Space Chatter

Adds random space traffic control chatter during the game. It's rare, not spammy. Like every 35 minutes it has one short conversation.

It adds a bunch of lore datums about different parties in space and ship names and stuff. That can be used for other stuff later.

If you find it annoying, you can disable it at the comms consoles (don't need to log in, anyone can do it).

***Normal traffic***
[Common] SCV Falken states, "Virgo TraCon, this is Federation SCV Falken on a military route to the Gateway 98-C at Arest, requesting refueling information."
[Common] Virgo Air/Space Control states, "Federation SCV Falken, this is Virgo TraCon, sending refueling information now."
[Common] SCV Falken states, "Virgo TraCon, thank you, good day."

***5% chance of wrong frequency***
[Common] SDV Lucina states, "Sol Command, this is Federation SDV Lucina on a diplomatic flight to NSB Checkmate, requesting remote telemetry data."
[Common] Virgo Air/Space Control states, "Federation SDV Lucina, this is Virgo TraCon, wrong frequency. Switch to 855.2."
[Common] SDV Lucina states, "Virgo TraCon, understood, apologies."

***2% chance of emergency traffic***
[Common] UNSC Colorado states, "This is Navy UNSC Colorado declaring an emergency! We have unknown life forms on board!"
[Common] Virgo Air/Space Control states, "Navy UNSC Colorado, this is Virgo TraCon, copy. Switch to emergency responder channel 639.2."
[Common] UNSC Colorado states, "Virgo TraCon, okay, switching now."

code/controllers/emergency_shuttle_controller.dm

@@ -95,6 +95,7 @@ var/global/datum/emergency_shuttle_controller/emergency_shuttle
 	shuttle.move_time = SHUTTLE_TRANSIT_DURATION
 
 	priority_announcement.Announce("The regularly scheduled shuttle to the [dock_name] will arrive in in approximately [round(estimate_arrival_time()/60)] minutes. Those leaving should proceed to docks one and two.")
+	atc.shift_ending() //VOREStation Add
 
 //recalls the shuttle
 /datum/emergency_shuttle_controller/proc/recall()

code/game/machinery/computer/communications.dm

@@ -34,13 +34,13 @@
 	var/status_display_freq = "1435"
 	var/stat_msg1
 	var/stat_msg2
-
+	var/datum/lore/atc_controller/ATC //VOREStation Add
 	var/datum/announcement/priority/crew_announcement = new
 
 /obj/machinery/computer/communications/New()
 	..()
 	crew_announcement.newscast = 1
-
+	ATC = atc //VOREStation Add
 /obj/machinery/computer/communications/process()
 	if(..())
 		if(state != STATE_STATUSDISPLAY)
@@ -130,6 +130,10 @@
 		if("messagelist")
 			src.currmsg = 0
 			src.state = STATE_MESSAGELIST
+		//VOREStation Add for ATC stuff
+		if("toggleatc")
+			src.ATC.squelched = !src.ATC.squelched
+		//VOREStation Add End
 		if("viewmessage")
 			src.state = STATE_VIEWMESSAGE
 			if (!src.currmsg)
@@ -311,6 +315,7 @@
 			else
 				dat += "<BR>\[ <A HREF='?src=\ref[src];operation=login'>Log In</A> \]"
 			dat += "<BR>\[ <A HREF='?src=\ref[src];operation=messagelist'>Message List</A> \]"
+			dat += "<BR>\[ <A HREF='?src=\ref[src];operation=toggleatc'>[ATC.squelched ? "Enable" : "Disable"] ATC Relay</A> \]" //VOREStation Add
 		if(STATE_CALLSHUTTLE)
 			dat += "Are you sure you want to call the shuttle? \[ <A HREF='?src=\ref[src];operation=callshuttle2'>OK</A> | <A HREF='?src=\ref[src];operation=main'>Cancel</A> \]"
 		if(STATE_CANCELSHUTTLE)
@@ -374,6 +379,7 @@
 				dat += "<BR>\[ <A HREF='?src=\ref[src];operation=ai-callshuttle'>Call Emergency Shuttle</A> \]"
 			dat += "<BR>\[ <A HREF='?src=\ref[src];operation=ai-messagelist'>Message List</A> \]"
 			dat += "<BR>\[ <A HREF='?src=\ref[src];operation=ai-status'>Set Status Display</A> \]"
+			dat += "<BR>\[ <A HREF='?src=\ref[src];operation=toggleatc'>[ATC.squelched ? "Enable" : "Disable"] ATC Relay</A> \]" //VOREStation Add
 		if(STATE_CALLSHUTTLE)
 			dat += "Are you sure you want to call the shuttle? \[ <A HREF='?src=\ref[src];operation=ai-callshuttle2'>OK</A> | <A HREF='?src=\ref[src];operation=ai-main'>Cancel</A> \]"
 		if(STATE_MESSAGELIST)

code/modules/busy_space/_defines.dm

@@ -0,0 +1,12 @@
+//Org flags
+//Ships you might see
+#define ORG_HAS_NAVY		0x1
+#define ORG_HAS_TRADERS		0x2
+#define ORG_HAS_TECH		0x4
+#define ORG_HAS_MERCS		0x8
+#define ORG_HAS_DIPLO		0x10
+
+//What they get up to kinda
+#define ORG_HAS_SHADY		0x20
+#define ORG_HAS_ENTERTAIN	0x40
+#define ORG_HAS_HUGENESS	0x80

code/modules/busy_space/air_traffic.dm

@@ -0,0 +1,128 @@
+//Cactus, Speedbird, Dynasty, oh my
+
+var/datum/lore/atc_controller/atc = new/datum/lore/atc_controller
+
+/datum/lore/atc_controller
+	var/delay_max = 25 MINUTES			//How long between ATC traffic, max
+	var/delay_min = 40 MINUTES			//How long between ATC traffic, min
+	var/backoff_delay = 5 MINUTES		//How long to back off if we can't talk and want to
+	var/next_message					//When the next message should happen in world.time
+	var/force_chatter_type				//Force a specific type of messages
+
+	var/squelched = 0					//If ATC is squelched currently
+
+/datum/lore/atc_controller/New()
+	spawn(100) //Lots of lag at the start of a shift.
+		msg("New shift beginning, resuming traffic control.")
+	next_message = world.time + rand(delay_min,delay_max)
+	process()
+
+/datum/lore/atc_controller/proc/process()
+	if(world.time >= next_message)
+		if(squelched)
+			next_message = world.time + backoff_delay
+		else
+			next_message = world.time + rand(delay_min,delay_max)
+			random_convo()
+
+	spawn(1 MINUTE) //We don't really need high-accuracy here.
+		process()
+
+/datum/lore/atc_controller/proc/msg(var/message,var/sender)
+	ASSERT(message)
+	global_announcer.autosay("[message]", sender ? sender : "Virgo Air/Space Control")
+
+/datum/lore/atc_controller/proc/reroute_traffic(var/yes = 1)
+	if(yes)
+		msg("Rerouting traffic away from NSS Adaphagia.")
+		squelched = 1
+	else
+		msg("Resuming normal traffic routing around NSS Adaphagia.")
+		squelched = 0
+
+/datum/lore/atc_controller/proc/shift_ending(var/evac = 0)
+	msg("Automated Shuttle departing NSS Virgo Central Command for NSS Adaphagia on routine transfer route.","NT Automated Shuttle")
+	sleep(5 SECONDS)
+	msg("Automated Shuttle, cleared to complete routine transfer from NSS Adaphagia to NSS Virgo Central Command.")
+
+/datum/lore/atc_controller/proc/random_convo()
+	var/one = pick(loremaster.orgs) //These will pick an index, not an instance
+	var/two = pick(loremaster.orgs)
+
+	var/datum/lore/org/source = loremaster.orgs[one] //Resolve to the instances
+	var/datum/lore/org/dest = loremaster.orgs[two]
+
+	//Let's get some mission parameters
+	var/owner = source.sname						//Use the short name
+	var/prefix = pick(source.ship_prefixes)			//Pick a random prefix
+	var/mission = source.ship_prefixes[prefix]		//The value of the prefix is the mission type that prefix does
+	var/shipname = pick(source.ship_names)			//Pick a random ship name to go with it
+	var/destname = pick(dest.holding_names)			//Pick a random holding from the destination
+
+	var/combined_name = "[owner] [prefix] [shipname]"
+	var/alt_atc_names = list("Virgo TraCon","Virgo Control","Virgo ATC","Virgo Airspace")
+	var/wrong_atc_names = list("Sol Command","Polaris TraCon","Orion Control")
+	var/mission_noun = list("flight","mission","route")
+	var/request_verb = list("requesting","calling for","asking for")
+
+	//First response is 'yes', second is 'no'
+	var/requests = list("Virgo transit clearance" = list("permission for transit granted", "permission for transit denied, contact regional on 953.5"),
+						"planetary flight rules" = list("authorizing planetary flight rules", "denying planetary flight rules right now due to traffic"),
+						"special flight rules" = list("authorizing special flight rules", "denying special flight rules, not allowed for your traffic class"),
+						"current solar weather info" = list("sending you the relevant information via tightbeam", "cannot fulfill your request at the moment"),
+						"nearby traffic info" = list("sending you current traffic info", "no available info in your area"),
+						"remote telemetry data" = list("sending telemetry now", "no uplink from your ship, recheck your uplink and ask again"),
+						"refueling information" = list("sending refueling information now", "no fuel for your ship class in this sector"),
+						"a current system time sync" = list("sending time sync ping to you now", "your ship isn't compatible with our time sync, set time manually"),
+						"current system starcharts" = list("transmitting current starcharts", "your request is queued, overloaded right now"),
+						"permission to engage FTL" = list("permission to engage FTL granted, good day", "permission denied, wait for current traffic to pass"),
+						"permission to transit system" = list("permission to transit granted, good day", "permission denied, wait for current traffic to pass"),
+						"permission to depart system" = list("permission to depart granted, good day", "permission denied, wait for current traffic to pass"),
+						"permission to enter system" = list("good day, permission to enter granted", "permission denied, wait for current traffic to pass"),
+						)
+
+	//Random chance things for variety
+	var/chatter_type = "normal"
+	if(force_chatter_type)
+		chatter_type = force_chatter_type
+	else
+		chatter_type = pick(2;"emerg",5;"wrong_freq","normal") //Be nice to have wrong_lang...
+
+	var/yes = prob(90) //Chance for them to say yes vs no
+
+	var/request = pick(requests)
+	var/callname = pick(alt_atc_names)
+	var/response = requests[request][yes ? 1 : 2] //1 is yes, 2 is no
+
+	var/full_request
+	var/full_response
+	var/full_closure
+
+	switch(chatter_type)
+		if("wrong_freq")
+			callname = pick(wrong_atc_names)
+			full_request = "[callname], this is [combined_name] on a [mission] [pick(mission_noun)] to [destname], [pick(request_verb)] [request]."
+			full_response = "[combined_name], this is Virgo TraCon, wrong frequency. Switch to [rand(700,999)].[rand(1,9)]."
+			full_closure = "Virgo TraCon, understood, apologies."
+		if("wrong_lang")
+			//Can't implement this until autosay has language support
+		if("emerg")
+			var/problem = pick("hull breaches on multiple decks","unknown life forms on board","a drive about to go critical","asteroids impacting the hull","a total loss of engine power","people trying to board the ship")
+			full_request = "This is [combined_name] declaring an emergency! We have [problem]!"
+			full_response = "[combined_name], this is Virgo TraCon, copy. Switch to emergency responder channel [rand(700,999)].[rand(1,9)]."
+			full_closure = "Virgo TraCon, okay, switching now."
+		else
+			full_request = "[callname], this is [combined_name] on a [mission] [pick(mission_noun)] to [destname], [pick(request_verb)] [request]."
+			full_response = "[combined_name], this is Virgo TraCon, [response]." //Virgo TraCon always calls themselves TraCon
+			full_closure = "Virgo TraCon, [yes ? "thank you" : "understood"], good day." //They always copy what TraCon called themselves in the end when they realize they said it wrong
+
+	//Ship sends request to ATC
+	msg(full_request,"[prefix] [shipname]")
+	sleep(5 SECONDS)
+	//ATC sends response to ship
+	msg(full_response)
+	sleep(5 SECONDS)
+	//Ship sends response to ATC
+	msg(full_closure,"[prefix] [shipname]")
+
+	return

code/modules/busy_space/loremaster.dm

@@ -0,0 +1,14 @@
+//I AM THE LOREMASTER, ARE YOU THE GATEKEEPER?
+
+var/datum/lore/loremaster/loremaster = new/datum/lore/loremaster
+
+/datum/lore/loremaster
+	var/list/orgs = list()
+
+/datum/lore/loremaster/New()
+	var/paths //Just reuse this a bunch of times.
+
+	paths = typesof(/datum/lore/org) - /datum/lore/org
+	for(var/path in paths)
+		var/datum/lore/org/instance = new path()
+		orgs[path] = instance

code/modules/busy_space/orgs.dm

@@ -0,0 +1,360 @@
+//Datums for different companies that can be used by busy_space
+/datum/lore/org
+	var/name = ""				//Organization's name
+	var/sname = ""				//Org's shortname (NanoTrasen for "NanoTrasen Incorporated")
+	var/desc = ""				//Long description of org, but only current stuff, see 'history'
+	var/history = ""			//Historical discription of org's origins
+	var/work = ""				//Short description of their work, eg "an arms manufacturer"
+	var/headquarters = ""		//Location of Org's HQ
+	var/motto = ""				//A motto, if they have one
+
+	var/org_flags = 0			//Flags for the org
+
+	var/list/ship_prefixes = list()//Some might have more than one! Like NanoTrasen. Value is the mission they perform.
+	var/list/ship_names = list()//Names of spaceships
+	var/list/holding_names = list()//Names of static holdings (planets, bases)
+
+//////////////////////////////////////////////////////////////////////////////////
+
+/datum/lore/org/nanotrasen
+	name = "NanoTrasen Incorporated"
+	sname = "NanoTrasen"
+	desc = "A megacorporation specializing in genetic and phoron research. The founder, Xavier Trasen, set the company \
+			up to be a powerhouse of buying up smaller companies, and turning a profit on the backs of it's workers. \
+			It's not known to be the most controversy-free company, nor the best to work for, though millions are employed \
+			nonetheless by NanoTrasen."
+	history = "Originally founded on Mars in 23rd Century by a man named Xavier Trasen, NanoTrasen started \
+				out as a small company, whose research was mostly based around gene-therapy. After a controversy over \
+				cloning, and buying many smaller companies, Xavier Trasen aggressively pursued phoron research \
+				as soon as it was discovered, bringing NanoTrasen to the forefront of the field."
+	work = "mega-conglomerate"
+	headquarters = "Mars"
+	motto = ""
+
+	org_flags = ORG_HAS_NAVY|ORG_HAS_TECH|ORG_HAS_HUGENESS
+
+	//Generic ship names!
+	ship_prefixes = list("NSV" = "exploration", "NTV" = "hauling", "NDV" = "patrol", "NRV" = "emergency response")
+	ship_names = list("Profit",
+					"Discovery",
+					"Endeavour",
+					"Desire",
+					"Gains",
+					"Torch II",
+					"Columbia",
+					"Leyte Gulf",
+					"Exeter",
+					"Zhukov",
+					"Xavier",
+					"Liteon",
+					"Fanatic",
+					"Slow Boat",
+					"Listing",
+					"Even Faster",
+					"Likely Story",
+					"Looking Glass",
+					"Witchcraft")
+	holding_names = list("NSS Phi Gamma",
+						"NSB Adelphia",
+						"NSS Vertigo",
+						"NSB Checkmate",
+						"NSS Lampour",
+						"NSB Adelade",
+						"NSS Indiana",
+						"NSB Memory Alpha",
+						"NSS Memory Beta")
+
+/datum/lore/org/federation
+	name = "United Federation of Planets"
+	sname = "Federation"
+	desc = "The United Federation is a federation of planets that have agreed to exist semi-autonomously \
+			under a single central hybrid government, sharing the ideals of liberty, equality, and rights \
+			for all. It is one of the larger known interstellar powers in known space and is seen as being \
+			the fastest building power. The core planet of Gaia is known for having a proud military culture \
+			that, ironically, tends to stomp out any idea of warmongering from their cadets due to their \
+			scarred history and the Federation's ideals."
+	history = "Before the United Federation, there was a simple alliance with no name between core planet \
+				members. The United Federation itself found its roots in the aftermath of the Bloody \
+				Valentine Civil War, a racially motivated war that occurred in 2550 during the last year of \
+				the Federation Alliance of Gaia between the Genetically Modified and so-called Naturalists. \
+				Neutral nations in Gaia's political sphere, encouraged by alien observers, formed the United \
+				Federation when the indiscriminate loss of life became intolerable. 2555 saw the official \
+				signing of the Federation Charter between the core planet members."
+	work = "governing body"
+	headquarters = ""
+	motto = ""
+
+	org_flags = ORG_HAS_NAVY|ORG_HAS_TRADERS|ORG_HAS_TECH|ORG_HAS_DIPLO
+
+	//Star Trek ship names!
+	ship_prefixes = list("SCV" = "military", "STV" = "trading", "SDV" = "diplomatic")
+	ship_names = list("Kestrel",
+						"Beacon",
+						"Signal",
+						"Flying Freedom",
+						"Los Canas",
+						"Ixiom",
+						"Falken",
+						"Marigold",
+						"White Valley",
+						"Eternal",
+						"Arkbird",
+						"Akira",
+						"Kongou",
+						"Maki",
+						"Kagero",
+						"Nishiki",
+						"Icarus",
+						"Yuudachi",
+						"Tiki",
+						"Lucina",
+						"Tenryu",
+						"Spirit of Koni",
+						"Lady of Onoilph")
+	holding_names = list("Ruins of Chani City on Quarri III",
+						"Ruins of Kreely City on Ocan II",
+						"Ruins of Mishi City on Lucida IV",
+						"Ruins of Posloo City on Pi Cephei Prime",
+						"Molten Plains of Anarakis VII",
+						"Living City of Shani",
+						"Floating City of Nuni Vanni",
+						"Crystalline City of Delve Tile",
+						"New Iapetus Colony",
+						"Onul Colony",
+						"Ahemait Colony",
+						"New Amasia Colony",
+						"New Vesta Colony",
+						"Amaus Research Facility on Azaleh III",
+						"Living City of Na'me L'Tauri",
+						"Living City of Fithpa",
+						"Resource Mines of Lyra III",
+						"Resource Mines of Chi Cerberi III",
+						"Ceani Military Outpost on Rily VII",
+						"Naro Industrial Complex on Scheddi III",
+						"Mari Industrial Complex on Furlou Prime",
+						"Runni Crystal Mines of Keid V")
+
+/datum/lore/org/solgov
+	name = "Solar Confederate Government"
+	sname = "SolGov"
+	desc = "SolGov is the entity in which many human states are members. Though SolGov has a dedicated miltiary force in the UNSC, \
+			it also claims the use of the forces of the member states when it needs to affect a \
+			military goal. Many if not most human states are members of SolGov, including all entities in Sol."
+	history = "Originally a military/economic pact between Earth and Mars in the early days of human colonization, \
+				the SolGov body of member states has grown over the years to be quite large, and hold a sizable \
+				amount of power compared to similar bodies."
+	work = "government of Sol"
+	headquarters = "Luna"
+	motto = ""
+
+	org_flags = ORG_HAS_TRADERS|ORG_HAS_DIPLO
+
+	//Random ship names!
+	ship_prefixes = list("SOL" = "SolGov") //Don't ask questions!
+	ship_names = list("Torch",
+					"Phoenix",
+					"Majesty",
+					"Duke",
+					"King",
+					"Mandrake",
+					"Foxglove",
+					"Prompt",
+					"Regal",
+					"Lordship",
+					"Highness",
+					"Rapido",
+					"Paperwork",
+					"Arthur",
+					"Durandal",
+					"Roland")
+	holding_names = list("San Francisco on Earth",
+						"SolGov Fleet Academy on Earth",
+						"Gateway One above Luna",
+						"SolGov Command on Luna",
+						"Olympus City on Mars",
+						"Hermes Naval Shipyard above Mars",
+						"a settlement on Titan",
+						"a settlement on Europa",
+						"Aleph Grande on Ganymede",
+						"a new colony in Proxima II",
+						"a new settlement on Ceti IV-B",
+						"a colony ship around Ceti IV-B",
+						"a classified location in SolGov territory")
+
+/datum/lore/org/unsc
+	name = "United Nations Space Command"
+	sname = "Navy" //Otherwise they call the ships UNSC UNSC Name
+	desc = "The dedicated military force of SolGov, formed from the remnants of the United Nations, is the might of SolGov. \
+			While it is greater in military strength than most alien polities, it is not by much."
+	history = ""
+	work = ""
+	headquarters = "Earth"
+	motto = ""
+
+	org_flags = ORG_HAS_NAVY|ORG_HAS_TECH
+
+	//Halo ship names!
+	ship_prefixes = list("UNSC" = "military")
+	ship_names = list("Colorado",
+						"Anjou",
+						"Shanxi",
+						"Hammerhead",
+						"Piranha",
+						"Barracuda",
+						"DeGaulle",
+						"Leonidas",
+						"Tokugawa",
+						"Halcyon",
+						"Bastion",
+						"Adjudicator",
+						"Devestator",
+						"Corsair",
+						"Herakles",
+						"Ain't No Sunshine",
+						"Dust of Snow",
+						"Finite Hearts")
+	holding_names = list("San Francisco on Earth",
+						"SolGov Fleet Academy on Earth",
+						"Gateway One above Luna",
+						"SolGov Command on Luna",
+						"Olympus City on Mars",
+						"Hermes Naval Shipyard above Mars",
+						"a settlement on Titan",
+						"a settlement on Europa",
+						"Aleph Grande on Ganymede",
+						"a new colony in Proxima II",
+						"a new settlement on Ceti IV-B",
+						"a colony ship around Ceti IV-B",
+						"a classified location in SolGov territory")
+
+/datum/lore/org/kitsuhana
+	name = "Kitsuhana Heavy Industries"
+	sname = "Kitsuhana"
+	desc = "A large post-scarcity amalgamation of races, Kitsuhana is no longer a company but rather a loose association of 'members' \
+			who only share the KHI name and their ideals in common. Kitsuhana accepts interviews to join their ranks, and though they have no \
+			formal structure with regards to government or law, the concept of 'consent' drives most of the large decision making. Kitsuhanans \
+			pride themselves on their ability to avoid consequence. Their post-scarcity allows them to rebuild, regrow, and replenish almost any \
+			lost asset or resource nearly instantly. It leads to many of the Kitsuhana 'members' treating everything with frivolity, \
+			and lends them a care-free demeanor."
+	history = "Originally a heavy industrial equipment and space mining company. During a forced evacuation of their homeworld, \
+			they were they only organization with enough ship capacity to evacuate any of the population, starting with their employees. \
+			After the resulting slowship travel to nearby starsystems, most of the population decided to keep the moniker of the \
+			company name. Over the years, Kitsuhana developed into a post-scarcity anarchy where virtually nothing has consequences \
+			and Kitsuhana 'members' can live their lives as they see fit, often in isolation."
+	work = "utopian anarchy"
+	headquarters = "Kitsuhana Prime"
+	motto = "Do what you want. We know we will."
+
+	org_flags = ORG_HAS_TRADERS|ORG_HAS_TECH|ORG_HAS_MERCS|ORG_HAS_ENTERTAIN
+
+	//Culture ship names!
+	ship_prefixes = list("KHI" = "personal") //Everybody's out for themselves, yanno.
+	ship_names = list("Nervous Energy",
+						"Prosthetic Conscience",
+						"Revisionist",
+						"Trade Surplus",
+						"Flexible Demeanour",
+						"Just Read The Instructions",
+						"Limiting Factor",
+						"Cargo Cult",
+						"Gunboat Diplomat",
+						"A Ship With A View",
+						"Cantankerous",
+						"I Thought He Was With You",
+						"Never Talk To Strangers",
+						"Sacrificial Victim",
+						"Unwitting Accomplice",
+						"Bad For Business",
+						"Just Testing",
+						"Size Isn't Everything",
+						"Yawning Angel",
+						"Liveware Problem",
+						"Very Little Gravitas Indeed",
+						"Zero Gravitas",
+						"Gravitas Free Zone",
+						"Absolutely No You-Know-What")
+	holding_names = list("Kitsuhana Prime",
+						"Kitsuhana Beta",
+						"Kitsuhana Gamma",
+						"the Kitsuhana Forge",
+						"a Kitsuhanan's home",
+						"a Kitsuhana ringworld in Pleis Ceti V",
+						"a Kitsuhana ringworld in Lund VI",
+						"a Kitsuhana ringworld in Dais IX",
+						"a Kitsuhana ringworld in Leibert II-b")
+
+/datum/lore/org/ares
+    name = "Ares Confederation"
+    sname = "ArCon"
+    desc = "A rebel faction on the fringes of human space that renounced the government of both SolGov and their corporate overlords. \
+			The Confederation has two fleets, a regular United Fleet Host, comprised of professional crewmen and officers and the Free Host of the Confederation, \
+			which are privateers, volunteers and former pirates. The Ares Confederation only holds a \
+			dozen planets, but are fiercely defending any incursion on their territory."
+    history = "Originally only a strike of miners on the dusty, arid planet of Ares in the year 2540, \
+    			the Ares Confederation was quickly established under the leadership of \
+	 			retired UNSC Colonel Rodrick Gellaume, who is now Prime Minister."
+    work = "rebel fringe government"
+    headquarters = "Paraiso a <20>strea"
+    motto = "Liberty to the Stars!"
+
+    org_flags = ORG_HAS_NAVY|ORG_HAS_SHADY
+
+    ship_prefixes = list("UFHV" = "military", "FFHV" = "shady")
+    ship_names = list("Liberty",
+					"Charged Negotiation",
+					"People's Fist",
+					"Corporation Breaker",
+					"Laughing Maniac",
+					"Not Insured",
+					"Prehensile Ethics",
+					"Fist of Ares",
+					"Gellaume",
+					"Memory of Fallen",
+					"Star of Tiamat",
+					"Mostly Harmless",
+					"Hero of the Revolution",
+					"Dawnstar",
+					"Freedom",
+					"Fiery Justice",
+					"Bulwark of the Free",
+					"Pride of Liberty",
+					"Gauntlet",
+					"Petrov",
+					"Miko",
+					"Mahama",
+					"Jerome",
+					"Rodrick",
+					"Torch",
+					"Torch of Freedom",
+					"She Is One Of Ours Sir",
+					"Fuck The Captain",
+					"None Of Your Business")
+    holding_names = list("Drydocks of the Ares Confederation",
+						"a classified location",
+						"a Homestead on Paraiso a <20>strea",
+						"a contested sector of ArCon space",
+						"one of our free colonies",
+						"the Gateway 98-C at Arest",
+						"Sars Mara on Ares",
+						"Listening Post Maryland-Sigma",
+						"an emergency nav bouy",
+						"New Berlin on Nov-Ferrum",
+						"a settlement needing our help",
+						"Forward Base Sigma-Alpha in ArCon space")
+
+/*
+/datum/lore/org
+	name = ""
+	sname = ""
+	desc = ""
+	history = ""
+	work = ""
+	headquarters = ""
+	motto = ""
+
+	org_flags = 0
+
+	ship_prefixes = list()
+	ship_names = list()
+	holding_names = list()
+*/