips the energy net apart!", usr), 1)

View File

@@ -1025,3 +1025,32 @@ That is why you attached them to objects.
sleep(5) sleep(5)
if(safety<=0) break if(safety<=0) break
return */ return */
//Alternate ninja speech replacement.
/*This text is hilarious but also absolutely retarded.
message = replacetext(message, "l", "r")
message = replacetext(message, "rr", "ru")
message = replacetext(message, "v", "b")
message = replacetext(message, "f", "hu")
message = replacetext(message, "'t", "")
message = replacetext(message, "t ", "to ")
message = replacetext(message, " I ", " ai ")
message = replacetext(message, "th", "z")
message = replacetext(message, "ish", "isu")
message = replacetext(message, "is", "izu")
message = replacetext(message, "ziz", "zis")
message = replacetext(message, "se", "su")
message = replacetext(message, "br", "bur")
message = replacetext(message, "ry", "ri")
message = replacetext(message, "you", "yuu")
message = replacetext(message, "ck", "cku")
message = replacetext(message, "eu", "uu")
message = replacetext(message, "ow", "au")
message = replacetext(message, "are", "aa")
message = replacetext(message, "ay", "ayu")
message = replacetext(message, "ea", "ii")
message = replacetext(message, "ch", "chi")
message = replacetext(message, "than", "sen")
message = replacetext(message, ".", "")
message = lowertext(message)
*/

View File

@@ -1,4 +1,4 @@
// SPACE VINES // SPACE VINES (Note that this code is very similar to Biomass code)
/obj/effect/spacevine /obj/effect/spacevine
name = "space vines" name = "space vines"
desc = "An extremely expansionistic species of vine." desc = "An extremely expansionistic species of vine."
@@ -6,6 +6,7 @@
icon_state = "Light1" icon_state = "Light1"
anchored = 1 anchored = 1
density = 0 density = 0
layer = 5
pass_flags = PASSTABLE | PASSGRILLE pass_flags = PASSTABLE | PASSGRILLE
var/energy = 0 var/energy = 0
var/obj/effect/spacevine_controller/master = null var/obj/effect/spacevine_controller/master = null

View File

@@ -137,6 +137,7 @@
if(config.continous_rounds) if(config.continous_rounds)
if(emergency_shuttle) if(emergency_shuttle)
emergency_shuttle.always_fake_recall = 0 emergency_shuttle.always_fake_recall = 0
malf_mode_declared = 0
else else
return 1 return 1
return ..() //check for shuttle and nuke return ..() //check for shuttle and nuke

View File

@@ -17,7 +17,7 @@
for(var/datum/objective/OBJ in H.mind.objectives) for(var/datum/objective/OBJ in H.mind.objectives)
H << "<B>Objective #[obj_count]</B>: [OBJ.explanation_text]" H << "<B>Objective #[obj_count]</B>: [OBJ.explanation_text]"
obj_count++ obj_count++
var/randomize = pick("taser","egun","laser","revolver","smg","nuclear","deagle","gyrojet","pulse","silenced","cannon","shotgun","mateba","uzi","crossbow","saw") var/randomize = pick("taser","egun","laser","revolver","detective","smg","nuclear","deagle","gyrojet","pulse","silenced","cannon","doublebarrel","shotgun","combatshotgun","mateba","smg","uzi","crossbow","saw")
switch (randomize) switch (randomize)
if("taser") if("taser")
new /obj/item/weapon/gun/energy/taser(get_turf(H)) new /obj/item/weapon/gun/energy/taser(get_turf(H))
@@ -27,6 +27,8 @@
new /obj/item/weapon/gun/energy/laser(get_turf(H)) new /obj/item/weapon/gun/energy/laser(get_turf(H))
if("revolver") if("revolver")
new /obj/item/weapon/gun/projectile(get_turf(H)) new /obj/item/weapon/gun/projectile(get_turf(H))
if("detective")
new /obj/item/weapon/gun/projectile/detective(get_turf(H))
if("smg") if("smg")
new /obj/item/weapon/gun/projectile/automatic/c20r(get_turf(H)) new /obj/item/weapon/gun/projectile/automatic/c20r(get_turf(H))
if("nuclear") if("nuclear")
@@ -38,13 +40,20 @@
if("pulse") if("pulse")
new /obj/item/weapon/gun/energy/pulse_rifle(get_turf(H)) new /obj/item/weapon/gun/energy/pulse_rifle(get_turf(H))
if("silenced") if("silenced")
new /obj/item/weapon/gun/projectile/silenced(get_turf(H)) new /obj/item/weapon/gun/projectile/pistol(get_turf(H))
new /obj/item/weapon/silencer(get_turf(H))
if("cannon") if("cannon")
new /obj/item/weapon/gun/energy/lasercannon(get_turf(H)) new /obj/item/weapon/gun/energy/lasercannon(get_turf(H))
if("doublebarrel")
new /obj/item/weapon/gun/projectile/shotgun/pump/(get_turf(H))
if("shotgun") if("shotgun")
new /obj/item/weapon/gun/projectile/shotgun/pump/(get_turf(H))
if("combatshotgun")
new /obj/item/weapon/gun/projectile/shotgun/pump/combat(get_turf(H)) new /obj/item/weapon/gun/projectile/shotgun/pump/combat(get_turf(H))
if("mateba") if("mateba")
new /obj/item/weapon/gun/projectile/mateba(get_turf(H)) new /obj/item/weapon/gun/projectile/mateba(get_turf(H))
if("smg")
new /obj/item/weapon/gun/projectile/automatic(get_turf(H))
if("uzi") if("uzi")
new /obj/item/weapon/gun/projectile/automatic/mini_uzi(get_turf(H)) new /obj/item/weapon/gun/projectile/automatic/mini_uzi(get_turf(H))
if("crossbow") if("crossbow")

View File

@@ -1,167 +1,189 @@
/obj/item/weapon/spellbook
name = "spell book"
desc = "The legendary book of spells of the wizard."
icon = 'icons/obj/library.dmi'
icon_state ="book"
throw_speed = 1
throw_range = 5
w_class = 1.0
flags = FPRINT | TABLEPASS
var/uses = 5
var/temp = null
var/max_uses = 5
var/op = 1
//SPELL BOOK PROCS
/obj/item/weapon/spellbook/attack_self(mob/user as mob) /obj/item/weapon/spellbook/attack_self(mob/user as mob)
user.set_machine(src) user.set_machine(src)
var/dat var/dat
if (src.temp) if(temp)
dat = "[src.temp]<BR><BR><A href='byond://?src=\ref[src];temp=1'>Clear</A>" dat = "[temp]<BR><BR><A href='byond://?src=\ref[src];temp=1'>Clear</A>"
else else
dat = "<B>The Book of Spells:</B><BR>" dat = "<B>The Book of Spells:</B><BR>"
dat += "Spells left to memorize: [src.uses]<BR>" dat += "Spells left to memorize: [uses]<BR>"
dat += "<HR>" dat += "<HR>"
dat += "<B>Memorize which spell:</B><BR>" dat += "<B>Memorize which spell:</B><BR>"
dat += "<I>The number after the spell name is the cooldown time.</I><BR>" dat += "<I>The number after the spell name is the cooldown time.</I><BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=1'>Magic Missile</A> (10)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=magicmissile'>Magic Missile</A> (10)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=2'>Fireball</A> (10)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=fireball'>Fireball</A> (10)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=3'>Disintegrate</A> (60)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=disintegrate'>Disintegrate</A> (60)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=4'>Disable Technology</A> (60)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=disabletech'>Disable Technology</A> (60)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=5'>Smoke</A> (10)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=smoke'>Smoke</A> (10)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=6'>Blind</A> (30)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=blind'>Blind</A> (30)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=7'>Mind Transfer</A> (60)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=mindswap'>Mind Transfer</A> (60)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=8'>Forcewall</A> (10)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=forcewall'>Forcewall</A> (10)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=9'>Blink</A> (2)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=blink'>Blink</A> (2)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=10'>Teleport</A> (60)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=teleport'>Teleport</A> (60)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=11'>Mutate</A> (60)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=mutate'>Mutate</A> (60)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=12'>Ethereal Jaunt</A> (60)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=etherealjaunt'>Ethereal Jaunt</A> (60)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=13'>Knock</A> (10)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=knock'>Knock</A> (10)<BR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=horseman'>Curse of the Horseman</A> (15)<BR>"
if(op) if(op)
dat += "<A href='byond://?src=\ref[src];spell_choice=14'>Summon Guns</A> (One time use, global spell)<BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=summonguns'>Summon Guns</A> (One time use, global spell)<BR>"
dat += "<HR>" dat += "<HR>"
dat += "<B>Artefacts:</B><BR>" dat += "<B>Artefacts:</B><BR>"
dat += "Powerful items imbued with eldritch magics. Summoning one will count towards your maximum number of spells.<BR>" dat += "Powerful items imbued with eldritch magics. Summoning one will count towards your maximum number of spells.<BR>"
dat += "It is recommended that only experienced wizards attempt to wield such artefacts.<BR>" dat += "It is recommended that only experienced wizards attempt to wield such artefacts.<BR>"
dat += "<HR>" dat += "<HR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=15'>Staff of Change</A><BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=staffchange'>Staff of Change</A><BR>"
dat += "<HR>" dat += "<HR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=16'>Six Soul Stone Shards and the spell Artificer</A><BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=soulstone'>Six Soul Stone Shards and the spell Artificer</A><BR>"
dat += "<HR>" dat += "<HR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=17'>Mastercrafted Armor Set</A><BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=armor'>Mastercrafted Armor Set</A><BR>"
dat += "<HR>" dat += "<HR>"
dat += "<A href='byond://?src=\ref[src];spell_choice=18'>Staff of Animation</A><BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=staffanimation'>Staff of Animation</A><BR>"
dat += "<HR>" dat += "<HR>"
if(op) if(op)
dat += "<A href='byond://?src=\ref[src];spell_choice=19'>Re-memorize Spells</A><BR>" dat += "<A href='byond://?src=\ref[src];spell_choice=rememorize'>Re-memorize Spells</A><BR>"
user << browse(dat, "window=radio") user << browse(dat, "window=radio")
onclose(user, "radio") onclose(user, "radio")
return return
/obj/item/weapon/spellbook/Topic(href, href_list) /obj/item/weapon/spellbook/Topic(href, href_list)
..() ..()
if (usr.stat || usr.restrained())
return
var/mob/living/carbon/human/H = usr var/mob/living/carbon/human/H = usr
if (!( istype(H, /mob/living/carbon/human)))
return 1
if ( src.loc == usr || (in_range(src,usr) && istype(src.loc, /turf)))
usr.set_machine(src)
if(href_list["spell_choice"])
if(src.uses >= 1 && src.max_uses >=1 && text2num(href_list["spell_choice"]) < 19)
src.uses--
var/list/available_spells = list("Magic Missile","Fireball","Disintegrate","Disable Tech","Smoke","Blind","Mind Transfer","Forcewall","Blink","Teleport","Mutate","Ethereal Jaunt","Knock","Summon Guns","Staff of Change","Six Soul Stone Shards and the spell Artificer","Mastercrafted Armor Set", "Staff of Animation")
var/already_knows = 0
for(var/obj/effect/proc_holder/spell/aspell in usr.spell_list)
if(available_spells[text2num(href_list["spell_choice"])] == aspell.name)
already_knows = 1
src.temp = "You already know that spell."
src.uses++
break
if(!already_knows)
switch(href_list["spell_choice"])
if ("1")
feedback_add_details("wizard_spell_learned","MM") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/projectile/magic_missile(usr)
src.temp = "This spell fires several, slow moving, magic projectiles at nearby targets. If they hit a target, it is paralyzed and takes minor damage."
if ("2")
feedback_add_details("wizard_spell_learned","FB") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/dumbfire/fireball(usr)
src.temp = "This spell fires a fireball in the direction you're facing and does not require wizard garb. Be careful not to fire it at people that are standing next to you."
if ("3")
feedback_add_details("wizard_spell_learned","DG") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/inflict_handler/disintegrate(usr)
src.temp = "This spell instantly kills somebody adjacent to you with the vilest of magick. It has a long cooldown."
if ("4")
feedback_add_details("wizard_spell_learned","DT") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/emplosion/disable_tech(usr)
src.temp = "This spell disables all weapons, cameras and most other technology in range."
if ("5")
feedback_add_details("wizard_spell_learned","SM") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/smoke(usr)
src.temp = "This spell spawns a cloud of choking smoke at your location and does not require wizard garb."
if ("6")
feedback_add_details("wizard_spell_learned","BD") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/trigger/blind(usr)
src.temp = "This spell temporarly blinds a single person and does not require wizard garb."
if ("7")
feedback_add_details("wizard_spell_learned","MT") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/mind_transfer(usr)
src.temp = "This spell allows the user to switch bodies with a target. Careful to not lose your memory in the process."
if ("8")
feedback_add_details("wizard_spell_learned","FW") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/aoe_turf/conjure/forcewall(usr)
src.temp = "This spell creates an unbreakable wall that lasts for 30 seconds and does not need wizard garb."
if ("9")
feedback_add_details("wizard_spell_learned","BL") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/turf_teleport/blink(usr)
src.temp = "This spell randomly teleports you a short distance. Useful for evasion or getting into areas if you have patience."
if ("10")
feedback_add_details("wizard_spell_learned","TP") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/area_teleport/teleport(usr)
src.temp = "This spell teleports you to a type of area of your selection. Very useful if you are in danger, but has a decent cooldown, and is unpredictable."
if ("11")
feedback_add_details("wizard_spell_learned","MU") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/genetic/mutate(usr)
src.temp = "This spell causes you to turn into a hulk and gain telekinesis for a short while."
if ("12")
feedback_add_details("wizard_spell_learned","EJ") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/targeted/ethereal_jaunt(usr)
src.temp = "This spell creates your ethereal form, temporarily making you invisible and able to pass through walls."
if ("13")
feedback_add_details("wizard_spell_learned","KN") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.spell_list += new /obj/effect/proc_holder/spell/aoe_turf/knock(usr)
src.temp = "This spell opens nearby doors and does not require wizard garb."
if ("14")
feedback_add_details("wizard_spell_learned","SG") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
usr.rightandwrong()
src.max_uses--
src.temp = "Nothing could possibly go wrong with arming a crew of lunatics just itching for an excuse to kill eachother. Just be careful not to get hit in the crossfire!"
if ("15")
feedback_add_details("wizard_spell_learned","ST") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/weapon/gun/energy/staff(get_turf(usr))
src.temp = "An artefact that spits bolts of coruscating energy which cause the target's very form to reshape itself"
src.max_uses--
if ("16")
feedback_add_details("wizard_spell_learned","SS") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/weapon/storage/belt/soulstone/full(get_turf(usr))
usr.spell_list += new /obj/effect/proc_holder/spell/aoe_turf/conjure/construct(usr)
src.temp = "Soul Stone Shards are ancient tools capable of capturing and harnessing the spirits of the dead and dying. The spell Artificer allows you to create arcane machines for the captured souls to pilot."
src.max_uses--
if ("17")
feedback_add_details("wizard_spell_learned","HS") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/clothing/shoes/sandal(get_turf(usr)) //In case they've lost them.
new /obj/item/clothing/gloves/purple(get_turf(usr))//To complete the outfit
new /obj/item/clothing/suit/space/rig/wizard(get_turf(usr))
new /obj/item/clothing/head/helmet/space/rig/wizard(get_turf(usr))
src.temp = "An artefact suit of armor that allows you to cast spells while providing more protection against attacks and the void of space."
src.max_uses--
if("18")
feedback_add_details("wizard_spell_learned","SA") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/weapon/gun/energy/staff/animate(get_turf(usr))
src.temp = "An artefact that spits bolts of life-force which causes objects which are hit by it to animate and come to life! This magic doesn't affect machines."
src.max_uses--
if (href_list["spell_choice"] == "19") if(H.stat || H.restrained())
return
if(!istype(H, /mob/living/carbon/human))
return 1
if(loc == H || (in_range(src, H) && istype(loc, /turf)))
H.set_machine(src)
if(href_list["spell_choice"])
if(href_list["spell_choice"] == "rememorize")
var/area/wizard_station/A = locate() var/area/wizard_station/A = locate()
if(usr in A.contents) if(usr in A.contents)
src.uses = src.max_uses uses = max_uses
usr.spellremove(usr) H.spellremove(usr)
src.temp = "All spells have been removed. You may now memorize a new set of spells." temp = "All spells have been removed. You may now memorize a new set of spells."
feedback_add_details("wizard_spell_learned","UM") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells feedback_add_details("wizard_spell_learned","UM") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
else else
src.temp = "You may only re-memorize spells whilst located inside the wizard sanctuary." temp = "You may only re-memorize spells whilst located inside the wizard sanctuary."
else if(uses >= 1 && max_uses >=1)
uses--
/*
*/
var/list/available_spells = list(magicmissile = "Magic Missile", fireball = "Fireball", disintegrate = "Disintegrate", disabletech = "Disable Tech", smoke = "Smoke", blind = "Blind", mindswap = "Mind Transfer", forcewall = "Forcewall", blink = "Blink", teleport = "Teleport", mutate = "Mutate", etherealjaunt = "Ethereal Jaunt", knock = "Knock", horseman = "Curse of the Horseman", summonguns = "Summon Guns", staffchange = "Staff of Change", soulstone = "Six Soul Stone Shards and the spell Artificer", armor = "Mastercrafted Armor Set", staffanimate = "Staff of Animation")
var/already_knows = 0
for(var/obj/effect/proc_holder/spell/aspell in H.spell_list)
if(available_spells[href_list["spell_choice"]] == aspell.name)
already_knows = 1
temp = "You already know that spell."
uses++
break
/*
*/
if(!already_knows)
switch(href_list["spell_choice"])
if("magicmissile")
feedback_add_details("wizard_spell_learned","MM") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/projectile/magic_missile(H)
temp = "This spell fires several, slow moving, magic projectiles at nearby targets. If they hit a target, it is paralyzed and takes minor damage."
if("fireball")
feedback_add_details("wizard_spell_learned","FB") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/dumbfire/fireball(H)
temp = "This spell fires a fireball in the direction you're facing and does not require wizard garb. Be careful not to fire it at people that are standing next to you."
if("disintegrate")
feedback_add_details("wizard_spell_learned","DG") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/inflict_handler/disintegrate(H)
temp = "This spell instantly kills somebody adjacent to you with the vilest of magick. It has a long cooldown."
if("disabletech")
feedback_add_details("wizard_spell_learned","DT") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/emplosion/disable_tech(H)
temp = "This spell disables all weapons, cameras and most other technology in range."
if("smoke")
feedback_add_details("wizard_spell_learned","SM") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/smoke(H)
temp = "This spell spawns a cloud of choking smoke at your location and does not require wizard garb."
if("blind")
feedback_add_details("wizard_spell_learned","BD") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/trigger/blind(H)
temp = "This spell temporarly blinds a single person and does not require wizard garb."
if("mindswap")
feedback_add_details("wizard_spell_learned","MT") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/mind_transfer(H)
temp = "This spell allows the user to switch bodies with a target. Careful to not lose your memory in the process."
if("forcewall")
feedback_add_details("wizard_spell_learned","FW") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/aoe_turf/conjure/forcewall(H)
temp = "This spell creates an unbreakable wall that lasts for 30 seconds and does not need wizard garb."
if("blink")
feedback_add_details("wizard_spell_learned","BL") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/turf_teleport/blink(H)
temp = "This spell randomly teleports you a short distance. Useful for evasion or getting into areas if you have patience."
if("teleport")
feedback_add_details("wizard_spell_learned","TP") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/area_teleport/teleport(H)
temp = "This spell teleports you to a type of area of your selection. Very useful if you are in danger, but has a decent cooldown, and is unpredictable."
if("mutate")
feedback_add_details("wizard_spell_learned","MU") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/genetic/mutate(H)
temp = "This spell causes you to turn into a hulk and gain telekinesis for a short while."
if("etherealjaunt")
feedback_add_details("wizard_spell_learned","EJ") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/ethereal_jaunt(H)
temp = "This spell creates your ethereal form, temporarily making you invisible and able to pass through walls."
if("knock")
feedback_add_details("wizard_spell_learned","KN") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/aoe_turf/knock(H)
temp = "This spell opens nearby doors and does not require wizard garb."
if("horseman")
feedback_add_details("wizard_spell_learned","HH") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.spell_list += new /obj/effect/proc_holder/spell/targeted/horsemask(H)
temp = "This spell will curse a person to wear an unremovable horse mask (it has glue on the inside) and speak like a horse. It does not require a wizard garb. Do note the curse will disintegrate the target's current mask if they are wearing one."
if("summonguns")
feedback_add_details("wizard_spell_learned","SG") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
H.rightandwrong()
max_uses--
temp = "Nothing could possibly go wrong with arming a crew of lunatics just itching for an excuse to kill eachother. Just be careful not to get hit in the crossfire!"
if("staffchange")
feedback_add_details("wizard_spell_learned","ST") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/weapon/gun/energy/staff(get_turf(H))
temp = "An artefact that spits bolts of coruscating energy which cause the target's very form to reshape itself"
max_uses--
if("soulstone")
feedback_add_details("wizard_spell_learned","SS") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/weapon/storage/belt/soulstone/full(get_turf(H))
H.spell_list += new /obj/effect/proc_holder/spell/aoe_turf/conjure/construct(H)
temp = "Soul Stone Shards are ancient tools capable of capturing and harnessing the spirits of the dead and dying. The spell Artificer allows you to create arcane machines for the captured souls to pilot."
max_uses--
if("armor")
feedback_add_details("wizard_spell_learned","HS") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/clothing/shoes/sandal(get_turf(H)) //In case they've lost them.
new /obj/item/clothing/gloves/purple(get_turf(H))//To complete the outfit
new /obj/item/clothing/suit/space/rig/wizard(get_turf(H))
new /obj/item/clothing/head/helmet/space/rig/wizard(get_turf(H))
temp = "An artefact suit of armor that allows you to cast spells while providing more protection against attacks and the void of space."
max_uses--
if("staffanimation")
feedback_add_details("wizard_spell_learned","SA") //please do not change the abbreviation to keep data processing consistent. Add a unique id to any new spells
new /obj/item/weapon/gun/energy/staff/animate(get_turf(H))
temp = "An artefact that spits bolts of life-force which causes objects which are hit by it to animate and come to life! This magic doesn't affect machines."
max_uses--
else else
if(href_list["temp"]) if(href_list["temp"])
src.temp = null temp = null
attack_self(H) attack_self(H)
return return

View File

@@ -252,13 +252,6 @@ datum/hud/New(mob/owner)
if(ishuman(mymob)) if(ishuman(mymob))
human_hud(ui_style) // Pass the player the UI style chosen in preferences human_hud(ui_style) // Pass the player the UI style chosen in preferences
if(RADAR in mymob.augmentations)
spawn()
if(mymob.radar_open)
mymob:start_radar()
else
mymob:place_radar_closed()
else if(ismonkey(mymob)) else if(ismonkey(mymob))
monkey_hud(ui_style) monkey_hud(ui_style)

View File

@@ -11,8 +11,8 @@
req_admin_notify = 1 req_admin_notify = 1
access = list() //See get_access() access = list() //See get_access()
minimal_access = list() //See get_access() minimal_access = list() //See get_access()
alt_titles = list("Administrator")
minimal_player_age = 14
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
H.equip_to_slot_or_del(new /obj/item/device/radio/headset/heads/captain(H), slot_ears) H.equip_to_slot_or_del(new /obj/item/device/radio/headset/heads/captain(H), slot_ears)
@@ -55,6 +55,7 @@
selection_color = "#ddddff" selection_color = "#ddddff"
idtype = /obj/item/weapon/card/id/silver idtype = /obj/item/weapon/card/id/silver
req_admin_notify = 1 req_admin_notify = 1
minimal_player_age = 10
access = list(access_security, access_sec_doors, access_brig, access_court, access_forensics_lockers, access = list(access_security, access_sec_doors, access_brig, access_court, access_forensics_lockers,
access_medical, access_engine, access_change_ids, access_ai_upload, access_eva, access_heads, access_medical, access_engine, access_change_ids, access_ai_upload, access_eva, access_heads,
access_all_personal_lockers, access_maint_tunnels, access_bar, access_janitor, access_construction, access_morgue, access_all_personal_lockers, access_maint_tunnels, access_bar, access_janitor, access_construction, access_morgue,

View File

@@ -8,7 +8,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_bar) access = list(access_hydroponics, access_bar, access_kitchen, access_morgue)
minimal_access = list(access_bar) minimal_access = list(access_bar)
@@ -50,7 +50,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_kitchen, access_morgue) access = list(access_hydroponics, access_bar, access_kitchen, access_morgue)
minimal_access = list(access_kitchen, access_morgue) minimal_access = list(access_kitchen, access_morgue)
alt_titles = list("Cook") alt_titles = list("Cook")
@@ -79,7 +79,7 @@
spawn_positions = 2 spawn_positions = 2
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_hydroponics, access_morgue) // Removed tox and chem access because STOP PISSING OFF THE CHEMIST GUYS // //Removed medical access because WHAT THE FUCK YOU AREN'T A DOCTOR YOU GROW WHEAT //Given Morgue access because they have a viable means of cloning. access = list(access_hydroponics, access_bar, access_kitchen, access_morgue) // Removed tox and chem access because STOP PISSING OFF THE CHEMIST GUYS // //Removed medical access because WHAT THE FUCK YOU AREN'T A DOCTOR YOU GROW WHEAT //Given Morgue access because they have a viable means of cloning.
minimal_access = list(access_hydroponics, access_morgue) // Removed tox and chem access because STOP PISSING OFF THE CHEMIST GUYS // //Removed medical access because WHAT THE FUCK YOU AREN'T A DOCTOR YOU GROW WHEAT //Given Morgue access because they have a viable means of cloning. minimal_access = list(access_hydroponics, access_morgue) // Removed tox and chem access because STOP PISSING OFF THE CHEMIST GUYS // //Removed medical access because WHAT THE FUCK YOU AREN'T A DOCTOR YOU GROW WHEAT //Given Morgue access because they have a viable means of cloning.
alt_titles = list("Hydroponicist") alt_titles = list("Hydroponicist")
@@ -140,7 +140,7 @@
spawn_positions = 2 spawn_positions = 2
supervisors = "the quartermaster and the head of personnel" supervisors = "the quartermaster and the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_maint_tunnels, access_cargo, access_cargo_bot, access_mailsorting) access = list(access_maint_tunnels, access_mailsorting, access_cargo, access_cargo_bot, access_qm, access_mint, access_mining, access_mining_station)
minimal_access = list(access_maint_tunnels, access_cargo, access_cargo_bot, access_mailsorting) minimal_access = list(access_maint_tunnels, access_cargo, access_cargo_bot, access_mailsorting)
@@ -168,7 +168,7 @@
spawn_positions = 3 spawn_positions = 3
supervisors = "the quartermaster and the head of personnel" supervisors = "the quartermaster and the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_mining, access_mint, access_mining_station, access_mailsorting) access = list(access_maint_tunnels, access_mailsorting, access_cargo, access_cargo_bot, access_qm, access_mint, access_mining, access_mining_station)
minimal_access = list(access_mining, access_mint, access_mining_station, access_mailsorting) minimal_access = list(access_mining, access_mint, access_mining_station, access_mailsorting)
alt_titles = list("Deep space miner") alt_titles = list("Deep space miner")
@@ -207,7 +207,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_clown, access_theatre) access = list(access_clown, access_theatre, access_maint_tunnels)
minimal_access = list(access_clown, access_theatre) minimal_access = list(access_clown, access_theatre)
@@ -239,7 +239,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_mime, access_theatre) access = list(access_mime, access_theatre, access_maint_tunnels)
minimal_access = list(access_mime, access_theatre) minimal_access = list(access_mime, access_theatre)
@@ -309,7 +309,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_library) access = list(access_library, access_maint_tunnels)
minimal_access = list(access_library) minimal_access = list(access_library)
alt_titles = list("Journalist") alt_titles = list("Journalist")
@@ -338,7 +338,7 @@ var/global/lawyer = 0//Checks for another lawyer
spawn_positions = 2 spawn_positions = 2
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_lawyer, access_court, access_sec_doors) access = list(access_lawyer, access_court, access_sec_doors, access_maint_tunnels)
minimal_access = list(access_lawyer, access_court, access_sec_doors) minimal_access = list(access_lawyer, access_court, access_sec_doors)
alt_titles = list("Attourney", "IA Consultant") alt_titles = list("Attourney", "IA Consultant")

View File

@@ -8,7 +8,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of personnel" supervisors = "the head of personnel"
selection_color = "#dddddd" selection_color = "#dddddd"
access = list(access_morgue, access_chapel_office, access_crematorium) access = list(access_morgue, access_chapel_office, access_crematorium, access_maint_tunnels)
minimal_access = list(access_morgue, access_chapel_office, access_crematorium) minimal_access = list(access_morgue, access_chapel_office, access_crematorium)
alt_titles = list("Counselor") alt_titles = list("Counselor")

View File

@@ -17,6 +17,7 @@
access_teleporter, access_external_airlocks, access_atmospherics, access_emergency_storage, access_eva, access_teleporter, access_external_airlocks, access_atmospherics, access_emergency_storage, access_eva,
access_heads, access_construction, access_sec_doors, access_heads, access_construction, access_sec_doors,
access_ce, access_RC_announce, access_keycard_auth, access_tcomsat) access_ce, access_RC_announce, access_keycard_auth, access_tcomsat)
minimal_player_age = 7
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
@@ -49,7 +50,7 @@
spawn_positions = 5 spawn_positions = 5
supervisors = "the chief engineer" supervisors = "the chief engineer"
selection_color = "#fff5cc" selection_color = "#fff5cc"
access = list(access_engine, access_engine_equip, access_tech_storage, access_maint_tunnels, access_external_airlocks, access_construction) access = list(access_eva, access_engine, access_engine_equip, access_tech_storage, access_maint_tunnels, access_external_airlocks, access_construction, access_atmospherics)
minimal_access = list(access_engine, access_engine_equip, access_tech_storage, access_maint_tunnels, access_external_airlocks, access_construction) minimal_access = list(access_engine, access_engine_equip, access_tech_storage, access_maint_tunnels, access_external_airlocks, access_construction)
alt_titles = list("Technician","Maintenance technician","Engine technician","EVA technician","Electrician","Construction specialist") alt_titles = list("Technician","Maintenance technician","Engine technician","EVA technician","Electrician","Construction specialist")
@@ -84,7 +85,7 @@
spawn_positions = 2 spawn_positions = 2
supervisors = "the chief engineer" supervisors = "the chief engineer"
selection_color = "#fff5cc" selection_color = "#fff5cc"
access = list(access_atmospherics, access_maint_tunnels, access_emergency_storage, access_construction) access = list(access_eva, access_engine, access_engine_equip, access_tech_storage, access_maint_tunnels, access_external_airlocks, access_construction, access_atmospherics)
minimal_access = list(access_atmospherics, access_maint_tunnels, access_emergency_storage, access_construction) minimal_access = list(access_atmospherics, access_maint_tunnels, access_emergency_storage, access_construction)

View File

@@ -38,6 +38,9 @@
//If this is set to 1, a text is printed to the player when jobs are assigned, telling him that he should let admins know that he has to disconnect. //If this is set to 1, a text is printed to the player when jobs are assigned, telling him that he should let admins know that he has to disconnect.
var/req_admin_notify var/req_admin_notify
//If you have use_age_restriction_for_jobs config option enabled and the database set up, this option will add a requirement for players to be at least minimal_player_age days old. (meaning they first signed in at least that many days before.)
var/minimal_player_age = 0
/datum/job/proc/equip(var/mob/living/carbon/human/H) /datum/job/proc/equip(var/mob/living/carbon/human/H)
return 1 return 1
@@ -49,3 +52,22 @@
return src.minimal_access return src.minimal_access
else else
return src.access return src.access
//If the configuration option is set to require players to be logged as old enough to play certain jobs, then this proc checks that they are, otherwise it just returns 1
/datum/job/proc/player_old_enough(client/C)
if(available_in_days(C) == 0)
return 1 //Available in 0 days = available right now = player is old enough to play.
return 0
/datum/job/proc/available_in_days(client/C)
if(!C)
return 0
if(!config.use_age_restriction_for_jobs)
return 0
if(!isnum(C.player_age))
return 0 //This is only a number if the db connection is established, otherwise it is text: "Requires database", meaning these restrictions cannot be enforced
if(!isnum(minimal_player_age))
return 0
return max(0, minimal_player_age - C.player_age)

View File

@@ -15,7 +15,7 @@
minimal_access = list(access_medical, access_morgue, access_genetics, access_heads, minimal_access = list(access_medical, access_morgue, access_genetics, access_heads,
access_chemistry, access_virology, access_cmo, access_surgery, access_RC_announce, access_chemistry, access_virology, access_cmo, access_surgery, access_RC_announce,
access_keycard_auth, access_sec_doors) access_keycard_auth, access_sec_doors)
minimal_player_age = 7
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
@@ -47,8 +47,7 @@
spawn_positions = 3 spawn_positions = 3
supervisors = "the chief medical officer" supervisors = "the chief medical officer"
selection_color = "#ffeef0" selection_color = "#ffeef0"
access = list(access_medical, access_morgue, access_surgery, access_chemistry, access_virology, access_genetics)
access = list(access_medical, access_morgue, access_surgery)
minimal_access = list(access_medical, access_morgue, access_surgery) minimal_access = list(access_medical, access_morgue, access_surgery)
alt_titles = list("Surgeon","Emergency Physician","Nurse","Orderly") alt_titles = list("Surgeon","Emergency Physician","Nurse","Orderly")
@@ -100,7 +99,7 @@
spawn_positions = 2 spawn_positions = 2
supervisors = "the chief medical officer" supervisors = "the chief medical officer"
selection_color = "#ffeef0" selection_color = "#ffeef0"
access = list(access_medical, access_chemistry) access = list(access_medical, access_morgue, access_surgery, access_chemistry, access_virology, access_genetics)
minimal_access = list(access_medical, access_chemistry) minimal_access = list(access_medical, access_chemistry)
alt_titles = list("Pharmacist") alt_titles = list("Pharmacist")
@@ -129,7 +128,7 @@
spawn_positions = 2 spawn_positions = 2
supervisors = "the chief medical officer and research director" supervisors = "the chief medical officer and research director"
selection_color = "#ffeef0" selection_color = "#ffeef0"
access = list(access_medical, access_morgue, access_genetics, access_research) access = list(access_medical, access_morgue, access_surgery, access_chemistry, access_virology, access_genetics, access_research)
minimal_access = list(access_medical, access_morgue, access_genetics, access_research) minimal_access = list(access_medical, access_morgue, access_genetics, access_research)
@@ -156,7 +155,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the chief medical officer" supervisors = "the chief medical officer"
selection_color = "#ffeef0" selection_color = "#ffeef0"
access = list(access_medical, access_virology) access = list(access_medical, access_morgue, access_surgery, access_chemistry, access_virology, access_genetics)
minimal_access = list(access_medical, access_virology) minimal_access = list(access_medical, access_virology)
alt_titles = list("Pathologist","Microbiologist") alt_titles = list("Pathologist","Microbiologist")

View File

@@ -17,7 +17,7 @@
access_tox_storage, access_teleporter, access_sec_doors, access_tox_storage, access_teleporter, access_sec_doors,
access_research, access_robotics, access_xenobiology, access_ai_upload, access_research, access_robotics, access_xenobiology, access_ai_upload,
access_RC_announce, access_keycard_auth, access_tcomsat, access_gateway) access_RC_announce, access_keycard_auth, access_tcomsat, access_gateway)
minimal_player_age = 7
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
@@ -44,8 +44,7 @@
spawn_positions = 3 spawn_positions = 3
supervisors = "the research director" supervisors = "the research director"
selection_color = "#ffeeff" selection_color = "#ffeeff"
access = list(access_robotics, access_tox, access_tox_storage, access_research, access_xenobiology)
access = list(access_tox, access_tox_storage, access_research, access_xenobiology)
minimal_access = list(access_tox, access_tox_storage, access_research, access_xenobiology) minimal_access = list(access_tox, access_tox_storage, access_research, access_xenobiology)
alt_titles = list("Xenoarcheologist", "Anomalist", "Plasma Researcher", "Xenobiologist") alt_titles = list("Xenoarcheologist", "Anomalist", "Plasma Researcher", "Xenobiologist")
@@ -73,7 +72,7 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "research director" supervisors = "research director"
selection_color = "#ffeeff" selection_color = "#ffeeff"
access = list(access_robotics, access_tech_storage, access_morgue, access_research) //As a job that handles so many corpses, it makes sense for them to have morgue access. access = list(access_robotics, access_tox, access_tox_storage, access_tech_storage, access_morgue, access_research) //As a job that handles so many corpses, it makes sense for them to have morgue access.
minimal_access = list(access_robotics, access_tech_storage, access_morgue, access_research) //As a job that handles so many corpses, it makes sense for them to have morgue access. minimal_access = list(access_robotics, access_tech_storage, access_morgue, access_research) //As a job that handles so many corpses, it makes sense for them to have morgue access.
alt_titles = list("Biomedical engineer","Mechatronic engineer") alt_titles = list("Biomedical engineer","Mechatronic engineer")

View File

@@ -17,7 +17,7 @@
access_forensics_lockers, access_morgue, access_maint_tunnels, access_all_personal_lockers, access_forensics_lockers, access_morgue, access_maint_tunnels, access_all_personal_lockers,
access_research, access_engine, access_mining, access_medical, access_construction, access_mailsorting, access_research, access_engine, access_mining, access_medical, access_construction, access_mailsorting,
access_heads, access_hos, access_RC_announce, access_keycard_auth, access_gateway) access_heads, access_hos, access_RC_announce, access_keycard_auth, access_gateway)
minimal_player_age = 14
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
@@ -55,9 +55,9 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of security" supervisors = "the head of security"
selection_color = "#ffeeee" selection_color = "#ffeeee"
access = list(access_security, access_sec_doors, access_brig, access_armory, access_court) access = list(access_security, access_sec_doors, access_brig, access_armory, access_court, access_maint_tunnels, access_morgue)
minimal_access = list(access_security, access_sec_doors, access_brig, access_armory, access_court) minimal_access = list(access_security, access_sec_doors, access_brig, access_armory, access_court)
minimal_player_age = 7
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
@@ -92,11 +92,12 @@
spawn_positions = 1 spawn_positions = 1
supervisors = "the head of security" supervisors = "the head of security"
selection_color = "#ffeeee" selection_color = "#ffeeee"
alt_titles = list("Forensic Technician")
access = list(access_sec_doors, access_forensics_lockers, access_morgue, access_maint_tunnels, access_court) access = list(access_sec_doors, access_forensics_lockers, access_morgue, access_maint_tunnels, access_court)
minimal_access = list(access_sec_doors, access_forensics_lockers, access_morgue, access_maint_tunnels, access_court) minimal_access = list(access_sec_doors, access_forensics_lockers, access_morgue, access_maint_tunnels, access_court)
alt_titles = list("Forensic Technician") alt_titles = list("Forensic Technician")
minimal_player_age = 7
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
H.equip_to_slot_or_del(new /obj/item/device/radio/headset/headset_sec(H), slot_ears) H.equip_to_slot_or_del(new /obj/item/device/radio/headset/headset_sec(H), slot_ears)
@@ -140,10 +141,9 @@
spawn_positions = 5 spawn_positions = 5
supervisors = "the head of security" supervisors = "the head of security"
selection_color = "#ffeeee" selection_color = "#ffeeee"
access = list(access_security, access_sec_doors, access_brig, access_court) access = list(access_security, access_sec_doors, access_brig, access_court, access_maint_tunnels, access_morgue)
minimal_access = list(access_security, access_sec_doors, access_brig, access_court) minimal_access = list(access_security, access_sec_doors, access_brig, access_court)
minimal_player_age = 7
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
H.equip_to_slot_or_del(new /obj/item/device/radio/headset/headset_sec(H), slot_ears) H.equip_to_slot_or_del(new /obj/item/device/radio/headset/headset_sec(H), slot_ears)

View File

@@ -8,7 +8,7 @@
selection_color = "#ccffcc" selection_color = "#ccffcc"
supervisors = "your laws" supervisors = "your laws"
req_admin_notify = 1 req_admin_notify = 1
minimal_player_age = 30
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0
@@ -25,6 +25,7 @@
spawn_positions = 2 spawn_positions = 2
supervisors = "your laws and the AI" //Nodrak supervisors = "your laws and the AI" //Nodrak
selection_color = "#ddffdd" selection_color = "#ddffdd"
minimal_player_age = 21
equip(var/mob/living/carbon/human/H) equip(var/mob/living/carbon/human/H)
if(!H) return 0 if(!H) return 0

View File

@@ -47,6 +47,7 @@ var/global/datum/controller/occupations/job_master
var/datum/job/job = GetJob(rank) var/datum/job/job = GetJob(rank)
if(!job) return 0 if(!job) return 0
if(jobban_isbanned(player, rank)) return 0 if(jobban_isbanned(player, rank)) return 0
if(!job.player_old_enough(player.client)) return 0
var/position_limit = job.total_positions var/position_limit = job.total_positions
if(!latejoin) if(!latejoin)
position_limit = job.spawn_positions position_limit = job.spawn_positions
@@ -74,6 +75,9 @@ var/global/datum/controller/occupations/job_master
if(jobban_isbanned(player, job.title)) if(jobban_isbanned(player, job.title))
Debug("FOC isbanned failed, Player: [player]") Debug("FOC isbanned failed, Player: [player]")
continue continue
if(!job.player_old_enough(player.client))
Debug("FOC player not old enough, Player: [player]")
continue
if(flag && (!player.client.prefs.be_special & flag)) if(flag && (!player.client.prefs.be_special & flag))
Debug("FOC flag failed, Player: [player], Flag: [flag], ") Debug("FOC flag failed, Player: [player], Flag: [flag], ")
continue continue
@@ -83,7 +87,7 @@ var/global/datum/controller/occupations/job_master
return candidates return candidates
proc/GiveRandomJob(var/mob/new_player/player) proc/GiveRandomJob(var/mob/new_player/player)
Debug("FOC Giving random job, Player: [player]") Debug("GRJ Giving random job, Player: [player]")
for(var/datum/job/job in shuffle(occupations)) for(var/datum/job/job in shuffle(occupations))
if(!job) if(!job)
continue continue
@@ -95,11 +99,15 @@ var/global/datum/controller/occupations/job_master
continue continue
if(jobban_isbanned(player, job.title)) if(jobban_isbanned(player, job.title))
Debug("FOC isbanned failed, Player: [player], Job: [job.title]") Debug("GRJ isbanned failed, Player: [player], Job: [job.title]")
continue
if(!job.player_old_enough(player.client))
Debug("GRJ player not old enough, Player: [player]")
continue continue
if((job.current_positions < job.spawn_positions) || job.spawn_positions == -1) if((job.current_positions < job.spawn_positions) || job.spawn_positions == -1)
Debug("FOC Random job given, Player: [player], Job: [job]") Debug("GRJ Random job given, Player: [player], Job: [job]")
AssignRole(player, job.title) AssignRole(player, job.title)
unassigned -= player unassigned -= player
break break
@@ -242,7 +250,11 @@ var/global/datum/controller/occupations/job_master
continue continue
if(jobban_isbanned(player, job.title)) if(jobban_isbanned(player, job.title))
Debug("FOC isbanned failed, Player: [player], Job:[job.title]") Debug("DO isbanned failed, Player: [player], Job:[job.title]")
continue
if(!job.player_old_enough(player.client))
Debug("DO player not old enough, Player: [player], Job:[job.title]")
continue continue
// If the player wants that job on this level, then try give it to him. // If the player wants that job on this level, then try give it to him.
@@ -250,7 +262,7 @@ var/global/datum/controller/occupations/job_master
// If the job isn't filled // If the job isn't filled
if((job.current_positions < job.spawn_positions) || job.spawn_positions == -1) if((job.current_positions < job.spawn_positions) || job.spawn_positions == -1)
Debug("FOC pass, Player: [player], Level:[level], Job:[job.title]") Debug("DO pass, Player: [player], Level:[level], Job:[job.title]")
AssignRole(player, job.title) AssignRole(player, job.title)
unassigned -= player unassigned -= player
break break
@@ -428,12 +440,16 @@ var/global/datum/controller/occupations/job_master
var/level3 = 0 //low var/level3 = 0 //low
var/level4 = 0 //never var/level4 = 0 //never
var/level5 = 0 //banned var/level5 = 0 //banned
var/level6 = 0 //account too young
for(var/mob/new_player/player in player_list) for(var/mob/new_player/player in player_list)
if(!(player.ready && player.mind && !player.mind.assigned_role)) if(!(player.ready && player.mind && !player.mind.assigned_role))
continue //This player is not ready continue //This player is not ready
if(jobban_isbanned(player, job.title)) if(jobban_isbanned(player, job.title))
level5++ level5++
continue continue
if(!job.player_old_enough(player.client))
level6++
continue
if(player.client.prefs.GetJobDepartment(job, 1) & job.flag) if(player.client.prefs.GetJobDepartment(job, 1) & job.flag)
level1++ level1++
else if(player.client.prefs.GetJobDepartment(job, 2) & job.flag) else if(player.client.prefs.GetJobDepartment(job, 2) & job.flag)
@@ -442,5 +458,5 @@ var/global/datum/controller/occupations/job_master
level3++ level3++
else level4++ //not selected else level4++ //not selected
tmp_str += "HIGH=[level1]|MEDIUM=[level2]|LOW=[level3]|NEVER=[level4]|BANNED=[level5]|-" tmp_str += "HIGH=[level1]|MEDIUM=[level2]|LOW=[level3]|NEVER=[level4]|BANNED=[level5]|-|YOUNG=[level6]|-"
feedback_add_details("job_preferences",tmp_str) feedback_add_details("job_preferences",tmp_str)

View File

@@ -63,7 +63,7 @@
return return
/obj/machinery/optable/attack_hand(mob/user as mob) /obj/machinery/optable/attack_hand(mob/user as mob)
if ((HULK in usr.mutations) || (SUPRSTR in usr.augmentations)) if (HULK in usr.mutations)
usr << text("\blue You destroy the table.") usr << text("\blue You destroy the table.")
visible_message("\red [usr] destroys the operating table!") visible_message("\red [usr] destroys the operating table!")
src.density = 0 src.density = 0

View File

@@ -665,7 +665,7 @@ Auto Patrol: []"},
if(src.emagged == 2) return 10 //Everyone is a criminal! if(src.emagged == 2) return 10 //Everyone is a criminal!
if((src.idcheck) || (isnull(perp:wear_id)) || (istype(perp:wear_id, /obj/item/weapon/card/id/syndicate))) if((src.idcheck) || (isnull(perp:wear_id)) || (istype(perp:wear_id.GetID(), /obj/item/weapon/card/id/syndicate)))
if((istype(perp.l_hand, /obj/item/weapon/gun) && !istype(perp.l_hand, /obj/item/weapon/gun/projectile/shotgun)) || istype(perp.l_hand, /obj/item/weapon/melee/baton)) if((istype(perp.l_hand, /obj/item/weapon/gun) && !istype(perp.l_hand, /obj/item/weapon/gun/projectile/shotgun)) || istype(perp.l_hand, /obj/item/weapon/melee/baton))
if(!istype(perp.l_hand, /obj/item/weapon/gun/energy/laser/bluetag) \ if(!istype(perp.l_hand, /obj/item/weapon/gun/energy/laser/bluetag) \
@@ -692,7 +692,7 @@ Auto Patrol: []"},
threatcount += 2 threatcount += 2
//Agent cards lower threatlevel when normal idchecking is off. //Agent cards lower threatlevel when normal idchecking is off.
if((istype(perp:wear_id, /obj/item/weapon/card/id/syndicate)) && src.idcheck) if((perp.wear_id && istype(perp:wear_id.GetID(), /obj/item/weapon/card/id/syndicate)) && src.idcheck)
threatcount -= 2 threatcount -= 2
if(src.lasercolor == "b")//Lasertag turrets target the opposing team, how great is that? -Sieve if(src.lasercolor == "b")//Lasertag turrets target the opposing team, how great is that? -Sieve

View File

@@ -623,7 +623,7 @@ Auto Patrol: []"},
threatcount += 2 threatcount += 2
//Agent cards lower threatlevel. //Agent cards lower threatlevel.
if(istype(perp:wear_id, /obj/item/weapon/card/id/syndicate)) if(perp.wear_id && istype(perp:wear_id.GetID(), /obj/item/weapon/card/id/syndicate))
threatcount -= 2 threatcount -= 2
if(src.check_records) if(src.check_records)

View File

@@ -8,7 +8,8 @@
active_power_usage = 10 active_power_usage = 10
layer = 5 layer = 5
var/network = "SS13" var/list/network = list("SS13")
var/network_multi = "" //This is for when you want to place a camera on the map. Input them as a string seperated by commas "SS13,RD,SomeOtherNetwork"
var/c_tag = null var/c_tag = null
var/c_tag_order = 999 var/c_tag_order = 999
var/status = 1.0 var/status = 1.0
@@ -40,17 +41,22 @@
assembly.state = 4 assembly.state = 4
/* // Use this to look for cameras that have the same c_tag. /* // Use this to look for cameras that have the same c_tag.
for(var/obj/machinery/camera/C in cameranet.cameras) for(var/obj/machinery/camera/C in cameranet.cameras)
if(C != src && C.c_tag == src.c_tag && C.network == src.network) var/list/tempnetwork = C.network&src.network
if(C != src && C.c_tag == src.c_tag && tempnetwork.len)
world.log << "[src.c_tag] [src.x] [src.y] [src.z] conflicts with [C.c_tag] [C.x] [C.y] [C.z]" world.log << "[src.c_tag] [src.x] [src.y] [src.z] conflicts with [C.c_tag] [C.x] [C.y] [C.z]"
*/ */
..() ..()
/obj/machinery/camera/initialize() //Lists dont work in the map editor so we have to translate a string into a list when the map initializes
if(network_multi)
network = text2list(network_multi,",")
/obj/machinery/camera/emp_act(severity) /obj/machinery/camera/emp_act(severity)
if(!isEmpProof()) if(!isEmpProof())
if(prob(100/severity)) if(prob(100/severity))
icon_state = "[initial(icon_state)]emp" icon_state = "[initial(icon_state)]emp"
network = null //Not the best way but it will do. I think. for(var/i in network)
network.Remove(i) //Not the best way but it will do. I think.
cameranet.removeCamera(src) cameranet.removeCamera(src)
stat |= EMPED stat |= EMPED
SetLuminosity(0) SetLuminosity(0)

View File

@@ -76,6 +76,17 @@
// State 3 // State 3
if(isscrewdriver(W)) if(isscrewdriver(W))
playsound(src.loc, 'sound/items/Screwdriver.ogg', 50, 1) playsound(src.loc, 'sound/items/Screwdriver.ogg', 50, 1)
var/input = strip_html(input(usr, "Which networks would you like to connect this camera to? Seperate networks with a comma. No Spaces!\nFor example: SS13,Security,Secret ", "Set Network", "SS13"))
if(!input)
usr << "No input found please hang up and try your call again."
return
var/list/tempnetwork = text2list(input, ",")
if(tempnetwork.len < 1)
usr << "No network found please hang up and try your call again."
return
state = 4 state = 4
var/obj/machinery/camera/C = new(src.loc) var/obj/machinery/camera/C = new(src.loc)
src.loc = C src.loc = C
@@ -83,8 +94,7 @@
C.auto_turn() C.auto_turn()
C.network = "SS13" C.network = tempnetwork
C.network = input(usr, "Which network would you like to connect this camera to?", "Set Network", "SS13")
C.c_tag = "[get_area_name(src)] ([rand(1, 999)]" C.c_tag = "[get_area_name(src)] ([rand(1, 999)]"

View File

@@ -12,7 +12,8 @@
var/list/T = list() var/list/T = list()
T["Cancel"] = "Cancel" T["Cancel"] = "Cancel"
for (var/obj/machinery/camera/C in L) for (var/obj/machinery/camera/C in L)
if (C.network == src.network) var/list/tempnetwork = C.network&src.network
if (tempnetwork.len)
T[text("[][]", C.c_tag, (C.can_use() ? null : " (Deactivated)"))] = C T[text("[][]", C.c_tag, (C.can_use() ? null : " (Deactivated)"))] = C
track = new() track = new()
@@ -74,7 +75,7 @@
human = 1 human = 1
var/mob/living/carbon/human/H = M var/mob/living/carbon/human/H = M
//Cameras can't track people wearing an agent card or a ninja hood. //Cameras can't track people wearing an agent card or a ninja hood.
if(istype(H.wear_id, /obj/item/weapon/card/id/syndicate)) if(H.wear_id && istype(H.wear_id.GetID(), /obj/item/weapon/card/id/syndicate))
continue continue
if(istype(H.head, /obj/item/clothing/head/helmet/space/space_ninja)) if(istype(H.head, /obj/item/clothing/head/helmet/space/space_ninja))
var/obj/item/clothing/head/helmet/space/space_ninja/hood = H.head var/obj/item/clothing/head/helmet/space/space_ninja/hood = H.head
@@ -131,15 +132,16 @@
if (U.cameraFollow == null) if (U.cameraFollow == null)
return return
if (istype(target, /mob/living/carbon/human)) if (istype(target, /mob/living/carbon/human))
if(istype(target:wear_id, /obj/item/weapon/card/id/syndicate)) var/mob/living/carbon/human/H = target
if(H.wear_id && istype(H.wear_id.GetID(), /obj/item/weapon/card/id/syndicate))
U << "Follow camera mode terminated." U << "Follow camera mode terminated."
U.cameraFollow = null U.cameraFollow = null
return return
if(istype(target:head, /obj/item/clothing/head/helmet/space/space_ninja) && !target:head:canremove) if(istype(H.head, /obj/item/clothing/head/helmet/space/space_ninja) && !H.head.canremove)
U << "Follow camera mode terminated." U << "Follow camera mode terminated."
U.cameraFollow = null U.cameraFollow = null
return return
if(target.digitalcamo) if(H.digitalcamo)
U << "Follow camera mode terminated." U << "Follow camera mode terminated."
U.cameraFollow = null U.cameraFollow = null
return return

View File

@@ -40,6 +40,7 @@
/obj/item/weapon/circuitboard/aicore /obj/item/weapon/circuitboard/aicore
name = "Circuit board (AI core)" name = "Circuit board (AI core)"
origin_tech = "programming=4;biotech=2" origin_tech = "programming=4;biotech=2"
board_type = "other"
/obj/item/weapon/circuitboard/aiupload /obj/item/weapon/circuitboard/aiupload
name = "Circuit board (AI Upload)" name = "Circuit board (AI Upload)"
build_path = "/obj/machinery/computer/aiupload" build_path = "/obj/machinery/computer/aiupload"

View File

@@ -8,7 +8,7 @@
circuit = "/obj/item/weapon/circuitboard/security" circuit = "/obj/item/weapon/circuitboard/security"
var/obj/machinery/camera/current = null var/obj/machinery/camera/current = null
var/last_pic = 1.0 var/last_pic = 1.0
var/network = "SS13" var/list/network = list("SS13")
var/mapping = 0//For the overview file, interesting bit of code. var/mapping = 0//For the overview file, interesting bit of code.
@@ -45,7 +45,8 @@
var/list/D = list() var/list/D = list()
D["Cancel"] = "Cancel" D["Cancel"] = "Cancel"
for(var/obj/machinery/camera/C in L) for(var/obj/machinery/camera/C in L)
if(C.network == network) var/list/tempnetwork = C.network&network
if(tempnetwork.len)
D[text("[][]", C.c_tag, (C.status ? null : " (Deactivated)"))] = C D[text("[][]", C.c_tag, (C.status ? null : " (Deactivated)"))] = C
var/t = input(user, "Which camera should you change to?") as null|anything in D var/t = input(user, "Which camera should you change to?") as null|anything in D
@@ -84,7 +85,7 @@
desc = "Used for watching an empty arena." desc = "Used for watching an empty arena."
icon = 'icons/obj/stationobjs.dmi' icon = 'icons/obj/stationobjs.dmi'
icon_state = "telescreen" icon_state = "telescreen"
network = "thunder" network = list("thunder")
density = 0 density = 0
circuit = null circuit = null
@@ -99,7 +100,7 @@
desc = "Damn, they better have /tg/thechannel on these things." desc = "Damn, they better have /tg/thechannel on these things."
icon = 'icons/obj/status_display.dmi' icon = 'icons/obj/status_display.dmi'
icon_state = "entertainment" icon_state = "entertainment"
network = "thunder" network = list("thunder")
density = 0 density = 0
circuit = null circuit = null
@@ -114,5 +115,5 @@
name = "Outpost Cameras" name = "Outpost Cameras"
desc = "Used to access the various cameras on the outpost." desc = "Used to access the various cameras on the outpost."
icon_state = "miningcameras" icon_state = "miningcameras"
network = "MINE" network = list("MINE")
circuit = "/obj/item/weapon/circuitboard/mining" circuit = "/obj/item/weapon/circuitboard/mining"

View File

@@ -289,11 +289,15 @@
else if (href_list["view_rec"]) else if (href_list["view_rec"])
src.active_record = locate(href_list["view_rec"]) src.active_record = locate(href_list["view_rec"])
if(istype(src.active_record,/datum/data/record))
if ((isnull(src.active_record.fields["ckey"])) || (src.active_record.fields["ckey"] == "")) if ((isnull(src.active_record.fields["ckey"])) || (src.active_record.fields["ckey"] == ""))
del(src.active_record) del(src.active_record)
src.temp = "ERROR: Record Corrupt" src.temp = "ERROR: Record Corrupt"
else else
src.menu = 3 src.menu = 3
else
src.active_record = null
src.temp = "Record missing."
else if (href_list["del_rec"]) else if (href_list["del_rec"])
if ((!src.active_record) || (src.menu < 3)) if ((!src.active_record) || (src.menu < 3))
@@ -416,9 +420,9 @@
if (subject.suiciding == 1) if (subject.suiciding == 1)
scantemp = "Error: Subject's brain is not responding to scanning stimuli." scantemp = "Error: Subject's brain is not responding to scanning stimuli."
return return
// if ((!subject.ckey) || (!subject.client)) if ((!subject.ckey) || (!subject.client))
// scantemp = "Error: Mental interface failure." scantemp = "Error: Mental interface failure."
// return return
if (NOCLONE in subject.mutations) if (NOCLONE in subject.mutations)
scantemp = "Error: Mental interface failure." scantemp = "Error: Mental interface failure."
return return

View File

@@ -100,7 +100,9 @@
on = !on on = !on
update_icon() update_icon()
if(href_list["eject"]) if(href_list["eject"])
beaker:loc = loc if (beaker)
var/obj/item/weapon/reagent_containers/glass/B = beaker
B.loc = get_step(loc, SOUTH)
beaker = null beaker = null
updateUsrDialog() updateUsrDialog()

View File

@@ -92,7 +92,6 @@ Airlock index -> wire color are { 9, 4, 6, 7, 5, 8, 1, 2, 3 }.
normalspeed = 1 normalspeed = 1
var/obj/item/weapon/airlock_electronics/electronics = null var/obj/item/weapon/airlock_electronics/electronics = null
var/hasShocked = 0 //Prevents multiple shocks from happening var/hasShocked = 0 //Prevents multiple shocks from happening
var/heat_proof = 0 // For glass airlocks
/obj/machinery/door/airlock/command /obj/machinery/door/airlock/command
name = "Airlock" name = "Airlock"
@@ -632,13 +631,6 @@ About the new airlock wires panel:
return 0 return 0
/obj/machinery/door/airlock/update_heat_protection(var/turf/simulated/source)
if(istype(source))
if(src.density && (src.opacity || src.heat_proof))
source.thermal_conductivity = DOOR_HEAT_TRANSFER_COEFFICIENT
else
source.thermal_conductivity = initial(source.thermal_conductivity)
/obj/machinery/door/airlock/update_icon() /obj/machinery/door/airlock/update_icon()
if(overlays) overlays.Cut() if(overlays) overlays.Cut()
if(density) if(density)

View File

@@ -17,6 +17,7 @@
var/autoclose = 0 var/autoclose = 0
var/glass = 0 var/glass = 0
var/normalspeed = 1 var/normalspeed = 1
var/heat_proof = 0 // For glass airlocks/opacity firedoors
/obj/machinery/door/New() /obj/machinery/door/New()
..() ..()
@@ -253,7 +254,7 @@
/obj/machinery/door/proc/update_heat_protection(var/turf/simulated/source) /obj/machinery/door/proc/update_heat_protection(var/turf/simulated/source)
if(istype(source)) if(istype(source))
if(src.density && src.opacity) if(src.density && (src.opacity || src.heat_proof))
source.thermal_conductivity = DOOR_HEAT_TRANSFER_COEFFICIENT source.thermal_conductivity = DOOR_HEAT_TRANSFER_COEFFICIENT
else else
source.thermal_conductivity = initial(source.thermal_conductivity) source.thermal_conductivity = initial(source.thermal_conductivity)

View File

@@ -226,6 +226,7 @@
icon = 'icons/obj/doors/edge_Doorfire.dmi' icon = 'icons/obj/doors/edge_Doorfire.dmi'
glass = 1 //There is a glass window so you can see through the door glass = 1 //There is a glass window so you can see through the door
//This is needed due to BYOND limitations in controlling visibility //This is needed due to BYOND limitations in controlling visibility
heat_proof = 1
CanPass(atom/movable/mover, turf/target, height=0, air_group=0) CanPass(atom/movable/mover, turf/target, height=0, air_group=0)
if(istype(mover) && mover.checkpass(PASSGLASS)) if(istype(mover) && mover.checkpass(PASSGLASS))

View File

@@ -558,7 +558,7 @@ Status: []<BR>"},
return 10 return 10
if(auth_weapons) // check for weapon authorization if(auth_weapons) // check for weapon authorization
if((isnull(perp:wear_id)) || (istype(perp:wear_id, /obj/item/weapon/card/id/syndicate))) if((isnull(perp.wear_id)) || (istype(perp.wear_id.GetID(), /obj/item/weapon/card/id/syndicate)))
if((src.allowed(perp)) && !(src.lasercolor)) // if the perp has security access, return 0 if((src.allowed(perp)) && !(src.lasercolor)) // if the perp has security access, return 0
return 0 return 0
@@ -569,40 +569,36 @@ Status: []<BR>"},
if((istype(perp.r_hand, /obj/item/weapon/gun) && !istype(perp.r_hand, /obj/item/weapon/gun/projectile/shotgun)) || istype(perp.r_hand, /obj/item/weapon/melee/baton)) if((istype(perp.r_hand, /obj/item/weapon/gun) && !istype(perp.r_hand, /obj/item/weapon/gun/projectile/shotgun)) || istype(perp.r_hand, /obj/item/weapon/melee/baton))
threatcount += 4 threatcount += 4
if(istype(perp:belt, /obj/item/weapon/gun) || istype(perp:belt, /obj/item/weapon/melee/baton)) if(istype(perp.belt, /obj/item/weapon/gun) || istype(perp.belt, /obj/item/weapon/melee/baton))
threatcount += 2 threatcount += 2
if((src.lasercolor) == "b")//Lasertag turrets target the opposing team, how great is that? -Sieve if((src.lasercolor) == "b")//Lasertag turrets target the opposing team, how great is that? -Sieve
threatcount = 0//But does not target anyone else threatcount = 0//But does not target anyone else
if(istype(perp.wear_suit, /obj/item/clothing/suit/redtag)) if(istype(perp.wear_suit, /obj/item/clothing/suit/redtag))
threatcount += 4 threatcount += 4
if((istype(perp:r_hand,/obj/item/weapon/gun/energy/laser/redtag)) || (istype(perp:l_hand,/obj/item/weapon/gun/energy/laser/redtag))) if((istype(perp.r_hand,/obj/item/weapon/gun/energy/laser/redtag)) || (istype(perp.l_hand,/obj/item/weapon/gun/energy/laser/redtag)))
threatcount += 4 threatcount += 4
if(istype(perp:belt, /obj/item/weapon/gun/energy/laser/redtag)) if(istype(perp.belt, /obj/item/weapon/gun/energy/laser/redtag))
threatcount += 2 threatcount += 2
if((src.lasercolor) == "r") if((src.lasercolor) == "r")
threatcount = 0 threatcount = 0
if(istype(perp.wear_suit, /obj/item/clothing/suit/bluetag)) if(istype(perp.wear_suit, /obj/item/clothing/suit/bluetag))
threatcount += 4 threatcount += 4
if((istype(perp:r_hand,/obj/item/weapon/gun/energy/laser/bluetag)) || (istype(perp:l_hand,/obj/item/weapon/gun/energy/laser/bluetag))) if((istype(perp.r_hand,/obj/item/weapon/gun/energy/laser/bluetag)) || (istype(perp.l_hand,/obj/item/weapon/gun/energy/laser/bluetag)))
threatcount += 4 threatcount += 4
if(istype(perp:belt, /obj/item/weapon/gun/energy/laser/bluetag)) if(istype(perp.belt, /obj/item/weapon/gun/energy/laser/bluetag))
threatcount += 2 threatcount += 2
if (src.check_records) // if the turret can check the records, check if they are set to *Arrest* on records if (src.check_records) // if the turret can check the records, check if they are set to *Arrest* on records
for (var/datum/data/record/E in data_core.general) for (var/datum/data/record/E in data_core.general)
var/perpname = perp.name var/perpname = perp.name
if (perp:wear_id) if (perp.wear_id)
var/obj/item/weapon/card/id/id = perp:wear_id var/obj/item/weapon/card/id/id = perp.wear_id.GetID()
if(istype(perp:wear_id, /obj/item/device/pda))
var/obj/item/device/pda/pda = perp:wear_id
id = pda.id
if (id) if (id)
perpname = id.registered_name perpname = id.registered_name
else
var/obj/item/device/pda/pda = perp:wear_id
perpname = pda.owner
if (E.fields["name"] == perpname) if (E.fields["name"] == perpname)
for (var/datum/data/record/R in data_core.security) for (var/datum/data/record/R in data_core.security)
if ((R.fields["id"] == E.fields["id"]) && (R.fields["criminal"] == "*Arrest*")) if ((R.fields["id"] == E.fields["id"]) && (R.fields["criminal"] == "*Arrest*"))

View File

@@ -17,14 +17,14 @@
var/active = 1 //No sales pitches if off! var/active = 1 //No sales pitches if off!
var/vend_ready = 1 //Are we ready to vend?? Is it time?? var/vend_ready = 1 //Are we ready to vend?? Is it time??
var/vend_delay = 10 //How long does it take to vend? var/vend_delay = 10 //How long does it take to vend?
var/product_paths = "" //String of product paths separated by semicolons. No spaces!
var/product_amounts = "" //String of product amounts separated by semicolons, must have amount for every path in product_paths // To be filled out at compile time
var/list/products = list() // For each, use the following pattern:
var/list/contraband = list() // list(/type/path = amount,/type/path2 = amount2)
var/list/premium = list() // No specified amount = only one in stock
var/product_slogans = "" //String of slogans separated by semicolons, optional var/product_slogans = "" //String of slogans separated by semicolons, optional
var/product_ads = "" //String of small ad messages in the vending screen - random chance var/product_ads = "" //String of small ad messages in the vending screen - random chance
var/product_hidden = "" //String of products that are hidden unless hacked.
var/product_hideamt = "" //String of hidden product amounts, separated by semicolons. Exact same as amounts. Must be left blank if hidden is.
var/product_coin = ""
var/product_coin_amt = ""
var/list/product_records = list() var/list/product_records = list()
var/list/hidden_records = list() var/list/hidden_records = list()
var/list/coin_records = list() var/list/coin_records = list()
@@ -53,25 +53,16 @@
..() ..()
spawn(4) spawn(4)
src.slogan_list = text2list(src.product_slogans, ";") src.slogan_list = text2list(src.product_slogans, ";")
var/list/temp_paths = text2list(src.product_paths, ";")
var/list/temp_amounts = text2list(src.product_amounts, ";")
var/list/temp_hidden = text2list(src.product_hidden, ";")
var/list/temp_hideamt = text2list(src.product_hideamt, ";")
var/list/temp_coin = text2list(src.product_coin, ";")
var/list/temp_coin_amt = text2list(src.product_coin_amt, ";")
src.last_slogan = world.time + rand(0, slogan_delay) //So not all machines speak at the exact same time. The first time this machine says something will be at slogantime + this random value, so if slogantime is 10 minutes, it will say it at somewhere between 10 and 20 minutes after the machine is crated. // So not all machines speak at the exact same time.
// The first time this machine says something will be at slogantime + this random value,
// so if slogantime is 10 minutes, it will say it at somewhere between 10 and 20 minutes after the machine is crated.
src.last_slogan = world.time + rand(0, slogan_delay)
//Little sanity check here src.build_inventory(products)
if ((isnull(temp_paths)) || (isnull(temp_amounts)) || (temp_paths.len != temp_amounts.len) || (temp_hidden.len != temp_hideamt.len))
stat |= BROKEN
power_change()
return
src.build_inventory(temp_paths,temp_amounts)
//Add hidden inventory //Add hidden inventory
src.build_inventory(temp_hidden,temp_hideamt, 1) src.build_inventory(contraband, 1)
src.build_inventory(temp_coin,temp_coin_amt, 0, 1) src.build_inventory(premium, 0, 1)
power_change() power_change()
return return
@@ -104,35 +95,25 @@
return return
/obj/machinery/vending/proc/build_inventory(var/list/path_list,var/list/amt_list,hidden=0,req_coin=0) /obj/machinery/vending/proc/build_inventory(var/list/productlist,hidden=0,req_coin=0)
for(var/typepath in productlist)
var/amount = productlist[typepath]
if(isnull(amount)) amount = 1
for(var/p=1, p <= path_list.len ,p++) var/atom/temp = new typepath(null)
var/checkpath = text2path(path_list[p])
if (!checkpath)
continue
var/obj/temp = new checkpath(src)
var/datum/data/vending_product/R = new /datum/data/vending_product() var/datum/data/vending_product/R = new /datum/data/vending_product()
R.product_name = capitalize(temp.name) R.product_name = temp.name
R.product_path = path_list[p] R.product_path = typepath
R.amount = amount
R.display_color = pick("red","blue","green") R.display_color = pick("red","blue","green")
// R. = text2num(amt_list[p])
// src.product_records += R
if(hidden) if(hidden)
R.amount = text2num(amt_list[p]) hidden_records += R
src.hidden_records += R
else if(req_coin) else if(req_coin)
R.amount = text2num(amt_list[p]) coin_records += R
src.coin_records += R
else else
R.amount = text2num(amt_list[p]) product_records += R
src.product_records += R
del(temp)
// world << "Added: [R.product_name]] - [R.amount] - [R.product_path]" // world << "Added: [R.product_name]] - [R.amount] - [R.product_path]"
continue
return return
/obj/machinery/vending/attackby(obj/item/weapon/W as obj, mob/user as mob) /obj/machinery/vending/attackby(obj/item/weapon/W as obj, mob/user as mob)
@@ -152,7 +133,7 @@
if(src.panel_open) if(src.panel_open)
attack_hand(user) attack_hand(user)
return return
else if(istype(W, /obj/item/weapon/coin) && product_coin != "") else if(istype(W, /obj/item/weapon/coin) && premium.len > 0)
user.drop_item() user.drop_item()
W.loc = src W.loc = src
coin = W coin = W
@@ -180,7 +161,7 @@
var/dat = "<TT><center><b>[vendorname]</b></center><hr /><br>" //display the name, and added a horizontal rule var/dat = "<TT><center><b>[vendorname]</b></center><hr /><br>" //display the name, and added a horizontal rule
dat += "<b>Select an item: </b><br><br>" //the rest is just general spacing and bolding dat += "<b>Select an item: </b><br><br>" //the rest is just general spacing and bolding
if (product_coin != "") if (premium.len > 0)
dat += "<b>Coin slot:</b> [coin ? coin : "No coin inserted"] (<a href='byond://?src=\ref[src];remove_coin=1'>Remove</A>)<br><br>" dat += "<b>Coin slot:</b> [coin ? coin : "No coin inserted"] (<a href='byond://?src=\ref[src];remove_coin=1'>Remove</A>)<br><br>"
if (src.product_records.len == 0) if (src.product_records.len == 0)
@@ -276,15 +257,7 @@
src.vend_ready = 0 //One thing at a time!! src.vend_ready = 0 //One thing at a time!!
var/datum/data/vending_product/R = locate(href_list["vend"]) var/datum/data/vending_product/R = locate(href_list["vend"])
if (!R || !istype(R)) if (!R || !istype(R) || !R.product_path || R.amount <= 0)
src.vend_ready = 1
return
var/product_path = text2path(R.product_path)
if (!product_path)
src.vend_ready = 1
return
if (R.amount <= 0)
src.vend_ready = 1 src.vend_ready = 1
return return
@@ -312,7 +285,7 @@
if (src.icon_vend) //Show the vending animation if needed if (src.icon_vend) //Show the vending animation if needed
flick(src.icon_vend,src) flick(src.icon_vend,src)
spawn(src.vend_delay) spawn(src.vend_delay)
new product_path(get_turf(src)) new R.product_path(get_turf(src))
src.vend_ready = 1 src.vend_ready = 1
return return
@@ -399,7 +372,7 @@
for(var/datum/data/vending_product/R in src.product_records) for(var/datum/data/vending_product/R in src.product_records)
if (R.amount <= 0) //Try to use a record that actually has something to dump. if (R.amount <= 0) //Try to use a record that actually has something to dump.
continue continue
var/dump_path = text2path(R.product_path) var/dump_path = R.product_path
if (!dump_path) if (!dump_path)
continue continue
@@ -422,7 +395,7 @@
for(var/datum/data/vending_product/R in src.product_records) for(var/datum/data/vending_product/R in src.product_records)
if (R.amount <= 0) //Try to use a record that actually has something to dump. if (R.amount <= 0) //Try to use a record that actually has something to dump.
continue continue
var/dump_path = text2path(R.product_path) var/dump_path = R.product_path
if (!dump_path) if (!dump_path)
continue continue
@@ -505,13 +478,10 @@
desc = "" desc = ""
icon = '' icon = ''
icon_state = "" icon_state = ""
product_paths = ""
product_amounts = ""
vend_delay = 15 vend_delay = 15
product_hidden = "" products = list()
product_hideamt = "" contraband = list()
product_slogans = "" premium = list()
product_ads = ""
*/ */
@@ -531,120 +501,119 @@
desc = "A technological marvel, supposedly able to mix just the mixture you'd like to drink the moment you ask for one." desc = "A technological marvel, supposedly able to mix just the mixture you'd like to drink the moment you ask for one."
icon_state = "boozeomat" //////////////18 drink entities below, plus the glasses, in case someone wants to edit the number of bottles icon_state = "boozeomat" //////////////18 drink entities below, plus the glasses, in case someone wants to edit the number of bottles
icon_deny = "boozeomat-deny" icon_deny = "boozeomat-deny"
product_paths = "/obj/item/weapon/reagent_containers/food/drinks/bottle/gin;/obj/item/weapon/reagent_containers/food/drinks/bottle/whiskey;/obj/item/weapon/reagent_containers/food/drinks/bottle/tequilla;/obj/item/weapon/reagent_containers/food/drinks/bottle/vodka;/obj/item/weapon/reagent_containers/food/drinks/bottle/vermouth;/obj/item/weapon/reagent_containers/food/drinks/bottle/rum;/obj/item/weapon/reagent_containers/food/drinks/bottle/wine;/obj/item/weapon/reagent_containers/food/drinks/bottle/cognac;/obj/item/weapon/reagent_containers/food/drinks/bottle/kahlua;/obj/item/weapon/reagent_containers/food/drinks/beer;/obj/item/weapon/reagent_containers/food/drinks/ale;/obj/item/weapon/reagent_containers/food/drinks/bottle/orangejuice;/obj/item/weapon/reagent_containers/food/drinks/bottle/tomatojuice;/obj/item/weapon/reagent_containers/food/drinks/bottle/limejuice;/obj/item/weapon/reagent_containers/food/drinks/bottle/cream;/obj/item/weapon/reagent_containers/food/drinks/tonic;/obj/item/weapon/reagent_containers/food/drinks/cola;/obj/item/weapon/reagent_containers/food/drinks/sodawater;/obj/item/weapon/reagent_containers/food/drinks/drinkingglass;/obj/item/weapon/reagent_containers/food/drinks/ice" products = list(/obj/item/weapon/reagent_containers/food/drinks/bottle/gin = 5,/obj/item/weapon/reagent_containers/food/drinks/bottle/whiskey = 5,
product_amounts = "5;5;5;5;5;5;5;5;5;6;6;4;4;4;4;8;8;15;30;9" /obj/item/weapon/reagent_containers/food/drinks/bottle/tequilla = 5,/obj/item/weapon/reagent_containers/food/drinks/bottle/vodka = 5,
/obj/item/weapon/reagent_containers/food/drinks/bottle/vermouth = 5,/obj/item/weapon/reagent_containers/food/drinks/bottle/rum = 5,
/obj/item/weapon/reagent_containers/food/drinks/bottle/wine = 5,/obj/item/weapon/reagent_containers/food/drinks/bottle/cognac = 5,
/obj/item/weapon/reagent_containers/food/drinks/bottle/kahlua = 5,/obj/item/weapon/reagent_containers/food/drinks/beer = 6,
/obj/item/weapon/reagent_containers/food/drinks/ale = 6,/obj/item/weapon/reagent_containers/food/drinks/bottle/orangejuice = 4,
/obj/item/weapon/reagent_containers/food/drinks/bottle/tomatojuice = 4,/obj/item/weapon/reagent_containers/food/drinks/bottle/limejuice = 4,
/obj/item/weapon/reagent_containers/food/drinks/bottle/cream = 4,/obj/item/weapon/reagent_containers/food/drinks/tonic = 8,
/obj/item/weapon/reagent_containers/food/drinks/cola = 8, /obj/item/weapon/reagent_containers/food/drinks/sodawater = 15,
/obj/item/weapon/reagent_containers/food/drinks/drinkingglass = 30,/obj/item/weapon/reagent_containers/food/drinks/ice = 9)
contraband = list(/obj/item/weapon/reagent_containers/food/drinks/tea = 10)
vend_delay = 15 vend_delay = 15
product_hidden = "/obj/item/weapon/reagent_containers/food/drinks/tea"
product_hideamt = "10"
product_slogans = "I hope nobody asks me for a bloody cup o' tea...;Alcohol is humanity's friend. Would you abandon a friend?;Quite delighted to serve you!;Is nobody thirsty on this station?" product_slogans = "I hope nobody asks me for a bloody cup o' tea...;Alcohol is humanity's friend. Would you abandon a friend?;Quite delighted to serve you!;Is nobody thirsty on this station?"
product_ads = "Drink up!;Booze is good for you!;Alcohol is humanity's best friend.;Quite delighted to serve you!;Care for a nice, cold beer?;Nothing cures you like booze!;Have a sip!;Have a drink!;Have a beer!;Beer is good for you!;Only the finest alcohol!;Best quality booze since 2053!;Award-winning wine!;Maximum alcohol!;Man loves beer.;A toast for progress!" product_ads = "Drink up!;Booze is good for you!;Alcohol is humanity's best friend.;Quite delighted to serve you!;Care for a nice, cold beer?;Nothing cures you like booze!;Have a sip!;Have a drink!;Have a beer!;Beer is good for you!;Only the finest alcohol!;Best quality booze since 2053!;Award-winning wine!;Maximum alcohol!;Man loves beer.;A toast for progress!"
req_access_txt = "25" req_access_txt = "25"
/obj/machinery/vending/assist /obj/machinery/vending/assist
product_amounts = "5;3;4;1;4" products = list( /obj/item/device/assembly/prox_sensor = 5,/obj/item/device/assembly/igniter = 3,/obj/item/device/assembly/signaler = 4,
product_hidden = "/obj/item/device/flashlight;obj/item/device/assembly/timer" /obj/item/weapon/wirecutters = 1, /obj/item/weapon/cartridge/signal = 4)
product_paths = "/obj/item/device/assembly/prox_sensor;/obj/item/device/assembly/igniter;/obj/item/device/assembly/signaler;/obj/item/weapon/wirecutters;/obj/item/weapon/cartridge/signal" contraband = list(/obj/item/device/flashlight = 5,/obj/item/device/assembly/timer = 2)
product_hideamt = "5;2"
product_ads = "Only the finest!;Have some tools.;The most robust equipment.;The finest gear in space!" product_ads = "Only the finest!;Have some tools.;The most robust equipment.;The finest gear in space!"
/obj/machinery/vending/coffee /obj/machinery/vending/coffee
name = "Hot Drinks machine" name = "Hot Drinks machine"
desc = "A vending machine which dispenses hot drinks." desc = "A vending machine which dispenses hot drinks."
product_ads = "Have a drink!;Drink up!;It's good for you!;Would you like a hot joe?;I'd kill for some coffee!;The best beans in the galaxy.;Only the finest brew for you.;Mmmm. Nothing like a coffee.;I like coffee, don't you?;Coffee helps you work!;Try some tea.;We hope you like the best!;Try our new chocolate!;Admin conspiracies"
icon_state = "coffee" icon_state = "coffee"
icon_vend = "coffee-vend" icon_vend = "coffee-vend"
product_paths = "/obj/item/weapon/reagent_containers/food/drinks/coffee;/obj/item/weapon/reagent_containers/food/drinks/tea;/obj/item/weapon/reagent_containers/food/drinks/h_chocolate"
product_amounts = "25;25;25"
vend_delay = 34 vend_delay = 34
product_hidden = "/obj/item/weapon/reagent_containers/food/drinks/ice" products = list(/obj/item/weapon/reagent_containers/food/drinks/coffee = 25,/obj/item/weapon/reagent_containers/food/drinks/tea = 25,/obj/item/weapon/reagent_containers/food/drinks/h_chocolate = 25)
product_ads = "Have a drink!;Drink up!;It's good for you!;Would you like a hot joe?;I'd kill for some coffee!;The best beans in the galaxy.;Only the finest brew for you.;Mmmm. Nothing like a coffee.;I like coffee, don't you?;Coffee helps you work!;Try some tea.;We hope you like the best!;Try our new chocolate!;Admin conspiracies" contraband = list(/obj/item/weapon/reagent_containers/food/drinks/ice = 10)
product_hideamt = "10"
/obj/machinery/vending/snack /obj/machinery/vending/snack
name = "Getmore Chocolate Corp" name = "Getmore Chocolate Corp"
desc = "A snack machine courtesy of the Getmore Chocolate Corporation, based out of Mars" desc = "A snack machine courtesy of the Getmore Chocolate Corporation, based out of Mars"
icon_state = "snack"
product_paths = "/obj/item/weapon/reagent_containers/food/snacks/candy;/obj/item/weapon/reagent_containers/food/drinks/dry_ramen;/obj/item/weapon/reagent_containers/food/snacks/chips;/obj/item/weapon/reagent_containers/food/snacks/sosjerky;/obj/item/weapon/reagent_containers/food/snacks/no_raisin;/obj/item/weapon/reagent_containers/food/snacks/spacetwinkie;/obj/item/weapon/reagent_containers/food/snacks/cheesiehonkers"
product_amounts = "6;6;6;6;6;6;6"
product_slogans = "Try our new nougat bar!;Twice the calories for half the price!" product_slogans = "Try our new nougat bar!;Twice the calories for half the price!"
product_hidden = "/obj/item/weapon/reagent_containers/food/snacks/syndicake"
product_hideamt = "6"
product_ads = "The healthiest!;Award-winning chocolate bars!;Mmm! So good!;Oh my god it's so juicy!;Have a snack.;Snacks are good for you!;Have some more Getmore!;Best quality snacks straight from mars.;We love chocolate!;Try our new jerky!" product_ads = "The healthiest!;Award-winning chocolate bars!;Mmm! So good!;Oh my god it's so juicy!;Have a snack.;Snacks are good for you!;Have some more Getmore!;Best quality snacks straight from mars.;We love chocolate!;Try our new jerky!"
icon_state = "snack"
products = list(/obj/item/weapon/reagent_containers/food/snacks/candy = 6,/obj/item/weapon/reagent_containers/food/drinks/dry_ramen = 6,/obj/item/weapon/reagent_containers/food/snacks/chips =6,
/obj/item/weapon/reagent_containers/food/snacks/sosjerky = 6,/obj/item/weapon/reagent_containers/food/snacks/no_raisin = 6,/obj/item/weapon/reagent_containers/food/snacks/spacetwinkie = 6,
/obj/item/weapon/reagent_containers/food/snacks/cheesiehonkers = 6)
contraband = list(/obj/item/weapon/reagent_containers/food/snacks/syndicake = 6)
/obj/machinery/vending/cola /obj/machinery/vending/cola
name = "Robust Softdrinks" name = "Robust Softdrinks"
desc = "A softdrink vendor provided by Robust Industries, LLC." desc = "A softdrink vendor provided by Robust Industries, LLC."
icon_state = "Cola_Machine" icon_state = "Cola_Machine"
product_paths = "/obj/item/weapon/reagent_containers/food/drinks/cola;/obj/item/weapon/reagent_containers/food/drinks/space_mountain_wind;/obj/item/weapon/reagent_containers/food/drinks/dr_gibb;/obj/item/weapon/reagent_containers/food/drinks/starkist;/obj/item/weapon/reagent_containers/food/drinks/space_up"
product_amounts = "10;10;10;10;10"
product_slogans = "Robust Softdrinks: More robust than a toolbox to the head!" product_slogans = "Robust Softdrinks: More robust than a toolbox to the head!"
product_hidden = "/obj/item/weapon/reagent_containers/food/drinks/thirteenloko"
product_hideamt = "5"
product_ads = "Refreshing!;Hope you're thirsty!;Over 1 million drinks sold!;Thirsty? Why not cola?;Please, have a drink!;Drink up!;The best drinks in space." product_ads = "Refreshing!;Hope you're thirsty!;Over 1 million drinks sold!;Thirsty? Why not cola?;Please, have a drink!;Drink up!;The best drinks in space."
products = list(/obj/item/weapon/reagent_containers/food/drinks/cola = 10,/obj/item/weapon/reagent_containers/food/drinks/space_mountain_wind = 10,
/obj/item/weapon/reagent_containers/food/drinks/dr_gibb = 10,/obj/item/weapon/reagent_containers/food/drinks/starkist = 10,
/obj/item/weapon/reagent_containers/food/drinks/space_up = 10)
contraband = list(/obj/item/weapon/reagent_containers/food/drinks/thirteenloko = 5)
//This one's from bay12 //This one's from bay12
/obj/machinery/vending/cart /obj/machinery/vending/cart
name = "PTech" name = "PTech"
desc = "Cartridges for PDAs" desc = "Cartridges for PDAs"
product_slogans = "Carts to go!"
icon_state = "cart" icon_state = "cart"
icon_deny = "cart-deny" icon_deny = "cart-deny"
product_paths = "/obj/item/weapon/cartridge/medical;/obj/item/weapon/cartridge/engineering;/obj/item/weapon/cartridge/security;/obj/item/weapon/cartridge/janitor;/obj/item/weapon/cartridge/signal/toxins;/obj/item/device/pda/heads;/obj/item/weapon/cartridge/captain;/obj/item/weapon/cartridge/quartermaster" products = list(/obj/item/weapon/cartridge/medical = 10,/obj/item/weapon/cartridge/engineering = 10,/obj/item/weapon/cartridge/security = 10,
product_amounts = "10;10;10;10;10;10;3;10" /obj/item/weapon/cartridge/janitor = 10,/obj/item/weapon/cartridge/signal/toxins = 10,/obj/item/device/pda/heads = 10,
product_slogans = "Carts to go!" /obj/item/weapon/cartridge/captain = 3,/obj/item/weapon/cartridge/quartermaster = 10)
product_hidden = ""
product_hideamt = ""
product_coin = ""
product_coin_amt = ""
/obj/machinery/vending/cigarette /obj/machinery/vending/cigarette
name = "Cigarette machine" //OCD had to be uppercase to look nice with the new formating name = "Cigarette machine" //OCD had to be uppercase to look nice with the new formating
desc = "If you want to get cancer, might as well do it in style" desc = "If you want to get cancer, might as well do it in style"
icon_state = "cigs"
product_paths = "/obj/item/weapon/storage/fancy/cigarettes;/obj/item/weapon/storage/box/matches;/obj/item/weapon/lighter/random"
product_amounts = "10;10;4"
product_slogans = "Space cigs taste good like a cigarette should.;I'd rather toolbox than switch.;Smoke!;Don't believe the reports - smoke today!" product_slogans = "Space cigs taste good like a cigarette should.;I'd rather toolbox than switch.;Smoke!;Don't believe the reports - smoke today!"
vend_delay = 34
product_hidden = "/obj/item/weapon/lighter/zippo"
product_hideamt = "4"
product_coin = "/obj/item/clothing/mask/cigarette/cigar/havana"
product_coin_amt = "2"
product_ads = "Probably not bad for you!;Don't believe the scientists!;It's good for you!;Don't quit, buy more!;Smoke!;Nicotine heaven.;Best cigarettes since 2150.;Award-winning cigs." product_ads = "Probably not bad for you!;Don't believe the scientists!;It's good for you!;Don't quit, buy more!;Smoke!;Nicotine heaven.;Best cigarettes since 2150.;Award-winning cigs."
vend_delay = 34
icon_state = "cigs"
products = list(/obj/item/weapon/storage/fancy/cigarettes = 10,/obj/item/weapon/storage/box/matches = 10,/obj/item/weapon/lighter/random = 4)
contraband = list(/obj/item/weapon/lighter/zippo = 4)
premium = list(/obj/item/clothing/mask/cigarette/cigar/havana = 2)
/obj/machinery/vending/medical /obj/machinery/vending/medical
name = "NanoMed Plus" name = "NanoMed Plus"
desc = "Medical drug dispenser." desc = "Medical drug dispenser."
icon_state = "med" icon_state = "med"
icon_deny = "med-deny" icon_deny = "med-deny"
req_access_txt = "5"
product_paths = "/obj/item/weapon/reagent_containers/glass/bottle/antitoxin;/obj/item/weapon/reagent_containers/glass/bottle/inaprovaline;/obj/item/weapon/reagent_containers/glass/bottle/stoxin;/obj/item/weapon/reagent_containers/glass/bottle/toxin;/obj/item/weapon/reagent_containers/syringe/antiviral;/obj/item/weapon/reagent_containers/syringe;/obj/item/device/healthanalyzer;/obj/item/weapon/reagent_containers/glass/beaker;/obj/item/weapon/reagent_containers/dropper"
product_amounts = "4;4;4;4;4;12;5;4;2"
product_hidden = "/obj/item/weapon/reagent_containers/pill/tox;/obj/item/weapon/reagent_containers/pill/stox;/obj/item/weapon/reagent_containers/pill/antitox"
product_hideamt = "3;4;6"
product_ads = "Go save some lives!;The best stuff for your medbay.;Only the finest tools.;Natural chemicals!;This stuff saves lives.;Don't you want some?;Ping!" product_ads = "Go save some lives!;The best stuff for your medbay.;Only the finest tools.;Natural chemicals!;This stuff saves lives.;Don't you want some?;Ping!"
req_access_txt = "5"
products = list(/obj/item/weapon/reagent_containers/glass/bottle/antitoxin = 4,/obj/item/weapon/reagent_containers/glass/bottle/inaprovaline = 4,
/obj/item/weapon/reagent_containers/glass/bottle/stoxin = 4,/obj/item/weapon/reagent_containers/glass/bottle/toxin = 4,
/obj/item/weapon/reagent_containers/syringe/antiviral = 4,/obj/item/weapon/reagent_containers/syringe = 12,
/obj/item/device/healthanalyzer = 5,/obj/item/weapon/reagent_containers/glass/beaker = 4, /obj/item/weapon/reagent_containers/dropper = 2)
contraband = list(/obj/item/weapon/reagent_containers/pill/tox = 3,/obj/item/weapon/reagent_containers/pill/stox = 4,/obj/item/weapon/reagent_containers/pill/antitox = 6)
//This one's from bay12 //This one's from bay12
/obj/machinery/vending/plasmaresearch /obj/machinery/vending/plasmaresearch
name = "Toximate 3000" name = "Toximate 3000"
desc = "All the fine parts you need in one vending machine!" desc = "All the fine parts you need in one vending machine!"
product_paths = "/obj/item/clothing/under/rank/scientist;/obj/item/clothing/suit/bio_suit;/obj/item/clothing/head/bio_hood;/obj/item/device/transfer_valve;/obj/item/device/assembly/signaler;/obj/item/device/assembly/prox_sensor;/obj/item/device/assembly/igniter;/obj/item/device/assembly/timer" products = list(/obj/item/clothing/under/rank/scientist = 6,/obj/item/clothing/suit/bio_suit = 6,/obj/item/clothing/head/bio_hood = 6,
product_amounts = "6;6;6;6;6" /obj/item/device/transfer_valve = 6,/obj/item/device/assembly/timer = 6,/obj/item/device/assembly/signaler = 6,
product_hidden = "" /obj/item/device/assembly/prox_sensor = 6,/obj/item/device/assembly/igniter = 6)
product_hideamt = ""
product_coin = ""
product_coin_amt = ""
/obj/machinery/vending/wallmed1 /obj/machinery/vending/wallmed1
name = "NanoMed" name = "NanoMed"
desc = "Wall-mounted Medical Equipment dispenser." desc = "Wall-mounted Medical Equipment dispenser."
product_ads = "Go save some lives!;The best stuff for your medbay.;Only the finest tools.;Natural chemicals!;This stuff saves lives.;Don't you want some?"
icon_state = "wallmed" icon_state = "wallmed"
icon_deny = "wallmed-deny" icon_deny = "wallmed-deny"
req_access_txt = "5" req_access_txt = "5"
product_paths = "/obj/item/stack/medical/bruise_pack;/obj/item/stack/medical/ointment;/obj/item/weapon/reagent_containers/syringe/inaprovaline;/obj/item/device/healthanalyzer"
product_amounts = "2;2;4;1"
product_hidden = "/obj/item/weapon/reagent_containers/syringe/antitoxin;/obj/item/weapon/reagent_containers/syringe/antiviral;/obj/item/weapon/reagent_containers/pill/tox"
product_hideamt = "4;4;1"
density = 0 //It is wall-mounted, and thus, not dense. --Superxpdude density = 0 //It is wall-mounted, and thus, not dense. --Superxpdude
product_ads = "Go save some lives!;The best stuff for your medbay.;Only the finest tools.;Natural chemicals!;This stuff saves lives.;Don't you want some?" products = list(/obj/item/stack/medical/bruise_pack = 2,/obj/item/stack/medical/ointment = 2,/obj/item/weapon/reagent_containers/syringe/inaprovaline = 4,/obj/item/device/healthanalyzer = 1)
contraband = list(/obj/item/weapon/reagent_containers/syringe/antitoxin = 4,/obj/item/weapon/reagent_containers/syringe/antiviral = 4,/obj/item/weapon/reagent_containers/pill/tox = 1)
/obj/machinery/vending/wallmed2 /obj/machinery/vending/wallmed2
name = "NanoMed" name = "NanoMed"
@@ -652,84 +621,76 @@
icon_state = "wallmed" icon_state = "wallmed"
icon_deny = "wallmed-deny" icon_deny = "wallmed-deny"
req_access_txt = "5" req_access_txt = "5"
product_paths = "/obj/item/weapon/reagent_containers/syringe/inaprovaline;/obj/item/weapon/reagent_containers/syringe/antitoxin;/obj/item/stack/medical/bruise_pack;/obj/item/stack/medical/ointment;/obj/item/device/healthanalyzer"
product_amounts = "5;3;3;3;3"
product_hidden = "/obj/item/weapon/reagent_containers/pill/tox"
product_hideamt = "3"
density = 0 //It is wall-mounted, and thus, not dense. --Superxpdude density = 0 //It is wall-mounted, and thus, not dense. --Superxpdude
products = list(/obj/item/weapon/reagent_containers/syringe/inaprovaline = 5,/obj/item/weapon/reagent_containers/syringe/antitoxin = 3,/obj/item/stack/medical/bruise_pack = 3,
/obj/item/stack/medical/ointment =3,/obj/item/device/healthanalyzer = 3)
contraband = list(/obj/item/weapon/reagent_containers/pill/tox = 3)
/obj/machinery/vending/security /obj/machinery/vending/security
name = "SecTech" name = "SecTech"
desc = "A security equipment vendor" desc = "A security equipment vendor"
product_ads = "Crack capitalist skulls!;Beat some heads in!;Don't forget - harm is good!;Your weapons are right here.;Handcuffs!;Freeze, scumbag!;Don't tase me bro!;Tase them, bro.;Why not have a donut?"
icon_state = "sec" icon_state = "sec"
icon_deny = "sec-deny" icon_deny = "sec-deny"
req_access_txt = "1" req_access_txt = "1"
product_paths = "/obj/item/weapon/handcuffs;/obj/item/weapon/grenade/flashbang;/obj/item/device/flash;/obj/item/weapon/reagent_containers/food/snacks/donut/normal;/obj/item/weapon/storage/box/evidence" products = list(/obj/item/weapon/handcuffs = 8,/obj/item/weapon/grenade/flashbang = 4,/obj/item/device/flash = 5,
product_amounts = "8;4;5;12;6" /obj/item/weapon/reagent_containers/food/snacks/donut/normal = 12,/obj/item/weapon/storage/box/evidence = 6)
product_hidden = "/obj/item/clothing/glasses/sunglasses;/obj/item/weapon/storage/fancy/donut_box" contraband = list(/obj/item/clothing/glasses/sunglasses = 2,/obj/item/weapon/storage/fancy/donut_box = 2)
product_hideamt = "2;2"
product_ads = "Crack capitalist skulls!;Beat some heads in!;Don't forget - harm is good!;Your weapons are right here.;Handcuffs!;Freeze, scumbag!;Don't tase me bro!;Tase them, bro.;Why not have a donut?"
/obj/machinery/vending/hydronutrients /obj/machinery/vending/hydronutrients
name = "NutriMax" name = "NutriMax"
desc = "A plant nutrients vendor" desc = "A plant nutrients vendor"
product_slogans = "Aren't you glad you don't have to fertilize the natural way?;Now with 50% less stink!;Plants are people too!"
product_ads = "We like plants!;Don't you want some?;The greenest thumbs ever.;We like big plants.;Soft soil..."
icon_state = "nutri" icon_state = "nutri"
icon_deny = "nutri-deny" icon_deny = "nutri-deny"
product_paths = "/obj/item/nutrient/ez;/obj/item/nutrient/l4z;/obj/item/nutrient/rh;/obj/item/weapon/pestspray;/obj/item/weapon/reagent_containers/syringe;/obj/item/weapon/storage/bag/plants" products = list(/obj/item/nutrient/ez = 35,/obj/item/nutrient/l4z = 25,/obj/item/nutrient/rh = 15,/obj/item/weapon/pestspray = 20,
product_amounts = "35;25;15;20;5;5" /obj/item/weapon/reagent_containers/syringe = 5,/obj/item/weapon/storage/bag/plants = 5)
product_slogans = "Aren't you glad you don't have to fertilize the natural way?;Now with 50% less stink!;Plants are people too!" contraband = list(/obj/item/weapon/reagent_containers/glass/bottle/ammonia = 10,/obj/item/weapon/reagent_containers/glass/bottle/diethylamine = 5)
product_hidden = "/obj/item/weapon/reagent_containers/glass/bottle/ammonia;/obj/item/weapon/reagent_containers/glass/bottle/diethylamine"
product_hideamt = "10;5"
product_ads = "We like plants!;Don't you want some?;The greenest thumbs ever.;We like big plants.;Soft soil..."
/obj/machinery/vending/hydroseeds /obj/machinery/vending/hydroseeds
name = "MegaSeed Servitor" name = "MegaSeed Servitor"
desc = "When you need seeds fast!" desc = "When you need seeds fast!"
icon_state = "seeds"
product_paths = "/obj/item/seeds/bananaseed;/obj/item/seeds/berryseed;/obj/item/seeds/carrotseed;/obj/item/seeds/chantermycelium;/obj/item/seeds/chiliseed;/obj/item/seeds/cornseed;/obj/item/seeds/eggplantseed;/obj/item/seeds/potatoseed;/obj/item/seeds/replicapod;/obj/item/seeds/soyaseed;/obj/item/seeds/sunflowerseed;/obj/item/seeds/tomatoseed;/obj/item/seeds/towermycelium;/obj/item/seeds/wheatseed;/obj/item/seeds/appleseed;/obj/item/seeds/poppyseed;/obj/item/seeds/ambrosiavulgarisseed;/obj/item/seeds/whitebeetseed;/obj/item/seeds/watermelonseed;/obj/item/seeds/limeseed;/obj/item/seeds/lemonseed;/obj/item/seeds/orangeseed;/obj/item/seeds/grassseed;/obj/item/seeds/cocoapodseed;/obj/item/seeds/cabbageseed;/obj/item/seeds/grapeseed;/obj/item/seeds/pumpkinseed;/obj/item/seeds/cherryseed"
product_amounts = "3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3;3"
product_slogans = "THIS'S WHERE TH' SEEDS LIVE! GIT YOU SOME!;Hands down the best seed selection on the station!;Also certain mushroom varieties available, more for experts! Get certified today!" product_slogans = "THIS'S WHERE TH' SEEDS LIVE! GIT YOU SOME!;Hands down the best seed selection on the station!;Also certain mushroom varieties available, more for experts! Get certified today!"
product_hidden = "/obj/item/seeds/amanitamycelium;/obj/item/seeds/glowshroom;/obj/item/seeds/libertymycelium;/obj/item/seeds/nettleseed;/obj/item/seeds/plumpmycelium;/obj/item/seeds/reishimycelium"
product_hideamt = "2;2;2;2;2;2"
product_coin = "/obj/item/toy/waterflower"
product_coin_amt = "1"
product_ads = "We like plants!;Grow some crops!;Grow, baby, growww!;Aw h'yeah son!" product_ads = "We like plants!;Grow some crops!;Grow, baby, growww!;Aw h'yeah son!"
icon_state = "seeds"
products = list(/obj/item/seeds/bananaseed = 3,/obj/item/seeds/berryseed = 3,/obj/item/seeds/carrotseed = 3,/obj/item/seeds/chantermycelium = 3,/obj/item/seeds/chiliseed = 3,
/obj/item/seeds/cornseed = 3, /obj/item/seeds/eggplantseed = 3, /obj/item/seeds/potatoseed = 3, /obj/item/seeds/replicapod = 3,/obj/item/seeds/soyaseed = 3,
/obj/item/seeds/sunflowerseed = 3,/obj/item/seeds/tomatoseed = 3,/obj/item/seeds/towermycelium = 3,/obj/item/seeds/wheatseed = 3,/obj/item/seeds/appleseed = 3,
/obj/item/seeds/poppyseed = 3,/obj/item/seeds/ambrosiavulgarisseed = 3,/obj/item/seeds/whitebeetseed = 3,/obj/item/seeds/watermelonseed = 3,/obj/item/seeds/limeseed = 3,
/obj/item/seeds/lemonseed = 3,/obj/item/seeds/orangeseed = 3,/obj/item/seeds/grassseed = 3,/obj/item/seeds/cocoapodseed = 3,
/obj/item/seeds/cabbageseed = 3,/obj/item/seeds/grapeseed = 3,/obj/item/seeds/pumpkinseed = 3,/obj/item/seeds/cherryseed = 3)
contraband = list(/obj/item/seeds/amanitamycelium = 2,/obj/item/seeds/glowshroom = 2,/obj/item/seeds/libertymycelium = 2,/obj/item/seeds/nettleseed = 2,
/obj/item/seeds/plumpmycelium = 2,/obj/item/seeds/reishimycelium = 2)
premium = list(/obj/item/toy/waterflower = 1)
/obj/machinery/vending/magivend /obj/machinery/vending/magivend
name = "MagiVend" name = "MagiVend"
desc = "A magic vending machine." desc = "A magic vending machine."
icon_state = "MagiVend" icon_state = "MagiVend"
product_amounts = "1;1;1;1;1;2"
product_slogans = "Sling spells the proper way with MagiVend!;Be your own Houdini! Use MagiVend!" product_slogans = "Sling spells the proper way with MagiVend!;Be your own Houdini! Use MagiVend!"
product_paths = "/obj/item/clothing/head/wizard;/obj/item/clothing/suit/wizrobe;/obj/item/clothing/head/wizard/red;/obj/item/clothing/suit/wizrobe/red;/obj/item/clothing/shoes/sandal;/obj/item/weapon/staff"
vend_delay = 15 vend_delay = 15
vend_reply = "Have an enchanted evening!" vend_reply = "Have an enchanted evening!"
product_hidden = "/obj/item/weapon/reagent_containers/glass/bottle/wizarditis" //No one can get to the machine to hack it anyways
product_hideamt = "1" //Just one, for the lulz, not like anyone can get it - Microwave
product_ads = "FJKLFJSD;AJKFLBJAKL;1234 LOONIES LOL!;>MFW;Kill them fuckers!;GET DAT FUKKEN DISK;HONK!;EI NATH;Destroy the station!;Admin conspiracies since forever!;Space-time bending hardware!" product_ads = "FJKLFJSD;AJKFLBJAKL;1234 LOONIES LOL!;>MFW;Kill them fuckers!;GET DAT FUKKEN DISK;HONK!;EI NATH;Destroy the station!;Admin conspiracies since forever!;Space-time bending hardware!"
products = list(/obj/item/clothing/head/wizard = 1,/obj/item/clothing/suit/wizrobe = 1,/obj/item/clothing/head/wizard/red = 1,/obj/item/clothing/suit/wizrobe/red = 1,/obj/item/clothing/shoes/sandal = 1,/obj/item/weapon/staff = 2)
contraband = list(/obj/item/weapon/reagent_containers/glass/bottle/wizarditis = 1) //No one can get to the machine to hack it anyways; for the lulz - Microwave
/obj/machinery/vending/dinnerware /obj/machinery/vending/dinnerware
name = "Dinnerware" name = "Dinnerware"
desc = "A kitchen and restaurant equipment vendor" desc = "A kitchen and restaurant equipment vendor"
icon_state = "dinnerware"
product_paths = "/obj/item/weapon/tray;/obj/item/weapon/kitchen/utensil/fork;/obj/item/weapon/kitchenknife;/obj/item/weapon/reagent_containers/food/drinks/drinkingglass;/obj/item/clothing/suit/chef/classic"
product_amounts = "8;6;3;8;2"
//product_amounts = "8;5;4" Old totals
product_hidden = "/obj/item/weapon/kitchen/utensil/spoon;/obj/item/weapon/kitchen/utensil/knife;/obj/item/weapon/kitchen/rollingpin;/obj/item/weapon/butch"
product_hideamt = "2;2;2;2"
product_ads = "Mm, food stuffs!;Food and food accessories.;Get your plates!;You like forks?;I like forks.;Woo, utensils.;You don't really need these..." product_ads = "Mm, food stuffs!;Food and food accessories.;Get your plates!;You like forks?;I like forks.;Woo, utensils.;You don't really need these..."
icon_state = "dinnerware"
products = list(/obj/item/weapon/tray = 8,/obj/item/weapon/kitchen/utensil/fork = 6,/obj/item/weapon/kitchenknife = 3,/obj/item/weapon/reagent_containers/food/drinks/drinkingglass = 8,/obj/item/clothing/suit/chef/classic = 2)
contraband = list(/obj/item/weapon/kitchen/utensil/spoon = 2,/obj/item/weapon/kitchen/utensil/knife = 2,/obj/item/weapon/kitchen/rollingpin = 2, /obj/item/weapon/butch = 2)
/obj/machinery/vending/sovietsoda /obj/machinery/vending/sovietsoda
name = "BODA" name = "BODA"
desc = "Old sweet water vending machine" desc = "Old sweet water vending machine"
icon_state = "sovietsoda" icon_state = "sovietsoda"
product_paths = "/obj/item/weapon/reagent_containers/food/drinks/drinkingglass/soda"
product_amounts = "30"
//product_amounts = "8;5;4" Old totals
product_hidden = "/obj/item/weapon/reagent_containers/food/drinks/drinkingglass/cola"
product_hideamt = "20"
product_ads = "For Tsar and Country.;Have you fulfilled your nutrition quota today?;Very nice!;We are simple people, for this is all we eat.;If there is a person, there is a problem. If there is no person, then there is no problem." product_ads = "For Tsar and Country.;Have you fulfilled your nutrition quota today?;Very nice!;We are simple people, for this is all we eat.;If there is a person, there is a problem. If there is no person, then there is no problem."
products = list(/obj/item/weapon/reagent_containers/food/drinks/drinkingglass/soda = 30)
contraband = list(/obj/item/weapon/reagent_containers/food/drinks/drinkingglass/cola = 20)
/obj/machinery/vending/tool /obj/machinery/vending/tool
name = "YouTool" name = "YouTool"
@@ -737,12 +698,10 @@
icon_state = "tool" icon_state = "tool"
icon_deny = "tool-deny" icon_deny = "tool-deny"
//req_access_txt = "12" //Maintenance access //req_access_txt = "12" //Maintenance access
product_paths = "/obj/item/weapon/cable_coil/random;/obj/item/weapon/crowbar;/obj/item/weapon/weldingtool;/obj/item/weapon/wirecutters;/obj/item/weapon/wrench;/obj/item/device/analyzer;/obj/item/device/t_scanner;/obj/item/weapon/screwdriver" products = list(/obj/item/weapon/cable_coil/random = 10,/obj/item/weapon/crowbar = 5,/obj/item/weapon/weldingtool = 3,/obj/item/weapon/wirecutters = 5,
product_amounts = "10;5;3;5;5;5;5;5" /obj/item/weapon/wrench = 5,/obj/item/device/analyzer = 5,/obj/item/device/t_scanner = 5,/obj/item/weapon/screwdriver = 5)
product_hidden = "/obj/item/weapon/weldingtool/hugeetank;/obj/item/clothing/gloves/fyellow" contraband = list(/obj/item/weapon/weldingtool/hugetank = 2,/obj/item/clothing/gloves/fyellow = 2)
product_hideamt = "2;2" premium = list(/obj/item/clothing/gloves/yellow = 1)
product_coin = "/obj/item/clothing/gloves/yellow"
product_coin_amt = "1"
/obj/machinery/vending/engivend /obj/machinery/vending/engivend
name = "Engi-Vend" name = "Engi-Vend"
@@ -750,12 +709,9 @@
icon_state = "engivend" icon_state = "engivend"
icon_deny = "engivend-deny" icon_deny = "engivend-deny"
req_access_txt = "11" //Engineering Equipment access req_access_txt = "11" //Engineering Equipment access
product_paths = "/obj/item/clothing/glasses/meson;/obj/item/device/multitool;/obj/item/weapon/airlock_electronics;/obj/item/weapon/module/power_control;/obj/item/weapon/cell/high" products = list(/obj/item/clothing/glasses/meson = 2,/obj/item/device/multitool = 4,/obj/item/weapon/airlock_electronics = 10,/obj/item/weapon/module/power_control = 10,/obj/item/weapon/airalarm_electronics = 10,/obj/item/weapon/cell/high = 10)
product_amounts = "2;4;10;10;10" contraband = list(/obj/item/weapon/cell/potato = 3)
product_hidden = "/obj/item/weapon/cell/potato" premium = list(/obj/item/weapon/storage/belt/utility = 3)
product_hideamt = "3"
product_coin = "/obj/item/weapon/storage/belt/utility"
product_coin_amt = "3"
//This one's from bay12 //This one's from bay12
/obj/machinery/vending/engineering /obj/machinery/vending/engineering
@@ -764,12 +720,15 @@
icon_state = "engi" icon_state = "engi"
icon_deny = "engi-deny" icon_deny = "engi-deny"
req_access_txt = "11" req_access_txt = "11"
product_paths = "/obj/item/clothing/under/rank/chief_engineer;/obj/item/clothing/under/rank/engineer;/obj/item/clothing/shoes/orange;/obj/item/clothing/head/helmet/hardhat;/obj/item/weapon/storage/belt/utility;/obj/item/clothing/glasses/meson;/obj/item/clothing/gloves/yellow;/obj/item/weapon/screwdriver;/obj/item/weapon/crowbar;/obj/item/weapon/wirecutters;/obj/item/device/multitool;/obj/item/weapon/wrench;/obj/item/device/t_scanner;/obj/item/weapon/CableCoil/power;/obj/item/weapon/circuitry;/obj/item/weapon/cell;/obj/item/weapon/weldingtool;/obj/item/clothing/head/helmet/welding;/obj/item/weapon/light/tube;/obj/item/clothing/suit/fire;/obj/item/weapon/stock_parts/scanning_module;/obj/item/weapon/stock_parts/micro_laser;/obj/item/weapon/stock_parts/matter_bin;/obj/item/weapon/stock_parts/manipulator;/obj/item/weapon/stock_parts/console_screen" products = list(/obj/item/clothing/under/rank/chief_engineer = 4,/obj/item/clothing/under/rank/engineer = 4,/obj/item/clothing/shoes/orange = 4,/obj/item/clothing/head/hardhat = 4,
// product_amounts = "4;4;4;4;4;4;4;12;12;12;12;12;12;8;4;8;8;8;10;4" /obj/item/weapon/storage/belt/utility = 4,/obj/item/clothing/glasses/meson = 4,/obj/item/clothing/gloves/yellow = 4, /obj/item/weapon/screwdriver = 12,
product_hidden = "" /obj/item/weapon/crowbar = 12,/obj/item/weapon/wirecutters = 12,/obj/item/device/multitool = 12,/obj/item/weapon/wrench = 12,/obj/item/device/t_scanner = 12,
product_hideamt = "" /obj/item/weapon/cable_coil/heavyduty = 8, /obj/item/weapon/cell = 8, /obj/item/weapon/weldingtool = 8,/obj/item/clothing/head/welding = 8,
product_coin = "" /obj/item/weapon/light/tube = 10,/obj/item/clothing/suit/fire = 4, /obj/item/weapon/stock_parts/scanning_module = 5,/obj/item/weapon/stock_parts/micro_laser = 5,
product_coin_amt = "" /obj/item/weapon/stock_parts/matter_bin = 5,/obj/item/weapon/stock_parts/manipulator = 5,/obj/item/weapon/stock_parts/console_screen = 5)
// There was an incorrect entry (cablecoil/power). I improvised to cablecoil/heavyduty.
// Another invalid entry, /obj/item/weapon/circuitry. I don't even know what that would translate to, removed it.
// The original products list wasn't finished. The ones without given quantities became quantity 5. -Sayu
//This one's from bay12 //This one's from bay12
/obj/machinery/vending/robotics /obj/machinery/vending/robotics
@@ -778,9 +737,9 @@
icon_state = "robotics" icon_state = "robotics"
icon_deny = "robotics-deny" icon_deny = "robotics-deny"
req_access_txt = "29" req_access_txt = "29"
product_paths = "/obj/item/clothing/suit/storage/labcoat;/obj/item/clothing/under/rank/roboticist;/obj/item/weapon/cable_coil;/obj/item/device/flash;/obj/item/weapon/cell/high;/obj/item/device/assembly/prox_sensor;/obj/item/device/assembly/signaler;/obj/item/device/healthanalyzer;/obj/item/weapon/scalpel;/obj/item/weapon/circular_saw;/obj/item/weapon/tank/anesthetic;/obj/item/clothing/mask/medical;/obj/item/weapon/screwdriver;/obj/item/weapon/crowbar" products = list(/obj/item/clothing/suit/storage/labcoat = 4,/obj/item/clothing/under/rank/roboticist = 4,/obj/item/weapon/cable_coil = 4,/obj/item/device/flash = 4,
product_amounts = "4;4;4;4;12" /obj/item/weapon/cell/high = 12, /obj/item/device/assembly/prox_sensor = 3,/obj/item/device/assembly/signaler = 3,/obj/item/device/healthanalyzer = 3,
product_hidden = "" /obj/item/weapon/scalpel = 2,/obj/item/weapon/circular_saw = 2,/obj/item/weapon/tank/anesthetic = 2,/obj/item/clothing/mask/breath/medical = 5,
product_hideamt = "" /obj/item/weapon/screwdriver = 5,/obj/item/weapon/crowbar = 5)
product_coin = "" //everything after the power cell had no amounts, I improvised. -Sayu
product_coin_amt = ""

View File

@@ -193,9 +193,9 @@
return 0 return 0
var/to_inject = min(R.volume, inject_amount) var/to_inject = min(R.volume, inject_amount)
if(to_inject && occupant.reagents.get_reagent_amount(R.id) + to_inject <= inject_amount*2) if(to_inject && occupant.reagents.get_reagent_amount(R.id) + to_inject <= inject_amount*2)
occupant_message("Injecting [occupant] with [to_inject] units of [R.name].")
log_message("Injecting [occupant] with [to_inject] units of [R.name].")
SG.reagents.trans_id_to(occupant,R.id,to_inject) SG.reagents.trans_id_to(occupant,R.id,to_inject)
occupant_message("[occupant] injected with [to_inject] units of [R.name].")
log_message("[occupant] injected with [to_inject] units of [R.name].")
update_equip_info() update_equip_info()
return return

View File

@@ -27,7 +27,7 @@
set_ready_state(0) set_ready_state(0)
playsound(chassis, fire_sound, 50, 1) playsound(chassis, fire_sound, 50, 1)
var/obj/item/projectile/A = new projectile(curloc) var/obj/item/projectile/A = new projectile(curloc)
A.original = targloc A.original = target
A.current = curloc A.current = curloc
A.yo = targloc.y - curloc.y A.yo = targloc.y - curloc.y
A.xo = targloc.x - curloc.x A.xo = targloc.x - curloc.x
@@ -209,7 +209,7 @@
playsound(chassis, fire_sound, 80, 1) playsound(chassis, fire_sound, 80, 1)
var/obj/item/projectile/A = new projectile(curloc) var/obj/item/projectile/A = new projectile(curloc)
src.projectiles-- src.projectiles--
A.original = targloc A.original = target
A.current = curloc A.current = curloc
A.yo = targloc.y - curloc.y A.yo = targloc.y - curloc.y
A.xo = targloc.x - curloc.x A.xo = targloc.x - curloc.x
@@ -251,7 +251,7 @@
playsound(chassis, fire_sound, 50, 1) playsound(chassis, fire_sound, 50, 1)
var/obj/item/projectile/A = new projectile(curloc) var/obj/item/projectile/A = new projectile(curloc)
src.projectiles-- src.projectiles--
A.original = targloc A.original = target
A.current = curloc A.current = curloc
A.yo = targloc.y - curloc.y A.yo = targloc.y - curloc.y
A.xo = targloc.x - curloc.x A.xo = targloc.x - curloc.x

View File

@@ -421,7 +421,7 @@
call(/obj/item/clothing/gloves/space_ninja/proc/drain)("MECHA",src,user:wear_suit) call(/obj/item/clothing/gloves/space_ninja/proc/drain)("MECHA",src,user:wear_suit)
return return
if ( ((HULK in user.mutations) || (SUPRSTR in user.augmentations)) && !prob(src.deflect_chance)) if ((HULK in user.mutations) && !prob(src.deflect_chance))
src.take_damage(15) src.take_damage(15)
src.check_for_internal_damage(list(MECHA_INT_TEMP_CONTROL,MECHA_INT_TANK_BREACH,MECHA_INT_CONTROL_LOST)) src.check_for_internal_damage(list(MECHA_INT_TEMP_CONTROL,MECHA_INT_TANK_BREACH,MECHA_INT_CONTROL_LOST))
user.visible_message("<font color='red'><b>[user] hits [src.name], doing some damage.</b></font>", "<font color='red'><b>You hit [src.name] with all your might. The metal creaks and bends.</b></font>") user.visible_message("<font color='red'><b>[user] hits [src.name], doing some damage.</b></font>", "<font color='red'><b>You hit [src.name] with all your might. The metal creaks and bends.</b></font>")

View File

@@ -402,6 +402,7 @@
icon = 'icons/obj/module.dmi' icon = 'icons/obj/module.dmi'
icon_state = "std_mod" icon_state = "std_mod"
item_state = "electronic" item_state = "electronic"
board_type = "other"
flags = FPRINT | TABLEPASS | CONDUCT flags = FPRINT | TABLEPASS | CONDUCT
force = 5.0 force = 5.0
w_class = 2.0 w_class = 2.0

View File

@@ -105,7 +105,7 @@
return return
/obj/effect/alien/resin/attack_hand() /obj/effect/alien/resin/attack_hand()
if ((HULK in usr.mutations) || (SUPRSTR in usr.augmentations)) if (HULK in usr.mutations)
usr << "\blue You easily destroy the [name]." usr << "\blue You easily destroy the [name]."
for(var/mob/O in oviewers(src)) for(var/mob/O in oviewers(src))
O.show_message("\red [usr] destroys the [name]!", 1) O.show_message("\red [usr] destroys the [name]!", 1)
@@ -414,8 +414,8 @@ Alien plants should do something if theres a lot of poison
return return
proc/Burst(var/kill = 1) //drops and kills the hugger if any is remaining proc/Burst(var/kill = 1) //drops and kills the hugger if any is remaining
if(status == GROWN || status == GROWING)
var/obj/item/clothing/mask/facehugger/child = GetFacehugger() var/obj/item/clothing/mask/facehugger/child = GetFacehugger()
icon_state = "egg_hatched" icon_state = "egg_hatched"
flick("egg_opening", src) flick("egg_opening", src)
status = BURSTING status = BURSTING
@@ -430,8 +430,6 @@ Alien plants should do something if theres a lot of poison
child.Attach(M) child.Attach(M)
break break
return
/obj/effect/alien/egg/bullet_act(var/obj/item/projectile/Proj) /obj/effect/alien/egg/bullet_act(var/obj/item/projectile/Proj)
health -= Proj.damage health -= Proj.damage

View File

@@ -1,3 +1,4 @@
/*
/obj/effect/biomass /obj/effect/biomass
icon = 'icons/obj/biomass.dmi' icon = 'icons/obj/biomass.dmi'
icon_state = "stage1" icon_state = "stage1"
@@ -122,3 +123,4 @@
if(location.density) if(location.density)
return 0 return 0
return 1 return 1
*/

View File

@@ -67,7 +67,7 @@
obj/structure/sign/poster obj/structure/sign/poster
name = "poster" name = "poster"
desc = "A large piece of space-resistant printed paper. It's considered contraband." desc = "A large piece of space-resistant printed paper. "
icon = 'icons/obj/contraband.dmi' icon = 'icons/obj/contraband.dmi'
anchored = 1 anchored = 1
var/serial_number //Will hold the value of src.loc if nobody initialises it var/serial_number //Will hold the value of src.loc if nobody initialises it

View File

@@ -985,7 +985,7 @@ steam.start() -- spawns the effect
return return
attack_hand(var/mob/user) attack_hand(var/mob/user)
if ((HULK in user.mutations) || (prob(75 - metal*25)) || (SUPRSTR in user.augmentations)) if ((HULK in user.mutations) || (prob(75 - metal*25)))
user << "\blue You smash through the metal foam wall." user << "\blue You smash through the metal foam wall."
for(var/mob/O in oviewers(user)) for(var/mob/O in oviewers(user))
if ((O.client && !( O.blinded ))) if ((O.client && !( O.blinded )))

View File

@@ -0,0 +1,199 @@
//generic procs copied from obj/effect/alien
/obj/effect/spider
name = "web"
desc = "it's stringy and sticky"
icon = 'icons/effects/effects.dmi'
anchored = 1
density = 0
var/health = 15
//similar to weeds, but only barfed out by nurses manually
/obj/effect/spider/ex_act(severity)
switch(severity)
if(1.0)
del(src)
if(2.0)
if (prob(50))
del(src)
if(3.0)
if (prob(5))
del(src)
return
/obj/effect/spider/attackby(var/obj/item/weapon/W, var/mob/user)
if(W.attack_verb.len)
visible_message("\red <B>\The [src] have been [pick(W.attack_verb)] with \the [W][(user ? " by [user]." : ".")]")
else
visible_message("\red <B>\The [src] have been attacked with \the [W][(user ? " by [user]." : ".")]")
var/damage = W.force / 4.0
if(istype(W, /obj/item/weapon/weldingtool))
var/obj/item/weapon/weldingtool/WT = W
if(WT.remove_fuel(0, user))
damage = 15
playsound(loc, 'sound/items/Welder.ogg', 100, 1)
health -= damage
healthcheck()
/obj/effect/spider/bullet_act(var/obj/item/projectile/Proj)
..()
health -= Proj.damage
healthcheck()
/obj/effect/spider/proc/healthcheck()
if(health <= 0)
del(src)
/obj/effect/spider/temperature_expose(datum/gas_mixture/air, exposed_temperature, exposed_volume)
if(exposed_temperature > 300)
health -= 5
healthcheck()
/obj/effect/spider/stickyweb
icon_state = "stickyweb1"
New()
if(prob(50))
icon_state = "stickyweb2"
/obj/effect/spider/stickyweb/CanPass(atom/movable/mover, turf/target, height=0, air_group=0)
if(air_group || (height==0)) return 1
if(istype(mover, /mob/living/simple_animal/hostile/giant_spider))
return 1
else if(istype(mover, /mob/living))
if(prob(50))
mover << "\red You get stuck in \the [src] for a moment."
return 0
else if(istype(mover, /obj/item/projectile))
return prob(30)
return 1
/obj/effect/spider/eggcluster
name = "egg cluster"
desc = "They seem to pulse slightly with an inner life"
icon_state = "eggs"
var/amount_grown = 0
New()
pixel_x = rand(3,-3)
pixel_y = rand(3,-3)
processing_objects.Add(src)
/obj/effect/spider/eggcluster/process()
amount_grown += rand(0,2)
if(amount_grown >= 100)
var/num = rand(3,12)
for(var/i=0, i<num, i++)
new /obj/effect/spider/spiderling(src.loc)
del(src)
/obj/effect/spider/spiderling
name = "spiderling"
desc = "It never stays still for long."
icon_state = "spiderling"
anchored = 0
layer = 2.7
health = 3
var/amount_grown = 0
var/obj/machinery/atmospherics/unary/vent_pump/entry_vent
var/travelling_in_vent = 0
New()
pixel_x = rand(6,-6)
pixel_y = rand(6,-6)
processing_objects.Add(src)
/obj/effect/spider/spiderling/Bump(atom/user)
if(istype(user, /obj/structure/table))
src.loc = user.loc
else
..()
/obj/effect/spider/spiderling/proc/die()
visible_message("<span class='alert'>[src] dies!</span>")
del(src)
/obj/effect/spider/spiderling/healthcheck()
if(health <= 0)
die()
/obj/effect/spider/spiderling/process()
if(travelling_in_vent)
if(istype(src.loc, /turf))
travelling_in_vent = 0
entry_vent = null
else if(entry_vent)
if(get_dist(src, entry_vent) <= 1)
if(entry_vent.network && entry_vent.network.normal_members.len)
var/list/vents = list()
for(var/obj/machinery/atmospherics/unary/vent_pump/temp_vent in entry_vent.network.normal_members)
vents.Add(temp_vent)
if(!vents.len)
entry_vent = null
return
var/obj/machinery/atmospherics/unary/vent_pump/exit_vent = pick(vents)
if(prob(50))
src.visible_message("<B>[src] scrambles into the ventillation ducts!</B>")
spawn(rand(20,60))
loc = exit_vent
var/travel_time = round(get_dist(loc, exit_vent.loc) / 2)
spawn(travel_time)
if(!exit_vent || exit_vent.welded)
loc = entry_vent
entry_vent = null
return
if(prob(50))
src.visible_message("\blue You hear something squeezing through the ventilation ducts.",2)
sleep(travel_time)
if(!exit_vent || exit_vent.welded)
loc = entry_vent
entry_vent = null
return
loc = exit_vent.loc
entry_vent = null
var/area/new_area = get_area(loc)
if(new_area)
new_area.Entered(src)
else
entry_vent = null
//=================
else if(prob(33))
var/list/nearby = oview(10, src)
if(nearby.len)
var/target_atom = pick(nearby)
walk_to(src, target_atom)
if(prob(40))
src.visible_message("\blue \the [src] skitters[pick(" away"," around","")].")
else if(prob(10))
//ventcrawl!
for(var/obj/machinery/atmospherics/unary/vent_pump/v in view(7,src))
if(!v.welded)
entry_vent = v
walk_to(src, entry_vent, 1)
break
if(isturf(loc))
amount_grown += rand(0,2)
if(amount_grown >= 100)
var/spawn_type = pick(typesof(/mob/living/simple_animal/hostile/giant_spider))
new spawn_type(src.loc)
del(src)
/obj/effect/spider/cocoon
name = "cocoon"
desc = "Something wrapped in silky spider web"
icon_state = "cocoon1"
health = 60
New()
icon_state = pick("cocoon1","cocoon2","cocoon3")
/obj/effect/spider/cocoon/Del()
src.visible_message("\red \the [src] splits open.")
for(var/atom/movable/A in contents)
A.loc = src.loc
..()

View File

@@ -10,6 +10,11 @@
proc/explosion(turf/epicenter, devastation_range, heavy_impact_range, light_impact_range, flash_range, adminlog = 1) proc/explosion(turf/epicenter, devastation_range, heavy_impact_range, light_impact_range, flash_range, adminlog = 1)
src = null //so we don't abort once src is deleted src = null //so we don't abort once src is deleted
spawn(0) spawn(0)
if(config.use_recursive_explosions)
var/power = devastation_range * 2 + heavy_impact_range + light_impact_range //The ranges add up, ie light 14 includes both heavy 7 and devestation 3. So this calculation means devestation counts for 4, heavy for 2 and light for 1 power, giving us a cap of 27 power.
explosion_rec(epicenter, power)
return
var/start = world.timeofday var/start = world.timeofday
epicenter = get_turf(epicenter) epicenter = get_turf(epicenter)
if(!epicenter) return if(!epicenter) return

View File

@@ -66,7 +66,11 @@ proc/explosion_rec(turf/epicenter, power)
if(ET.max_power <= 0) continue if(ET.max_power <= 0) continue
if(!ET.turf) continue if(!ET.turf) continue
var/severity = 4 - round(max(min( 3, (ET.max_power / 3) ) ,1), 1) //Wow severity looks confusing to calculate... Fret not, I didn't leave you with any additional instructions or help. (just kidding, see the line under the calculation)
var/severity = 4 - round(max(min( 3, ((ET.max_power - ET.turf.explosion_resistance) / (max(3,(power/3)))) ) ,1), 1)
//sanity effective power on tile divided by either 3 or one third the total explosion power
// One third because there are three power levels and I
// want each one to take up a third of the crater
var/x = ET.turf.x var/x = ET.turf.x
var/y = ET.turf.y var/y = ET.turf.y
var/z = ET.turf.z var/z = ET.turf.z

View File

@@ -13,7 +13,7 @@
flags = FPRINT | TABLEPASS flags = FPRINT | TABLEPASS
var/slot_flags = 0 //This is used to determine on which slots an item can fit. var/slot_flags = 0 //This is used to determine on which slots an item can fit.
pass_flags = PASSTABLE pass_flags = PASSTABLE
pressure_resistance = 50 pressure_resistance = 5
// causeerrorheresoifixthis // causeerrorheresoifixthis
var/obj/item/master = null var/obj/item/master = null
@@ -63,11 +63,11 @@
//user: The mob that is suiciding //user: The mob that is suiciding
//damagetype: The type of damage the item will inflict on the user //damagetype: The type of damage the item will inflict on the user
//bruteloss = 1 //BRUTELOSS = 1
//fireloss = 2 //FIRELOSS = 2
//toxloss = 4 //TOXLOSS = 4
//oxyloss = 8 //OXYLOSS = 8
//This proc will return an array. The first element of the list should always be the suicide message that players will see, next is the damagetype //Output a creative message and then return the damagetype done
/obj/item/proc/suicide_act(mob/user) /obj/item/proc/suicide_act(mob/user)
return return
@@ -232,7 +232,7 @@
///////////////////////// /////////////////////////
var/power = src.force var/power = src.force
if((HULK in user.mutations) || (SUPRSTR in user.augmentations)) if(HULK in user.mutations)
power *= 2 power *= 2
if(!istype(M, /mob/living/carbon/human)) if(!istype(M, /mob/living/carbon/human))

View File

@@ -129,6 +129,7 @@ move an amendment</a> to the drawing.</p>
A.power_equip = 0 A.power_equip = 0
A.power_light = 0 A.power_light = 0
A.power_environ = 0 A.power_environ = 0
A.always_unpowered = 0
move_turfs_to_area(turfs, A) move_turfs_to_area(turfs, A)
spawn(5) spawn(5)
//ma = A.master ? "[A.master]" : "(null)" //ma = A.master ? "[A.master]" : "(null)"

View File

@@ -4,7 +4,7 @@
icon_state = "intercom" icon_state = "intercom"
anchored = 1 anchored = 1
w_class = 4.0 w_class = 4.0
canhear_range = 4 canhear_range = 2
var/number = 0 var/number = 0
var/anyai = 1 var/anyai = 1
var/mob/living/silicon/ai/ai = list() var/mob/living/silicon/ai/ai = list()

View File

@@ -595,6 +595,7 @@ var/GLOBAL_RADIO_TYPE = 1 // radio type to use
/obj/item/device/radio/hear_talk(mob/M as mob, msg) /obj/item/device/radio/hear_talk(mob/M as mob, msg)
if (broadcasting) if (broadcasting)
if(get_dist(src, M) <= canhear_range)
talk_into(M, msg) talk_into(M, msg)
/* /*
/obj/item/device/radio/proc/accept_rad(obj/item/device/radio/R as obj, message) /obj/item/device/radio/proc/accept_rad(obj/item/device/radio/R as obj, message)

View File

@@ -370,7 +370,7 @@
var/colourName = "red" //for updateIcon purposes var/colourName = "red" //for updateIcon purposes
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is jaming the [src] up \his nose and into \his brain. It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is jamming the [src.name] up \his nose and into \his brain. It looks like \he's trying to commit suicide.</b>"
return (BRUTELOSS|OXYLOSS) return (BRUTELOSS|OXYLOSS)
/* /*

View File

@@ -4,7 +4,7 @@
icon = 'icons/obj/flamethrower.dmi' icon = 'icons/obj/flamethrower.dmi'
icon_state = "flamethrowerbase" icon_state = "flamethrowerbase"
item_state = "flamethrower_0" item_state = "flamethrower_0"
flags = FPRINT | TABLEPASS| CONDUCT flags = FPRINT | TABLEPASS| CONDUCT | USEDELAY // USEDELAY flag needed in order to use afterattack() for things that are not in reach. I.E: Shooting flames.
force = 3.0 force = 3.0
throwforce = 10.0 throwforce = 10.0
throw_speed = 1 throw_speed = 1
@@ -60,6 +60,13 @@
item_state = "flamethrower_0" item_state = "flamethrower_0"
return return
/obj/item/weapon/flamethrower/afterattack(atom/target, mob/user, flag)
// Make sure our user is still holding us
if(user && user.get_active_hand() == src)
var/turf/target_turf = get_turf(target)
if(target_turf)
var/turflist = getline(user, target_turf)
flame_turf(turflist)
/obj/item/weapon/flamethrower/attackby(obj/item/W as obj, mob/user as mob) /obj/item/weapon/flamethrower/attackby(obj/item/W as obj, mob/user as mob)
if(user.stat || user.restrained() || user.lying) return if(user.stat || user.restrained() || user.lying) return

View File

@@ -13,7 +13,6 @@
icon = 'icons/obj/items.dmi' icon = 'icons/obj/items.dmi'
icon_state = "gift1" icon_state = "gift1"
item_state = "gift1" item_state = "gift1"
pressure_resistance = 70
/obj/item/weapon/a_gift/New() /obj/item/weapon/a_gift/New()
..() ..()

View File

@@ -1,186 +0,0 @@
/obj/item/weapon/implant/nanoaug
name = "nanoaug"
desc = "A nano-robotic biological augmentation implant."
var/augmentation
var/augment_text = "You feel strange..."
var/activation_emote = "fart"
get_data()
var/dat = {"
<b>Implant Specifications:</b><BR>
<b>Name:</b> Cybersun Industries Nano-Robotic Biological Augmentation Suite<BR>
<b>Life:</b> Infinite. WARNING: Biological changes are irreversable.<BR>
<b>Important Notes:</b> <font color='red'>Illegal</font>. Subjects exposed to nanorobotic agent are considered dangerous.<BR>
<HR>
<b>Implant Details:</b><BR>
<b>Function:</b> Implant contains colony of pre-programmed nanorobots. Subject will experience radical changes in their body, amplifying and improving certain bodily characteristics.<BR>
<b>Special Features:</b> Will grant subject superhuman powers.<BR>
<b>Integrity:</b> Nanoaugmentation is permanent. Once the process is complete, the nanorobots disassemble and are dissolved by the blood stream."}
return dat
implanted(mob/M)
if(!istype(M, /mob/living/carbon/human)) return 0
M.augmentations.Add(augmentation) // give them the mutation
M << "\blue [augment_text]"
return 1
/obj/item/weapon/implant/nanoaug/strength
name = "Superhuman Strength"
augmentation = SUPRSTR
augment_text = "You muscle ache, and you feel a rapid surge of energy pulse through your body. You feel strong."
/obj/item/weapon/implant/nanoaug/radar
name = "Short-range Psionic Radar"
augmentation = RADAR
augment_text = "You begin to sense the presence or lack of presence of others around you."
implanted(mob/M)
if(..())
M << "<font color='#FF0000'>Red</font color> blips on the map are Security."
M << "White blips are civlians."
M << "<font color='#3E710B'>Monochrome Green</font color> blips are cyborgs and AIs."
M << "<font color='#238989'>Light blue</font color> blips are heads of staff."
M << "<font color='#663366'>Purple</font color> blips are unidentified organisms."
M << "Dead biologicals will not display on the radar."
spawn()
var/mob/living/carbon/human/H = M
H.start_radar()
return 1
return 0
/obj/item/weapon/implant/nanoaug/electrichands
name = "Electric Hands"
augmentation = ELECTRICHANDS
augment_text = "You feel a sudden jolt of electricity pulse through your veins. Arcs of electricity travel through your hands."
/obj/item/weapon/implant/nanoaug/eswordsynth
name = "Energy Blade Synthesizer"
augmentation = ESWORDSYNTH
augment_text = "Your hands throb and pulsate. They feel sharper, and strangely hot."
implanted(mob/M)
if(..())
activation_emote = pick("blink", "blink_r", "eyebrow", "chuckle", "twitch_s", "frown", "nod", "blush", "giggle", "grin", "groan", "shrug", "smile", "pale", "sniff", "whimper", "wink")
M.mind.store_memory("Freedom nanoaugmentation can be activated by using the [src.activation_emote] emote, <B>say *[src.activation_emote]</B> to attempt to activate.", 0, 0)
M << "The nanoaugmentation implant can be activated by using the [src.activation_emote] emote, <B>say *[src.activation_emote]</B> to attempt to activate."
return 1
return 0
trigger(emote, source as mob)
if(emote == activation_emote)
src.activate(source)
return
activate(var/mob/source)
var/obj/item/weapon/melee/energy/blade/swordspawn = new /obj/item/weapon/melee/energy/blade
if(!source.get_active_hand())
source.put_in_hands(swordspawn)
var/datum/effect/effect/system/spark_spread/spark_system = new /datum/effect/effect/system/spark_spread()
spark_system.set_up(5, 0, source.loc)
spark_system.start()
playsound(source.loc, "sparks", 50, 1)
..()
/obj/item/weapon/implant/nanoaug/rebreather
name = "Bioelectric Rebreather"
augmentation = REBREATHER
augment_text = "You begin to lose your breath. Just as you are about to pass out, you suddenly lose the urge to breath. Breathing is no longer a necessity for you."
/obj/item/weapon/implant/nanoaug/dermalarmor
name = "Skin-intergrated Dermal Armor"
augmentation = DERMALARMOR
augment_text = "The skin throughout your body grows tense and tight, and you become slightly stiff. Your bones and skin feel a lot stronger."
/obj/item/weapon/implant/nanoaug/reflexes
name = "Combat Reflexes"
augmentation = REFLEXES
augment_text = "Your mind suddenly is able to identify threats before you are aware of them. You become more aware of your surroundings."
/obj/item/weapon/implant/nanoaug/nanoregen
name = "Regenerative Nanobots"
augmentation = NANOREGEN
augment_text = "You feel a very faint vibration in your body. You instantly feel much younger."
/obj/item/weapon/implanter/nanoaug
name = "Nanoaugmentation Implanter (Empty)"
icon_state = "nanoimplant"
/obj/item/weapon/implanter/nanoaug/update()
if (src.imp)
src.icon_state = "nanoimplant"
else
src.icon_state = "nanoimplant0"
return
/obj/item/weapon/implanter/nanoaug/strength
name = "Nanoaugmentation Implaner (Superhuman Strength)"
/obj/item/weapon/implanter/nanoaug/strength/New()
src.imp = new /obj/item/weapon/implant/nanoaug/strength( src )
..()
update()
/obj/item/weapon/implanter/nanoaug/radar
name = "Nanoaugmentation Implaner (Short-range Psionic Radar)"
/obj/item/weapon/implanter/nanoaug/radar/New()
src.imp = new /obj/item/weapon/implant/nanoaug/radar( src )
..()
update()
/obj/item/weapon/implanter/nanoaug/electrichands
name = "Nanoaugmentation Implaner (Electric Hands)"
/obj/item/weapon/implanter/nanoaug/electrichands/New()
src.imp = new /obj/item/weapon/implant/nanoaug/electrichands( src )
..()
update()
/obj/item/weapon/implanter/nanoaug/eswordsynth
name = "Nanoaugmentation Implaner (Energy Blade Synthesizer)"
/obj/item/weapon/implanter/nanoaug/eswordsynth/New()
src.imp = new /obj/item/weapon/implant/nanoaug/eswordsynth( src )
..()
update()
/obj/item/weapon/implanter/nanoaug/rebreather
name = "Nanoaugmentation Implaner (Bioelectric Rebreather)"
/obj/item/weapon/implanter/nanoaug/rebreather/New()
src.imp = new /obj/item/weapon/implant/nanoaug/rebreather( src )
..()
update()
/obj/item/weapon/implanter/nanoaug/dermalarmor
name = "Nanoaugmentation Implaner (Skin-intergrated Dermal Armor)"
/obj/item/weapon/implanter/nanoaug/dermalarmor/New()
src.imp = new /obj/item/weapon/implant/nanoaug/dermalarmor( src )
..()
update()
/obj/item/weapon/implanter/nanoaug/reflexes
name = "Nanoaugmentation Implaner (Combat Reflexes)"
/obj/item/weapon/implanter/nanoaug/reflexes/New()
src.imp = new /obj/item/weapon/implant/nanoaug/reflexes( src )
..()
update()
/obj/item/weapon/implanter/nanoaug/nanoregen
name = "Nanoaugmentation Implaner (Regenerative Nanobots)"
/obj/item/weapon/implanter/nanoaug/nanoregen/New()
src.imp = new /obj/item/weapon/implant/nanoaug/nanoregen( src )
..()
update()

View File

@@ -33,11 +33,6 @@
src.add_fingerprint(user) src.add_fingerprint(user)
update() update()
else
if (user.contents.Find(src))
spawn( 0 )
src.attack_self(user)
return
else else
return ..() return ..()
return return

View File

@@ -82,9 +82,9 @@
throwforce = 10.0 throwforce = 10.0
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << pick("\red <b>[user] is slitting \his wrists with the [src]! It looks like \he's trying to commit suicide.</b>", \ viewers(user) << pick("\red <b>[user] is slitting \his wrists with the [src.name]! It looks like \he's trying to commit suicide.</b>", \
"\red <b>[user] is slitting \his throat with the [src]! It looks like \he's trying to commit suicide.</b>", \ "\red <b>[user] is slitting \his throat with the [src.name]! It looks like \he's trying to commit suicide.</b>", \
"\red <b>[user] is slitting \his stomach open with the [src]! It looks like \he's trying to commit seppuku.</b>") "\red <b>[user] is slitting \his stomach open with the [src.name]! It looks like \he's trying to commit seppuku.</b>")
return (BRUTELOSS) return (BRUTELOSS)
/obj/item/weapon/kitchen/utensil/knife/attack(target as mob, mob/living/user as mob) /obj/item/weapon/kitchen/utensil/knife/attack(target as mob, mob/living/user as mob)
@@ -114,9 +114,9 @@
attack_verb = list("slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut") attack_verb = list("slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << pick("\red <b>[user] is slitting \his wrists with the [src]! It looks like \he's trying to commit suicide.</b>", \ viewers(user) << pick("\red <b>[user] is slitting \his wrists with the [src.name]! It looks like \he's trying to commit suicide.</b>", \
"\red <b>[user] is slitting \his throat with the [src]! It looks like \he's trying to commit suicide.</b>", \ "\red <b>[user] is slitting \his throat with the [src.name]! It looks like \he's trying to commit suicide.</b>", \
"\red <b>[user] is slitting \his stomach open with the [src]! It looks like \he's trying to commit seppuku.</b>") "\red <b>[user] is slitting \his stomach open with the [src.name]! It looks like \he's trying to commit seppuku.</b>")
return (BRUTELOSS) return (BRUTELOSS)
/obj/item/weapon/kitchenknife/ritual /obj/item/weapon/kitchenknife/ritual

View File

@@ -2,8 +2,8 @@
var/active = 0 var/active = 0
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << pick("\red <b>[user] is slitting \his stomach open with the [src]! It looks like \he's trying to commit seppuku.</b>", \ viewers(user) << pick("\red <b>[user] is slitting \his stomach open with the [src.name]! It looks like \he's trying to commit seppuku.</b>", \
"\red <b>[user] is falling on the [src]! It looks like \he's trying to commit suicide.</b>") "\red <b>[user] is falling on the [src.name]! It looks like \he's trying to commit suicide.</b>")
return (BRUTELOSS|FIRELOSS) return (BRUTELOSS|FIRELOSS)
/obj/item/weapon/melee/energy/axe /obj/item/weapon/melee/energy/axe
@@ -20,7 +20,7 @@
attack_verb = list("attacked", "chopped", "cleaved", "torn", "cut") attack_verb = list("attacked", "chopped", "cleaved", "torn", "cut")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] swings the [src] towards /his head! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] swings the [src.name] towards /his head! It looks like \he's trying to commit suicide.</b>"
return (BRUTELOSS|FIRELOSS) return (BRUTELOSS|FIRELOSS)
/obj/item/weapon/melee/energy/sword /obj/item/weapon/melee/energy/sword

View File

@@ -12,5 +12,5 @@
attack_verb = list("flogged", "whipped", "lashed", "disciplined") attack_verb = list("flogged", "whipped", "lashed", "disciplined")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is strangling \himself with the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is strangling \himself with the [src.name]! It looks like \he's trying to commit suicide.</b>"
return (OXYLOSS) return (OXYLOSS)

View File

@@ -11,7 +11,6 @@
throw_speed = 3 throw_speed = 3
throw_range = 5 throw_range = 5
w_class = 3.0 w_class = 3.0
pressure_resistance = 80
var/charge = 0 // note %age conveted to actual charge in New var/charge = 0 // note %age conveted to actual charge in New
var/maxcharge = 1000 var/maxcharge = 1000
m_amt = 700 m_amt = 700
@@ -22,7 +21,7 @@
var/construction_time=100 var/construction_time=100
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is licking the electrodes of the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is licking the electrodes of the [src.name]! It looks like \he's trying to commit suicide.</b>"
return (FIRELOSS) return (FIRELOSS)
/obj/item/weapon/cell/crap /obj/item/weapon/cell/crap

View File

@@ -69,12 +69,22 @@
user <<"The spell matrix was unable to locate a suitable teleport destination for an unknown reason. Sorry." user <<"The spell matrix was unable to locate a suitable teleport destination for an unknown reason. Sorry."
return return
var/attempt = 0 if(user && user.buckled)
user.buckled.unbuckle()
var/list/tempL = L
var/attempt = null
var/success = 0 var/success = 0
while(!success) while(tempL.len)
success = user.Move(pick(L)) attempt = pick(tempL)
if(attempt > 20) break //Failsafe success = user.Move(attempt)
if(!success)
tempL.Remove(attempt)
else
break
if(!success) if(!success)
user.loc = pick(L) user.loc = pick(L)
smoke.start() smoke.start()
src.uses -= 1 src.uses -= 1

View File

@@ -1,7 +1,7 @@
/obj/item/weapon/storage/box/syndicate/ /obj/item/weapon/storage/box/syndicate/
New() New()
..() ..()
switch (pickweight(list("bloodyspai" = 1, "stealth" = 1, "screwed" = 1, "guns" = 1, "murder" = 1, "freedom" = 1, "hacker" = 1, "lordsingulo" = 1))) switch (pickweight(list("bloodyspai" = 1, "stealth" = 1, "screwed" = 1, "guns" = 1, "murder" = 1, "freedom" = 1, "hacker" = 1, "lordsingulo" = 1, "smoothoperator" = 1)))
if("bloodyspai") if("bloodyspai")
new /obj/item/clothing/under/chameleon(src) new /obj/item/clothing/under/chameleon(src)
new /obj/item/clothing/mask/gas/voice(src) new /obj/item/clothing/mask/gas/voice(src)
@@ -9,6 +9,7 @@
new /obj/item/clothing/shoes/syndigaloshes(src) new /obj/item/clothing/shoes/syndigaloshes(src)
return return
if ("stealth")
if("stealth") if("stealth")
new /obj/item/weapon/gun/energy/crossbow(src) new /obj/item/weapon/gun/energy/crossbow(src)
new /obj/item/weapon/pen/paralysis(src) new /obj/item/weapon/pen/paralysis(src)
@@ -57,6 +58,16 @@
new /obj/item/weapon/card/emag(src) new /obj/item/weapon/card/emag(src)
return return
if("smoothoperator")
new /obj/item/weapon/gun/projectile/pistol(src)
new /obj/item/weapon/silencer(src)
new /obj/item/weapon/soap/syndie(src)
new /obj/item/weapon/storage/bag/trash(src)
new /obj/item/bodybag(src)
new /obj/item/clothing/under/suit_jacket(src)
new /obj/item/clothing/shoes/laceup(src)
return
/obj/item/weapon/storage/box/syndie_kit /obj/item/weapon/storage/box/syndie_kit
name = "Box" name = "Box"
desc = "A sleek, sturdy box" desc = "A sleek, sturdy box"

View File

@@ -15,7 +15,7 @@
origin_tech = "combat=2" origin_tech = "combat=2"
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is putting the live [src] in \his mouth! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is putting the live [src.name] in \his mouth! It looks like \he's trying to commit suicide.</b>"
return (FIRELOSS) return (FIRELOSS)
/obj/item/weapon/melee/baton/update_icon() /obj/item/weapon/melee/baton/update_icon()
@@ -60,7 +60,7 @@
if(user.a_intent == "hurt") if(user.a_intent == "hurt")
if(!..()) return if(!..()) return
H.apply_effect(5, WEAKEN, 0) //H.apply_effect(5, WEAKEN, 0)
H.visible_message("<span class='danger'>[M] has been beaten with the [src] by [user]!</span>") H.visible_message("<span class='danger'>[M] has been beaten with the [src] by [user]!</span>")
playsound(src.loc, "swing_hit", 50, 1, -1) playsound(src.loc, "swing_hit", 50, 1, -1)
else if(!status) else if(!status)

View File

@@ -365,8 +365,8 @@ LOOK FOR SURGERY.DM*/
attack_verb = list("drilled") attack_verb = list("drilled")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << pick("/red <b>[user] is pressing the [src] to \his temple and activating it! It looks like \he's trying to commit suicide.</b>", \ viewers(user) << pick("/red <b>[user] is pressing the [src.name] to \his temple and activating it! It looks like \he's trying to commit suicide.</b>", \
"/red <b>[user] is pressing [src] to \his chest and activating it! It looks like \he's trying to commit suicide.</b>") "/red <b>[user] is pressing [src.name] to \his chest and activating it! It looks like \he's trying to commit suicide.</b>")
return (BRUTELOSS) return (BRUTELOSS)
/* /*
@@ -389,9 +389,9 @@ LOOK FOR SURGERY.DM*/
attack_verb = list("attacked", "slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut") attack_verb = list("attacked", "slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << pick("\red <b>[user] is slitting \his wrists with the [src]! It looks like \he's trying to commit suicide.</b>", \ viewers(user) << pick("\red <b>[user] is slitting \his wrists with the [src.name]! It looks like \he's trying to commit suicide.</b>", \
"\red <b>[user] is slitting \his throat with the [src]! It looks like \he's trying to commit suicide.</b>", \ "\red <b>[user] is slitting \his throat with the [src.name]! It looks like \he's trying to commit suicide.</b>", \
"\red <b>[user] is slitting \his stomach open with the [src]! It looks like \he's trying to commit seppuku.</b>") "\red <b>[user] is slitting \his stomach open with the [src.name]! It looks like \he's trying to commit seppuku.</b>")
return (BRUTELOSS) return (BRUTELOSS)
/* /*
@@ -492,7 +492,7 @@ LOOK FOR SURGERY.DM*/
if(istype(M, /mob/living/carbon/slime)) if(istype(M, /mob/living/carbon/slime))
if(M.stat == 2) if(M.stat == 2)
for(var/mob/O in (viewers(M) - user - M)) for(var/mob/O in (viewers(M) - user - M))
O.show_message("\red [M.name] is having its silky inndards cut apart with [src] by [user].", 1) O.show_message("\red [M.name] is having its silky innards cut apart with [src] by [user].", 1)
M << "\red [user] begins to cut apart your innards with [src]!" M << "\red [user] begins to cut apart your innards with [src]!"
user << "\red You cut [M]'s silky innards apart with [src]!" user << "\red You cut [M]'s silky innards apart with [src]!"
M:brain_op_stage = 2.0 M:brain_op_stage = 2.0

View File

@@ -49,8 +49,8 @@
attack_verb = list("stabbed") attack_verb = list("stabbed")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << pick("\red <b>[user] is stabbing the [src] into \his temple! It looks like \he's trying to commit suicide.</b>", \ viewers(user) << pick("\red <b>[user] is stabbing the [src.name] into \his temple! It looks like \he's trying to commit suicide.</b>", \
"\red <b>[user] is stabbing the [src] into \his heart! It looks like \he's trying to commit suicide.</b>") "\red <b>[user] is stabbing the [src.name] into \his heart! It looks like \he's trying to commit suicide.</b>")
return(BRUTELOSS) return(BRUTELOSS)
/obj/item/weapon/screwdriver/New() /obj/item/weapon/screwdriver/New()

View File

@@ -12,7 +12,7 @@
attack_verb = list("banned") attack_verb = list("banned")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is hitting \himself with the [src]! It looks like \he's trying to ban \himself from life.</b>" viewers(user) << "\red <b>[user] is hitting \himself with the [src.name]! It looks like \he's trying to ban \himself from life.</b>"
return (BRUTELOSS|FIRELOSS|TOXLOSS|OXYLOSS) return (BRUTELOSS|FIRELOSS|TOXLOSS|OXYLOSS)
/obj/item/weapon/nullrod /obj/item/weapon/nullrod
@@ -29,7 +29,7 @@
w_class = 1 w_class = 1
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is impaling \himself with the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is impaling \himself with the [src.name]! It looks like \he's trying to commit suicide.</b>"
return (BRUTELOSS|FIRELOSS) return (BRUTELOSS|FIRELOSS)
/obj/item/weapon/sord /obj/item/weapon/sord
@@ -45,7 +45,7 @@
attack_verb = list("attacked", "slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut") attack_verb = list("attacked", "slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is impaling \himself with the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is impaling \himself with the [src.name]! It looks like \he's trying to commit suicide.</b>"
return(BRUTELOSS) return(BRUTELOSS)
/obj/item/weapon/sord/attack(mob/living/carbon/M as mob, mob/living/carbon/user as mob) /obj/item/weapon/sord/attack(mob/living/carbon/M as mob, mob/living/carbon/user as mob)
@@ -68,7 +68,7 @@
return 1 return 1
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is falling on the [src]! It looks like \he's trying to commit suicide.</b>" viewers(user) << "\red <b>[user] is falling on the [src.name]! It looks like \he's trying to commit suicide.</b>"
return(BRUTELOSS) return(BRUTELOSS)
/obj/item/weapon/claymore/attack(mob/living/carbon/M as mob, mob/living/carbon/user as mob) /obj/item/weapon/claymore/attack(mob/living/carbon/M as mob, mob/living/carbon/user as mob)
@@ -88,7 +88,7 @@
attack_verb = list("attacked", "slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut") attack_verb = list("attacked", "slashed", "stabbed", "sliced", "torn", "ripped", "diced", "cut")
suicide_act(mob/user) suicide_act(mob/user)
viewers(user) << "\red <b>[user] is slitting \his stomach open with the [src]! It looks like \he's trying to commit seppuku.</b>" viewers(user) << "\red <b>[user] is slitting \his stomach open with the [src.name]! It looks like \he's trying to commit seppuku.</b>"
return(BRUTELOSS) return(BRUTELOSS)
/obj/item/weapon/katana/IsShield() /obj/item/weapon/katana/IsShield()

View File

@@ -160,6 +160,38 @@
return return
/obj/structure/closet/secure_closet/security/cargo
New()
..()
new /obj/item/clothing/tie/armband/cargo(src)
new /obj/item/device/encryptionkey/headset_cargo(src)
return
/obj/structure/closet/secure_closet/security/engine
New()
..()
new /obj/item/clothing/tie/armband/engine(src)
new /obj/item/device/encryptionkey/headset_eng(src)
return
/obj/structure/closet/secure_closet/security/science
New()
..()
new /obj/item/clothing/tie/armband/science(src)
new /obj/item/device/encryptionkey/headset_sci(src)
return
/obj/structure/closet/secure_closet/security/med
New()
..()
new /obj/item/clothing/tie/armband/medgreen(src)
new /obj/item/device/encryptionkey/headset_med(src)
return
/obj/structure/closet/secure_closet/detective /obj/structure/closet/secure_closet/detective
name = "Detective's Cabinet" name = "Detective's Cabinet"
@@ -205,7 +237,7 @@
/obj/structure/closet/secure_closet/injection /obj/structure/closet/secure_closet/injection
name = "Lethal Injections" name = "Lethal Injections"
req_access = list(access_hos) req_access = list(access_captain)
New() New()

View File

@@ -32,5 +32,33 @@
/obj/structure/largecrate/lisa/attackby(obj/item/weapon/W as obj, mob/user as mob) //ugly but oh well /obj/structure/largecrate/lisa/attackby(obj/item/weapon/W as obj, mob/user as mob) //ugly but oh well
if(istype(W, /obj/item/weapon/crowbar)) if(istype(W, /obj/item/weapon/crowbar))
new /mob/living/simple_animal/corgi/Lisa(loc) new /mob/living/simple_animal/corgi/Lisa(loc)
..()
/obj/structure/largecrate/cow
name = "cow crate"
icon_state = "lisacrate"
/obj/structure/largecrate/cow/attackby(obj/item/weapon/W as obj, mob/user as mob)
if(istype(W, /obj/item/weapon/crowbar))
new /mob/living/simple_animal/cow(loc)
..()
/obj/structure/largecrate/goat
name = "goat crate"
icon_state = "lisacrate"
/obj/structure/largecrate/goat/attackby(obj/item/weapon/W as obj, mob/user as mob)
if(istype(W, /obj/item/weapon/crowbar))
new /mob/living/simple_animal/hostile/retaliate/goat(loc)
..()
/obj/structure/largecrate/chick
name = "chicken crate"
icon_state = "lisacrate"
/obj/structure/largecrate/chick/attackby(obj/item/weapon/W as obj, mob/user as mob)
if(istype(W, /obj/item/weapon/crowbar))
var/num = rand(4, 6)
for(var/i = 0, i < num, i++)
new /mob/living/simple_animal/chick(loc)
..() ..()

View File

@@ -38,7 +38,7 @@
if(shock(user, 70)) if(shock(user, 70))
return return
if((HULK in user.mutations) || (SUPRSTR in user.augmentations)) if(HULK in user.mutations)
health -= 5 health -= 5
else else
health -= 3 health -= 3

View File

@@ -4,7 +4,7 @@
icon = 'icons/obj/janitor.dmi' icon = 'icons/obj/janitor.dmi'
icon_state = "mopbucket" icon_state = "mopbucket"
density = 1 density = 1
pressure_resistance = ONE_ATMOSPHERE pressure_resistance = 5
flags = FPRINT | TABLEPASS | OPENCONTAINER flags = FPRINT | TABLEPASS | OPENCONTAINER
var/amount_per_transfer_from_this = 5 //shit I dunno, adding this so syringes stop runtime erroring. --NeoFite var/amount_per_transfer_from_this = 5 //shit I dunno, adding this so syringes stop runtime erroring. --NeoFite

View File

@@ -92,6 +92,11 @@
desc = "The Intergalactic symbol of Medical institutions. You'll probably get help here.'" desc = "The Intergalactic symbol of Medical institutions. You'll probably get help here.'"
icon_state = "redcross" icon_state = "redcross"
/obj/structure/sign/greencross
name = "medbay"
desc = "The Intergalactic symbol of Medical institutions. You'll probably get help here.'"
icon_state = "greencross"
/obj/structure/sign/goldenplaque /obj/structure/sign/goldenplaque
name = "The Most Robust Men Award for Robustness" name = "The Most Robust Men Award for Robustness"
desc = "To be Robust is not an action or a way of life, but a mental state. Only those with the force of Will strong enough to act during a crisis, saving friend from foe, are truly Robust. Stay Robust my friends." desc = "To be Robust is not an action or a way of life, but a mental state. Only those with the force of Will strong enough to act during a crisis, saving friend from foe, are truly Robust. Stay Robust my friends."

View File

@@ -67,6 +67,10 @@
if ( !ismob(M) || (get_dist(src, user) > 1) || (M.loc != src.loc) || user.restrained() || user.lying || user.stat || M.buckled || istype(user, /mob/living/silicon/pai) ) if ( !ismob(M) || (get_dist(src, user) > 1) || (M.loc != src.loc) || user.restrained() || user.lying || user.stat || M.buckled || istype(user, /mob/living/silicon/pai) )
return return
if (istype(M, /mob/living/carbon/slime))
user << "The [M] is too squishy to buckle in."
return
unbuckle() unbuckle()
if (M == usr) if (M == usr)

View File

@@ -52,6 +52,11 @@
set category = "Object" set category = "Object"
set src in oview(1) set src in oview(1)
if(config.ghost_interaction)
src.dir = turn(src.dir, 90)
handle_rotation()
return
else
if(!usr || !isturf(usr.loc)) if(!usr || !isturf(usr.loc))
return return
if(usr.stat || usr.restrained()) if(usr.stat || usr.restrained())

View File

@@ -5,7 +5,7 @@
icon_state = "stool" icon_state = "stool"
anchored = 1.0 anchored = 1.0
flags = FPRINT flags = FPRINT
pressure_resistance = 3*ONE_ATMOSPHERE pressure_resistance = 15
/obj/structure/stool/ex_act(severity) /obj/structure/stool/ex_act(severity)
switch(severity) switch(severity)
@@ -49,7 +49,7 @@
icon = 'icons/obj/objects.dmi' icon = 'icons/obj/objects.dmi'
icon_state = "stool" icon_state = "stool"
force = 10 force = 10
throwforce = 20 throwforce = 10
w_class = 5.0 w_class = 5.0
var/obj/structure/stool/origin = null var/obj/structure/stool/origin = null

View File

@@ -19,6 +19,7 @@
anchored = 1.0 anchored = 1.0
layer = 2.8 layer = 2.8
throwpass = 1 //You can throw objects over this, despite it's density.") throwpass = 1 //You can throw objects over this, despite it's density.")
var/parts = /obj/item/weapon/table_parts
/obj/structure/table/New() /obj/structure/table/New()
..() ..()
@@ -38,6 +39,12 @@
T.update_icon() T.update_icon()
..() ..()
/obj/structure/table/proc/destroy()
new parts(loc)
density = 0
del(src)
/obj/structure/table/update_icon() /obj/structure/table/update_icon()
spawn(2) //So it properly updates when deleting spawn(2) //So it properly updates when deleting
var/dir_sum = 0 var/dir_sum = 0
@@ -219,80 +226,42 @@
return return
if(3.0) if(3.0)
if (prob(25)) if (prob(25))
src.density = 0 destroy()
else else
return return
/obj/structure/table/blob_act() /obj/structure/table/blob_act()
if(prob(75)) if(prob(75))
if(istype(src, /obj/structure/table/woodentable)) destroy()
new /obj/item/weapon/table_parts/wood( src.loc )
del(src)
return
new /obj/item/weapon/table_parts( src.loc )
del(src)
return
/obj/structure/table/hand_p(mob/user as mob) /obj/structure/table/hand_p(mob/user as mob)
return src.attack_paw(user) return src.attack_paw(user)
return
/obj/structure/table/attack_paw(mob/user) /obj/structure/table/attack_paw(mob/user)
if(HULK in user.mutations) if(HULK in user.mutations)
user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" )) user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" ))
visible_message("<span class='danger'>[user] smashes the table apart!</span>") visible_message("<span class='danger'>[user] smashes the [src] apart!</span>")
if(istype(src, /obj/structure/table/reinforced)) destroy()
new /obj/item/weapon/table_parts/reinforced(loc)
else if(istype(src, /obj/structure/table/woodentable))
new/obj/item/weapon/table_parts/wood(loc)
else
new /obj/item/weapon/table_parts(loc)
density = 0
del(src)
/obj/structure/table/attack_alien(mob/user) /obj/structure/table/attack_alien(mob/user)
visible_message("<span class='danger'>[user] slices [src] apart!</span>") visible_message("<span class='danger'>[user] slices [src] apart!</span>")
if(istype(src, /obj/structure/table/reinforced))
new /obj/item/weapon/table_parts/reinforced(loc)
else if(istype(src, /obj/structure/table/woodentable))
new/obj/item/weapon/table_parts/wood(loc)
else
new /obj/item/weapon/table_parts(loc)
density = 0
del(src)
/obj/structure/table/attack_animal(mob/living/simple_animal/user) /obj/structure/table/attack_animal(mob/living/simple_animal/user)
if(user.wall_smash) if(user.wall_smash)
visible_message("<span class='danger'>[user] smashes [src] apart!</span>") visible_message("<span class='danger'>[user] smashes [src] apart!</span>")
if(istype(src, /obj/structure/table/reinforced)) destroy()
new /obj/item/weapon/table_parts/reinforced(loc)
else if(istype(src, /obj/structure/table/woodentable))
new/obj/item/weapon/table_parts/wood(loc)
else
new /obj/item/weapon/table_parts(loc)
density = 0
del(src)
/obj/structure/table/attack_hand(mob/user) /obj/structure/table/attack_hand(mob/user)
if(HULK in user.mutations || SUPRSTR in user.augmentations) if(HULK in user.mutations)
visible_message("<span class='danger'>[user] smashes [src] apart!</span>") visible_message("<span class='danger'>[user] smashes [src] apart!</span>")
user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" )) user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" ))
if(istype(src, /obj/structure/table/reinforced)) destroy()
new /obj/item/weapon/table_parts/reinforced(loc)
else if(istype(src, /obj/structure/table/woodentable))
new/obj/item/weapon/table_parts/wood(loc)
else
new /obj/item/weapon/table_parts(loc)
density = 0
del(src)
/obj/structure/table/CanPass(atom/movable/mover, turf/target, height=0, air_group=0) /obj/structure/table/CanPass(atom/movable/mover, turf/target, height=0, air_group=0)
@@ -323,9 +292,9 @@
var/mob/living/M = G.affecting var/mob/living/M = G.affecting
if (G.state < 2) if (G.state < 2)
if(user.a_intent == "hurt") if(user.a_intent == "hurt")
if (prob(5)) M.Weaken(3) if (prob(15)) M.Weaken(5)
M.apply_damage(10) M.apply_damage(8,def_zone = "head")
visible_message("\red [G.assailant] slams [G.affecting] against \the [src]!") visible_message("\red [G.assailant] slams [G.affecting]'s face against \the [src]!")
playsound(src.loc, 'sound/weapons/tablehit1.ogg', 50, 1) playsound(src.loc, 'sound/weapons/tablehit1.ogg', 50, 1)
else else
user << "\red You need a better grip to do that!" user << "\red You need a better grip to do that!"
@@ -341,10 +310,7 @@
user << "\blue Now disassembling table" user << "\blue Now disassembling table"
playsound(src.loc, 'sound/items/Ratchet.ogg', 50, 1) playsound(src.loc, 'sound/items/Ratchet.ogg', 50, 1)
if(do_after(user,50)) if(do_after(user,50))
new /obj/item/weapon/table_parts( src.loc ) destroy()
playsound(src.loc, 'sound/items/Deconstruct.ogg', 50, 1)
//SN src = null
del(src)
return return
if(isrobot(user)) if(isrobot(user))
@@ -357,13 +323,10 @@
playsound(src.loc, 'sound/weapons/blade1.ogg', 50, 1) playsound(src.loc, 'sound/weapons/blade1.ogg', 50, 1)
playsound(src.loc, "sparks", 50, 1) playsound(src.loc, "sparks", 50, 1)
for(var/mob/O in viewers(user, 4)) for(var/mob/O in viewers(user, 4))
O.show_message("\blue The table was sliced apart by [user]!", 1, "\red You hear metal coming apart.", 2) O.show_message("\blue The [src] was sliced apart by [user]!", 1, "\red You hear [src] coming apart.", 2)
new /obj/item/weapon/table_parts( src.loc ) destroy()
del(src)
return
user.drop_item(src) user.drop_item(src)
//if(W && W.loc) W.loc = src.loc // Unnecessary - see: mob/proc/drop_item(atom) - Doohl
return return
@@ -374,46 +337,7 @@
name = "wooden table" name = "wooden table"
desc = "Do not apply fire to this. Rumour says it burns easily." desc = "Do not apply fire to this. Rumour says it burns easily."
icon_state = "wood_table" icon_state = "wood_table"
parts = /obj/item/weapon/table_parts/wood
/obj/structure/table/woodentable/attackby(obj/item/weapon/W as obj, mob/user as mob)
if (istype(W, /obj/item/weapon/grab))
var/obj/item/weapon/grab/G = W
if(G.state<2)
user << "\red You need a better grip to do that!"
return
G.affecting.loc = src.loc
G.affecting.Weaken(5)
visible_message("\red [G.assailant] puts [G.affecting] on the table.")
del(W)
return
if (istype(W, /obj/item/weapon/wrench))
user << "\blue Now disassembling the wooden table"
playsound(src.loc, 'sound/items/Ratchet.ogg', 50, 1)
sleep(50)
new /obj/item/weapon/table_parts/wood( src.loc )
playsound(src.loc, 'sound/items/Deconstruct.ogg', 50, 1)
del(src)
return
if(isrobot(user))
return
if(istype(W, /obj/item/weapon/melee/energy/blade))
var/datum/effect/effect/system/spark_spread/spark_system = new /datum/effect/effect/system/spark_spread()
spark_system.set_up(5, 0, src.loc)
spark_system.start()
playsound(src.loc, 'sound/weapons/blade1.ogg', 50, 1)
playsound(src.loc, "sparks", 50, 1)
for(var/mob/O in viewers(user, 4))
O.show_message("\blue The wooden table was sliced apart by [user]!", 1, "\red You hear wood coming apart.", 2)
new /obj/item/weapon/table_parts/wood( src.loc )
del(src)
return
user.drop_item(src)
//if(W && W.loc) W.loc = src.loc
return
/* /*
* Reinforced tables * Reinforced tables
@@ -423,21 +347,10 @@
desc = "A version of the four legged table. It is stronger." desc = "A version of the four legged table. It is stronger."
icon_state = "reinf_table" icon_state = "reinf_table"
var/status = 2 var/status = 2
parts = /obj/item/weapon/table_parts/reinforced
/obj/structure/table/reinforced/attackby(obj/item/weapon/W as obj, mob/user as mob) /obj/structure/table/reinforced/attackby(obj/item/weapon/W as obj, mob/user as mob)
if (istype(W, /obj/item/weapon/grab))
var/obj/item/weapon/grab/G = W
if(G.state<2)
user << "\red You need a better grip to do that!"
return
G.affecting.loc = src.loc
G.affecting.Weaken(5)
visible_message("\red [G.assailant] puts [G.affecting] on the table.")
del(W)
return
if (istype(W, /obj/item/weapon/weldingtool)) if (istype(W, /obj/item/weapon/weldingtool))
var/obj/item/weapon/weldingtool/WT = W var/obj/item/weapon/weldingtool/WT = W
if(WT.remove_fuel(0, user)) if(WT.remove_fuel(0, user))
@@ -456,40 +369,13 @@
user << "\blue Table strengthened" user << "\blue Table strengthened"
src.status = 2 src.status = 2
return return
if(isrobot(user))
return
user.drop_item(src)
//if(W && W.loc) W.loc = src.loc
return return
if (istype(W, /obj/item/weapon/wrench)) if (istype(W, /obj/item/weapon/wrench))
if(src.status == 1) if(src.status == 2)
user << "\blue Now disassembling the reinforced table"
playsound(src.loc, 'sound/items/Ratchet.ogg', 50, 1)
if (do_after(user, 50))
new /obj/item/weapon/table_parts/reinforced( src.loc )
playsound(src.loc, 'sound/items/Deconstruct.ogg', 50, 1)
del(src)
return
if(isrobot(user))
return
if(istype(W, /obj/item/weapon/melee/energy/blade))
var/datum/effect/effect/system/spark_spread/spark_system = new /datum/effect/effect/system/spark_spread()
spark_system.set_up(5, 0, src.loc)
spark_system.start()
playsound(src.loc, 'sound/weapons/blade1.ogg', 50, 1)
playsound(src.loc, "sparks", 50, 1)
for(var/mob/O in viewers(user, 4))
O.show_message("\blue The reinforced table was sliced apart by [user]!", 1, "\red You hear metal coming apart.", 2)
new /obj/item/weapon/table_parts/reinforced( src.loc )
del(src)
return
user.drop_item(src)
//if(W && W.loc) W.loc = src.loc
return return
..()
/* /*
* Racks * Racks
@@ -562,7 +448,7 @@
/obj/structure/table/attack_hand(mob/user) /obj/structure/table/attack_hand(mob/user)
if(HULK in user.mutations || SUPRSTR in user.augmentations) if(HULK in user.mutations)
visible_message("<span class='danger'>[user] smashes [src] apart!</span>") visible_message("<span class='danger'>[user] smashes [src] apart!</span>")
user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" )) user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" ))
new /obj/item/weapon/rack_parts(loc) new /obj/item/weapon/rack_parts(loc)

View File

@@ -98,7 +98,7 @@
/obj/structure/window/attack_hand(mob/user as mob) /obj/structure/window/attack_hand(mob/user as mob)
if((HULK in user.mutations) || (SUPRSTR in user.augmentations)) if(HULK in user.mutations)
user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!")) user.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!"))
user.visible_message("<span class='danger'>[user] smashes through [src]!</span>") user.visible_message("<span class='danger'>[user] smashes through [src]!</span>")
new /obj/item/weapon/shard(loc) new /obj/item/weapon/shard(loc)
@@ -152,17 +152,18 @@
del(W) //gotta delete it here because if window breaks, it won't get deleted del(W) //gotta delete it here because if window breaks, it won't get deleted
switch (state) switch (state)
if(1) if(1)
M.apply_damage(10) M.apply_damage(7)
hit(10) hit(10)
visible_message("\red [user] slams [M] against \the [src]!") visible_message("\red [user] slams [M] against \the [src]!")
if(2) if(2)
M.Weaken(2) if (prob(50))
M.apply_damage(15) M.Weaken(1)
M.apply_damage(10)
hit(25) hit(25)
visible_message("\red <b>[user] bashes [M] against \the [src]!</b>") visible_message("\red <b>[user] bashes [M] against \the [src]!</b>")
if(3) if(3)
M.Weaken(10) M.Weaken(5)
M.apply_damage(25) M.apply_damage(20)
hit(50) hit(50)
visible_message("\red <big><b>[user] crushes [M] against \the [src]!</b></big>") visible_message("\red <big><b>[user] crushes [M] against \the [src]!</b></big>")
return return

Some files were not shown because too many files have changed in this diff Show More