diff --git a/baystation12.dme b/baystation12.dme
index 25ecc5fee8..7d0acca9a9 100644
--- a/baystation12.dme
+++ b/baystation12.dme
@@ -6,14 +6,235 @@
 // BEGIN_FILE_DIR
 #define FILE_DIR .
 #define FILE_DIR "code"
+#define FILE_DIR "code/__HELPERS"
+#define FILE_DIR "code/ATMOSPHERICS"
+#define FILE_DIR "code/ATMOSPHERICS/components"
+#define FILE_DIR "code/ATMOSPHERICS/components/binary_devices"
+#define FILE_DIR "code/ATMOSPHERICS/components/trinary_devices"
+#define FILE_DIR "code/ATMOSPHERICS/components/unary"
+#define FILE_DIR "code/controllers"
+#define FILE_DIR "code/datums"
+#define FILE_DIR "code/datums/diseases"
+#define FILE_DIR "code/datums/diseases/advance"
+#define FILE_DIR "code/datums/diseases/advance/symptoms"
+#define FILE_DIR "code/datums/helper_datums"
+#define FILE_DIR "code/datums/spells"
+#define FILE_DIR "code/defines"
+#define FILE_DIR "code/defines/obj"
+#define FILE_DIR "code/defines/procs"
+#define FILE_DIR "code/FEA"
+#define FILE_DIR "code/game"
+#define FILE_DIR "code/game/area"
+#define FILE_DIR "code/game/gamemodes"
+#define FILE_DIR "code/game/gamemodes/autotraitor"
+#define FILE_DIR "code/game/gamemodes/blob"
+#define FILE_DIR "code/game/gamemodes/blob/blobs"
+#define FILE_DIR "code/game/gamemodes/changeling"
+#define FILE_DIR "code/game/gamemodes/cult"
+#define FILE_DIR "code/game/gamemodes/epidemic"
+#define FILE_DIR "code/game/gamemodes/events"
+#define FILE_DIR "code/game/gamemodes/events/holidays"
+#define FILE_DIR "code/game/gamemodes/extended"
+#define FILE_DIR "code/game/gamemodes/malfunction"
+#define FILE_DIR "code/game/gamemodes/meme"
+#define FILE_DIR "code/game/gamemodes/meteor"
+#define FILE_DIR "code/game/gamemodes/nuclear"
+#define FILE_DIR "code/game/gamemodes/revolution"
+#define FILE_DIR "code/game/gamemodes/sandbox"
+#define FILE_DIR "code/game/gamemodes/traitor"
+#define FILE_DIR "code/game/gamemodes/wizard"
+#define FILE_DIR "code/game/jobs"
+#define FILE_DIR "code/game/jobs/job"
+#define FILE_DIR "code/game/machinery"
+#define FILE_DIR "code/game/machinery/atmoalter"
+#define FILE_DIR "code/game/machinery/bots"
+#define FILE_DIR "code/game/machinery/camera"
+#define FILE_DIR "code/game/machinery/computer"
+#define FILE_DIR "code/game/machinery/doors"
+#define FILE_DIR "code/game/machinery/embedded_controller"
+#define FILE_DIR "code/game/machinery/kitchen"
+#define FILE_DIR "code/game/machinery/pipe"
+#define FILE_DIR "code/game/machinery/telecomms"
+#define FILE_DIR "code/game/magic"
+#define FILE_DIR "code/game/mecha"
+#define FILE_DIR "code/game/mecha/combat"
+#define FILE_DIR "code/game/mecha/equipment"
+#define FILE_DIR "code/game/mecha/equipment/tools"
+#define FILE_DIR "code/game/mecha/equipment/weapons"
+#define FILE_DIR "code/game/mecha/medical"
+#define FILE_DIR "code/game/mecha/working"
+#define FILE_DIR "code/game/objects"
+#define FILE_DIR "code/game/objects/closets"
+#define FILE_DIR "code/game/objects/closets/secure"
+#define FILE_DIR "code/game/objects/effects"
+#define FILE_DIR "code/game/objects/effects/decals"
+#define FILE_DIR "code/game/objects/effects/decals/Cleanable"
+#define FILE_DIR "code/game/objects/effects/spawners"
+#define FILE_DIR "code/game/objects/items"
+#define FILE_DIR "code/game/objects/items/devices"
+#define FILE_DIR "code/game/objects/items/devices/PDA"
+#define FILE_DIR "code/game/objects/items/devices/radio"
+#define FILE_DIR "code/game/objects/items/robot"
+#define FILE_DIR "code/game/objects/items/stacks"
+#define FILE_DIR "code/game/objects/items/stacks/sheets"
+#define FILE_DIR "code/game/objects/items/stacks/tiles"
+#define FILE_DIR "code/game/objects/items/weapons"
+#define FILE_DIR "code/game/objects/items/weapons/grenades"
+#define FILE_DIR "code/game/objects/items/weapons/implants"
+#define FILE_DIR "code/game/objects/items/weapons/melee"
+#define FILE_DIR "code/game/objects/items/weapons/storage"
+#define FILE_DIR "code/game/objects/items/weapons/tanks"
+#define FILE_DIR "code/game/objects/storage"
+#define FILE_DIR "code/game/objects/structures"
+#define FILE_DIR "code/game/objects/structures/crates_lockers"
+#define FILE_DIR "code/game/objects/structures/crates_lockers/closets"
+#define FILE_DIR "code/game/objects/structures/crates_lockers/closets/secure"
+#define FILE_DIR "code/game/objects/structures/stool_bed_chair_nest"
+#define FILE_DIR "code/game/structure"
+#define FILE_DIR "code/game/turfs"
+#define FILE_DIR "code/game/turfs/simulated"
+#define FILE_DIR "code/game/turfs/space"
+#define FILE_DIR "code/game/turfs/unsimulated"
+#define FILE_DIR "code/game/vehicles"
+#define FILE_DIR "code/game/verbs"
+#define FILE_DIR "code/js"
+#define FILE_DIR "code/modules"
+#define FILE_DIR "code/modules/admin"
+#define FILE_DIR "code/modules/admin/DB ban"
+#define FILE_DIR "code/modules/admin/permissionverbs"
+#define FILE_DIR "code/modules/admin/verbs"
+#define FILE_DIR "code/modules/assembly"
+#define FILE_DIR "code/modules/awaymissions"
+#define FILE_DIR "code/modules/awaymissions/maploader"
+#define FILE_DIR "code/modules/client"
+#define FILE_DIR "code/modules/clothing"
+#define FILE_DIR "code/modules/clothing/glasses"
+#define FILE_DIR "code/modules/clothing/gloves"
+#define FILE_DIR "code/modules/clothing/head"
+#define FILE_DIR "code/modules/clothing/masks"
+#define FILE_DIR "code/modules/clothing/shoes"
+#define FILE_DIR "code/modules/clothing/spacesuits"
+#define FILE_DIR "code/modules/clothing/suits"
+#define FILE_DIR "code/modules/clothing/under"
+#define FILE_DIR "code/modules/clothing/under/jobs"
+#define FILE_DIR "code/modules/customitems"
+#define FILE_DIR "code/modules/destilery"
+#define FILE_DIR "code/modules/DetectiveWork"
+#define FILE_DIR "code/modules/events"
+#define FILE_DIR "code/modules/flufftext"
+#define FILE_DIR "code/modules/food"
+#define FILE_DIR "code/modules/genetics"
+#define FILE_DIR "code/modules/icon generation"
+#define FILE_DIR "code/modules/library"
+#define FILE_DIR "code/modules/liquid"
+#define FILE_DIR "code/modules/maps"
+#define FILE_DIR "code/modules/mining"
+#define FILE_DIR "code/modules/mob"
+#define FILE_DIR "code/modules/mob/dead"
+#define FILE_DIR "code/modules/mob/dead/observer"
+#define FILE_DIR "code/modules/mob/living"
+#define FILE_DIR "code/modules/mob/living/blob"
+#define FILE_DIR "code/modules/mob/living/carbon"
+#define FILE_DIR "code/modules/mob/living/carbon/alien"
+#define FILE_DIR "code/modules/mob/living/carbon/alien/humanoid"
+#define FILE_DIR "code/modules/mob/living/carbon/alien/humanoid/caste"
+#define FILE_DIR "code/modules/mob/living/carbon/alien/larva"
+#define FILE_DIR "code/modules/mob/living/carbon/alien/special"
+#define FILE_DIR "code/modules/mob/living/carbon/brain"
+#define FILE_DIR "code/modules/mob/living/carbon/human"
+#define FILE_DIR "code/modules/mob/living/carbon/metroid"
+#define FILE_DIR "code/modules/mob/living/carbon/monkey"
+#define FILE_DIR "code/modules/mob/living/silicon"
+#define FILE_DIR "code/modules/mob/living/silicon/ai"
+#define FILE_DIR "code/modules/mob/living/silicon/ai/freelook"
+#define FILE_DIR "code/modules/mob/living/silicon/decoy"
+#define FILE_DIR "code/modules/mob/living/silicon/pai"
+#define FILE_DIR "code/modules/mob/living/silicon/robot"
+#define FILE_DIR "code/modules/mob/living/simple_animal"
+#define FILE_DIR "code/modules/mob/living/simple_animal/friendly"
+#define FILE_DIR "code/modules/mob/living/simple_animal/hostile"
+#define FILE_DIR "code/modules/mob/living/simple_animal/hostile/retaliate"
+#define FILE_DIR "code/modules/mob/new_player"
+#define FILE_DIR "code/modules/organs"
+#define FILE_DIR "code/modules/paperwork"
+#define FILE_DIR "code/modules/power"
+#define FILE_DIR "code/modules/power/antimatter"
+#define FILE_DIR "code/modules/power/singularity"
+#define FILE_DIR "code/modules/power/singularity/particle_accelerator"
+#define FILE_DIR "code/modules/projectiles"
+#define FILE_DIR "code/modules/projectiles/ammunition"
+#define FILE_DIR "code/modules/projectiles/guns"
+#define FILE_DIR "code/modules/projectiles/guns/energy"
+#define FILE_DIR "code/modules/projectiles/guns/projectile"
+#define FILE_DIR "code/modules/projectiles/projectile"
+#define FILE_DIR "code/modules/reagents"
+#define FILE_DIR "code/modules/reagents/reagent_containers"
+#define FILE_DIR "code/modules/reagents/reagent_containers/food"
+#define FILE_DIR "code/modules/reagents/reagent_containers/food/drinks"
+#define FILE_DIR "code/modules/reagents/reagent_containers/food/drinks/bottle"
+#define FILE_DIR "code/modules/reagents/reagent_containers/food/snacks"
+#define FILE_DIR "code/modules/reagents/reagent_containers/glass"
+#define FILE_DIR "code/modules/reagents/reagent_containers/glass/bottle"
+#define FILE_DIR "code/modules/recycling"
+#define FILE_DIR "code/modules/research"
+#define FILE_DIR "code/modules/research/xenoarchaeology"
+#define FILE_DIR "code/modules/research/xenoarchaeology/artifact"
+#define FILE_DIR "code/modules/research/xenoarchaeology/artifact/effects"
+#define FILE_DIR "code/modules/research/xenoarchaeology/finds"
+#define FILE_DIR "code/modules/research/xenoarchaeology/machinery"
+#define FILE_DIR "code/modules/research/xenoarchaeology/tools"
+#define FILE_DIR "code/modules/scripting"
+#define FILE_DIR "code/modules/scripting/AST"
+#define FILE_DIR "code/modules/scripting/AST/Operators"
+#define FILE_DIR "code/modules/scripting/Implementations"
+#define FILE_DIR "code/modules/scripting/Interpreter"
+#define FILE_DIR "code/modules/scripting/Parser"
+#define FILE_DIR "code/modules/scripting/Scanner"
+#define FILE_DIR "code/modules/security levels"
+#define FILE_DIR "code/modules/surgery"
 #define FILE_DIR "code/TriDimension"
+#define FILE_DIR "code/unused"
+#define FILE_DIR "code/unused/beast"
+#define FILE_DIR "code/unused/computer2"
+#define FILE_DIR "code/unused/disease2"
+#define FILE_DIR "code/unused/gamemodes"
+#define FILE_DIR "code/unused/hivebot"
+#define FILE_DIR "code/unused/mining"
+#define FILE_DIR "code/unused/optics"
+#define FILE_DIR "code/unused/pda2"
+#define FILE_DIR "code/unused/powerarmor"
+#define FILE_DIR "code/unused/spacecraft"
 #define FILE_DIR "code/WorkInProgress"
+#define FILE_DIR "code/WorkInProgress/AI_Visibility"
+#define FILE_DIR "code/WorkInProgress/animusstation"
+#define FILE_DIR "code/WorkInProgress/Apples"
 #define FILE_DIR "code/WorkInProgress/Cael_Aislinn"
+#define FILE_DIR "code/WorkInProgress/Cael_Aislinn/Economy"
 #define FILE_DIR "code/WorkInProgress/Cael_Aislinn/Jungle"
 #define FILE_DIR "code/WorkInProgress/Cael_Aislinn/Rust"
 #define FILE_DIR "code/WorkInProgress/Cael_Aislinn/ShieldGen"
 #define FILE_DIR "code/WorkInProgress/Cael_Aislinn/Supermatter"
+#define FILE_DIR "code/WorkInProgress/carn"
+#define FILE_DIR "code/WorkInProgress/Chinsky"
+#define FILE_DIR "code/WorkInProgress/Cib"
+#define FILE_DIR "code/WorkInProgress/Cib/amorph"
+#define FILE_DIR "code/WorkInProgress/Mini"
+#define FILE_DIR "code/WorkInProgress/Mloc"
+#define FILE_DIR "code/WorkInProgress/organs"
+#define FILE_DIR "code/WorkInProgress/Ported"
+#define FILE_DIR "code/WorkInProgress/Ported/Abi79"
+#define FILE_DIR "code/WorkInProgress/Ported/Bureaucracy"
+#define FILE_DIR "code/WorkInProgress/Ported/Spawners"
+#define FILE_DIR "code/WorkInProgress/Sigyn"
+#define FILE_DIR "code/WorkInProgress/Sigyn/Department Sec"
+#define FILE_DIR "code/WorkInProgress/Sigyn/Softcurity"
+#define FILE_DIR "code/WorkInProgress/SkyMarshal"
 #define FILE_DIR "code/WorkInProgress/Susan"
+#define FILE_DIR "code/WorkInProgress/Tastyfish"
+#define FILE_DIR "code/WorkInProgress/virus2"
+#define FILE_DIR "code/WorkInProgress/virus2/Disease2"
+#define FILE_DIR "code/WorkInProgress/Wrongnumber"
+#define FILE_DIR "code/ZAS"
 #define FILE_DIR "html"
 #define FILE_DIR "icons"
 #define FILE_DIR "icons/48x48"
@@ -36,6 +257,9 @@
 #define FILE_DIR "icons/turf"
 #define FILE_DIR "icons/vending_icons"
 #define FILE_DIR "icons/xenoarch_icons"
+#define FILE_DIR "interface"
+#define FILE_DIR "maps"
+#define FILE_DIR "maps/RandomZLevels"
 #define FILE_DIR "sound"
 #define FILE_DIR "sound/AI"
 #define FILE_DIR "sound/ambience"
@@ -53,8 +277,7 @@
 #define FILE_DIR "sound/voice"
 #define FILE_DIR "sound/weapons"
 #define FILE_DIR "tools"
-#define FILE_DIR "tools/AddToChangelog"
-#define FILE_DIR "tools/AddToChangelog/AddToChangelog"
+#define FILE_DIR "tools/Redirector"
 // END_FILE_DIR
 // BEGIN_PREFERENCES
 #define DEBUG
@@ -807,6 +1030,7 @@
 #include "code\modules\events\money_hacker.dm"
 #include "code\modules\events\money_lotto.dm"
 #include "code\modules\events\money_spam.dm"
+#include "code\modules\events\organ_failure.dm"
 #include "code\modules\events\prison_break.dm"
 #include "code\modules\events\radiation_storm.dm"
 #include "code\modules\events\rogue_drones.dm"
@@ -816,6 +1040,7 @@
 #include "code\modules\events\spontaneous_appendicitis.dm"
 #include "code\modules\events\viral_infection.dm"
 #include "code\modules\events\viral_outbreak.dm"
+#include "code\modules\events\wallrot.dm"
 #include "code\modules\flufftext\Dreaming.dm"
 #include "code\modules\flufftext\Hallucination.dm"
 #include "code\modules\flufftext\TextFilters.dm"
@@ -837,6 +1062,7 @@
 #include "code\modules\mining\ores_coins.dm"
 #include "code\modules\mining\satchel_ore_boxdm.dm"
 #include "code\modules\mob\death.dm"
+#include "code\modules\mob\emote.dm"
 #include "code\modules\mob\inventory.dm"
 #include "code\modules\mob\login.dm"
 #include "code\modules\mob\logout.dm"
@@ -1248,6 +1474,7 @@
 #include "code\WorkInProgress\autopsy.dm"
 #include "code\WorkInProgress\buildmode.dm"
 #include "code\WorkInProgress\explosion_particles.dm"
+#include "code\WorkInProgress\periodic_news.dm"
 #include "code\WorkInProgress\Cael_Aislinn\meteor_battery.dm"
 #include "code\WorkInProgress\Cael_Aislinn\sculpture.dm"
 #include "code\WorkInProgress\Cael_Aislinn\Economy\Accounts.dm"
diff --git a/code/WorkInProgress/periodic_news.dm b/code/WorkInProgress/periodic_news.dm
new file mode 100644
index 0000000000..9218686926
--- /dev/null
+++ b/code/WorkInProgress/periodic_news.dm
@@ -0,0 +1,117 @@
+// This system defines news that will be displayed in the course of a round.
+// Uses BYOND's type system to put everything into a nice format
+
+/datum/news_announcement
+	var
+		round_time // time of the round at which this should be announced, in seconds
+		message // body of the message
+		author = "NanoTrasen Editor"
+		channel_name = "Tau Ceti Daily"
+		can_be_redacted = 0
+
+	revolution_inciting_event
+
+		paycuts_suspicion
+			round_time = 60*10
+			message = "Reports have leaked that Nanotrasen Inc. is planning to put paycuts into effect on many of its Research Stations in Tau Ceti. Apparently these research stations haven't been able to yield the expected revenue, and thus adjustments have to be made."
+			author = "Unauthorized"
+
+		paycuts_confirmation
+			round_time = 60*40
+			message = "Earlier rumours about paycuts on Research Stations in the Tau Ceti system have been confirmed. Shockingly, however, the cuts will only affect lower tier personnel. Heads of Staff will, according to our sources, not be affected."
+			author = "Unauthorized"
+
+		human_experiments
+			round_time = 60*90
+			message = "Unbelievable reports about human experimentation have reached our ears. According to a refugee from one of the Tau Ceti Research Stations, their station, in order to increase revenue, has refactored several of their facilities to perform experiments on live humans, including virology research, genetic manipulation, and \"feeding them to the slimes to see what happens\". Allegedly, these test subjects were neither humanified monkeys nor volunteers, but rather unqualified staff that were forced into the experiments, and reported to have died in a \"work accident\" by Nanotrasen Inc."
+			author = "Unauthorized"
+
+	bluespace_research
+
+		announcement
+			round_time = 60*20
+			message = "The new field of research trying to explain several interesting spacetime oddities, also known as \"Bluespace Research\", has reached new heights. Of the several hundred space stations now orbiting in Tau Ceti, fifteen are now specially equipped to experiment with and research Bluespace effects. Rumours have it some of these stations even sport functional \"travel gates\" that can instantly move a whole research team to an alternate reality."
+
+	random_junk
+		cheesy_honkers
+			author = "Assistant Editor Carl Ritz"
+			channel_name = "The Gibson Gazzette"
+			message = "Do cheesy honkers increase risk of having a miscarriage? Several health administrations say so!"
+			round_time = 60 * 15
+
+		net_block
+			author = "Assistant Editor Carl Ritz"
+			channel_name = "The Gibson Gazzette"
+			message = "Several corporations banding together to block access to 'wetskrell.nt', site administrators claiming violation of net laws."
+			round_time = 60 * 50
+
+		found_ssd
+			channel_name = "Tau Ceti Daily"
+			author = "Doctor Eric Hanfield"
+
+			message = "Several people have been found unconscious at their terminals. It is thought that it was due to a lack of sleep or of simply migraines from staring at the screen too long. Camera footage reveals that many of them were playing games instead of working and their pay has been docked accordingly."
+			round_time = 60 * 90
+
+	lotus_tree
+		explosions
+			channel_name = "Tau Ceti Daily"
+			author = "Reporter Leland H. Howards"
+
+			message = "The newly-christened civillian transport Lotus Tree suffered two very large explosions near the bridge today, and there are unconfirmed reports that the death toll has passed 50. The cause of the explosions remain unknown, but there is speculation that it might have something to do with the recent change of regulation in the Moore-Lee Corporation, a major funder of the ship, when M-L announced that they were officially acknowledging inter-species marriage and providing couples with marriage tax-benefits."
+			round_time = 60 * 30
+
+	food_riots
+		breaking_news
+			channel_name = "Tau Ceti Daily"
+			author = "Reporter Ro'kii Ar-Raqis"
+
+			message = "Breaking news: Food riots have broken out throughout the Refuge asteroid colony in the Tenebrae Lupus system. This comes only hours after NanoTrasen officials announced they will no longer trade with the colony, citing the increased presence of \"hostile factions\" on the colony has made trade too dangerous to continue. NanoTrasen officials have not given any details about said factions. More on that at the top of the hour."
+			round_time = 60 * 10
+
+		more
+			channel_name = "Tau Ceti Daily"
+			author = "Reporter Ro'kii Ar-Raqis"
+
+			message = "More on the Refuge food riots: The Refuge Council has condemned NanoTrasen's withdrawal from the colony, claiming \"there has been no increase in anti-NanoTrasen activity\", and \"\[the only] reason NanoTrasen withdrew was because the \[Tenebrae Lupus] system's Plasma deposits have been completely mined out. We have little to trade with them now\". NanoTrasen officials have denied these allegations, calling them \"further proof\" of the colony's anti-NanoTrasen stance. Meanwhile, Refuge Security has been unable to quell the riots. More on this at 6."
+			round_time = 60 * 60
+
+
+var/global/list/newscaster_standard_feeds = list(/datum/news_announcement/bluespace_research, /datum/news_announcement/lotus_tree, /datum/news_announcement/random_junk,  /datum/news_announcement/lotus_tree)
+
+proc/process_newscaster()
+	check_for_newscaster_updates(ticker.mode.newscaster_announcements)
+
+var/global/tmp/announced_news_types = list()
+proc/check_for_newscaster_updates(type)
+	for(var/subtype in typesof(type)-type)
+		var/datum/news_announcement/news = new subtype()
+		if(news.round_time * 10 <= world.time && !(subtype in announced_news_types))
+			announced_news_types += subtype
+			announce_newscaster_news(news)
+
+proc/announce_newscaster_news(datum/news_announcement/news)
+
+	var/datum/feed_message/newMsg = new /datum/feed_message
+	newMsg.author = news.author
+	newMsg.is_admin_message = !news.can_be_redacted
+
+	newMsg.body = news.message
+
+	var/datum/feed_channel/sendto
+	for(var/datum/feed_channel/FC in news_network.network_channels)
+		if(FC.channel_name == news.channel_name)
+			sendto = FC
+			break
+
+	if(!sendto)
+		sendto = new /datum/feed_channel
+		sendto.channel_name = news.channel_name
+		sendto.author = news.author
+		sendto.locked = 1
+		sendto.is_admin_channel = 1
+		news_network.network_channels += sendto
+
+	sendto.messages += newMsg
+
+	for(var/obj/machinery/newscaster/NEWSCASTER in allCasters)
+		NEWSCASTER.newsAlert(news.channel_name)
diff --git a/code/__HELPERS/logging.dm b/code/__HELPERS/logging.dm
index 2daf3690d8..8a5b496328 100644
--- a/code/__HELPERS/logging.dm
+++ b/code/__HELPERS/logging.dm
@@ -15,6 +15,16 @@
 	if (config.log_admin)
 		diary << "\[[time_stamp()]]ADMIN: [text]"
 
+
+/proc/log_debug(text)
+	if (config.log_debug)
+		diary << "\[[time_stamp()]]DEBUG: [text]"
+
+	for(var/client/C in admins)
+		if(C.prefs.toggles & CHAT_DEBUGLOGS)
+			C << "DEBUG: [text]"
+
+
 /proc/log_game(text)
 	if (config.log_game)
 		diary << "\[[time_stamp()]]GAME: [text]"
diff --git a/code/__HELPERS/unsorted.dm b/code/__HELPERS/unsorted.dm
index 659948266e..9b2c323e3a 100644
--- a/code/__HELPERS/unsorted.dm
+++ b/code/__HELPERS/unsorted.dm
@@ -1327,6 +1327,7 @@ proc/is_hot(obj/item/W as obj)
 
 //Is this even used for anything besides balloons? Yes I took out the W:lit stuff because : really shouldnt be used.
 /proc/is_sharp(obj/item/W as obj)		// For the record, WHAT THE HELL IS THIS METHOD OF DOING IT?
+	if(W.sharp) return 1
 	return ( \
 		istype(W, /obj/item/weapon/screwdriver)                   || \
 		istype(W, /obj/item/weapon/pen)                           || \
diff --git a/code/controllers/configuration.dm b/code/controllers/configuration.dm
index f537bbae3e..02f8c521aa 100644
--- a/code/controllers/configuration.dm
+++ b/code/controllers/configuration.dm
@@ -8,6 +8,7 @@
 	var/log_access = 0					// log login/logout
 	var/log_say = 0						// log client say
 	var/log_admin = 0					// log admin actions
+	var/log_debug = 1					// log debug output
 	var/log_game = 0					// log game events
 	var/log_vote = 0					// log voting
 	var/log_whisper = 0					// log client whisper
@@ -193,6 +194,9 @@
 				if ("log_admin")
 					config.log_admin = 1
 
+				if ("log_debug")
+					config.log_debug = text2num(value)
+
 				if ("log_game")
 					config.log_game = 1
 
diff --git a/code/controllers/master_controller.dm b/code/controllers/master_controller.dm
index 25dc9804d9..c618079f68 100644
--- a/code/controllers/master_controller.dm
+++ b/code/controllers/master_controller.dm
@@ -117,6 +117,7 @@ datum/controller/game_controller/proc/process()
 				controller_iteration++
 
 				vote.process()
+				process_newscaster()
 
 				//AIR
 
diff --git a/code/controllers/voting.dm b/code/controllers/voting.dm
index 69915279a8..c8336d85f2 100644
--- a/code/controllers/voting.dm
+++ b/code/controllers/voting.dm
@@ -165,7 +165,7 @@ datum/controller/vote
 
 	proc/initiate_vote(var/vote_type, var/initiator_key)
 		if(!mode)
-			if(started_time != null)
+			if(started_time != null && !check_rights(R_ADMIN))
 				var/next_allowed_time = (started_time + config.vote_delay)
 				if(next_allowed_time > world.time)
 					return 0
@@ -200,7 +200,13 @@ datum/controller/vote
 
 			log_vote(text)
 			world << "<font color='purple'><b>[text]</b>\nType vote to place your votes.\nYou have [config.vote_period/10] seconds to vote.</font>"
-			world << sound('weapons/smg_empty_alarm.ogg')
+			switch(vote_type)
+				if("crew_transfer")
+					world << sound('sound/voice/Serithi/Shuttlehere.ogg')
+				if("gamemode")
+					world << sound('sound/voice/Serithi/pretenddemoc.ogg')
+				if("custom")
+					world << sound('sound/voice/Serithi/weneedvote.ogg')
 			if(mode == "gamemode" && going)
 				going = 0
 				world << "<font color='red'><b>Round start has been delayed.</b></font>"
diff --git a/code/game/gamemodes/autotraitor/autotraitor.dm b/code/game/gamemodes/autotraitor/autotraitor.dm
index c0368c0ad0..c5b159dd1a 100644
--- a/code/game/gamemodes/autotraitor/autotraitor.dm
+++ b/code/game/gamemodes/autotraitor/autotraitor.dm
@@ -142,7 +142,7 @@
 		traitorcheckloop()
 
 
-/*
+
 /datum/game_mode/traitor/autotraitor/latespawn(mob/living/carbon/human/character)
 	..()
 	if(emergency_shuttle.departed)
@@ -192,6 +192,5 @@
 				//message_admins("New traitor roll failed.  No new traitor.")
 	//else
 		//message_admins("Late Joiner does not have Be Syndicate")
-*/
 
 
diff --git a/code/game/gamemodes/game_mode.dm b/code/game/gamemodes/game_mode.dm
index 10c0c3f631..ee289f92fe 100644
--- a/code/game/gamemodes/game_mode.dm
+++ b/code/game/gamemodes/game_mode.dm
@@ -27,6 +27,7 @@
 	var/required_players_secret = 0 //Minimum number of players for that game mode to be chose in Secret
 	var/required_enemies = 0
 	var/recommended_enemies = 0
+	var/newscaster_announcements = null
 	var/uplink_welcome = "Syndicate Uplink Console:"
 	var/uplink_uses = 10
 	var/uplink_items = {"Highly Visible and Dangerous Weapons;
@@ -279,6 +280,7 @@ Implants;
 			if(player.client.prefs.be_special & role)
 				if(!jobban_isbanned(player, "Syndicate") && !jobban_isbanned(player, roletext)) //Nodrak/Carn: Antag Job-bans
 					candidates += player.mind				// Get a list of all the people who want to be the antagonist for this round
+					log_debug("[player.key] had [roletext] enabled, so drafting them.")
 
 	if(restricted_jobs)
 		for(var/datum/mind/player in candidates)
@@ -306,6 +308,7 @@ Implants;
 			applicant = pick(drafted)
 			if(applicant)
 				candidates += applicant
+				log_debug("[applicant.key] was force-drafted as [roletext], because there aren't enough candidates.")
 				drafted.Remove(applicant)
 
 		else												// Not enough scrubs, ABORT ABORT ABORT
@@ -331,7 +334,7 @@ Implants;
 			if(applicant)
 				candidates += applicant
 				drafted.Remove(applicant)
-				message_admins("[applicant.key] drafted into antagonist role against their preferences.")
+				log_debug("[applicant.key] was force-drafted as [roletext], because there aren't enough candidates.")
 
 		else												// Not enough scrubs, ABORT ABORT ABORT
 			break
@@ -340,9 +343,10 @@ Implants;
 							//			recommended_enemies if the number of people with that role set to yes is less than recomended_enemies,
 							//			Less if there are not enough valid players in the game entirely to make recommended_enemies.
 
-/*
+
 /datum/game_mode/proc/latespawn(var/mob)
 
+/*
 /datum/game_mode/proc/check_player_role_pref(var/role, var/mob/new_player/player)
 	if(player.preferences.be_special & role)
 		return 1
@@ -377,6 +381,9 @@ Implants;
 			heads += player.mind
 	return heads
 
+/datum/game_mode/New()
+	newscaster_announcements = pick(newscaster_standard_feeds)
+
 //////////////////////////
 //Reports player logouts//
 //////////////////////////
diff --git a/code/game/gamemodes/revolution/rp_revolution.dm b/code/game/gamemodes/revolution/rp_revolution.dm
index 2159138448..9b14622537 100644
--- a/code/game/gamemodes/revolution/rp_revolution.dm
+++ b/code/game/gamemodes/revolution/rp_revolution.dm
@@ -8,6 +8,9 @@
 	required_enemies = 3
 	recommended_enemies = 3
 
+	newscaster_announcements = /datum/news_announcement/revolution_inciting_event
+
+	var/last_command_report = 0
 	var/list/heads = list()
 	var/tried_to_add_revheads = 0
 
@@ -57,7 +60,7 @@
 			var/datum/objective/mutiny/rp/rev_obj = new
 			rev_obj.owner = rev_mind
 			rev_obj.target = head_mind
-			rev_obj.explanation_text = "Assassinate or capture [head_mind.name], the [head_mind.assigned_role]."
+			rev_obj.explanation_text = "Assassinate, convert or capture [head_mind.name], the [head_mind.assigned_role]."
 			rev_mind.objectives += rev_obj
 
 		update_rev_icons_added(rev_mind)
@@ -183,8 +186,7 @@
 				active_revs++
 
 		if(active_revs == 0)
-			log_admin("There are zero active head revolutionists, trying to add some..")
-			message_admins("There are zero active head revolutionists, trying to add some..")
+			log_debug("There are zero active heads of revolution, trying to add some..")
 			var/added_heads = 0
 			for(var/mob/living/carbon/human/H in world) if(H.client && H.mind && H.client.inactivity <= 10*60*20 && H.mind in revolutionaries)
 				head_revolutionaries += H.mind
@@ -210,4 +212,28 @@
 				message_admins("Unable to add new heads of revolution.")
 				tried_to_add_revheads = world.time + 6000 // wait 10 minutes
 
-	return ..()
\ No newline at end of file
+	if(last_command_report == 0 && world.time >= 60 * 10)
+		command_alert("We are regrettably announcing that your performance has been disappointing, and we are thus forced to cut down on financial support to your station. To achieve this, the pay of all personnal, except the Heads of Staff, has been halved.")
+		last_command_report = 1
+	else if(last_command_report == 1 && world.time >= 60 * 30)
+		command_alert("Statistics hint that a high amount of leisure time, and associated activities, are responsible for the poor performance of many of our stations. You are to bolt and close down any leisure facilities, such as the holodeck, the theatre and the bar. Food can be distributed through vendors and the kitchen.")
+		last_command_report = 2
+	else if(last_command_report == 2 && world.time >= 60 * 60)
+		command_alert("It is reported that merely closing down leisure facilities has not been successful. You and your Heads of Staff are to ensure that all crew are working hard, and not wasting time or energy. Any crew caught off duty without leave from their Head of Staff are to be warned, and on repeated offence, to be brigged until the next transfer shuttle arrives, which will take them to facilities where they can be of more use.")
+		last_command_report = 3
+
+	return ..()
+
+
+/datum/game_mode/revolution/rp_revolution/latespawn(mob/M)
+	if(M.mind.assigned_role in command_positions)
+		log_debug("Adding head kill/capture/convert objective for [M.name]")
+		heads += M
+
+		for(var/datum/mind/rev_mind in head_revolutionaries)
+			var/datum/objective/mutiny/rp/rev_obj = new
+			rev_obj.owner = rev_mind
+			rev_obj.target = M.mind
+			rev_obj.explanation_text = "Assassinate, convert or capture [M.name], the [M.mind.assigned_role]."
+			rev_mind.objectives += rev_obj
+			rev_mind.current << "\red A new Head of Staff, [M.name], the [M.mind.assigned_role] has appeared. Your objectives have been updated."
\ No newline at end of file
diff --git a/code/game/objects/items/bodybag.dm b/code/game/objects/items/bodybag.dm
index 1c6fe70e8c..ba63563d7c 100644
--- a/code/game/objects/items/bodybag.dm
+++ b/code/game/objects/items/bodybag.dm
@@ -84,3 +84,45 @@
 		icon_state = icon_closed
 	else
 		icon_state = icon_opened
+
+
+/obj/item/bodybag/cryobag
+	name = "stasis bag"
+	desc = "A folded, non-reusable bag designed for the preservation of an occupant's brain by stasis."
+	icon = 'icons/obj/cryobag.dmi'
+	icon_state = "bodybag_folded"
+
+
+	attack_self(mob/user)
+		var/obj/structure/closet/body_bag/cryobag/R = new /obj/structure/closet/body_bag/cryobag(user.loc)
+		R.add_fingerprint(user)
+		del(src)
+
+
+
+/obj/structure/closet/body_bag/cryobag
+	name = "stasis bag"
+	desc = "A non-reusable plastic bag designed for the preservation of an occupant's brain by stasis."
+	icon = 'icons/obj/cryobag.dmi'
+	icon_state = "bodybag_closed"
+	icon_closed = "bodybag_closed"
+	icon_opened = "bodybag_open"
+	density = 0
+
+	var/used = 0
+
+	open()
+		. = ..()
+		if(used)
+			var/obj/item/O = new/obj/item(src.loc)
+			O.name = "used stasis bag"
+			O.icon = src.icon
+			O.icon_state = "bodybag_used"
+			O.desc = "Pretty useless now.."
+			del(src)
+
+	MouseDrop(over_object, src_location, over_location)
+		if((over_object == usr && (in_range(src, usr) || usr.contents.Find(src))))
+			if(!ishuman(usr))	return
+			usr << "\red You can't fold that up anymore.."
+		..()
\ No newline at end of file
diff --git a/code/game/turfs/simulated/walls.dm b/code/game/turfs/simulated/walls.dm
index 5d055f1a8c..f06eb81ba3 100644
--- a/code/game/turfs/simulated/walls.dm
+++ b/code/game/turfs/simulated/walls.dm
@@ -3,6 +3,7 @@
 	desc = "A huge chunk of metal used to seperate rooms."
 	icon = 'icons/turf/walls.dmi'
 	var/mineral = "metal"
+	var/rotting = 0
 	opacity = 1
 	density = 1
 	blocks_air = 1
@@ -59,9 +60,11 @@
 			P.roll_and_drop(src)
 		else
 			O.loc = src
+
 	ChangeTurf(/turf/simulated/floor/plating)
 
 /turf/simulated/wall/ex_act(severity)
+	if(rotting) severity = 1.0
 	switch(severity)
 		if(1.0)
 			//SN src = null
@@ -84,7 +87,7 @@
 	return
 
 /turf/simulated/wall/blob_act()
-	if(prob(50))
+	if(prob(50) || rotting)
 		dismantle_wall()
 
 /turf/simulated/wall/attack_paw(mob/user as mob)
@@ -103,11 +106,11 @@
 
 /turf/simulated/wall/attack_animal(mob/living/simple_animal/M as mob)
 	if(M.wall_smash)
-		if (istype(src, /turf/simulated/wall/r_wall))
+		if (istype(src, /turf/simulated/wall/r_wall) && !rotting)
 			M << text("\blue This wall is far too strong for you to destroy.")
 			return
 		else
-			if (prob(40))
+			if (prob(40) || rotting)
 				M << text("\blue You smash through the wall.")
 				dismantle_wall(1)
 				return
@@ -120,7 +123,7 @@
 
 /turf/simulated/wall/attack_hand(mob/user as mob)
 	if (HULK in user.mutations)
-		if (prob(40))
+		if (prob(40) || rotting)
 			usr << text("\blue You smash through the wall.")
 			usr.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" ))
 			dismantle_wall(1)
@@ -129,6 +132,11 @@
 			usr << text("\blue You punch the wall.")
 			return
 
+	if(rotting)
+		user << "\blue The wall crumbles under your touch."
+		dismantle_wall()
+		return
+
 	user << "\blue You push the wall but nothing happens!"
 	playsound(src.loc, 'sound/weapons/Genhit.ogg', 25, 1)
 	src.add_fingerprint(user)
@@ -143,6 +151,21 @@
 	//get the user's location
 	if( !istype(user.loc, /turf) )	return	//can't do this stuff whilst inside objects and such
 
+	if(rotting)
+		if(istype(W, /obj/item/weapon/weldingtool) )
+			var/obj/item/weapon/weldingtool/WT = W
+			if( WT.remove_fuel(0,user) )
+				user << "<span class='notice'>You burn away the fungi with \the [WT].</span>"
+				playsound(src.loc, 'sound/items/Welder.ogg', 10, 1)
+				for(var/obj/effect/E in src) if(E.name == "Wallrot")
+					del E
+				rotting = 0
+				return
+		else if(!is_sharp(W) && W.force >= 10 || W.force >= 20)
+			user << "<span class='notice'>\The [src] crumbles away under the force of your [W.name].</span>"
+			src.dismantle_wall(1)
+			return
+
 	//THERMITE related stuff. Calls src.thermitemelt() which handles melting simulated walls and the relevant effects
 	if( thermite )
 		if( istype(W, /obj/item/weapon/weldingtool) )
@@ -284,6 +307,24 @@
 		return attack_hand(user)
 	return
 
+// Wall-rot effect, a nasty fungus that destroys walls.
+/turf/simulated/wall/proc/rot()
+	if(!rotting)
+		rotting = 1
+
+		var/number_rots = rand(2,3)
+		for(var/i=0, i<number_rots, i++)
+			var/obj/effect/overlay/O = new/obj/effect/overlay( src )
+			O.name = "Wallrot"
+			O.desc = "Ick..."
+			O.icon = 'icons/effects/wallrot.dmi'
+			O.pixel_x += rand(-10, 10)
+			O.pixel_y += rand(-10, 10)
+			O.anchored = 1
+			O.density = 1
+			O.layer = 5
+			O.mouse_opacity = 0
+
 /turf/simulated/wall/proc/thermitemelt(mob/user as mob)
 	if(mineral == "diamond")
 		return
@@ -307,10 +348,18 @@
 	return
 
 /turf/simulated/wall/meteorhit(obj/M as obj)
-	if (prob(15))
+	if (prob(15) && !rotting)
 		dismantle_wall()
-	else if(prob(70))
+	else if(prob(70) && !rotting)
 		ChangeTurf(/turf/simulated/floor/plating)
 	else
 		ReplaceWithLattice()
-	return 0
\ No newline at end of file
+	return 0
+
+/turf/simulated/wall/Del()
+	for(var/obj/effect/E in src) if(E.name == "Wallrot") del E
+	..()
+
+/turf/simulated/wall/ChangeTurf(var/newtype)
+	for(var/obj/effect/E in src) if(E.name == "Wallrot") del E
+	..(newtype)
\ No newline at end of file
diff --git a/code/game/turfs/simulated/walls_reinforced.dm b/code/game/turfs/simulated/walls_reinforced.dm
index 455f474dbe..c2ef4050c1 100644
--- a/code/game/turfs/simulated/walls_reinforced.dm
+++ b/code/game/turfs/simulated/walls_reinforced.dm
@@ -11,7 +11,7 @@
 
 /turf/simulated/wall/r_wall/attack_hand(mob/user as mob)
 	if (HULK in user.mutations)
-		if (prob(10))
+		if (prob(10) || rotting)
 			usr << text("\blue You smash through the wall.")
 			usr.say(pick(";RAAAAAAAARGH!", ";HNNNNNNNNNGGGGGGH!", ";GWAAAAAAAARRRHHH!", "NNNNNNNNGGGGGGGGHH!", ";AAAAAAARRRGH!" ))
 			dismantle_wall(1)
@@ -20,6 +20,10 @@
 			usr << text("\blue You punch the wall.")
 			return
 
+	if(rotting)
+		user << "\blue This wall feels rather unstable."
+		return
+
 	user << "\blue You push the wall but nothing happens!"
 	playsound(src.loc, 'sound/weapons/Genhit.ogg', 25, 1)
 	src.add_fingerprint(user)
@@ -35,6 +39,20 @@
 	//get the user's location
 	if( !istype(user.loc, /turf) )	return	//can't do this stuff whilst inside objects and such
 
+	if(rotting)
+		if(istype(W, /obj/item/weapon/weldingtool) )
+			var/obj/item/weapon/weldingtool/WT = W
+			if( WT.remove_fuel(0,user) )
+				user << "<span class='notice'>You burn away the fungi with \the [WT].</span>"
+				playsound(src.loc, 'sound/items/Welder.ogg', 10, 1)
+				for(var/obj/effect/E in src) if(E.name == "Wallrot")
+					del E
+				rotting = 0
+				return
+		else if(!is_sharp(W) && W.force >= 10 || W.force >= 20)
+			user << "<span class='notice'>\The [src] crumbles away under the force of your [W.name].</span>"
+			src.dismantle_wall()
+			return
 
 	//THERMITE related stuff. Calls src.thermitemelt() which handles melting simulated walls and the relevant effects
 	if( thermite )
diff --git a/code/modules/admin/admin_verbs.dm b/code/modules/admin/admin_verbs.dm
index abcb3d52b7..25daafc9f4 100644
--- a/code/modules/admin/admin_verbs.dm
+++ b/code/modules/admin/admin_verbs.dm
@@ -64,6 +64,7 @@ var/list/admin_verbs_admin = list(
 	/client/proc/cmd_admin_change_custom_event,
 	/client/proc/cmd_admin_rejuvenate,
 	/client/proc/toggleattacklogs,
+	/client/proc/toggledebuglogs,
 	/datum/admins/proc/show_skills,
 	/client/proc/check_customitem_activity
 )
@@ -134,7 +135,8 @@ var/list/admin_verbs_debug = list(
 	/client/proc/reload_admins,
 	/client/proc/restart_controller,
 	/client/proc/enable_debug_verbs,
-	/client/proc/callproc
+	/client/proc/callproc,
+	/client/proc/toggledebuglogs
 	)
 var/list/admin_verbs_possess = list(
 	/proc/possess,
@@ -222,6 +224,7 @@ var/list/admin_verbs_mod = list(
 	/client/proc/cmd_admin_pm_context,	/*right-click adminPM interface*/
 	/client/proc/cmd_admin_pm_panel,	/*admin-pm list*/
 	/client/proc/debug_variables,		/*allows us to -see- the variables of any instance in the game.*/
+	/client/proc/toggledebuglogs,
 	/datum/admins/proc/PlayerNotes,
 	/client/proc/admin_ghost,			/*allows us to ghost/reenter body at will*/
 	/client/proc/cmd_mod_say,
@@ -721,4 +724,15 @@ var/list/admin_verbs_mod = list(
 	if (prefs.toggles & CHAT_ATTACKLOGS)
 		usr << "You now will get attack log messages"
 	else
-		usr << "You now won't get attack log messages"
+		usr << "You now won't get attack log messages"
+
+
+/client/proc/toggledebuglogs()
+	set name = "Toggle Debug Log Messages"
+	set category = "Preferences"
+
+	prefs.toggles ^= CHAT_DEBUGLOGS
+	if (prefs.toggles & CHAT_DEBUGLOGS)
+		usr << "You now will get debug log messages"
+	else
+		usr << "You now won't get debug log messages"
\ No newline at end of file
diff --git a/code/modules/events/event_dynamic.dm b/code/modules/events/event_dynamic.dm
index dce1fcc0b3..fa0a6c6efc 100644
--- a/code/modules/events/event_dynamic.dm
+++ b/code/modules/events/event_dynamic.dm
@@ -61,6 +61,7 @@
 	possibleEvents[/datum/event/ionstorm] = 25 + active_with_role["AI"] * 25 + active_with_role["Cyborg"] * 25 + active_with_role["Engineer"] * 10 + active_with_role["Scientist"] * 5
 	possibleEvents[/datum/event/grid_check] = 25 + 10 * active_with_role["Engineer"]
 	possibleEvents[/datum/event/electrical_storm] = 75 + 25 * active_with_role["Janitor"] + 5 * active_with_role["Engineer"]
+	possibleEvents[/datum/event/wallrot] = 50 * active_with_role["Engineer"] + 100 * active_with_role["Botanist"]
 
 	if(!spacevines_spawned)
 		possibleEvents[/datum/event/spacevine] = 5 + 10 * active_with_role["Engineer"]
@@ -69,11 +70,12 @@
 		possibleEvents[/datum/event/meteor_shower] = 80 * active_with_role["Engineer"]
 		possibleEvents[/datum/event/blob] = 30 * active_with_role["Engineer"]
 
-	possibleEvents[/datum/event/viral_infection] = 25 + active_with_role["Medical"] * 25
+	possibleEvents[/datum/event/viral_infection] = 25 + active_with_role["Medical"] * 100
 	if(active_with_role["Medical"] > 0)
 		possibleEvents[/datum/event/radiation_storm] = active_with_role["Medical"] * 100
-		possibleEvents[/datum/event/spontaneous_appendicitis] = active_with_role["Medical"] * 75
-		possibleEvents[/datum/event/viral_outbreak] = active_with_role["Medical"] * 5
+		possibleEvents[/datum/event/spontaneous_appendicitis] = active_with_role["Medical"] * 150
+		possibleEvents[/datum/event/viral_outbreak] = active_with_role["Medical"] * 10
+		possibleEvents[/datum/event/organ_failure] = active_with_role["Medical"] * 50
 
 	possibleEvents[/datum/event/prison_break] = active_with_role["Security"] * 50
 	if(active_with_role["Security"] > 0)
@@ -84,16 +86,19 @@
 		if(!sent_ninja_to_station && toggle_space_ninja)
 			possibleEvents[/datum/event/space_ninja] = max(active_with_role["Security"], 5)
 
+
+	var/picked_event = pickweight(possibleEvents)
+
 	// Debug code below here, very useful for testing so don't delete please.
-	/*var/debug_message = "Firing random event. "
+	var/debug_message = "Firing random event. "
 	for(var/V in active_with_role)
 		debug_message += "#[V]:[active_with_role[V]] "
 	debug_message += "||| "
 	for(var/V in possibleEvents)
 		debug_message += "[V]:[possibleEvents[V]]"
-	message_admins(debug_message)*/
+	debug_message += "|||Picked:[picked_event]"
+	log_debug(debug_message)
 
-	var/picked_event = pickweight(possibleEvents)
 	if(!picked_event)
 		return
 
@@ -176,6 +181,7 @@
 	active_with_role["AI"] = 0
 	active_with_role["Cyborg"] = 0
 	active_with_role["Janitor"] = 0
+	active_with_role["Botanist"] = 0
 
 	for(var/mob/M in player_list)
 		if(!M.mind || !M.client || M.client.inactivity > 10 * 10 * 60) // longer than 10 minutes AFK counts them as inactive
@@ -208,4 +214,7 @@
 		if(M.mind.assigned_role == "Janitor")
 			active_with_role["Janitor"]++
 
+		if(M.mind.assigned_role == "Botanist")
+			active_with_role["Botanist"]++
+
 	return active_with_role
diff --git a/code/modules/events/event_manager.dm b/code/modules/events/event_manager.dm
index 0af33b153b..b2201c7c92 100644
--- a/code/modules/events/event_manager.dm
+++ b/code/modules/events/event_manager.dm
@@ -30,7 +30,9 @@ var/scheduledEvent = null
 				playercount_modifier = 0.9
 			if(36 to 100000)
 				playercount_modifier = 0.8
-		scheduledEvent = world.timeofday + rand(eventTimeLower, eventTimeUpper) * playercount_modifier
+		var/next_event_delay = rand(eventTimeLower, eventTimeUpper) * playercount_modifier
+		scheduledEvent = world.timeofday + next_event_delay
+		log_debug("Next event in [next_event_delay/600] minutes.")
 
 	else if(world.timeofday > scheduledEvent)
 		spawn_dynamic_event()
diff --git a/code/modules/events/organ_failure.dm b/code/modules/events/organ_failure.dm
new file mode 100644
index 0000000000..2a6b0b6a37
--- /dev/null
+++ b/code/modules/events/organ_failure.dm
@@ -0,0 +1,28 @@
+datum/event/organ_failure
+	var/severity = 1
+
+datum/event/organ_failure/setup()
+	announceWhen = rand(0, 3000)
+	endWhen = announceWhen + 1
+	severity = rand(1, 3)
+
+datum/event/organ_failure/announce()
+	command_alert("Confirmed outbreak of level [rand(3,7)] biohazard aboard [station_name()]. All personnel must contain the outbreak.", "Biohazard Alert")
+	world << sound('sound/AI/outbreak5.ogg')
+
+datum/event/organ_failure/start()
+	var/list/candidates = list()	//list of candidate keys
+	for(var/mob/living/carbon/human/G in player_list)
+		if(!(G.mind && G.mind.current && G.mind.current.stat != DEAD && G.health > 70))
+			candidates += G
+	if(!candidates.len)	return
+	candidates = shuffle(candidates)//Incorporating Donkie's list shuffle
+
+	while(severity > 0 && candidates.len)
+		var/mob/living/carbon/human/C = candidates[1]
+
+		// Bruise one of their organs
+		var/datum/organ/internal/I = pick(C.internal_organs)
+		I.damage = I.min_bruised_damage
+		candidates.Remove(C)
+		severity--
diff --git a/code/modules/events/radiation_storm.dm b/code/modules/events/radiation_storm.dm
index b077ef5782..18911c6181 100644
--- a/code/modules/events/radiation_storm.dm
+++ b/code/modules/events/radiation_storm.dm
@@ -1,36 +1,45 @@
 /datum/event/radiation_storm
-	announceWhen	= 5
+	announceWhen	= 1
 	oneShot			= 1
 
 
 /datum/event/radiation_storm/announce()
-	command_alert("High levels of radiation detected near the station. Please report to the Med-bay if you feel strange.", "Anomaly Alert")
-	world << sound('sound/AI/radiation.ogg')
-
+	// Don't do anything, we want to pack the announcement with the actual event
 
 /datum/event/radiation_storm/start()
-	for(var/mob/living/carbon/human/H in living_mob_list)
-		var/turf/T = get_turf(H)
-		if(!T)
-			continue
-		if(T.z != 1)
-			continue
-		if(istype(H,/mob/living/carbon/human))
-			H.apply_effect((rand(15,75)),IRRADIATE,0)
-			if(prob(5))
-				H.apply_effect((rand(90,150)),IRRADIATE,0)
-			if(prob(25))
-				if (prob(75))
-					randmutb(H)
-					domutcheck(H,null,1)
-				else
-					randmutg(H)
-					domutcheck(H,null,1)
+	spawn()
+		command_alert("High levels of radiation detected near the station. Please evacuate into one of the shielded maintenance tunnels.", "Anomaly Alert")
 
-	for(var/mob/living/carbon/monkey/M in living_mob_list)
-		var/turf/T = get_turf(M)
-		if(!T)
-			continue
-		if(T.z != 1)
-			continue
-		M.apply_effect((rand(15,75)),IRRADIATE,0)
\ No newline at end of file
+		sleep(200)
+
+		command_alert("The station has entered the radiation belt. Please report to medbay if you experience any unusual symptoms.", "Anomaly Alert")
+		for(var/i = 0, i < 10, i++)
+			for(var/mob/living/carbon/human/H in living_mob_list)
+				var/turf/T = get_turf(H)
+				if(!T)
+					continue
+				if(T.z != 1)
+					continue
+				if(istype(T.loc, /area/maintenance) || istype(T.loc, /area/crew_quarters))
+					continue
+				if(istype(H,/mob/living/carbon/human))
+					H.apply_effect((rand(5,25)),IRRADIATE,0)
+					if(prob(5))
+						H.apply_effect((rand(30,50)),IRRADIATE,0)
+						if (prob(75))
+							randmutb(H)
+							domutcheck(H,null,1)
+						else
+							randmutg(H)
+							domutcheck(H,null,1)
+			for(var/mob/living/carbon/monkey/M in living_mob_list)
+				var/turf/T = get_turf(M)
+				if(!T)
+					continue
+				if(T.z != 1)
+					continue
+				M.apply_effect((rand(5,25)),IRRADIATE,0)
+			sleep(50)
+
+
+		command_alert("The station has passed the radiation belt", "Anomaly Alert")
\ No newline at end of file
diff --git a/code/modules/events/wallrot.dm b/code/modules/events/wallrot.dm
new file mode 100644
index 0000000000..02e33c52d7
--- /dev/null
+++ b/code/modules/events/wallrot.dm
@@ -0,0 +1,37 @@
+/turf/simulated/wall
+
+
+datum/event/wallrot
+	var/severity = 1
+
+datum/event/wallrot/setup()
+	announceWhen = rand(0, 3000)
+	endWhen = announceWhen + 1
+	severity = rand(5, 10)
+
+datum/event/wallrot/announce()
+	command_alert("Harmful fungi detected on station. Station structures may be contaminated.", "Biohazard Alert")
+
+datum/event/wallrot/start()
+	spawn()
+		var/turf/center = null
+
+		// 100 attempts
+		for(var/i=0, i<100, i++)
+			var/turf/candidate = locate(rand(1, world.maxx), rand(1, world.maxy), 1)
+			if(istype(candidate, /turf/simulated/wall))
+				center = candidate
+
+		if(center)
+			// Make sure at least one piece of wall rots!
+			center:rot()
+
+			// Have a chance to rot lots of other walls.
+			var/rotcount = 0
+			for(var/turf/simulated/wall/W in range(5, center)) if(prob(50))
+				W:rot()
+				rotcount++
+
+				// Only rot up to severity walls
+				if(rotcount >= severity)
+					break
\ No newline at end of file
diff --git a/code/modules/mob/emote.dm b/code/modules/mob/emote.dm
index 3c070bdbd2..9225eb0f8b 100644
--- a/code/modules/mob/emote.dm
+++ b/code/modules/mob/emote.dm
@@ -32,19 +32,13 @@ mob/proc/custom_emote(var/m_type=1,var/message = null)
 				continue
 			if(findtext(message," snores.")) //Because we have so many sleeping people.
 				break
-			if(M.stat == 2 && M.client.ghost_sight && !(M in viewers(src,null)))
+			if(M.stat == 2 && (M.client.prefs.toggles & CHAT_GHOSTSIGHT) && !(M in viewers(src,null)))
 				M.show_message(message)
 
 
 		if (m_type & 1)
 			for (var/mob/O in viewers(src, null))
-				if(istype(O,/mob/living/carbon/human))
-					for(var/mob/living/parasite/P in O:parasites)
-						P.show_message(message, m_type)
 				O.show_message(message, m_type)
 		else if (m_type & 2)
 			for (var/mob/O in hearers(src.loc, null))
-				if(istype(O,/mob/living/carbon/human))
-					for(var/mob/living/parasite/P in O:parasites)
-						P.show_message(message, m_type)
 				O.show_message(message, m_type)
diff --git a/code/modules/mob/living/carbon/human/emote.dm b/code/modules/mob/living/carbon/human/emote.dm
index 802841e17a..4029fc4644 100644
--- a/code/modules/mob/living/carbon/human/emote.dm
+++ b/code/modules/mob/living/carbon/human/emote.dm
@@ -53,27 +53,17 @@
 			var/input = copytext(sanitize(input("Choose an emote to display.") as text|null),1,MAX_MESSAGE_LEN)
 			if (!input)
 				return
-			if(copytext(input,1,5) == "says")
-				src << "\red Invalid emote."
-				return
-			else if(copytext(input,1,9) == "exclaims")
-				src << "\red Invalid emote."
-				return
-			else if(copytext(input,1,5) == "asks")
-				src << "\red Invalid emote."
-				return
-			else
-				var/input2 = input("Is this a visible or hearable emote?") in list("Visible","Hearable")
-				if (input2 == "Visible")
-					m_type = 1
-				else if (input2 == "Hearable")
-					if (src.miming)
-						return
-					m_type = 2
-				else
-					alert("Unable to use this emote, must be either hearable or visible.")
+			var/input2 = input("Is this a visible or hearable emote?") in list("Visible","Hearable")
+			if (input2 == "Visible")
+				m_type = 1
+			else if (input2 == "Hearable")
+				if (src.miming)
 					return
-				message = "<B>[src]</B> [input]"
+				m_type = 2
+			else
+				alert("Unable to use this emote, must be either hearable or visible.")
+				return
+			message = "<B>[src]</B> [input]"
 
 		if ("me")
 			if(silent)
@@ -88,17 +78,7 @@
 				return
 			if(!(message))
 				return
-			if(copytext(message,1,5) == "says")
-				src << "\red Invalid emote."
-				return
-			else if(copytext(message,1,9) == "exclaims")
-				src << "\red Invalid emote."
-				return
-			else if(copytext(message,1,5) == "asks")
-				src << "\red Invalid emote."
-				return
-			else
-				message = "<B>[src]</B> [message]"
+			message = "<B>[src]</B> [message]"
 
 		if ("salute")
 			if (!src.buckled)
diff --git a/code/modules/mob/living/carbon/human/life.dm b/code/modules/mob/living/carbon/human/life.dm
index 5221d77979..36b039dc89 100644
--- a/code/modules/mob/living/carbon/human/life.dm
+++ b/code/modules/mob/living/carbon/human/life.dm
@@ -28,6 +28,7 @@
 	var/pressure_alert = 0
 	var/prev_gender = null // Debug for plural genders
 	var/temperature_alert = 0
+	var/in_stasis = 0
 
 
 /mob/living/carbon/human/Life()
@@ -59,8 +60,11 @@
 	life_tick++
 	var/datum/gas_mixture/environment = loc.return_air()
 
+	in_stasis = istype(loc, /obj/structure/closet/body_bag/cryobag) && loc:opened == 0
+	if(in_stasis) loc:used++
+
 	//No need to update all of these procs if the guy is dead.
-	if(stat != DEAD)
+	if(stat != DEAD && !in_stasis)
 		if(air_master.current_cycle%4==2 || failed_last_breath) 	//First, resolve location and get a breath
 			breathe() 				//Only try to take a breath every 4 ticks, unless suffocating
 
@@ -86,18 +90,20 @@
 
 		handle_virus_updates()
 
+		//stuff in the stomach
+		handle_stomach()
+
+		handle_shock()
+
+		handle_pain()
+
+		handle_medical_side_effects()
+
+	handle_stasis_bag()
+
 	//Handle temperature/pressure differences between body and environment
 	handle_environment(environment)
 
-	//stuff in the stomach
-	handle_stomach()
-
-	handle_shock()
-
-	handle_pain()
-
-	handle_medical_side_effects()
-
 	//Status updates, death etc.
 	handle_regular_status_updates()		//TODO: optimise ~Carn
 	update_canmove()
@@ -196,6 +202,16 @@
 					src << "\red Your legs won't respond properly, you fall down."
 					lying = 1
 
+	proc/handle_stasis_bag()
+		// Handle side effects from stasis bag
+		if(in_stasis)
+			// First off, there's no oxygen supply, so the mob will slowly take brain damage
+			adjustBrainLoss(0.1)
+
+			// Next, the method to induce stasis has some adverse side-effects, manifesting
+			// as cloneloss
+			adjustCloneLoss(0.1)
+
 	proc/handle_mutations_and_radiation()
 		if(getFireLoss())
 			if((COLD_RESISTANCE in mutations) || (prob(1)))
@@ -787,8 +803,8 @@
 		var/total_plasmaloss = 0
 		for(var/obj/item/I in src)
 			if(I.contaminated)
-				total_plasmaloss += vsc.plc.CONTAMINATION_LOSS
-		if(status_flags & GODMODE)	return 0	//godmode
+				total_plasmaloss += vsc.plc.CONTAMINATION_LOSS
+		if(status_flags & GODMODE)	return 0	//godmode
 		adjustToxLoss(total_plasmaloss)
 
 //		if(dna && dna.mutantrace == "plant") //couldn't think of a better place to place it, since it handles nutrition -- Urist
@@ -886,8 +902,10 @@
 			silent = 0
 		else				//ALIVE. LIGHTS ARE ON
 			updatehealth()	//TODO
-			handle_organs()
-			handle_blood()
+			if(!in_stasis)
+				handle_organs()
+				handle_blood()
+
 			if(health <= config.health_threshold_dead || brain_op_stage == 4.0)
 				death()
 				blinded = 1
diff --git a/code/modules/mob/living/carbon/metroid/emote.dm b/code/modules/mob/living/carbon/metroid/emote.dm
index 2ee388f7d0..0e6688e69e 100644
--- a/code/modules/mob/living/carbon/metroid/emote.dm
+++ b/code/modules/mob/living/carbon/metroid/emote.dm
@@ -1,4 +1,4 @@
-/mob/living/carbon/slime/emote(var/act)
+/mob/living/carbon/slime/emote(var/act, var/type, var/desc)
 
 
 	if (findtext(act, "-", 1, null))
@@ -13,6 +13,10 @@
 	var/message
 
 	switch(act)
+		if ("me")
+			return custom_emote(m_type, desc)
+		if ("custom")
+			return custom_emote(m_type, desc)
 		if("moan")
 			message = "<B>The [src.name]</B> moans."
 			m_type = 2
diff --git a/code/modules/mob/living/carbon/monkey/emote.dm b/code/modules/mob/living/carbon/monkey/emote.dm
index eccb365a6f..8e6c281c78 100644
--- a/code/modules/mob/living/carbon/monkey/emote.dm
+++ b/code/modules/mob/living/carbon/monkey/emote.dm
@@ -1,4 +1,4 @@
-/mob/living/carbon/monkey/emote(var/act)
+/mob/living/carbon/monkey/emote(var/act, var/type, var/desc)
 
 	var/param = null
 	if (findtext(act, "-", 1, null))
@@ -14,6 +14,12 @@
 	var/message
 
 	switch(act)
+		if ("me")
+			return custom_emote(m_type, desc)
+
+		if ("custom")
+			return custom_emote(m_type, desc)
+
 		if("sign")
 			if (!src.restrained())
 				message = text("<B>The monkey</B> signs[].", (text2num(param) ? text(" the number []", text2num(param)) : null))
diff --git a/code/modules/mob/living/silicon/robot/emote.dm b/code/modules/mob/living/silicon/robot/emote.dm
index dcf08ba0d8..86d4e5d2f4 100644
--- a/code/modules/mob/living/silicon/robot/emote.dm
+++ b/code/modules/mob/living/silicon/robot/emote.dm
@@ -9,6 +9,12 @@
 		act = copytext(act,1,length(act))
 
 	switch(act)
+		if ("me")
+			return custom_emote(m_type, message)
+
+		if ("custom")
+			return custom_emote(m_type, message)
+
 		if ("salute")
 			if (!src.buckled)
 				var/M = null
@@ -56,20 +62,6 @@
 				message = "<B>[src]</B> flaps his wings ANGRILY!"
 				m_type = 2
 
-		if ("custom")
-			var/input = copytext(sanitize(input("Choose an emote to display.") as text|null),1,MAX_MESSAGE_LEN)
-			if (!input)
-				return
-			var/input2 = input("Is this a visible or hearable emote?") in list("Visible","Hearable")
-			if (input2 == "Visible")
-				m_type = 1
-			else if (input2 == "Hearable")
-				m_type = 2
-			else
-				alert("Unable to use this emote, must be either hearable or visible.")
-				return
-			message = "<B>[src]</B> [input]"
-
 		if ("me")
 			if (src.client)
 				if(client.prefs.muted & MUTE_IC)
diff --git a/code/modules/mob/living/simple_animal/simple_animal.dm b/code/modules/mob/living/simple_animal/simple_animal.dm
index bc25116ae5..f7154694f7 100644
--- a/code/modules/mob/living/simple_animal/simple_animal.dm
+++ b/code/modules/mob/living/simple_animal/simple_animal.dm
@@ -226,14 +226,8 @@
 
 /mob/living/simple_animal/emote(var/act, var/type, var/desc)
 	if(act)
-		if(act == "scream")	act = "makes a loud and pained whimper" //ugly hack to stop animals screaming when crushed :P
-		if(act == "me") //Allow me-emotes.
-			act = desc
-		if( findtext(act,".",lentext(act)) == 0 && findtext(act,"!",lentext(act)) == 0 && findtext(act,"?",lentext(act)) == 0 )
-			act = addtext(act,".") //Makes sure all emotes end with a period.
-		for (var/mob/O in viewers(src, null))
-			O.show_message("<B>[src]</B> [act]")
-
+		if(act == "scream")	act = "whimper" //ugly hack to stop animals screaming when crushed :P
+		..(act, type, desc)
 
 /mob/living/simple_animal/attack_animal(mob/living/simple_animal/M as mob)
 	if(M.melee_damage_upper == 0)
diff --git a/code/modules/mob/new_player/new_player.dm b/code/modules/mob/new_player/new_player.dm
index 97133deb4c..a5b92bdc40 100644
--- a/code/modules/mob/new_player/new_player.dm
+++ b/code/modules/mob/new_player/new_player.dm
@@ -277,6 +277,8 @@
 		character.loc = pick(latejoin)
 		character.lastarea = get_area(loc)
 
+		ticker.mode.latespawn(character)
+
 		//ticker.mode.latespawn(character)
 
 		if(character.mind.assigned_role != "Cyborg")
diff --git a/code/modules/mob/say.dm b/code/modules/mob/say.dm
index 5876a874e9..8a28152a23 100644
--- a/code/modules/mob/say.dm
+++ b/code/modules/mob/say.dm
@@ -75,31 +75,32 @@
 		//tcomms code is still runtiming somewhere here
 	var/ending = copytext(text, length(text))
 	if (is_speaking_soghun)
-		return "hisses, \"<span class='soghun'>[text]</span>\"";
+		return "<span class='say_quote'>hisses</span>, \"<span class='soghun'>[text]</span>\"";
 	if (is_speaking_skrell)
-		return "warbles, \"<span class='skrell'>[text]</span>\"";
+		return "<span class='say_quote'>warbles</span>, \"<span class='skrell'>[text]</span>\"";
 	if (is_speaking_tajaran)
-		return "mrowls, \"<span class='tajaran'>[text]</span>\"";
+		return "<span class='say_quote'>mrowls</span>, \"<span class='tajaran'>[text]</span>\"";
 //Needs Virus2
 //	if (src.disease_symptoms & DISEASE_HOARSE)
 //		return "rasps, \"[text]\"";
 	if (src.stuttering)
-		return "stammers, \"[text]\"";
+		return "<span class='say_quote'>stammers</span>, \"[text]\"";
 	if (src.slurring)
-		return "slurrs, \"[text]\"";
+		return "<span class='say_quote'>slurrs</span>, \"[text]\"";
 	if(isliving(src))
 		var/mob/living/L = src
 		if (L.getBrainLoss() >= 60)
-			return "gibbers, \"[text]\"";
+			return "<span class='say_quote'>gibbers</span>, \"[text]\"";
 	if (ending == "?")
-		return "asks, \"[text]\"";
+		return "<span class='say_quote'>asks</span>, \"[text]\"";
 	if (ending == "!")
-		return "exclaims, \"[text]\"";
+		return "<span class='say_quote'>exclaims</span>, \"[text]\"";
 
-	return "says, \"[text]\"";
+	return "<span class='say_quote'>says</span>, \"[text]\"";
 
-/mob/proc/emote(var/act)
-	return
+/mob/proc/emote(var/act, var/type, var/message)
+	if(act == "me")
+		return custom_emote(type, message)
 
 /mob/proc/get_ear()
 	// returns an atom representing a location on the map from which this
diff --git a/code/modules/reagents/Chemistry-Reagents.dm b/code/modules/reagents/Chemistry-Reagents.dm
index 0036ca2333..e839cf34a8 100644
--- a/code/modules/reagents/Chemistry-Reagents.dm
+++ b/code/modules/reagents/Chemistry-Reagents.dm
@@ -1214,6 +1214,17 @@ datum
 				..()
 				return
 
+			// Clear off wallrot fungi
+			reaction_turf(var/turf/T, var/volume)
+				if(istype(T, /turf/simulated/wall))
+					var/turf/simulated/wall/W = T
+					if(W.rotting)
+						W.rotting = 0
+						for(var/obj/effect/E in W) if(E.name == "Wallrot") del E
+
+						for(var/mob/O in viewers(W, null))
+							O.show_message(text("\blue The fungi are completely dissolved by the solution!"), 1)
+
 			reaction_obj(var/obj/O, var/volume)
 				if(istype(O,/obj/effect/alien/weeds/))
 					var/obj/effect/alien/weeds/alien_weeds = O
diff --git a/code/modules/reagents/reagent_containers/spray.dm b/code/modules/reagents/reagent_containers/spray.dm
index da78e252a3..8551a16f2a 100644
--- a/code/modules/reagents/reagent_containers/spray.dm
+++ b/code/modules/reagents/reagent_containers/spray.dm
@@ -49,12 +49,20 @@
 
 	D.icon += mix_color_from_reagents(D.reagents.reagent_list)
 
+	var/turf/A_turf = get_turf(A)
+
 	spawn(0)
 		for(var/i=0, i<3, i++)
 			step_towards(D,A)
 			D.reagents.reaction(get_turf(D))
 			for(var/atom/T in get_turf(D))
 				D.reagents.reaction(T)
+
+				// When spraying against the wall, also react with the wall, but
+				// not its contents.
+				if(get_dist(D, A_turf) == 1 && A_turf.density)
+					D.reagents.reaction(A_turf)
+				sleep(2)
 			sleep(3)
 		del(D)
 
diff --git a/code/setup.dm b/code/setup.dm
index 35fe8827a4..d4f4941d43 100644
--- a/code/setup.dm
+++ b/code/setup.dm
@@ -620,6 +620,8 @@ var/list/TAGGERLOCATIONS = list("Disposals",
 #define CHAT_PRAYER		256
 #define CHAT_RADIO		512
 #define CHAT_ATTACKLOGS	1024
+#define CHAT_DEBUGLOGS	2048
+
 
 #define TOGGLES_DEFAULT (SOUND_ADMINHELP|SOUND_MIDI|SOUND_AMBIENCE|SOUND_LOBBY|CHAT_OOC|CHAT_DEAD|CHAT_GHOSTEARS|CHAT_GHOSTSIGHT|CHAT_PRAYER|CHAT_RADIO|CHAT_ATTACKLOGS)
 
diff --git a/code/stylesheet.dm b/code/stylesheet.dm
index b838c9c77d..2481e247af 100644
--- a/code/stylesheet.dm
+++ b/code/stylesheet.dm
@@ -55,6 +55,7 @@ h1.alert, h2.alert		{color: #000000;}
 .tajaran				{color: #803B56;}
 .skrell					{color: #00CED1;}
 .soghun					{color: #228B22;}
+.say_quote				{font-family: Georgia, Verdana, sans-serif;}
 
 .interface				{color: #330033;}
 </style>"}
diff --git a/html/changelog.html b/html/changelog.html
index b18d546282..5b6aa9e5a1 100644
--- a/html/changelog.html
+++ b/html/changelog.html
@@ -58,7 +58,16 @@ Stuff which is in development and not yet visible to players or just code relate
 should be listed in the changelog upon commit though. Thanks. -->
 
 <!-- To take advantage of the pretty new format (well it was new when I wrote this anyway), open the "add-to-changelog.html" file in any browser and add the stuff and then generate the html code and paste it here --><div class="commit sansserif">
-	<h2 class="date">April 24, 2013</h2>
+<div>
+  <h2 class="date">May 18th, 2013</h2>
+	<h3 class="author">CIB updated:</h3>
+	<ul class="changes bgimages16">
+		<li class="rscadd">A new event type: Wallrot. Use welder or plantbgone on infected walls.</li>
+		<li class="tweak">Newscasters now can deliver preset news stories over the course of a round. See http://baystation12.net/forums/viewtopic.php?f=14&t=7619 to add your own!</li>
+	</ul>
+</div>
+<div>
+  <h2 class="date">April 24, 2013</h2>
 	<h3 class="author">Jediluke69 updated:</h3>
 	<ul class="changes bgimages16">
 		<li class="rscadd">Added 5 new drinks (Kira Special, Lemonade, Brown Star, Milkshakes, Rewriter)</li>
diff --git a/icons/effects/wallrot.dmi b/icons/effects/wallrot.dmi
new file mode 100644
index 0000000000..3ca5467712
Binary files /dev/null and b/icons/effects/wallrot.dmi differ
diff --git a/icons/obj/cryobag.dmi b/icons/obj/cryobag.dmi
index 116a2c44d1..fe543fad64 100644
Binary files a/icons/obj/cryobag.dmi and b/icons/obj/cryobag.dmi differ
diff --git a/maps/tgstation.2.1.0.0.1.dmm b/maps/tgstation.2.1.0.0.1.dmm
index 5455931b38..838ce99de4 100644
--- a/maps/tgstation.2.1.0.0.1.dmm
+++ b/maps/tgstation.2.1.0.0.1.dmm
@@ -323,16 +323,19 @@
 "agk" = (/obj/effect/landmark/start{name = "Psychiatrist"},/obj/structure/stool/bed/chair/comfy/teal{tag = "icon-comfychair_teal (EAST)"; icon_state = "comfychair_teal"; dir = 4},/obj/machinery/door_control{id = "medpriv1"; name = "Privacy Shutters"; pixel_y = -25},/obj/machinery/atmospherics/unary/vent_pump{dir = 1; external_pressure_bound = 101.325; on = 1; pressure_checks = 0},/turf/simulated/floor{dir = 2; icon_state = "whiteblue"},/area/medical/medbay)
 "agl" = (/obj/structure/closet{name = "Evidence Closet"},/obj/machinery/alarm{dir = 1; icon_state = "alarm0"; pixel_y = -22},/obj/machinery/atmospherics/pipe/simple/scrubbers/hidden,/turf/simulated/floor{tag = "icon-vault (WEST)"; icon_state = "vault"; dir = 8},/area/security/brig)
 "agm" = (/obj/structure/closet{name = "Evidence Closet"},/obj/machinery/light/small,/turf/simulated/floor{tag = "icon-vault (WEST)"; icon_state = "vault"; dir = 8},/area/security/brig)
+"agn" = (/obj/structure/table,/obj/item/device/radio/intercom{freerange = 0; frequency = 1459; name = "Station Intercom (General)"; pixel_x = -30},/obj/item/weapon/storage/firstaid/o2,/obj/item/weapon/storage/firstaid/regular{pixel_x = 3; pixel_y = 3},/obj/item/bodybag/cryobag,/turf/simulated/floor{icon_state = "white"},/area/security/brig)
 "ago" = (/obj/machinery/deployable/barrier,/obj/machinery/atmospherics/pipe/simple/scrubbers/hidden,/turf/simulated/floor{icon_state = "bot"; dir = 1},/area/security/warden)
 "agp" = (/obj/structure/cable{d1 = 1; d2 = 2; icon_state = "1-2"; tag = ""},/turf/simulated/floor,/area/security/warden)
 "agq" = (/obj/structure/rack,/obj/item/weapon/storage/box/seccarts{pixel_x = 3; pixel_y = 2},/obj/item/weapon/storage/box/handcuffs,/obj/item/weapon/storage/box/flashbangs{pixel_x = -2; pixel_y = -2},/obj/machinery/atmospherics/pipe/simple/supply/hidden,/turf/simulated/floor{icon_state = "bot"; dir = 1},/area/security/warden)
 "agr" = (/obj/structure/rack,/obj/item/clothing/mask/gas{pixel_x = 3; pixel_y = 3},/obj/item/clothing/mask/gas{pixel_x = 3; pixel_y = 3},/obj/item/clothing/mask/gas,/obj/item/clothing/mask/gas,/obj/item/clothing/mask/gas{pixel_x = -3; pixel_y = -3},/obj/item/clothing/mask/gas{pixel_x = -3; pixel_y = -3},/turf/simulated/floor{icon_state = "bot"; dir = 1},/area/security/warden)
 "ags" = (/obj/structure/reagent_dispensers/peppertank{pixel_x = -30; pixel_y = 0},/turf/simulated/floor{icon_state = "red"; dir = 8},/area/security/main)
 "agt" = (/obj/structure/closet/secure_closet/security,/obj/structure/window/reinforced{dir = 4},/turf/simulated/floor{icon_state = "bot"; dir = 1},/area/security/main)
+"agu" = (/obj/structure/table,/obj/item/weapon/storage/belt/medical{pixel_x = 0; pixel_y = 2},/obj/item/weapon/storage/belt/medical{pixel_x = 0; pixel_y = 2},/obj/item/weapon/storage/belt/medical{pixel_x = 0; pixel_y = 2},/obj/item/clothing/tie/stethoscope,/obj/item/clothing/mask/muzzle,/obj/item/weapon/cane,/obj/item/weapon/cane,/obj/item/bodybag/cryobag{pixel_x = 5},/obj/item/bodybag/cryobag,/obj/item/clothing/suit/straight_jacket,/turf/simulated/floor{icon_state = "white"},/area/medical/sleeper)
 "agv" = (/turf/simulated/floor{icon_state = "red"; dir = 8},/area/security/main)
 "agw" = (/obj/structure/table,/obj/machinery/atmospherics/pipe/simple/supply/hidden,/obj/structure/cable{d1 = 1; d2 = 2; icon_state = "1-2"; pixel_y = 0; tag = ""},/obj/structure/disposalpipe/segment,/obj/item/weapon/storage/fancy/donut_box,/turf/simulated/floor{tag = "icon-redfull (NORTHWEST)"; icon_state = "redfull"; dir = 9},/area/security/main)
 "agx" = (/obj/structure/table,/turf/simulated/floor{icon_state = "redcorner"; dir = 4},/area/security/main)
 "agy" = (/obj/structure/stool/bed/chair{dir = 8},/turf/simulated/floor,/area/security/main)
+"agz" = (/obj/structure/disposalpipe/segment{dir = 4},/obj/machinery/light,/obj/structure/table,/obj/machinery/atmospherics/pipe/manifold{color = "blue"; dir = 1; icon_state = "manifold-b-f"; level = 1; name = "pipe manifold"},/obj/item/weapon/storage/firstaid/regular{pixel_x = -2; pixel_y = 4},/obj/item/bodybag/cryobag,/turf/simulated/floor,/area/engine/break_room)
 "agA" = (/obj/structure/grille,/obj/structure/window/reinforced{dir = 4},/obj/structure/window/reinforced{dir = 8},/obj/structure/window/reinforced{dir = 1},/obj/structure/cable{d1 = 1; d2 = 2; icon_state = "1-2"; tag = ""},/obj/structure/cable,/obj/structure/cable{d1 = 1; d2 = 2; icon_state = "1-2"; tag = ""},/turf/simulated/floor/plating,/area/security/hos)
 "agB" = (/turf/simulated/floor/carpet{icon_state = "carpetnoconnect"},/area/security/hos)
 "agC" = (/obj/structure/cable{d1 = 1; d2 = 2; icon_state = "1-2"; tag = ""},/obj/machinery/atmospherics/pipe/simple/scrubbers/hidden{dir = 6},/turf/simulated/floor/carpet{icon_state = "carpetnoconnect"},/area/security/hos)
@@ -442,7 +445,6 @@
 "aiP" = (/obj/machinery/door/window/eastright{dir = 1; name = "Security Delivery"; req_access_txt = "1"},/obj/structure/window/reinforced{dir = 8},/turf/simulated/floor{icon_state = "delivery"},/area/security/main)
 "aiQ" = (/obj/structure/plasticflaps{opacity = 1},/obj/machinery/navbeacon{codes_txt = "delivery;dir=1"; dir = 1; freq = 1400; location = "Security"},/turf/simulated/floor/plating,/area/security/main)
 "aiR" = (/turf/simulated/floor/plating,/area/security/main)
-"aiS" = (/obj/structure/table,/obj/item/device/radio/intercom{freerange = 0; frequency = 1459; name = "Station Intercom (General)"; pixel_x = -30},/obj/item/weapon/storage/firstaid/o2,/obj/item/weapon/storage/firstaid/regular{pixel_x = 3; pixel_y = 3},/turf/simulated/floor{icon_state = "white"},/area/security/brig)
 "aiT" = (/obj/structure/table,/obj/item/device/healthanalyzer{pixel_y = 2},/turf/simulated/floor{icon_state = "white"},/area/security/brig)
 "aiU" = (/obj/structure/table,/obj/item/weapon/reagent_containers/syringe/inaprovaline{pixel_x = 1; pixel_y = -2},/obj/item/weapon/reagent_containers/syringe/inaprovaline{pixel_x = 1; pixel_y = 6},/obj/item/weapon/reagent_containers/syringe/inaprovaline{pixel_x = 0; pixel_y = 2},/turf/simulated/floor{icon_state = "white"},/area/security/brig)
 "aiV" = (/obj/structure/cable{d1 = 2; d2 = 4; icon_state = "2-4"; tag = ""},/turf/simulated/floor{tag = "icon-whitehall (WEST)"; icon_state = "whitehall"; dir = 8},/area/security/brig)
@@ -4455,7 +4457,6 @@
 "bIt" = (/obj/machinery/holosign/surgery,/obj/machinery/door/firedoor/border_only{dir = 4; name = "Firelock East"},/obj/machinery/door/airlock/medical{name = "Operating Theatre"; req_access_txt = "45"},/turf/simulated/floor,/area/medical/sleeper)
 "bIu" = (/turf/simulated/floor{dir = 8; icon_state = "whitered"},/area/medical/sleeper)
 "bIv" = (/obj/machinery/alarm{dir = 8; icon_state = "alarm0"; pixel_x = 24},/obj/machinery/atmospherics/pipe/simple/supply/hidden,/obj/structure/stool/bed,/obj/item/weapon/bedsheet/medical,/turf/simulated/floor{dir = 4; icon_state = "whiteredcorner"},/area/medical/sleeper)
-"bIw" = (/obj/structure/table,/obj/item/weapon/storage/belt/medical{pixel_x = 0; pixel_y = 2},/obj/item/weapon/storage/belt/medical{pixel_x = 0; pixel_y = 2},/obj/item/weapon/storage/belt/medical{pixel_x = 0; pixel_y = 2},/obj/item/clothing/tie/stethoscope,/obj/item/clothing/mask/muzzle,/obj/item/clothing/suit/straight_jacket,/obj/item/weapon/cane,/obj/item/weapon/cane,/turf/simulated/floor{icon_state = "white"},/area/medical/sleeper)
 "bIx" = (/obj/machinery/atmospherics/unary/vent_pump{on = 1},/turf/simulated/floor{icon_state = "white"},/area/medical/sleeper)
 "bIy" = (/obj/machinery/atmospherics/unary/vent_scrubber{on = 1; scrub_N2O = 0; scrub_Toxins = 0},/turf/simulated/floor{icon_state = "white"},/area/medical/sleeper)
 "bIz" = (/obj/structure/disposalpipe/segment,/obj/structure/sink{dir = 4; icon_state = "sink"; pixel_x = 11; pixel_y = 0},/turf/simulated/floor{icon_state = "white"},/area/medical/sleeper)
@@ -6061,7 +6062,6 @@
 "cno" = (/obj/machinery/power/smes,/obj/structure/cable,/turf/simulated/floor,/area/engine/engineering)
 "cnp" = (/obj/machinery/atmospherics/pipe/simple/scrubbers/hidden{dir = 4},/turf/simulated/floor{dir = 5; icon_state = "warning"},/area/engine/engineering)
 "cnq" = (/obj/machinery/atmospherics/pipe/manifold{color = "red"; icon_state = "manifold-r-f"; level = 1; name = "pipe manifold"},/turf/simulated/wall/r_wall,/area/engine/engineering)
-"cnr" = (/obj/structure/disposalpipe/segment{dir = 4},/obj/machinery/light,/obj/structure/table,/obj/machinery/atmospherics/pipe/manifold{color = "blue"; dir = 1; icon_state = "manifold-b-f"; level = 1; name = "pipe manifold"},/obj/item/weapon/storage/firstaid/regular{pixel_x = -2; pixel_y = 4},/turf/simulated/floor,/area/engine/break_room)
 "cns" = (/obj/machinery/power/terminal{dir = 4},/obj/structure/cable{icon_state = "0-2"; pixel_y = 1; d2 = 2},/obj/structure/cable{d2 = 8; icon_state = "0-8"},/obj/structure/cable,/turf/simulated/floor,/area/engine/engineering)
 "cnt" = (/turf/simulated/floor/plating,/obj/structure/shuttle/engine/propulsion/burst{dir = 4},/turf/simulated/shuttle/wall{tag = "icon-swall_f5"; icon_state = "swall_f5"; dir = 2},/area/shuttle/escape_pod5/station)
 "cnu" = (/turf/simulated/shuttle/wall{tag = "icon-swall_s9"; icon_state = "swall_s9"; dir = 2},/area/shuttle/escape_pod5/station)
@@ -9996,7 +9996,7 @@ aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaiahGahHadAaexahIahJahKahLahMahNahOahPahQahRahSahTahUahVagtdRPahxahXaemagxdRKdROagyahYadPadPadPahZaiaadPaibaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaiaicaevaidaexaieaifaigaihahMaiiaijdRGahrailaimahuainaenagtaioaipaiqairaisaitaemaiuafPabYabYabXaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaexaexaexaexagLaiwaixaiyaexaizaiAaiBaihahMaegaiCaiDahQaiEdRHaegaiGaiHaiIaiJaffaiKabXaiLaiMaiNaiOaiPaiQaiRabXabXabYaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
-aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaaaaexaiSaiTaiUaiVaiWaiXaiYaexaiZajaaiZajbaiZaegagPagQajcagSagTaegabXajdajeabXajfajgabXdRudRtdRtdRvabXaexaiRajkajlajmajmajnaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
+aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaaaaexagnaiTaiUaiVaiWaiXaiYaexaiZajaaiZajbaiZaegagPagQajcagSagTaegabXajdajeabXajfajgabXdRudRtdRtdRvabXaexaiRajkajlajmajmajnaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaaaaexajoajpajqajrajsajtajuajvajvajwajxajyajvajvajvajyajzajwajAajBajxajCajDajEajFajGajHdRsajJajKajLajMajNajOajPajQajRajSajTaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaafaexajUajVajWajXajYajZakaakbakcakdakeakfakgakhakbakgakiakjakkakgakeakfakgaklakmaknakoaiBakpakqakraksaexaiRaktakuajmajmakvaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaexaexaexaexaexaexaexaexakwakxaexaexaexagLakyakzakAakBakCakDakEagLaexaexaexakFakGakHakHakIakJakKakLakHakHakMabXabXabYabYaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaeaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
@@ -10064,7 +10064,7 @@ aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabnAbnAbnAbnAbnAaaaaaaaaaaaaaaaaaaaaaaaabDDbDEbDFbDEbDGaaaaaaaaabzLbzLbDHbDIbCsbDIbDJbDKbDLbDMbDNbzNbDObenbDPbDQbtGbDRbtGbDSbDTbDUbtHaItbDVbDWbjcbjcbDXaXeaXeaXeaXeaXeaXebDYbDZbEabEbbEcaXebEdbEebEfbEgaItaItbxmbEhbEibEjbAjbxmbxmbxnbEkbxnbxmbxmbxmbxmbxmbxmbxmbxmbyXbhKbElbEmbEnbyObEobpQbEpbEqbErbEsbEtbEubEvbEwbAEbExbEybCabEzbEAbEBbECbAGbEDbDkbDlbDlbAJbEEbEFbEGbEHbEIbEJbEKbELbEMbENbEObEPbEQbEQbEQbEQbERblTaaaaaaaaaaaaaafaaaaaaaaaaaaaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaafaafbESbETbEUbETbDAbDBbDBbEVbEWbEVbDBbDBaafaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabEXbEYbEZbEYbEXbFabFbbFcbzLbFdbDIbFebFfbFgbFhbFibFibFjbFkbzNbFlbFlbFmbFlaTFaTFaTFaTFbFnbFnbFnbFnbFnbFnbFnbFnbFobbxbbxbFpbFpbFpbFpbFqbFrbFpbFpbFpbFpbFsbFtbFuaIzaJZbFvbxmbFwbFxbFybFzbFAbxmbFBbFCbFDbxnbFEbFEbFFbFGbFHbFIbxnbFJbhKbhKbhKbhKbhKbyXbpTbFKbFLbFMbFNbpQbFObFPbFQbFQbFQbFQbFQbFQbFQbFQbFQbAGbFRbFSbFTbFTbAJbFUbFVbFWbFXbFXbFXbFXbFYbFZbGabGbbFXbFXbFXbFXbzybGcbGdaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagaagbGebETbETbGfbDBbDBbEVbEVbGgbEVbEVbDBbDBaafaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabDFbGhbGibGhbDFbGjbGkbGlbzLbGmbGnbDIbGobGpbzNbGqbGrbGsbGtbzNbGubGubGvbFlaaaaaaaaaaaabFnbGwbGxbGybGzbGAbGBbFnbGCbGDbGEbFpbGFbGGbGHbGIbGJbGKbGLbGMbGNbGObGPbGQbGRbGSbFsbxmbGTbFCbBIbGUbGVbxmbGWbGXbGYbGZbAnbAnbAnbAnbAnbHabHbbHcbsPbsPbsPbsPbvTbyXbHdbFKbFLbFMbHebpQbFObFPbFQbHfbHgbHgbHhbHibHjbHkbHlbAGbHmbHnbHobHobAJbHpbHqbAMbHrbHsbHtbHubHvbHwbHxbHybHzbHAbHBbFXbgBbHCbgBbHDbHDbHDbHDbHDaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaaaaaabHEbDBbGebDBbDBbEVbEVbEVbEVbEVbEVbEVbDBbDBaafaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
-aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabEXbGhbGhbGhbHFbHGbDIbDIbHHbHIbDIbDIbHJbHKbzNbzNbzNbHLbzNbzNbHMbHNbHObHPaaabHQbHRbHSbHTbHUbGBbHVbHWbHXbHYbHZbIabIbbIcbIdbIebIfbIgbIhbIibIjbIkbFpbFpbIlbImbInbIobIpbIqbIrbAnbFCbIsbGUbAnbItbIubFCbIvbxmbIwbIxbAnbAnbIybIzbpQbpQbpQbpQbpQbIAbyXbyXbIBbFKbFLbFMbICbIDbIEbFPbFQbIFbIGbHgbIHbHgbHgbHgbIIbAGbIJbDkbIKbIKbAJbALbILbIMbINbIObIObIObIObIPbIQbIRbISbITbIUbFXbIVbIWbIXbIYbIZbJabJbbJcaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafbDAbDBbJdbJebJebEVbEVbEVbEVbEVbEVbEVbEVbDBbDBaafaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
+aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabEXbGhbGhbGhbHFbHGbDIbDIbHHbHIbDIbDIbHJbHKbzNbzNbzNbHLbzNbzNbHMbHNbHObHPaaabHQbHRbHSbHTbHUbGBbHVbHWbHXbHYbHZbIabIbbIcbIdbIebIfbIgbIhbIibIjbIkbFpbFpbIlbImbInbIobIpbIqbIrbAnbFCbIsbGUbAnbItbIubFCbIvbxmagubIxbAnbAnbIybIzbpQbpQbpQbpQbpQbIAbyXbyXbIBbFKbFLbFMbICbIDbIEbFPbFQbIFbIGbHgbIHbHgbHgbHgbIIbAGbIJbDkbIKbIKbAJbALbILbIMbINbIObIObIObIObIPbIQbIRbISbITbIUbFXbIVbIWbIXbIYbIZbJabJbbJcaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafbDAbDBbJdbJebJebEVbEVbEVbEVbEVbEVbEVbEVbDBbDBaafaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabDFbGibGibGibDFbJfbJgbJhbJibJjbDIbJkbJlbJmbJnbJobJobJpbJobJobJqbJrbJsbJtaaabJubJvbJwbJxbJybGBbJzbJAbJBbJCbFnbJDbJEbJFbFpbJGbJHbJIbJJbJKbJLbJMbJNbJObJPbJQbJRbJSbJTbJUbxsbJVbJWbJXbJYbJZbxmbKabFCbKbbxmbKcbGUbAnbAnbKdbKebpQbKfbKgbKhbKibjmbyXbsNbKjbKkbKkbKkbKkbKlbKmbKnbFQbHfbKobHgbHgbHgbHgbHgbKpbAGbKqbDkbKrbKrbAJbKsbKtbAMbKubIQbIQbKvbKwbKxbKybKzbKAbKBbKCbKDbKEbKFbKGbKHbKIbKJbJbbKKaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaaaaaabDBbDBbKLbEVbEVbEVbEVbEVbEVbEVbEVbEVbEVbEVbDBbDBaafaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwbqwaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaeaaaaaaaaaaaaaaaaaabEXbKMbKNbKObEXbKPbFbbFcbzLbzLbKQbKQbKQbzLbzLbFlbFlbFlbFlbKRbFlbFlbKSbJtaaabJubKTbKUbKVbKWbKXbKYbKZbKWbKWbLabLbbLcbLdbFpbFpbFpbFpbFpbFpbLebFpbFpbLfbLgbLhbLibLjbLkbLjbxsbLlbLmbLnbLobLpbxmbLqbLrbLsbxmbLtbLubLvbLwbLxbLybpQbLzbhKbjnbLAbjmbLBbsPbLCbLDbLEbLFbLGbpQbFObFPbFQbFQbLHbHgbHgbHgbLIbFQbFQbAGbLJbLKbKrbKrbAJbLLbKtbAMbHrbLMbLNbLObLPbLQbLRbLSbIQbLTbLUbFXbLVbLWbLXbHDbLYbLZbMabMbaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafaafbDBbEVbEVbEVbEVbEVbEVbMcbEVbMdbEVbEVbEVbEVbEVbDBbDBaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaabMebDEbMfbDEbMgaaaaafaaaaaabzLbMhbMibMjbzLaaaaaaaaabFlbMkbMlbHMbFlbKSbJtaaabJubMmbMnbMobMpbGBbMqbMrbMsbMtbFnbMubMvbMwbMxbMybMybMybMybMzbMAbMBbMBbMCbMDbMEbMFbMGbMHbMIbMJbMKbMLbMJbMMbMKbMJbMJbMLbMMbMJbMJbMMbMJbMJbMLbMJbMNbMObpQbrnbpQbMPbyXbMQbpQbpQbpQbpQbpQbpQbMRbFPbFQbMSbMTbMUbMVbMWbMXbMYbMSbAJbMZbNabChbAJbAJbNbbKtbNcbHDbHDbFXbFXbFXbFXbGbbFXbNdbIQbNebFXbNfbHCbgBbHDbNgbNhbNibHDaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaaaaaabDBbNjbNjbNjbNjbNjbNjbNkbEVbNlbNjbMdbEVbEVbEVbEVbDBaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
@@ -10087,7 +10087,7 @@ aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaalwaaaaaaaafaafaaaaafaafaaaaaaaafaafaafaaaalwaaaaafaafaaaaaaaaaaaaaaaaaaaaaaaabJtcaXccSccTccUccVccWccWccWccWccXccYccZccjcdaccjccjcdbccjcdccddcdecdfccobQXcbicdgcpmbPTcdicdjcdkbPTcdjcdlcdmcdnbRkbVEbRkbScbYScdocdpcdqcdrcdsbWJbSkbSlcdtcducdubRpaafaaabXMcaNcdvcdwbTzcdxcdyccIcdzcdAcdBcdCcaQcdDcdEcdFbTzaaaaaaaaaaafaaaaaaaaabVVccKccKccKcdGcdHcbNcdIcdJcdKcdLcdMcdNbVVaaaaaaaaaaaaaafaafaaaaaaaaaaaaaaaaafaaacdOaaaaafaafaaaaaaaaaaafaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaalwaaacdPcdQcdRaaacdPcdQcdRaaacdPcdQcdRaafcdSaafaafaaaaaaaaaaaaaaaaaaaaaaaaaaabJtcaXccScdTccjcdbcdUccjccjccjccjccjcdTcdTccjccjccjccjcdVcdWcddcdXcddcdYcdZcdgcdgcplbPTcebceccedbPTceebOVcefcegcehceibWAbUscejcekbSebUubXHcelbTtaafbTucemcenceobRpaafaafaafaafaafaafbTzcepbVObVQceqcerbVNccEcesbVNcesccEbTzaaaaaaaaaaafaaaaaaaaabVVcbPcbPcbPcbPcetbXSceucevcewcexceycezbVVaaaaaaaaaaaaaaaceAceAceAceBaafaafaafaafcdOaafaafaafaafaafalXceAceAaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaalwaaacdPceCcdRaaacdPceCcdRaaacdPceCcdRaafaafaafaafaaaaaaaaaaaaaaaaaaaafaafaafbJtcaXceDcdTceEccjceFceGceHceHcdaccjcdTceIccjccjccjccjceJceKceLceMbJEceNceOcePceQceRbPTcebcdjceSbPTceTbOVbVEbRkbRkcejbRnceUbXvceVceWbQiceXceYbYqbUAbSlceZcducdubRpaafaaaaaaaafaaaaaabTzcfabVObVQbVOcfbbVNbVObVQbVNbVQcfcbTzaaaaaaaaaaafaaaaaaaaabVVcbIcbJcbKcfdcfecbNcffcfgcfhcfibXScfjbVVaaaaaaaaaaaaaaaceAaaaaafaaaaafaaaaaaaaacfkaaaaafaafaaaaaaaaaaaaceAaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
-aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaeaaaaaaaaaaaaaaaaaaalvaafcdPceCcdRaaacdPceCcdRaafcdPceCcdRaafaaaaaaaafaafaaaaaaaaaaaaaaaaafaaaaaabNpcaXcakcflccjcfmcfncfocfpcfqcfpcfrcfpcfscftccfcfucdTcdTcdWbLdcfvcfwcfxcfycfzcnrcfBcfCcfDcfEcfFcfGcfHbOVcfIbRkbRkcfJbRkbRkbRkbRmbXCcfJbXHbYWbTtaafbRpbRpbRpbRpbRpaafaaaaaaaafaaaaaabTzcfKcfLcfMcfNcfOcfPcfQcfRcfPcfRcfQbTzaafaafaafaafaafaafaafbVVccKccKccKcfSccNbXScfTcfUcfVcfWbXScfXbVVbVVbVVbVVaaaaaaceAaaacfYcfYcfYcfYcfYaafcfZaafcfYcfYcfYcfYcfYaaaceAaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
+aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaeaaaaaaaaaaaaaaaaaaalvaafcdPceCcdRaaacdPceCcdRaafcdPceCcdRaafaaaaaaaafaafaaaaaaaaaaaaaaaaafaaaaaabNpcaXcakcflccjcfmcfncfocfpcfqcfpcfrcfpcfscftccfcfucdTcdTcdWbLdcfvcfwcfxcfycfzagzcfBcfCcfDcfEcfFcfGcfHbOVcfIbRkbRkcfJbRkbRkbRkbRmbXCcfJbXHbYWbTtaafbRpbRpbRpbRpbRpaafaaaaaaaafaaaaaabTzcfKcfLcfMcfNcfOcfPcfQcfRcfPcfRcfQbTzaafaafaafaafaafaafaafbVVccKccKccKcfSccNbXScfTcfUcfVcfWbXScfXbVVbVVbVVbVVaaaaaaceAaaacfYcfYcfYcfYcfYaafcfZaafcfYcfYcfYcfYcfYaaaceAaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaafaaacdPceCcdRaafcdPceCcdRaaacdPceCcdRaaaaaaaaaaaaaaaaafaaaaafaaaaafaafaaaaaabFlcaXcakcgacgbcgbcgccakcakcakcakcakcakcakcakcakcakcakcakcakbFlcgdbFlcgebFlbOPcgfcggcghcgicgjcgkcglcgmbOVcgncgocgpcgqcgrcgscgrcgqcgtcgqcgucejcgvaafaafaafaafaafaafaafaaaaaaaaaaaaaaabTzbTzbTzcgwcgxbTzbTzcgybTzbTzbTzcgybXMaaaaaaaaaaaaaaaaaaaaabVVccKccKccKcfdcgzcbNcgAcgBcgCcgDcgEcgEcgFcgGcgHbVVaafaafceAaafcgIcgJcgJcgJcgJcgKcfZcgLcgMcgMcgMcgMcgNaafceAaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaalwalwalvaafaaacdPceCcdRaafcdPceCcdRaaacdPceCcdRaafaaaaaaaaaaaaaafaafcgOcgPcgPcgPcgPbFlbFlcaXcakcgQcgRcgRcgScgTcgUcgVcgVcgVcgVcgVcgVcgWcgVcgVcgXcgXcgVcgYcgZchachbbOPchcchdchechfchgchhbPSchibYNbRYchjchkchlchmchnchochpbRkchqchrchsbRhaafaafaaaaaaaaaaaaaafaaaaaaaaaaaaaaaaafaaabTzcaNchtbTzaafaafaafaafaafaafaaaaaaaaaaaaaaaaaaaaaaaabVVcbPcbPcbPcbPchubXScfTchvchwchxbXSbXSchybXSchzbVVaaaaaaceAaafchAchAchAchAchAaaacfZaaachAchAchAchAchAaafceAaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
 aaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaalwaaaaafaaaaafaafchBaafaafaafchBaafaaaaafchBaafaaaaaaaaaaaaaaachCchDchEchFchGchHchIchJcaichKcakcakchLchMcakcakbOGchNchNchNchNchNchNchOchNchNchNchPchPchQchRchSchSchTchUchdchebPSbPSbPSbPScpqchWchXchYchZciacibciccibciacibcidcibcidcieaafaafaaaaaaaaaaaaaafaaaaaaaaaaaaaaaaafaaaaaaaaacifaaaaaaaaaaaaaafaaaaafaaaaaaaaaaaaaaaaaaaaaaaabVVcbIcbJcbKcigcfecbNcihbXUciicijcijcikcilcimcinbVVaaaaaaceAaaaaafaaaaafaafaafaaacfZaaaaafaaaaafaaaaafaaaceAaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa
diff --git a/sound/voice/Serithi/Shuttlehere.ogg b/sound/voice/Serithi/Shuttlehere.ogg
new file mode 100644
index 0000000000..095d0eb433
Binary files /dev/null and b/sound/voice/Serithi/Shuttlehere.ogg differ
diff --git a/sound/voice/Serithi/pretenddemoc.ogg b/sound/voice/Serithi/pretenddemoc.ogg
new file mode 100644
index 0000000000..2265aeae4c
Binary files /dev/null and b/sound/voice/Serithi/pretenddemoc.ogg differ
diff --git a/sound/voice/Serithi/weneedvote.ogg b/sound/voice/Serithi/weneedvote.ogg
new file mode 100644
index 0000000000..4bc18b70a6
Binary files /dev/null and b/sound/voice/Serithi/weneedvote.ogg differ