mirror of
https://github.com/CHOMPStation2/CHOMPStation2.git
synced 2025-12-10 10:12:45 +00:00
POLARIS: Moves most boxes to use starts_with
This commit is contained in:
@@ -47,19 +47,15 @@
|
|||||||
max_storage_space = ITEMSIZE_COST_NORMAL * 14 // 56
|
max_storage_space = ITEMSIZE_COST_NORMAL * 14 // 56
|
||||||
storage_cost = INVENTORY_STANDARD_SPACE + 1
|
storage_cost = INVENTORY_STANDARD_SPACE + 1
|
||||||
|
|
||||||
New()
|
/obj/item/weapon/storage/backpack/holding/attackby(obj/item/weapon/W as obj, mob/user as mob)
|
||||||
..()
|
|
||||||
return
|
|
||||||
|
|
||||||
attackby(obj/item/weapon/W as obj, mob/user as mob)
|
|
||||||
if(istype(W, /obj/item/weapon/storage/backpack/holding))
|
if(istype(W, /obj/item/weapon/storage/backpack/holding))
|
||||||
user << "<span class='warning'>The Bluespace interfaces of the two devices conflict and malfunction.</span>"
|
user << "<span class='warning'>The Bluespace interfaces of the two devices conflict and malfunction.</span>"
|
||||||
qdel(W)
|
qdel(W)
|
||||||
return
|
return
|
||||||
..()
|
. = ..()
|
||||||
|
|
||||||
//Please don't clutter the parent storage item with stupid hacks.
|
//Please don't clutter the parent storage item with stupid hacks.
|
||||||
can_be_inserted(obj/item/W as obj, stop_messages = 0)
|
/obj/item/weapon/storage/backpack/holding/can_be_inserted(obj/item/W as obj, stop_messages = 0)
|
||||||
if(istype(W, /obj/item/weapon/storage/backpack/holding))
|
if(istype(W, /obj/item/weapon/storage/backpack/holding))
|
||||||
return 1
|
return 1
|
||||||
return ..()
|
return ..()
|
||||||
@@ -197,9 +193,7 @@
|
|||||||
item_state_slots = list(slot_r_hand_str = "briefcase", slot_l_hand_str = "briefcase")
|
item_state_slots = list(slot_r_hand_str = "briefcase", slot_l_hand_str = "briefcase")
|
||||||
|
|
||||||
/obj/item/weapon/storage/backpack/satchel/withwallet
|
/obj/item/weapon/storage/backpack/satchel/withwallet
|
||||||
New()
|
starts_with = list(/obj/item/weapon/storage/wallet/random)
|
||||||
..()
|
|
||||||
new /obj/item/weapon/storage/wallet/random( src )
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/backpack/satchel/norm
|
/obj/item/weapon/storage/backpack/satchel/norm
|
||||||
name = "satchel"
|
name = "satchel"
|
||||||
|
|||||||
@@ -112,12 +112,8 @@
|
|||||||
storage_slots = 7
|
storage_slots = 7
|
||||||
|
|
||||||
allow_quick_empty = 1 // this function is superceded
|
allow_quick_empty = 1 // this function is superceded
|
||||||
New()
|
|
||||||
..()
|
|
||||||
//verbs -= /obj/item/weapon/storage/verb/quick_empty
|
|
||||||
//verbs += /obj/item/weapon/storage/bag/sheetsnatcher/quick_empty
|
|
||||||
|
|
||||||
can_be_inserted(obj/item/W as obj, stop_messages = 0)
|
/obj/item/weapon/storage/bag/sheetsnatcher/can_be_inserted(obj/item/W as obj, stop_messages = 0)
|
||||||
if(!istype(W,/obj/item/stack/material))
|
if(!istype(W,/obj/item/stack/material))
|
||||||
if(!stop_messages)
|
if(!stop_messages)
|
||||||
usr << "The snatcher does not accept [W]."
|
usr << "The snatcher does not accept [W]."
|
||||||
@@ -133,7 +129,7 @@
|
|||||||
|
|
||||||
|
|
||||||
// Modified handle_item_insertion. Would prefer not to, but...
|
// Modified handle_item_insertion. Would prefer not to, but...
|
||||||
handle_item_insertion(obj/item/W as obj, prevent_warning = 0)
|
/obj/item/weapon/storage/bag/sheetsnatcher/handle_item_insertion(obj/item/W as obj, prevent_warning = 0)
|
||||||
var/obj/item/stack/material/S = W
|
var/obj/item/stack/material/S = W
|
||||||
if(!istype(S)) return 0
|
if(!istype(S)) return 0
|
||||||
|
|
||||||
@@ -173,7 +169,7 @@
|
|||||||
|
|
||||||
// Sets up numbered display to show the stack size of each stored mineral
|
// Sets up numbered display to show the stack size of each stored mineral
|
||||||
// NOTE: numbered display is turned off currently because it's broken
|
// NOTE: numbered display is turned off currently because it's broken
|
||||||
orient2hud(mob/user as mob)
|
/obj/item/weapon/storage/bag/sheetsnatcher/orient2hud(mob/user as mob)
|
||||||
var/adjusted_contents = contents.len
|
var/adjusted_contents = contents.len
|
||||||
|
|
||||||
//Numbered contents display
|
//Numbered contents display
|
||||||
@@ -194,9 +190,8 @@
|
|||||||
src.slot_orient_objs(row_num, col_count, numbered_contents)
|
src.slot_orient_objs(row_num, col_count, numbered_contents)
|
||||||
return
|
return
|
||||||
|
|
||||||
|
|
||||||
// Modified quick_empty verb drops appropriate sized stacks
|
// Modified quick_empty verb drops appropriate sized stacks
|
||||||
quick_empty()
|
/obj/item/weapon/storage/bag/sheetsnatcher/quick_empty()
|
||||||
var/location = get_turf(src)
|
var/location = get_turf(src)
|
||||||
for(var/obj/item/stack/material/S in contents)
|
for(var/obj/item/stack/material/S in contents)
|
||||||
while(S.amount)
|
while(S.amount)
|
||||||
@@ -212,7 +207,7 @@
|
|||||||
update_icon()
|
update_icon()
|
||||||
|
|
||||||
// Instead of removing
|
// Instead of removing
|
||||||
remove_from_storage(obj/item/W as obj, atom/new_location)
|
/obj/item/weapon/storage/bag/sheetsnatcher/remove_from_storage(obj/item/W as obj, atom/new_location)
|
||||||
var/obj/item/stack/material/S = W
|
var/obj/item/stack/material/S = W
|
||||||
if(!istype(S)) return 0
|
if(!istype(S)) return 0
|
||||||
|
|
||||||
|
|||||||
@@ -59,23 +59,25 @@
|
|||||||
/obj/item/device/integrated_electronics/wirer,
|
/obj/item/device/integrated_electronics/wirer,
|
||||||
)
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/utility/full/New()
|
/obj/item/weapon/storage/belt/utility/full
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/weapon/screwdriver(src)
|
/obj/item/weapon/screwdriver,
|
||||||
new /obj/item/weapon/wrench(src)
|
/obj/item/weapon/wrench,
|
||||||
new /obj/item/weapon/weldingtool(src)
|
/obj/item/weapon/weldingtool,
|
||||||
new /obj/item/weapon/crowbar(src)
|
/obj/item/weapon/crowbar,
|
||||||
new /obj/item/weapon/wirecutters(src)
|
/obj/item/weapon/wirecutters,
|
||||||
new /obj/item/stack/cable_coil(src,30,pick("red","yellow","orange"))
|
/obj/item/stack/cable_coil/random_belt
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/utility/atmostech/New()
|
/obj/item/weapon/storage/belt/utility/atmostech
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/weapon/screwdriver(src)
|
/obj/item/weapon/screwdriver,
|
||||||
new /obj/item/weapon/wrench(src)
|
/obj/item/weapon/wrench,
|
||||||
new /obj/item/weapon/weldingtool(src)
|
/obj/item/weapon/weldingtool,
|
||||||
new /obj/item/weapon/crowbar(src)
|
/obj/item/weapon/crowbar,
|
||||||
new /obj/item/weapon/wirecutters(src)
|
/obj/item/weapon/wirecutters,
|
||||||
new /obj/item/device/t_scanner(src)
|
/obj/item/device/t_scanner
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/utility/chief
|
/obj/item/weapon/storage/belt/utility/chief
|
||||||
name = "chief engineer's toolbelt"
|
name = "chief engineer's toolbelt"
|
||||||
@@ -83,15 +85,16 @@
|
|||||||
icon_state = "utilitybelt_ce"
|
icon_state = "utilitybelt_ce"
|
||||||
item_state = "utility_ce"
|
item_state = "utility_ce"
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/utility/chief/full/New()
|
/obj/item/weapon/storage/belt/utility/chief/full
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/weapon/screwdriver/power(src)
|
/obj/item/weapon/screwdriver/power,
|
||||||
new /obj/item/weapon/crowbar/power(src)
|
/obj/item/weapon/crowbar/power,
|
||||||
new /obj/item/weapon/weldingtool/experimental(src)
|
/obj/item/weapon/weldingtool/experimental,
|
||||||
new /obj/item/device/multitool(src)
|
/obj/item/device/multitool,
|
||||||
new /obj/item/stack/cable_coil(src,30,pick("red","yellow","orange"))
|
/obj/item/stack/cable_coil/random_belt,
|
||||||
new /obj/item/weapon/extinguisher/mini(src)
|
/obj/item/weapon/extinguisher/mini,
|
||||||
new /obj/item/device/analyzer(src)
|
/obj/item/device/analyzer
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/medical
|
/obj/item/weapon/storage/belt/medical
|
||||||
name = "medical belt"
|
name = "medical belt"
|
||||||
@@ -216,14 +219,8 @@
|
|||||||
/obj/item/device/soulstone
|
/obj/item/device/soulstone
|
||||||
)
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/soulstone/full/New()
|
/obj/item/weapon/storage/belt/soulstone/full
|
||||||
..()
|
starts_with = list(/obj/item/device/soulstone = 6)
|
||||||
new /obj/item/device/soulstone(src)
|
|
||||||
new /obj/item/device/soulstone(src)
|
|
||||||
new /obj/item/device/soulstone(src)
|
|
||||||
new /obj/item/device/soulstone(src)
|
|
||||||
new /obj/item/device/soulstone(src)
|
|
||||||
new /obj/item/device/soulstone(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/utility/alien
|
/obj/item/weapon/storage/belt/utility/alien
|
||||||
name = "alien belt"
|
name = "alien belt"
|
||||||
@@ -232,15 +229,16 @@
|
|||||||
icon_state = "belt"
|
icon_state = "belt"
|
||||||
item_state = "security"
|
item_state = "security"
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/utility/alien/full/New()
|
/obj/item/weapon/storage/belt/utility/alien/full
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/weapon/screwdriver/alien(src)
|
/obj/item/weapon/screwdriver/alien,
|
||||||
new /obj/item/weapon/wrench/alien(src)
|
/obj/item/weapon/wrench/alien,
|
||||||
new /obj/item/weapon/weldingtool/alien(src)
|
/obj/item/weapon/weldingtool/alien,
|
||||||
new /obj/item/weapon/crowbar/alien(src)
|
/obj/item/weapon/crowbar/alien,
|
||||||
new /obj/item/weapon/wirecutters/alien(src)
|
/obj/item/weapon/wirecutters/alien,
|
||||||
new /obj/item/device/multitool/alien(src)
|
/obj/item/device/multitool/alien,
|
||||||
new /obj/item/stack/cable_coil/alien(src)
|
/obj/item/stack/cable_coil/alien
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/medical/alien
|
/obj/item/weapon/storage/belt/medical/alien
|
||||||
name = "alien belt"
|
name = "alien belt"
|
||||||
@@ -277,16 +275,17 @@
|
|||||||
/obj/item/weapon/surgical
|
/obj/item/weapon/surgical
|
||||||
)
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/medical/alien/New()
|
/obj/item/weapon/storage/belt/medical/alien
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/weapon/surgical/scalpel/alien(src)
|
/obj/item/weapon/surgical/scalpel/alien,
|
||||||
new /obj/item/weapon/surgical/hemostat/alien(src)
|
/obj/item/weapon/surgical/hemostat/alien,
|
||||||
new /obj/item/weapon/surgical/retractor/alien(src)
|
/obj/item/weapon/surgical/retractor/alien,
|
||||||
new /obj/item/weapon/surgical/circular_saw/alien(src)
|
/obj/item/weapon/surgical/circular_saw/alien,
|
||||||
new /obj/item/weapon/surgical/FixOVein/alien(src)
|
/obj/item/weapon/surgical/FixOVein/alien,
|
||||||
new /obj/item/weapon/surgical/bone_clamp/alien(src)
|
/obj/item/weapon/surgical/bone_clamp/alien,
|
||||||
new /obj/item/weapon/surgical/cautery/alien(src)
|
/obj/item/weapon/surgical/cautery/alien,
|
||||||
new /obj/item/weapon/surgical/surgicaldrill/alien(src)
|
/obj/item/weapon/surgical/surgicaldrill/alien
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/belt/champion
|
/obj/item/weapon/storage/belt/champion
|
||||||
name = "championship belt"
|
name = "championship belt"
|
||||||
|
|||||||
@@ -14,12 +14,13 @@
|
|||||||
icon_state ="bible"
|
icon_state ="bible"
|
||||||
|
|
||||||
/obj/item/weapon/storage/bible/booze/New()
|
/obj/item/weapon/storage/bible/booze/New()
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/weapon/reagent_containers/food/drinks/bottle/small/beer(src)
|
/obj/item/weapon/reagent_containers/food/drinks/bottle/small/beer,
|
||||||
new /obj/item/weapon/reagent_containers/food/drinks/bottle/small/beer(src)
|
/obj/item/weapon/reagent_containers/food/drinks/bottle/small/beer,
|
||||||
new /obj/item/weapon/spacecash/c100(src)
|
/obj/item/weapon/spacecash/c100,
|
||||||
new /obj/item/weapon/spacecash/c100(src)
|
/obj/item/weapon/spacecash/c100,
|
||||||
new /obj/item/weapon/spacecash/c100(src)
|
/obj/item/weapon/spacecash/c100
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/bible/afterattack(atom/A, mob/user as mob, proximity)
|
/obj/item/weapon/storage/bible/afterattack(atom/A, mob/user as mob, proximity)
|
||||||
if(!proximity) return
|
if(!proximity) return
|
||||||
|
|||||||
@@ -75,393 +75,250 @@
|
|||||||
name = "box of latex gloves"
|
name = "box of latex gloves"
|
||||||
desc = "Contains white gloves."
|
desc = "Contains white gloves."
|
||||||
icon_state = "latex"
|
icon_state = "latex"
|
||||||
|
starts_with = list(/obj/item/clothing/gloves/sterile/latex = 7)
|
||||||
/obj/item/weapon/storage/box/gloves/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/clothing/gloves/sterile/latex(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/masks
|
/obj/item/weapon/storage/box/masks
|
||||||
name = "box of sterile masks"
|
name = "box of sterile masks"
|
||||||
desc = "This box contains masks of sterility."
|
desc = "This box contains masks of sterility."
|
||||||
icon_state = "sterile"
|
icon_state = "sterile"
|
||||||
|
starts_with = list(/obj/item/clothing/mask/surgical = 7)
|
||||||
/obj/item/weapon/storage/box/masks/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/clothing/mask/surgical(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syringes
|
/obj/item/weapon/storage/box/syringes
|
||||||
name = "box of syringes"
|
name = "box of syringes"
|
||||||
desc = "A box full of syringes."
|
desc = "A box full of syringes."
|
||||||
icon_state = "syringe"
|
icon_state = "syringe"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/syringe = 7)
|
||||||
/obj/item/weapon/storage/box/syringes/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/reagent_containers/syringe(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syringegun
|
/obj/item/weapon/storage/box/syringegun
|
||||||
name = "box of syringe gun cartridges"
|
name = "box of syringe gun cartridges"
|
||||||
desc = "A box full of compressed gas cartridges."
|
desc = "A box full of compressed gas cartridges."
|
||||||
icon_state = "syringe"
|
icon_state = "syringe"
|
||||||
|
starts_with = list(/obj/item/weapon/syringe_cartridge = 7)
|
||||||
/obj/item/weapon/storage/box/syringegun/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/syringe_cartridge(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/beakers
|
/obj/item/weapon/storage/box/beakers
|
||||||
name = "box of beakers"
|
name = "box of beakers"
|
||||||
icon_state = "beaker"
|
icon_state = "beaker"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/glass/beaker = 7)
|
||||||
/obj/item/weapon/storage/box/beakers/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/reagent_containers/glass/beaker(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/injectors
|
/obj/item/weapon/storage/box/injectors
|
||||||
name = "box of DNA injectors"
|
name = "box of DNA injectors"
|
||||||
desc = "This box contains injectors it seems."
|
desc = "This box contains injectors it seems."
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/injectors/New()
|
/obj/item/weapon/dnainjector/h2m = 3,
|
||||||
..()
|
/obj/item/weapon/dnainjector/m2h = 3
|
||||||
for(var/i = 1 to 3)
|
)
|
||||||
new /obj/item/weapon/dnainjector/h2m(src)
|
|
||||||
for(var/i = 1 to 3)
|
|
||||||
new /obj/item/weapon/dnainjector/m2h(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/blanks
|
/obj/item/weapon/storage/box/blanks
|
||||||
name = "box of blank shells"
|
name = "box of blank shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front."
|
desc = "It has a picture of a gun and several warning symbols on the front."
|
||||||
icon_state = "blankshot_box"
|
icon_state = "blankshot_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g/blank = 8)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/blanks/New()
|
/obj/item/weapon/storage/box/blanks/large
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g/blank = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/blank(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/blanks/large/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/blank(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/beanbags
|
/obj/item/weapon/storage/box/beanbags
|
||||||
name = "box of beanbag shells"
|
name = "box of beanbag shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
||||||
icon_state = "beanshot_box"
|
icon_state = "beanshot_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g/beanbag = 8)
|
||||||
/obj/item/weapon/storage/box/beanbags/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/beanbag(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/beanbags/large/New()
|
/obj/item/weapon/storage/box/beanbags/large/New()
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g/beanbag = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/beanbag(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/shotgunammo
|
/obj/item/weapon/storage/box/shotgunammo
|
||||||
name = "box of shotgun slugs"
|
name = "box of shotgun slugs"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
||||||
icon_state = "lethalshellshot_box"
|
icon_state = "lethalshellshot_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g = 8)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/shotgunammo/New()
|
/obj/item/weapon/storage/box/shotgunammo/large
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/shotgunammo/large/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/shotgunshells
|
/obj/item/weapon/storage/box/shotgunshells
|
||||||
name = "box of shotgun shells"
|
name = "box of shotgun shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
||||||
icon_state = "lethalslug_box"
|
icon_state = "lethalslug_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g/pellet = 8)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/shotgunshells/New()
|
/obj/item/weapon/storage/box/shotgunshells/large
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g/pellet = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/pellet(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/shotgunshells/large/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/pellet(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/flashshells
|
/obj/item/weapon/storage/box/flashshells
|
||||||
name = "box of illumination shells"
|
name = "box of illumination shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
||||||
icon_state = "illumshot_box"
|
icon_state = "illumshot_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g/flash = 8)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/flashshells/New()
|
/obj/item/weapon/storage/box/flashshells/large
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g/flash = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/flash(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/flashshells/large/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/flash(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/stunshells
|
/obj/item/weapon/storage/box/stunshells
|
||||||
name = "box of stun shells"
|
name = "box of stun shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
||||||
icon_state = "stunshot_box"
|
icon_state = "stunshot_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g/stunshell = 8)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/stunshells/New()
|
/obj/item/weapon/storage/box/stunshells/large
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g/stunshell = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/stunshell(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/stunshells/large/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/stunshell(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/practiceshells
|
/obj/item/weapon/storage/box/practiceshells
|
||||||
name = "box of practice shells"
|
name = "box of practice shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
||||||
icon_state = "blankshot_box"
|
icon_state = "blankshot_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g/practice = 8)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/practiceshells/New()
|
/obj/item/weapon/storage/box/practiceshells/large
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g/practice = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/practice(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/practiceshells/large/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/practice(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/empshells
|
/obj/item/weapon/storage/box/empshells
|
||||||
name = "box of emp shells"
|
name = "box of emp shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front."
|
desc = "It has a picture of a gun and several warning symbols on the front."
|
||||||
icon_state = "empshot_box"
|
icon_state = "empshot_box"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a12g/emp = 8)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/empshells/New()
|
/obj/item/weapon/storage/box/empshells/large
|
||||||
..()
|
starts_with = list(/obj/item/ammo_casing/a12g/emp = 16)
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/emp(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/empshells/large/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/ammo_casing/a12g/emp(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/sniperammo
|
/obj/item/weapon/storage/box/sniperammo
|
||||||
name = "box of 14.5mm shells"
|
name = "box of 14.5mm shells"
|
||||||
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
|
||||||
|
starts_with = list(/obj/item/ammo_casing/a145 = 7)
|
||||||
/obj/item/weapon/storage/box/sniperammo/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/ammo_casing/a145(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/flashbangs
|
/obj/item/weapon/storage/box/flashbangs
|
||||||
name = "box of flashbangs (WARNING)"
|
name = "box of flashbangs (WARNING)"
|
||||||
desc = "<B>WARNING: These devices are extremely dangerous and can cause blindness or deafness in repeated use.</B>"
|
desc = "<B>WARNING: These devices are extremely dangerous and can cause blindness or deafness in repeated use.</B>"
|
||||||
icon_state = "flashbang"
|
icon_state = "flashbang"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/flashbang = 7)
|
||||||
/obj/item/weapon/storage/box/flashbangs/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/flashbang(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/emps
|
/obj/item/weapon/storage/box/emps
|
||||||
name = "box of emp grenades"
|
name = "box of emp grenades"
|
||||||
desc = "A box containing 5 military grade EMP grenades.<br> WARNING: Do not use near unshielded electronics or biomechanical augmentations, death or permanent paralysis may occur."
|
desc = "A box containing 5 military grade EMP grenades.<br> WARNING: Do not use near unshielded electronics or biomechanical augmentations, death or permanent paralysis may occur."
|
||||||
icon_state = "emp"
|
icon_state = "emp"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/empgrenade = 7)
|
||||||
/obj/item/weapon/storage/box/emps/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/empgrenade(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/empslite
|
/obj/item/weapon/storage/box/empslite
|
||||||
name = "box of low yield emp grenades"
|
name = "box of low yield emp grenades"
|
||||||
desc = "A box containing 5 low yield EMP grenades.<br> WARNING: Do not use near unshielded electronics or biomechanical augmentations, death or permanent paralysis may occur."
|
desc = "A box containing 5 low yield EMP grenades.<br> WARNING: Do not use near unshielded electronics or biomechanical augmentations, death or permanent paralysis may occur."
|
||||||
icon_state = "emp"
|
icon_state = "emp"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/empgrenade/low_yield = 7)
|
||||||
/obj/item/weapon/storage/box/empslite/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/empgrenade/low_yield(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/smokes
|
/obj/item/weapon/storage/box/smokes
|
||||||
name = "box of smoke bombs"
|
name = "box of smoke bombs"
|
||||||
desc = "A box containing 7 smoke bombs."
|
desc = "A box containing 7 smoke bombs."
|
||||||
icon_state = "flashbang"
|
icon_state = "flashbang"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/smokebomb = 7)
|
||||||
/obj/item/weapon/storage/box/smokes/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/smokebomb(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/anti_photons
|
/obj/item/weapon/storage/box/anti_photons
|
||||||
name = "box of anti-photon grenades"
|
name = "box of anti-photon grenades"
|
||||||
desc = "A box containing 7 experimental photon disruption grenades."
|
desc = "A box containing 7 experimental photon disruption grenades."
|
||||||
icon_state = "flashbang"
|
icon_state = "flashbang"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/anti_photon = 7)
|
||||||
/obj/item/weapon/storage/box/anti_photons/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/anti_photon(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/frags
|
/obj/item/weapon/storage/box/frags
|
||||||
name = "box of fragmentation grenades (WARNING)"
|
name = "box of fragmentation grenades (WARNING)"
|
||||||
desc = "A box containing 7 military grade fragmentation grenades.<br> WARNING: These devices are extremely dangerous and can cause limb loss or death in repeated use."
|
desc = "A box containing 7 military grade fragmentation grenades.<br> WARNING: These devices are extremely dangerous and can cause limb loss or death in repeated use."
|
||||||
icon_state = "frag"
|
icon_state = "frag"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/explosive = 7)
|
||||||
/obj/item/weapon/storage/box/frags/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/explosive(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/frags_half_box
|
/obj/item/weapon/storage/box/frags_half_box
|
||||||
name = "box of fragmentation grenades (WARNING)"
|
name = "box of fragmentation grenades (WARNING)"
|
||||||
desc = "A box containing 4 military grade fragmentation grenades.<br> WARNING: These devices are extremely dangerous and can cause limb loss or death in repeated use."
|
desc = "A box containing 4 military grade fragmentation grenades.<br> WARNING: These devices are extremely dangerous and can cause limb loss or death in repeated use."
|
||||||
icon_state = "frag"
|
icon_state = "frag"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/explosive = 4)
|
||||||
/obj/item/weapon/storage/box/frags_half_box/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 4)
|
|
||||||
new /obj/item/weapon/grenade/explosive(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/metalfoam
|
/obj/item/weapon/storage/box/metalfoam
|
||||||
name = "box of metal foam grenades."
|
name = "box of metal foam grenades."
|
||||||
desc = "A box containing 7 metal foam grenades."
|
desc = "A box containing 7 metal foam grenades."
|
||||||
icon_state = "flashbang"
|
icon_state = "flashbang"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/chem_grenade/metalfoam = 7)
|
||||||
/obj/item/weapon/storage/box/metalfoam/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/chem_grenade/metalfoam(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/teargas
|
/obj/item/weapon/storage/box/teargas
|
||||||
name = "box of teargas grenades"
|
name = "box of teargas grenades"
|
||||||
desc = "A box containing 7 teargas grenades."
|
desc = "A box containing 7 teargas grenades."
|
||||||
icon_state = "flashbang"
|
icon_state = "flashbang"
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/chem_grenade/teargas = 7)
|
||||||
/obj/item/weapon/storage/box/teargas/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/grenade/chem_grenade/teargas(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/flare
|
/obj/item/weapon/storage/box/flare
|
||||||
name = "box of flares"
|
name = "box of flares"
|
||||||
desc = "A box containing 4 flares."
|
desc = "A box containing 4 flares."
|
||||||
|
starts_with = list(/obj/item/device/flashlight/flare = 4)
|
||||||
/obj/item/weapon/storage/box/flare/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 4)
|
|
||||||
new /obj/item/device/flashlight/flare(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/trackimp
|
/obj/item/weapon/storage/box/trackimp
|
||||||
name = "boxed tracking implant kit"
|
name = "boxed tracking implant kit"
|
||||||
desc = "Box full of scum-bag tracking utensils."
|
desc = "Box full of scum-bag tracking utensils."
|
||||||
icon_state = "implant"
|
icon_state = "implant"
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/trackimp/New()
|
/obj/item/weapon/implantcase/tracking = 4,
|
||||||
..()
|
/obj/item/weapon/implanter,
|
||||||
for(var/i = 1 to 4)
|
/obj/item/weapon/implantpad,
|
||||||
new /obj/item/weapon/implantcase/tracking(src)
|
/obj/item/weapon/locator
|
||||||
new /obj/item/weapon/implanter(src)
|
)
|
||||||
new /obj/item/weapon/implantpad(src)
|
|
||||||
new /obj/item/weapon/locator(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/chemimp
|
/obj/item/weapon/storage/box/chemimp
|
||||||
name = "boxed chemical implant kit"
|
name = "boxed chemical implant kit"
|
||||||
desc = "Box of stuff used to implant chemicals."
|
desc = "Box of stuff used to implant chemicals."
|
||||||
icon_state = "implant"
|
icon_state = "implant"
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/chemimp/New()
|
/obj/item/weapon/implantcase/chem = 5,
|
||||||
..()
|
/obj/item/weapon/implanter,
|
||||||
for(var/i = 1 to 5)
|
/obj/item/weapon/implantpad
|
||||||
new /obj/item/weapon/implantcase/chem(src)
|
)
|
||||||
new /obj/item/weapon/implanter(src)
|
|
||||||
new /obj/item/weapon/implantpad(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/camerabug
|
/obj/item/weapon/storage/box/camerabug
|
||||||
name = "mobile camera pod box"
|
name = "mobile camera pod box"
|
||||||
desc = "A box containing some mobile camera pods."
|
desc = "A box containing some mobile camera pods."
|
||||||
icon_state = "pda"
|
icon_state = "pda"
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/camerabug/New()
|
/obj/item/device/camerabug = 6,
|
||||||
..()
|
/obj/item/device/bug_monitor
|
||||||
for(var/i = 1 to 6)
|
)
|
||||||
new /obj/item/device/camerabug(src)
|
|
||||||
new /obj/item/device/bug_monitor(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/rxglasses
|
/obj/item/weapon/storage/box/rxglasses
|
||||||
name = "box of prescription glasses"
|
name = "box of prescription glasses"
|
||||||
desc = "This box contains nerd glasses."
|
desc = "This box contains nerd glasses."
|
||||||
icon_state = "glasses"
|
icon_state = "glasses"
|
||||||
|
starts_with = list(/obj/item/clothing/glasses/regular = 7)
|
||||||
/obj/item/weapon/storage/box/rxglasses/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/clothing/glasses/regular(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/cdeathalarm_kit
|
/obj/item/weapon/storage/box/cdeathalarm_kit
|
||||||
name = "death alarm kit"
|
name = "death alarm kit"
|
||||||
desc = "Box of stuff used to implant death alarms."
|
desc = "Box of stuff used to implant death alarms."
|
||||||
icon_state = "implant"
|
icon_state = "implant"
|
||||||
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
item_state_slots = list(slot_r_hand_str = "syringe_kit", slot_l_hand_str = "syringe_kit")
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/cdeathalarm_kit/New()
|
/obj/item/weapon/implantcase/death_alarm = 7,
|
||||||
..()
|
/obj/item/weapon/implanter
|
||||||
for(var/i = 1 to 7)
|
)
|
||||||
new /obj/item/weapon/implantcase/death_alarm(src)
|
|
||||||
new /obj/item/weapon/implanter(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/condimentbottles
|
/obj/item/weapon/storage/box/condimentbottles
|
||||||
name = "box of condiment bottles"
|
name = "box of condiment bottles"
|
||||||
desc = "It has a large ketchup smear on it."
|
desc = "It has a large ketchup smear on it."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/condiment = 7)
|
||||||
/obj/item/weapon/storage/box/condimentbottles/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/condiment(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/cups
|
/obj/item/weapon/storage/box/cups
|
||||||
name = "box of paper cups"
|
name = "box of paper cups"
|
||||||
desc = "It has pictures of paper cups on the front."
|
desc = "It has pictures of paper cups on the front."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/drinks/sillycup = 7)
|
||||||
/obj/item/weapon/storage/box/cups/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/drinks/sillycup(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/donkpockets
|
/obj/item/weapon/storage/box/donkpockets
|
||||||
name = "box of donk-pockets"
|
name = "box of donk-pockets"
|
||||||
desc = "<B>Instructions:</B> <I>Heat in microwave. Product will cool if not eaten within seven minutes.</I>"
|
desc = "<B>Instructions:</B> <I>Heat in microwave. Product will cool if not eaten within seven minutes.</I>"
|
||||||
icon_state = "donk_kit"
|
icon_state = "donk_kit"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/donkpocket = 7)
|
||||||
/obj/item/weapon/storage/box/donkpockets/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/donkpocket(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/sinpockets
|
/obj/item/weapon/storage/box/sinpockets
|
||||||
name = "box of sin-pockets"
|
name = "box of sin-pockets"
|
||||||
desc = "<B>Instructions:</B> <I>Crush bottom of package to initiate chemical heating. Wait for 20 seconds before consumption. Product will cool if not eaten within seven minutes.</I>"
|
desc = "<B>Instructions:</B> <I>Crush bottom of package to initiate chemical heating. Wait for 20 seconds before consumption. Product will cool if not eaten within seven minutes.</I>"
|
||||||
icon_state = "donk_kit"
|
icon_state = "donk_kit"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/donkpocket/sinpocket = 7)
|
||||||
/obj/item/weapon/storage/box/sinpockets/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/donkpocket/sinpocket(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/monkeycubes
|
/obj/item/weapon/storage/box/monkeycubes
|
||||||
name = "monkey cube box"
|
name = "monkey cube box"
|
||||||
@@ -469,88 +326,51 @@
|
|||||||
icon = 'icons/obj/food.dmi'
|
icon = 'icons/obj/food.dmi'
|
||||||
icon_state = "monkeycubebox"
|
icon_state = "monkeycubebox"
|
||||||
can_hold = list(/obj/item/weapon/reagent_containers/food/snacks/monkeycube)
|
can_hold = list(/obj/item/weapon/reagent_containers/food/snacks/monkeycube)
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped = 4)
|
||||||
/obj/item/weapon/storage/box/monkeycubes/New()
|
|
||||||
..()
|
|
||||||
if(type == /obj/item/weapon/storage/box/monkeycubes)
|
|
||||||
for(var/i = 1 to 4)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/monkeycubes/farwacubes
|
/obj/item/weapon/storage/box/monkeycubes/farwacubes
|
||||||
name = "farwa cube box"
|
name = "farwa cube box"
|
||||||
desc = "Drymate brand farwa cubes, shipped from Meralar. Just add water!"
|
desc = "Drymate brand farwa cubes, shipped from Meralar. Just add water!"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped/farwacube = 4)
|
||||||
/obj/item/weapon/storage/box/monkeycubes/farwacubes/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 4)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped/farwacube(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/monkeycubes/stokcubes
|
/obj/item/weapon/storage/box/monkeycubes/stokcubes
|
||||||
name = "stok cube box"
|
name = "stok cube box"
|
||||||
desc = "Drymate brand stok cubes, shipped from Moghes. Just add water!"
|
desc = "Drymate brand stok cubes, shipped from Moghes. Just add water!"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped/stokcube = 4)
|
||||||
/obj/item/weapon/storage/box/monkeycubes/stokcubes/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 4)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped/stokcube(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/monkeycubes/neaeracubes
|
/obj/item/weapon/storage/box/monkeycubes/neaeracubes
|
||||||
name = "neaera cube box"
|
name = "neaera cube box"
|
||||||
desc = "Drymate brand neaera cubes, shipped from Jargon 4. Just add water!"
|
desc = "Drymate brand neaera cubes, shipped from Jargon 4. Just add water!"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped/neaeracube = 4)
|
||||||
/obj/item/weapon/storage/box/monkeycubes/neaeracubes/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 4)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/monkeycube/wrapped/neaeracube(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/ids
|
/obj/item/weapon/storage/box/ids
|
||||||
name = "box of spare IDs"
|
name = "box of spare IDs"
|
||||||
desc = "Has so many empty IDs."
|
desc = "Has so many empty IDs."
|
||||||
icon_state = "id"
|
icon_state = "id"
|
||||||
|
starts_with = list(/obj/item/weapon/card/id = 7)
|
||||||
/obj/item/weapon/storage/box/ids/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/card/id(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/seccarts
|
/obj/item/weapon/storage/box/seccarts
|
||||||
name = "box of spare R.O.B.U.S.T. Cartridges"
|
name = "box of spare R.O.B.U.S.T. Cartridges"
|
||||||
desc = "A box full of R.O.B.U.S.T. Cartridges, used by Security."
|
desc = "A box full of R.O.B.U.S.T. Cartridges, used by Security."
|
||||||
icon_state = "pda"
|
icon_state = "pda"
|
||||||
|
starts_with = list(/obj/item/weapon/cartridge/security = 7)
|
||||||
/obj/item/weapon/storage/box/seccarts/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/cartridge/security(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/handcuffs
|
/obj/item/weapon/storage/box/handcuffs
|
||||||
name = "box of spare handcuffs"
|
name = "box of spare handcuffs"
|
||||||
desc = "A box full of handcuffs."
|
desc = "A box full of handcuffs."
|
||||||
icon_state = "handcuff"
|
icon_state = "handcuff"
|
||||||
|
starts_with = list(/obj/item/weapon/handcuffs = 7)
|
||||||
/obj/item/weapon/storage/box/handcuffs/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/handcuffs(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/mousetraps
|
/obj/item/weapon/storage/box/mousetraps
|
||||||
name = "box of Pest-B-Gon mousetraps"
|
name = "box of Pest-B-Gon mousetraps"
|
||||||
desc = "<B><FONT color='red'>WARNING:</FONT></B> <I>Keep out of reach of children</I>."
|
desc = "<B><FONT color='red'>WARNING:</FONT></B> <I>Keep out of reach of children</I>."
|
||||||
icon_state = "mousetraps"
|
icon_state = "mousetraps"
|
||||||
|
starts_with = list(/obj/item/device/assembly/mousetrap = 7)
|
||||||
/obj/item/weapon/storage/box/mousetraps/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/device/assembly/mousetrap(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/pillbottles
|
/obj/item/weapon/storage/box/pillbottles
|
||||||
name = "box of pill bottles"
|
name = "box of pill bottles"
|
||||||
desc = "It has pictures of pill bottles on its front."
|
desc = "It has pictures of pill bottles on its front."
|
||||||
|
starts_with = list(/obj/item/weapon/storage/pill_bottle = 7)
|
||||||
/obj/item/weapon/storage/box/pillbottles/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/storage/pill_bottle(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/snappops
|
/obj/item/weapon/storage/box/snappops
|
||||||
name = "snap pop box"
|
name = "snap pop box"
|
||||||
@@ -558,11 +378,7 @@
|
|||||||
icon = 'icons/obj/toy.dmi'
|
icon = 'icons/obj/toy.dmi'
|
||||||
icon_state = "spbox"
|
icon_state = "spbox"
|
||||||
can_hold = list(/obj/item/toy/snappop)
|
can_hold = list(/obj/item/toy/snappop)
|
||||||
|
starts_with = list(/obj/item/toy/snappop = 8)
|
||||||
/obj/item/weapon/storage/box/snappops/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/toy/snappop(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/matches
|
/obj/item/weapon/storage/box/matches
|
||||||
name = "matchbox"
|
name = "matchbox"
|
||||||
@@ -572,11 +388,7 @@
|
|||||||
w_class = ITEMSIZE_TINY
|
w_class = ITEMSIZE_TINY
|
||||||
slot_flags = SLOT_BELT
|
slot_flags = SLOT_BELT
|
||||||
can_hold = list(/obj/item/weapon/flame/match)
|
can_hold = list(/obj/item/weapon/flame/match)
|
||||||
|
starts_with = list(/obj/item/weapon/flame/match = 10)
|
||||||
/obj/item/weapon/storage/box/matches/New()
|
|
||||||
..()
|
|
||||||
for(var/i=1 to 10)
|
|
||||||
new /obj/item/weapon/flame/match(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/matches/attackby(obj/item/weapon/flame/match/W as obj, mob/user as mob)
|
/obj/item/weapon/storage/box/matches/attackby(obj/item/weapon/flame/match/W as obj, mob/user as mob)
|
||||||
if(istype(W) && !W.lit && !W.burnt)
|
if(istype(W) && !W.lit && !W.burnt)
|
||||||
@@ -591,11 +403,7 @@
|
|||||||
name = "box of injectors"
|
name = "box of injectors"
|
||||||
desc = "Contains autoinjectors."
|
desc = "Contains autoinjectors."
|
||||||
icon_state = "syringe"
|
icon_state = "syringe"
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/hypospray/autoinjector = 7)
|
||||||
/obj/item/weapon/storage/box/autoinjectors/New()
|
|
||||||
..()
|
|
||||||
for (var/i = 1 to 7)
|
|
||||||
new /obj/item/weapon/reagent_containers/hypospray/autoinjector(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/lights
|
/obj/item/weapon/storage/box/lights
|
||||||
name = "box of replacement bulbs"
|
name = "box of replacement bulbs"
|
||||||
@@ -608,30 +416,21 @@
|
|||||||
max_storage_space = ITEMSIZE_COST_SMALL * 24 //holds 24 items of w_class 2
|
max_storage_space = ITEMSIZE_COST_SMALL * 24 //holds 24 items of w_class 2
|
||||||
use_to_pickup = 1 // for picking up broken bulbs, not that most people will try
|
use_to_pickup = 1 // for picking up broken bulbs, not that most people will try
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/lights/bulbs/New()
|
/obj/item/weapon/storage/box/lights/bulbs
|
||||||
..()
|
starts_with = list(/obj/item/weapon/light/bulb = 24)
|
||||||
for(var/i = 1 to 24)
|
|
||||||
new /obj/item/weapon/light/bulb(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/lights/tubes
|
/obj/item/weapon/storage/box/lights/tubes
|
||||||
name = "box of replacement tubes"
|
name = "box of replacement tubes"
|
||||||
icon_state = "lighttube"
|
icon_state = "lighttube"
|
||||||
|
starts_with = list(/obj/item/weapon/light/tube = 24)
|
||||||
/obj/item/weapon/storage/box/lights/tubes/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 24)
|
|
||||||
new /obj/item/weapon/light/tube(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/lights/mixed
|
/obj/item/weapon/storage/box/lights/mixed
|
||||||
name = "box of replacement lights"
|
name = "box of replacement lights"
|
||||||
icon_state = "lightmixed"
|
icon_state = "lightmixed"
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/lights/mixed/New()
|
/obj/item/weapon/light/tube = 16,
|
||||||
..()
|
/obj/item/weapon/light/bulb = 8
|
||||||
for(var/i = 1 to 16)
|
)
|
||||||
new /obj/item/weapon/light/tube(src)
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/weapon/light/bulb(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/freezer
|
/obj/item/weapon/storage/box/freezer
|
||||||
name = "portable freezer"
|
name = "portable freezer"
|
||||||
@@ -664,17 +463,9 @@
|
|||||||
/obj/item/weapon/storage/box/ambrosia
|
/obj/item/weapon/storage/box/ambrosia
|
||||||
name = "ambrosia seeds box"
|
name = "ambrosia seeds box"
|
||||||
desc = "Contains the seeds you need to get a little high."
|
desc = "Contains the seeds you need to get a little high."
|
||||||
|
starts_with = list(/obj/item/seeds/ambrosiavulgarisseed = 7)
|
||||||
/obj/item/weapon/storage/box/ambrosia/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/seeds/ambrosiavulgarisseed(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/ambrosiadeus
|
/obj/item/weapon/storage/box/ambrosiadeus
|
||||||
name = "ambrosia deus seeds box"
|
name = "ambrosia deus seeds box"
|
||||||
desc = "Contains the seeds you need to get a proper healthy high."
|
desc = "Contains the seeds you need to get a proper healthy high."
|
||||||
|
starts_with = list(/obj/item/seeds/ambrosiadeusseed = 7)
|
||||||
/obj/item/weapon/storage/box/ambrosiadeus/New()
|
|
||||||
..()
|
|
||||||
for(var/i = 1 to 7)
|
|
||||||
new /obj/item/seeds/ambrosiadeusseed(src)
|
|
||||||
|
|||||||
@@ -52,12 +52,7 @@
|
|||||||
/obj/item/weapon/reagent_containers/food/snacks/egg,
|
/obj/item/weapon/reagent_containers/food/snacks/egg,
|
||||||
/obj/item/weapon/reagent_containers/food/snacks/boiledegg
|
/obj/item/weapon/reagent_containers/food/snacks/boiledegg
|
||||||
)
|
)
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/egg = 12)
|
||||||
/obj/item/weapon/storage/fancy/egg_box/New()
|
|
||||||
..()
|
|
||||||
for(var/i=1 to storage_slots)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/egg(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Candle Box
|
* Candle Box
|
||||||
@@ -72,12 +67,7 @@
|
|||||||
item_state = "candlebox5"
|
item_state = "candlebox5"
|
||||||
throwforce = 2
|
throwforce = 2
|
||||||
slot_flags = SLOT_BELT
|
slot_flags = SLOT_BELT
|
||||||
|
starts_with = list(/obj/item/weapon/flame/candle = 5)
|
||||||
/obj/item/weapon/storage/fancy/candle_box/New()
|
|
||||||
..()
|
|
||||||
for(var/i=1 to 5)
|
|
||||||
new /obj/item/weapon/flame/candle(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Crayon Box
|
* Crayon Box
|
||||||
@@ -93,31 +83,36 @@
|
|||||||
can_hold = list(
|
can_hold = list(
|
||||||
/obj/item/weapon/pen/crayon
|
/obj/item/weapon/pen/crayon
|
||||||
)
|
)
|
||||||
|
starts_with = list(
|
||||||
|
/obj/item/weapon/pen/crayon/red,
|
||||||
|
/obj/item/weapon/pen/crayon/orange,
|
||||||
|
/obj/item/weapon/pen/crayon/yellow,
|
||||||
|
/obj/item/weapon/pen/crayon/green,
|
||||||
|
/obj/item/weapon/pen/crayon/blue,
|
||||||
|
/obj/item/weapon/pen/crayon/purple
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/crayons/New()
|
/obj/item/weapon/storage/fancy/crayons/initialize()
|
||||||
..()
|
. = ..()
|
||||||
new /obj/item/weapon/pen/crayon/red(src)
|
|
||||||
new /obj/item/weapon/pen/crayon/orange(src)
|
|
||||||
new /obj/item/weapon/pen/crayon/yellow(src)
|
|
||||||
new /obj/item/weapon/pen/crayon/green(src)
|
|
||||||
new /obj/item/weapon/pen/crayon/blue(src)
|
|
||||||
new /obj/item/weapon/pen/crayon/purple(src)
|
|
||||||
update_icon()
|
update_icon()
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/crayons/update_icon()
|
/obj/item/weapon/storage/fancy/crayons/update_icon()
|
||||||
overlays = list() //resets list
|
var/mutable_appearance/ma = new(src)
|
||||||
overlays += image('icons/obj/crayons.dmi',"crayonbox")
|
ma.plane = plane
|
||||||
|
ma.layer = layer
|
||||||
|
ma.overlays = list()
|
||||||
for(var/obj/item/weapon/pen/crayon/crayon in contents)
|
for(var/obj/item/weapon/pen/crayon/crayon in contents)
|
||||||
overlays += image('icons/obj/crayons.dmi',crayon.colourName)
|
ma.overlays += image('icons/obj/crayons.dmi',crayon.colourName)
|
||||||
|
appearance = ma
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/crayons/attackby(obj/item/W as obj, mob/user as mob)
|
/obj/item/weapon/storage/fancy/crayons/attackby(obj/item/W as obj, mob/user as mob)
|
||||||
if(istype(W,/obj/item/weapon/pen/crayon))
|
if(istype(W,/obj/item/weapon/pen/crayon))
|
||||||
switch(W:colourName)
|
switch(W:colourName)
|
||||||
if("mime")
|
if("mime")
|
||||||
usr << "This crayon is too sad to be contained in this box."
|
to_chat(usr,"This crayon is too sad to be contained in this box.")
|
||||||
return
|
return
|
||||||
if("rainbow")
|
if("rainbow")
|
||||||
usr << "This crayon is too powerful to be contained in this box."
|
to_chat(usr,"This crayon is too powerful to be contained in this box.")
|
||||||
return
|
return
|
||||||
..()
|
..()
|
||||||
|
|
||||||
@@ -136,13 +131,12 @@
|
|||||||
storage_slots = 6
|
storage_slots = 6
|
||||||
can_hold = list(/obj/item/clothing/mask/smokable/cigarette, /obj/item/weapon/flame/lighter)
|
can_hold = list(/obj/item/clothing/mask/smokable/cigarette, /obj/item/weapon/flame/lighter)
|
||||||
icon_type = "cigarette"
|
icon_type = "cigarette"
|
||||||
|
starts_with = list(/obj/item/clothing/mask/smokable/cigarette = 6)
|
||||||
var/brand = "\improper Trans-Stellar Duty-free"
|
var/brand = "\improper Trans-Stellar Duty-free"
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/cigarettes/New()
|
/obj/item/weapon/storage/fancy/cigarettes/initialize()
|
||||||
..()
|
. = ..()
|
||||||
flags |= NOREACT
|
flags |= NOREACT
|
||||||
for(var/i = 1 to storage_slots)
|
|
||||||
new /obj/item/clothing/mask/smokable/cigarette(src)
|
|
||||||
create_reagents(15 * storage_slots)//so people can inject cigarettes without opening a packet, now with being able to inject the whole one
|
create_reagents(15 * storage_slots)//so people can inject cigarettes without opening a packet, now with being able to inject the whole one
|
||||||
flags |= OPENCONTAINER
|
flags |= OPENCONTAINER
|
||||||
if(brand)
|
if(brand)
|
||||||
@@ -201,10 +195,6 @@
|
|||||||
icon_state = "Bpacket"
|
icon_state = "Bpacket"
|
||||||
brand = "\improper Acme Co. cigarette"
|
brand = "\improper Acme Co. cigarette"
|
||||||
|
|
||||||
// New()
|
|
||||||
// ..()
|
|
||||||
// fill_cigarre_package(src,list("fuel" = 15))
|
|
||||||
|
|
||||||
// New exciting ways to kill your lungs! - Earthcrusher //
|
// New exciting ways to kill your lungs! - Earthcrusher //
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/cigarettes/luckystars
|
/obj/item/weapon/storage/fancy/cigarettes/luckystars
|
||||||
@@ -248,12 +238,11 @@
|
|||||||
storage_slots = 7
|
storage_slots = 7
|
||||||
can_hold = list(/obj/item/clothing/mask/smokable/cigarette/cigar)
|
can_hold = list(/obj/item/clothing/mask/smokable/cigarette/cigar)
|
||||||
icon_type = "cigar"
|
icon_type = "cigar"
|
||||||
|
starts_with = list(/obj/item/clothing/mask/smokable/cigarette/cigar = 7)
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/cigar/New()
|
/obj/item/weapon/storage/fancy/cigar/initialize()
|
||||||
..()
|
. = ..()
|
||||||
flags |= NOREACT
|
flags |= NOREACT
|
||||||
for(var/i = 1 to storage_slots)
|
|
||||||
new /obj/item/clothing/mask/smokable/cigarette/cigar(src)
|
|
||||||
create_reagents(15 * storage_slots)
|
create_reagents(15 * storage_slots)
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/cigar/update_icon()
|
/obj/item/weapon/storage/fancy/cigar/update_icon()
|
||||||
@@ -277,12 +266,7 @@
|
|||||||
name = "vial storage box"
|
name = "vial storage box"
|
||||||
storage_slots = 6
|
storage_slots = 6
|
||||||
can_hold = list(/obj/item/weapon/reagent_containers/glass/beaker/vial)
|
can_hold = list(/obj/item/weapon/reagent_containers/glass/beaker/vial)
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/glass/beaker/vial = 6)
|
||||||
/obj/item/weapon/storage/fancy/vials/New()
|
|
||||||
..()
|
|
||||||
for(var/i=1 to 6)
|
|
||||||
new /obj/item/weapon/reagent_containers/glass/beaker/vial(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/lockbox/vials
|
/obj/item/weapon/storage/lockbox/vials
|
||||||
name = "secure vial storage box"
|
name = "secure vial storage box"
|
||||||
@@ -296,8 +280,8 @@
|
|||||||
storage_slots = 6
|
storage_slots = 6
|
||||||
req_access = list(access_virology)
|
req_access = list(access_virology)
|
||||||
|
|
||||||
/obj/item/weapon/storage/lockbox/vials/New()
|
/obj/item/weapon/storage/lockbox/vials/initialize()
|
||||||
..()
|
. = ..()
|
||||||
update_icon()
|
update_icon()
|
||||||
|
|
||||||
/obj/item/weapon/storage/lockbox/vials/update_icon(var/itemremoved = 0)
|
/obj/item/weapon/storage/lockbox/vials/update_icon(var/itemremoved = 0)
|
||||||
@@ -330,19 +314,19 @@
|
|||||||
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/white,
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/white,
|
||||||
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/truffle
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/truffle
|
||||||
)
|
)
|
||||||
|
starts_with = list(
|
||||||
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece,
|
||||||
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece,
|
||||||
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece,
|
||||||
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/white,
|
||||||
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/white,
|
||||||
|
/obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/truffle
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/heartbox/New()
|
/obj/item/weapon/storage/fancy/heartbox/initialize()
|
||||||
..()
|
. = ..()
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/chocolatepiece(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/chocolatepiece(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/chocolatepiece(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/white(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/white(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/chocolatepiece/truffle(src)
|
|
||||||
update_icon()
|
update_icon()
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/fancy/heartbox/update_icon(var/itemremoved = 0)
|
/obj/item/weapon/storage/fancy/heartbox/update_icon(var/itemremoved = 0)
|
||||||
if (contents.len == 0)
|
if (contents.len == 0)
|
||||||
icon_state = "heartbox_empty"
|
icon_state = "heartbox_empty"
|
||||||
return
|
|
||||||
@@ -13,158 +13,147 @@
|
|||||||
icon_state = "firstaid"
|
icon_state = "firstaid"
|
||||||
throw_speed = 2
|
throw_speed = 2
|
||||||
throw_range = 8
|
throw_range = 8
|
||||||
var/empty = 0
|
|
||||||
max_storage_space = ITEMSIZE_COST_SMALL * 7 // 14
|
max_storage_space = ITEMSIZE_COST_SMALL * 7 // 14
|
||||||
|
var/list/icon_variety
|
||||||
|
|
||||||
|
/obj/item/weapon/storage/firstaid/initialize()
|
||||||
|
. = ..()
|
||||||
|
if(icon_variety)
|
||||||
|
icon_state = pick(icon_variety)
|
||||||
|
icon_variety = null
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/fire
|
/obj/item/weapon/storage/firstaid/fire
|
||||||
name = "fire first aid kit"
|
name = "fire first aid kit"
|
||||||
desc = "It's an emergency medical kit for when the toxins lab <i>spontaneously</i> burns down."
|
desc = "It's an emergency medical kit for when the toxins lab <i>spontaneously</i> burns down."
|
||||||
icon_state = "ointment"
|
icon_state = "ointment"
|
||||||
item_state_slots = list(slot_r_hand_str = "firstaid-ointment", slot_l_hand_str = "firstaid-ointment")
|
item_state_slots = list(slot_r_hand_str = "firstaid-ointment", slot_l_hand_str = "firstaid-ointment")
|
||||||
|
icon_variety = list("ointment","firefirstaid")
|
||||||
New()
|
starts_with = list(
|
||||||
..()
|
/obj/item/device/healthanalyzer,
|
||||||
if (empty) return
|
/obj/item/weapon/reagent_containers/hypospray/autoinjector,
|
||||||
|
/obj/item/stack/medical/ointment,
|
||||||
icon_state = pick("ointment","firefirstaid")
|
/obj/item/stack/medical/ointment,
|
||||||
|
/obj/item/weapon/reagent_containers/pill/kelotane,
|
||||||
new /obj/item/device/healthanalyzer( src )
|
/obj/item/weapon/reagent_containers/pill/kelotane,
|
||||||
new /obj/item/weapon/reagent_containers/hypospray/autoinjector( src )
|
/obj/item/weapon/reagent_containers/pill/kelotane
|
||||||
new /obj/item/stack/medical/ointment( src )
|
)
|
||||||
new /obj/item/stack/medical/ointment( src )
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane( src )
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane( src )
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane( src ) //Replaced ointment with these since they actually work --Errorage
|
|
||||||
return
|
|
||||||
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/regular
|
/obj/item/weapon/storage/firstaid/regular
|
||||||
icon_state = "firstaid"
|
icon_state = "firstaid"
|
||||||
|
starts_with = list(
|
||||||
New()
|
/obj/item/stack/medical/bruise_pack,
|
||||||
..()
|
/obj/item/stack/medical/bruise_pack,
|
||||||
if (empty) return
|
/obj/item/stack/medical/bruise_pack,
|
||||||
new /obj/item/stack/medical/bruise_pack(src)
|
/obj/item/stack/medical/ointment,
|
||||||
new /obj/item/stack/medical/bruise_pack(src)
|
/obj/item/stack/medical/ointment,
|
||||||
new /obj/item/stack/medical/bruise_pack(src)
|
/obj/item/device/healthanalyzer,
|
||||||
new /obj/item/stack/medical/ointment(src)
|
/obj/item/weapon/reagent_containers/hypospray/autoinjector
|
||||||
new /obj/item/stack/medical/ointment(src)
|
)
|
||||||
new /obj/item/device/healthanalyzer(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/hypospray/autoinjector( src )
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/toxin
|
/obj/item/weapon/storage/firstaid/toxin
|
||||||
name = "poison first aid kit" //IRL the term used would be poison first aid kit.
|
name = "poison first aid kit" //IRL the term used would be poison first aid kit.
|
||||||
desc = "Used to treat when one has a high amount of toxins in their body."
|
desc = "Used to treat when one has a high amount of toxins in their body."
|
||||||
icon_state = "antitoxin"
|
icon_state = "antitoxin"
|
||||||
item_state_slots = list(slot_r_hand_str = "firstaid-toxin", slot_l_hand_str = "firstaid-toxin")
|
item_state_slots = list(slot_r_hand_str = "firstaid-toxin", slot_l_hand_str = "firstaid-toxin")
|
||||||
|
icon_variety = list("antitoxin","antitoxfirstaid","antitoxfirstaid2","antitoxfirstaid3")
|
||||||
New()
|
starts_with = list(
|
||||||
..()
|
/obj/item/weapon/reagent_containers/syringe/antitoxin,
|
||||||
if (empty) return
|
/obj/item/weapon/reagent_containers/syringe/antitoxin,
|
||||||
|
/obj/item/weapon/reagent_containers/syringe/antitoxin,
|
||||||
icon_state = pick("antitoxin","antitoxfirstaid","antitoxfirstaid2","antitoxfirstaid3")
|
/obj/item/weapon/reagent_containers/pill/antitox,
|
||||||
|
/obj/item/weapon/reagent_containers/pill/antitox,
|
||||||
new /obj/item/weapon/reagent_containers/syringe/antitoxin( src )
|
/obj/item/weapon/reagent_containers/pill/antitox,
|
||||||
new /obj/item/weapon/reagent_containers/syringe/antitoxin( src )
|
/obj/item/device/healthanalyzer
|
||||||
new /obj/item/weapon/reagent_containers/syringe/antitoxin( src )
|
)
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox( src )
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox( src )
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox( src )
|
|
||||||
new /obj/item/device/healthanalyzer( src )
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/o2
|
/obj/item/weapon/storage/firstaid/o2
|
||||||
name = "oxygen deprivation first aid kit"
|
name = "oxygen deprivation first aid kit"
|
||||||
desc = "A box full of oxygen goodies."
|
desc = "A box full of oxygen goodies."
|
||||||
icon_state = "o2"
|
icon_state = "o2"
|
||||||
item_state_slots = list(slot_r_hand_str = "firstaid-o2", slot_l_hand_str = "firstaid-o2")
|
item_state_slots = list(slot_r_hand_str = "firstaid-o2", slot_l_hand_str = "firstaid-o2")
|
||||||
|
starts_with = list(
|
||||||
New()
|
/obj/item/weapon/reagent_containers/pill/dexalin,
|
||||||
..()
|
/obj/item/weapon/reagent_containers/pill/dexalin,
|
||||||
if (empty) return
|
/obj/item/weapon/reagent_containers/pill/dexalin,
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin( src )
|
/obj/item/weapon/reagent_containers/pill/dexalin,
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin( src )
|
/obj/item/weapon/reagent_containers/hypospray/autoinjector,
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin( src )
|
/obj/item/weapon/reagent_containers/syringe/inaprovaline,
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin( src )
|
/obj/item/device/healthanalyzer
|
||||||
new /obj/item/weapon/reagent_containers/hypospray/autoinjector( src )
|
)
|
||||||
new /obj/item/weapon/reagent_containers/syringe/inaprovaline( src )
|
|
||||||
new /obj/item/device/healthanalyzer( src )
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/adv
|
/obj/item/weapon/storage/firstaid/adv
|
||||||
name = "advanced first aid kit"
|
name = "advanced first aid kit"
|
||||||
desc = "Contains advanced medical treatments, for <b>serious</b> boo-boos."
|
desc = "Contains advanced medical treatments, for <b>serious</b> boo-boos."
|
||||||
icon_state = "advfirstaid"
|
icon_state = "advfirstaid"
|
||||||
item_state_slots = list(slot_r_hand_str = "firstaid-advanced", slot_l_hand_str = "firstaid-advanced")
|
item_state_slots = list(slot_r_hand_str = "firstaid-advanced", slot_l_hand_str = "firstaid-advanced")
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/firstaid/adv/New()
|
/obj/item/weapon/reagent_containers/hypospray/autoinjector,
|
||||||
..()
|
/obj/item/stack/medical/advanced/bruise_pack,
|
||||||
if (empty) return
|
/obj/item/stack/medical/advanced/bruise_pack,
|
||||||
new /obj/item/weapon/reagent_containers/hypospray/autoinjector( src )
|
/obj/item/stack/medical/advanced/bruise_pack,
|
||||||
new /obj/item/stack/medical/advanced/bruise_pack(src)
|
/obj/item/stack/medical/advanced/ointment,
|
||||||
new /obj/item/stack/medical/advanced/bruise_pack(src)
|
/obj/item/stack/medical/advanced/ointment,
|
||||||
new /obj/item/stack/medical/advanced/bruise_pack(src)
|
/obj/item/stack/medical/splint
|
||||||
new /obj/item/stack/medical/advanced/ointment(src)
|
)
|
||||||
new /obj/item/stack/medical/advanced/ointment(src)
|
|
||||||
new /obj/item/stack/medical/splint(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/combat
|
/obj/item/weapon/storage/firstaid/combat
|
||||||
name = "combat medical kit"
|
name = "combat medical kit"
|
||||||
desc = "Contains advanced medical treatments."
|
desc = "Contains advanced medical treatments."
|
||||||
icon_state = "bezerk"
|
icon_state = "bezerk"
|
||||||
item_state_slots = list(slot_r_hand_str = "firstaid-advanced", slot_l_hand_str = "firstaid-advanced")
|
item_state_slots = list(slot_r_hand_str = "firstaid-advanced", slot_l_hand_str = "firstaid-advanced")
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/firstaid/combat/New()
|
/obj/item/weapon/storage/pill_bottle/bicaridine,
|
||||||
..()
|
/obj/item/weapon/storage/pill_bottle/dermaline,
|
||||||
if (empty) return
|
/obj/item/weapon/storage/pill_bottle/dexalin_plus,
|
||||||
new /obj/item/weapon/storage/pill_bottle/bicaridine(src)
|
/obj/item/weapon/storage/pill_bottle/dylovene,
|
||||||
new /obj/item/weapon/storage/pill_bottle/dermaline(src)
|
/obj/item/weapon/storage/pill_bottle/tramadol,
|
||||||
new /obj/item/weapon/storage/pill_bottle/dexalin_plus(src)
|
/obj/item/weapon/storage/pill_bottle/spaceacillin,
|
||||||
new /obj/item/weapon/storage/pill_bottle/dylovene(src)
|
/obj/item/weapon/reagent_containers/hypospray/autoinjector/biginjector/clotting,
|
||||||
new /obj/item/weapon/storage/pill_bottle/tramadol(src)
|
/obj/item/stack/medical/splint,
|
||||||
new /obj/item/weapon/storage/pill_bottle/spaceacillin(src)
|
/obj/item/device/healthanalyzer/advanced
|
||||||
new /obj/item/weapon/reagent_containers/hypospray/autoinjector/biginjector/clotting(src)
|
)
|
||||||
new /obj/item/stack/medical/splint(src)
|
|
||||||
new /obj/item/device/healthanalyzer/advanced(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/surgery
|
/obj/item/weapon/storage/firstaid/surgery
|
||||||
name = "surgery kit"
|
name = "surgery kit"
|
||||||
desc = "Contains tools for surgery."
|
desc = "Contains tools for surgery. Has precise foam fitting for safe transport and automatically sterilizes the content between uses."
|
||||||
max_storage_space = ITEMSIZE_COST_NORMAL * 6 // Formally 21. Odd numbers should be avoided for a system based on exponents of 2.
|
icon_state = "surgerykit"
|
||||||
|
item_state = "firstaid-surgery"
|
||||||
max_w_class = ITEMSIZE_NORMAL
|
max_w_class = ITEMSIZE_NORMAL
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/surgery/New()
|
can_hold = list(
|
||||||
..()
|
/obj/item/weapon/surgical/bonesetter,
|
||||||
if (empty) return
|
/obj/item/weapon/surgical/cautery,
|
||||||
new /obj/item/weapon/surgical/bonesetter(src)
|
/obj/item/weapon/surgical/circular_saw,
|
||||||
new /obj/item/weapon/surgical/cautery(src)
|
/obj/item/weapon/surgical/hemostat,
|
||||||
new /obj/item/weapon/surgical/circular_saw(src)
|
/obj/item/weapon/surgical/retractor,
|
||||||
new /obj/item/weapon/surgical/hemostat(src)
|
/obj/item/weapon/surgical/scalpel,
|
||||||
new /obj/item/weapon/surgical/retractor(src)
|
/obj/item/weapon/surgical/surgicaldrill,
|
||||||
new /obj/item/weapon/surgical/scalpel(src)
|
/obj/item/weapon/surgical/bonegel,
|
||||||
new /obj/item/weapon/surgical/surgicaldrill(src)
|
/obj/item/weapon/surgical/FixOVein,
|
||||||
new /obj/item/weapon/surgical/bonegel(src)
|
/obj/item/stack/medical/advanced/bruise_pack,
|
||||||
new /obj/item/weapon/surgical/FixOVein(src)
|
/obj/item/stack/nanopaste,
|
||||||
new /obj/item/stack/medical/advanced/bruise_pack(src)
|
/obj/item/device/healthanalyzer/enhanced
|
||||||
new /obj/item/device/healthanalyzer/enhanced(src)
|
)
|
||||||
return
|
|
||||||
|
starts_with = list(
|
||||||
|
/obj/item/weapon/surgical/bonesetter,
|
||||||
|
/obj/item/weapon/surgical/cautery,
|
||||||
|
/obj/item/weapon/surgical/circular_saw,
|
||||||
|
/obj/item/weapon/surgical/hemostat,
|
||||||
|
/obj/item/weapon/surgical/retractor,
|
||||||
|
/obj/item/weapon/surgical/scalpel,
|
||||||
|
/obj/item/weapon/surgical/surgicaldrill,
|
||||||
|
/obj/item/weapon/surgical/bonegel,
|
||||||
|
/obj/item/weapon/surgical/FixOVein,
|
||||||
|
/obj/item/stack/medical/advanced/bruise_pack,
|
||||||
|
/obj/item/device/healthanalyzer/enhanced
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/firstaid/clotting
|
/obj/item/weapon/storage/firstaid/clotting
|
||||||
name = "clotting kit"
|
name = "clotting kit"
|
||||||
desc = "Contains chemicals to stop bleeding."
|
desc = "Contains chemicals to stop bleeding."
|
||||||
max_storage_space = ITEMSIZE_COST_SMALL * 7
|
max_storage_space = ITEMSIZE_COST_SMALL * 7
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/hypospray/autoinjector/biginjector/clotting = 8)
|
||||||
/obj/item/weapon/storage/firstaid/clotting/New()
|
|
||||||
..()
|
|
||||||
if (empty)
|
|
||||||
return
|
|
||||||
for(var/i = 1 to 8)
|
|
||||||
new /obj/item/weapon/reagent_containers/hypospray/autoinjector/biginjector/clotting(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Pill Bottles
|
* Pill Bottles
|
||||||
@@ -187,167 +176,59 @@
|
|||||||
/obj/item/weapon/storage/pill_bottle/antitox
|
/obj/item/weapon/storage/pill_bottle/antitox
|
||||||
name = "bottle of Dylovene pills"
|
name = "bottle of Dylovene pills"
|
||||||
desc = "Contains pills used to counter toxins."
|
desc = "Contains pills used to counter toxins."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/antitox = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/antitox/New() //25u each
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/antitox(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/bicaridine
|
/obj/item/weapon/storage/pill_bottle/bicaridine
|
||||||
name = "bottle of Bicaridine pills"
|
name = "bottle of Bicaridine pills"
|
||||||
desc = "Contains pills used to stabilize the severely injured."
|
desc = "Contains pills used to stabilize the severely injured."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/bicaridine = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/bicaridine/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/bicaridine(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/bicaridine(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/bicaridine(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/bicaridine(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/bicaridine(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/bicaridine(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/bicaridine(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/dexalin_plus
|
/obj/item/weapon/storage/pill_bottle/dexalin_plus
|
||||||
name = "bottle of Dexalin Plus pills"
|
name = "bottle of Dexalin Plus pills"
|
||||||
desc = "Contains pills used to treat extreme cases of oxygen deprivation."
|
desc = "Contains pills used to treat extreme cases of oxygen deprivation."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/dexalin_plus = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/dexalin_plus/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin_plus(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin_plus(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin_plus(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin_plus(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin_plus(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin_plus(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dexalin_plus(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/dermaline
|
/obj/item/weapon/storage/pill_bottle/dermaline
|
||||||
name = "bottle of Dermaline pills"
|
name = "bottle of Dermaline pills"
|
||||||
desc = "Contains pills used to treat burn wounds."
|
desc = "Contains pills used to treat burn wounds."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/dermaline = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/dermaline/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dermaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dermaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dermaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dermaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dermaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dermaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dermaline(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/dylovene
|
/obj/item/weapon/storage/pill_bottle/dylovene
|
||||||
name = "bottle of Dylovene pills"
|
name = "bottle of Dylovene pills"
|
||||||
desc = "Contains pills used to treat toxic substances in the blood."
|
desc = "Contains pills used to treat toxic substances in the blood."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/dylovene = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/dylovene/New() //15u each
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dylovene(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dylovene(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dylovene(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dylovene(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dylovene(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dylovene(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/dylovene(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/inaprovaline
|
/obj/item/weapon/storage/pill_bottle/inaprovaline
|
||||||
name = "bottle of Inaprovaline pills"
|
name = "bottle of Inaprovaline pills"
|
||||||
desc = "Contains pills used to stabilize patients."
|
desc = "Contains pills used to stabilize patients."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/inaprovaline = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/inaprovaline/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/inaprovaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/inaprovaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/inaprovaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/inaprovaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/inaprovaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/inaprovaline(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/inaprovaline(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/kelotane
|
/obj/item/weapon/storage/pill_bottle/kelotane
|
||||||
name = "bottle of kelotane pills"
|
name = "bottle of kelotane pills"
|
||||||
desc = "Contains pills used to treat burns."
|
desc = "Contains pills used to treat burns."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/kelotane = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/kelotane/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/kelotane(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/spaceacillin
|
/obj/item/weapon/storage/pill_bottle/spaceacillin
|
||||||
name = "bottle of Spaceacillin pills"
|
name = "bottle of Spaceacillin pills"
|
||||||
desc = "A theta-lactam antibiotic. Effective against many diseases likely to be encountered in space."
|
desc = "A theta-lactam antibiotic. Effective against many diseases likely to be encountered in space."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/spaceacillin = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/spaceacillin/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/spaceacillin(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/spaceacillin(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/spaceacillin(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/spaceacillin(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/spaceacillin(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/spaceacillin(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/spaceacillin(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/tramadol
|
/obj/item/weapon/storage/pill_bottle/tramadol
|
||||||
name = "bottle of Tramadol pills"
|
name = "bottle of Tramadol pills"
|
||||||
desc = "Contains pills used to relieve pain."
|
desc = "Contains pills used to relieve pain."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/tramadol = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/tramadol/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/tramadol(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/tramadol(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/tramadol(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/tramadol(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/tramadol(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/tramadol(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/tramadol(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/citalopram
|
/obj/item/weapon/storage/pill_bottle/citalopram
|
||||||
name = "bottle of Citalopram pills"
|
name = "bottle of Citalopram pills"
|
||||||
desc = "Contains pills used to stabilize a patient's mood."
|
desc = "Contains pills used to stabilize a patient's mood."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/citalopram = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/citalopram/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/citalopram(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/citalopram(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/citalopram(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/citalopram(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/citalopram(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/citalopram(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/citalopram(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/carbon
|
/obj/item/weapon/storage/pill_bottle/carbon
|
||||||
name = "bottle of Carbon pills"
|
name = "bottle of Carbon pills"
|
||||||
desc = "Contains pills used to neutralise chemicals in the stomach."
|
desc = "Contains pills used to neutralise chemicals in the stomach."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/carbon = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/carbon/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/carbon(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/carbon(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/carbon(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/carbon(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/carbon(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/carbon(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/carbon(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/pill_bottle/iron
|
/obj/item/weapon/storage/pill_bottle/iron
|
||||||
name = "bottle of Iron pills"
|
name = "bottle of Iron pills"
|
||||||
desc = "Contains pills used to aid in blood regeneration."
|
desc = "Contains pills used to aid in blood regeneration."
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/pill/iron = 7)
|
||||||
/obj/item/weapon/storage/pill_bottle/iron/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/iron(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/iron(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/iron(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/iron(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/iron(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/iron(src)
|
|
||||||
new /obj/item/weapon/reagent_containers/pill/iron(src)
|
|
||||||
|
|||||||
@@ -77,36 +77,28 @@
|
|||||||
/obj/item/weapon/storage/lockbox/loyalty
|
/obj/item/weapon/storage/lockbox/loyalty
|
||||||
name = "lockbox of loyalty implants"
|
name = "lockbox of loyalty implants"
|
||||||
req_access = list(access_security)
|
req_access = list(access_security)
|
||||||
|
starts_with = list(
|
||||||
New()
|
/obj/item/weapon/implantcase/loyalty = 3,
|
||||||
..()
|
/obj/item/weapon/implanter/loyalty
|
||||||
new /obj/item/weapon/implantcase/loyalty(src)
|
)
|
||||||
new /obj/item/weapon/implantcase/loyalty(src)
|
|
||||||
new /obj/item/weapon/implantcase/loyalty(src)
|
|
||||||
new /obj/item/weapon/implanter/loyalty(src)
|
|
||||||
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/lockbox/clusterbang
|
/obj/item/weapon/storage/lockbox/clusterbang
|
||||||
name = "lockbox of clusterbangs"
|
name = "lockbox of clusterbangs"
|
||||||
desc = "You have a bad feeling about opening this."
|
desc = "You have a bad feeling about opening this."
|
||||||
req_access = list(access_security)
|
req_access = list(access_security)
|
||||||
|
starts_with = list(/obj/item/weapon/grenade/flashbang/clusterbang)
|
||||||
New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/grenade/flashbang/clusterbang(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/lockbox/medal
|
/obj/item/weapon/storage/lockbox/medal
|
||||||
name = "lockbox of medals"
|
name = "lockbox of medals"
|
||||||
desc = "A lockbox filled with commemorative medals, it has the NanoTrasen logo stamped on it."
|
desc = "A lockbox filled with commemorative medals, it has the NanoTrasen logo stamped on it."
|
||||||
req_access = list(access_heads)
|
req_access = list(access_heads)
|
||||||
storage_slots = 7
|
storage_slots = 7
|
||||||
|
starts_with = list(
|
||||||
New()
|
/obj/item/clothing/accessory/medal/conduct,
|
||||||
..()
|
/obj/item/clothing/accessory/medal/bronze_heart,
|
||||||
new /obj/item/clothing/accessory/medal/conduct(src)
|
/obj/item/clothing/accessory/medal/nobel_science,
|
||||||
new /obj/item/clothing/accessory/medal/bronze_heart(src)
|
/obj/item/clothing/accessory/medal/silver/valor,
|
||||||
new /obj/item/clothing/accessory/medal/nobel_science(src)
|
/obj/item/clothing/accessory/medal/silver/security,
|
||||||
new /obj/item/clothing/accessory/medal/silver/valor(src)
|
/obj/item/clothing/accessory/medal/gold/captain,
|
||||||
new /obj/item/clothing/accessory/medal/silver/security(src)
|
/obj/item/clothing/accessory/medal/gold/heroism
|
||||||
new /obj/item/clothing/accessory/medal/gold/captain(src)
|
)
|
||||||
new /obj/item/clothing/accessory/medal/gold/heroism(src)
|
|
||||||
|
|||||||
@@ -6,17 +6,14 @@
|
|||||||
icon = 'icons/obj/food.dmi'
|
icon = 'icons/obj/food.dmi'
|
||||||
icon_state = "donutbox"
|
icon_state = "donutbox"
|
||||||
name = "donut box"
|
name = "donut box"
|
||||||
var/startswith = 6
|
|
||||||
max_storage_space = ITEMSIZE_COST_SMALL * 6
|
max_storage_space = ITEMSIZE_COST_SMALL * 6
|
||||||
can_hold = list(/obj/item/weapon/reagent_containers/food/snacks/donut)
|
can_hold = list(/obj/item/weapon/reagent_containers/food/snacks/donut)
|
||||||
foldable = /obj/item/stack/material/cardboard
|
foldable = /obj/item/stack/material/cardboard
|
||||||
|
starts_with = list(/obj/item/weapon/reagent_containers/food/snacks/donut/normal = 6)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/donut/New()
|
/obj/item/weapon/storage/box/donut/initialize()
|
||||||
..()
|
. = ..()
|
||||||
for(var/i=1 to startswith)
|
|
||||||
new /obj/item/weapon/reagent_containers/food/snacks/donut/normal(src)
|
|
||||||
update_icon()
|
update_icon()
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/donut/update_icon()
|
/obj/item/weapon/storage/box/donut/update_icon()
|
||||||
overlays.Cut()
|
overlays.Cut()
|
||||||
@@ -26,4 +23,4 @@
|
|||||||
i++
|
i++
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/donut/empty
|
/obj/item/weapon/storage/box/donut/empty
|
||||||
startswith = 0
|
empty = TRUE
|
||||||
|
|||||||
@@ -184,15 +184,10 @@
|
|||||||
anchored = 1.0
|
anchored = 1.0
|
||||||
density = 0
|
density = 0
|
||||||
cant_hold = list(/obj/item/weapon/storage/secure/briefcase)
|
cant_hold = list(/obj/item/weapon/storage/secure/briefcase)
|
||||||
|
starts_with = list(
|
||||||
|
/obj/item/weapon/paper,
|
||||||
|
/obj/item/weapon/pen
|
||||||
|
)
|
||||||
|
|
||||||
New()
|
/obj/item/weapon/storage/secure/safe/attack_hand(mob/user as mob)
|
||||||
..()
|
|
||||||
new /obj/item/weapon/paper(src)
|
|
||||||
new /obj/item/weapon/pen(src)
|
|
||||||
|
|
||||||
attack_hand(mob/user as mob)
|
|
||||||
return attack_self(user)
|
return attack_self(user)
|
||||||
|
|
||||||
/obj/item/weapon/storage/secure/safe/HoS/New()
|
|
||||||
..()
|
|
||||||
//new /obj/item/weapon/storage/lockbox/clusterbang(src) This item is currently broken... and probably shouldnt exist to begin with (even though it's cool)
|
|
||||||
|
|||||||
@@ -36,6 +36,7 @@
|
|||||||
var/collection_mode = 1; //0 = pick one at a time, 1 = pick all on tile
|
var/collection_mode = 1; //0 = pick one at a time, 1 = pick all on tile
|
||||||
var/use_sound = "rustle" //sound played when used. null for no sound.
|
var/use_sound = "rustle" //sound played when used. null for no sound.
|
||||||
var/list/starts_with //Things to spawn on the box on spawn
|
var/list/starts_with //Things to spawn on the box on spawn
|
||||||
|
var/empty //Mapper override to spawn an empty version of a container that usually has stuff
|
||||||
|
|
||||||
/obj/item/weapon/storage/Destroy()
|
/obj/item/weapon/storage/Destroy()
|
||||||
close_all()
|
close_all()
|
||||||
@@ -576,12 +577,13 @@
|
|||||||
src.closer.hud_layerise()
|
src.closer.hud_layerise()
|
||||||
orient2hud()
|
orient2hud()
|
||||||
|
|
||||||
if(LAZYLEN(starts_with))
|
if(LAZYLEN(starts_with) && !empty)
|
||||||
for(var/newtype in starts_with)
|
for(var/newtype in starts_with)
|
||||||
var/count = starts_with[newtype] || 1 //Could have left it blank.
|
var/count = starts_with[newtype] || 1 //Could have left it blank.
|
||||||
while(count)
|
while(count)
|
||||||
count--
|
count--
|
||||||
new newtype(src)
|
new newtype(src)
|
||||||
|
starts_with = null //Reduce list count.
|
||||||
|
|
||||||
calibrate_size()
|
calibrate_size()
|
||||||
|
|
||||||
|
|||||||
@@ -19,48 +19,50 @@
|
|||||||
name = "emergency toolbox"
|
name = "emergency toolbox"
|
||||||
icon_state = "red"
|
icon_state = "red"
|
||||||
item_state_slots = list(slot_r_hand_str = "toolbox_red", slot_l_hand_str = "toolbox_red")
|
item_state_slots = list(slot_r_hand_str = "toolbox_red", slot_l_hand_str = "toolbox_red")
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/toolbox/emergency/New()
|
/obj/item/weapon/crowbar/red,
|
||||||
..()
|
/obj/item/weapon/extinguisher/mini,
|
||||||
new /obj/item/weapon/crowbar/red(src)
|
/obj/item/device/radio
|
||||||
new /obj/item/weapon/extinguisher/mini(src)
|
)
|
||||||
|
/obj/item/weapon/storage/toolbox/emergency/initialize()
|
||||||
if(prob(50))
|
if(prob(50))
|
||||||
new /obj/item/device/flashlight(src)
|
new /obj/item/device/flashlight(src)
|
||||||
else
|
else
|
||||||
new /obj/item/device/flashlight/flare(src)
|
new /obj/item/device/flashlight/flare(src)
|
||||||
new /obj/item/device/radio(src)
|
. = ..()
|
||||||
|
|
||||||
/obj/item/weapon/storage/toolbox/mechanical
|
/obj/item/weapon/storage/toolbox/mechanical
|
||||||
name = "mechanical toolbox"
|
name = "mechanical toolbox"
|
||||||
icon_state = "blue"
|
icon_state = "blue"
|
||||||
item_state_slots = list(slot_r_hand_str = "toolbox_blue", slot_l_hand_str = "toolbox_blue")
|
item_state_slots = list(slot_r_hand_str = "toolbox_blue", slot_l_hand_str = "toolbox_blue")
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/toolbox/mechanical/New()
|
/obj/item/weapon/screwdriver,
|
||||||
..()
|
/obj/item/weapon/wrench,
|
||||||
new /obj/item/weapon/screwdriver(src)
|
/obj/item/weapon/weldingtool,
|
||||||
new /obj/item/weapon/wrench(src)
|
/obj/item/weapon/crowbar,
|
||||||
new /obj/item/weapon/weldingtool(src)
|
/obj/item/device/analyzer,
|
||||||
new /obj/item/weapon/crowbar(src)
|
/obj/item/weapon/wirecutters
|
||||||
new /obj/item/device/analyzer(src)
|
)
|
||||||
new /obj/item/weapon/wirecutters(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/toolbox/electrical
|
/obj/item/weapon/storage/toolbox/electrical
|
||||||
name = "electrical toolbox"
|
name = "electrical toolbox"
|
||||||
icon_state = "yellow"
|
icon_state = "yellow"
|
||||||
item_state_slots = list(slot_r_hand_str = "toolbox_yellow", slot_l_hand_str = "toolbox_yellow")
|
item_state_slots = list(slot_r_hand_str = "toolbox_yellow", slot_l_hand_str = "toolbox_yellow")
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/toolbox/electrical/New()
|
/obj/item/weapon/screwdriver,
|
||||||
..()
|
/obj/item/weapon/wirecutters,
|
||||||
new /obj/item/weapon/screwdriver(src)
|
/obj/item/device/t_scanner,
|
||||||
new /obj/item/weapon/wirecutters(src)
|
/obj/item/weapon/crowbar,
|
||||||
new /obj/item/device/t_scanner(src)
|
/obj/item/stack/cable_coil/random_belt,
|
||||||
new /obj/item/weapon/crowbar(src)
|
/obj/item/stack/cable_coil/random_belt
|
||||||
new /obj/item/stack/cable_coil/random(src,30)
|
)
|
||||||
new /obj/item/stack/cable_coil/random(src,30)
|
/obj/item/weapon/storage/toolbox/electrical/initialize()
|
||||||
|
. = ..()
|
||||||
if(prob(5))
|
if(prob(5))
|
||||||
new /obj/item/clothing/gloves/yellow(src)
|
new /obj/item/clothing/gloves/yellow(src)
|
||||||
else
|
else
|
||||||
new /obj/item/stack/cable_coil/random(src,30)
|
new /obj/item/stack/cable_coil/random(src,30)
|
||||||
|
calibrate_size()
|
||||||
|
|
||||||
/obj/item/weapon/storage/toolbox/syndicate
|
/obj/item/weapon/storage/toolbox/syndicate
|
||||||
name = "black and red toolbox"
|
name = "black and red toolbox"
|
||||||
@@ -68,29 +70,26 @@
|
|||||||
item_state_slots = list(slot_r_hand_str = "toolbox_syndi", slot_l_hand_str = "toolbox_syndi")
|
item_state_slots = list(slot_r_hand_str = "toolbox_syndi", slot_l_hand_str = "toolbox_syndi")
|
||||||
origin_tech = list(TECH_COMBAT = 1, TECH_ILLEGAL = 1)
|
origin_tech = list(TECH_COMBAT = 1, TECH_ILLEGAL = 1)
|
||||||
force = 14
|
force = 14
|
||||||
var/powertools = FALSE
|
starts_with = list(
|
||||||
|
/obj/item/clothing/gloves/yellow,
|
||||||
|
/obj/item/weapon/screwdriver,
|
||||||
|
/obj/item/weapon/wrench,
|
||||||
|
/obj/item/weapon/weldingtool,
|
||||||
|
/obj/item/weapon/crowbar,
|
||||||
|
/obj/item/weapon/wirecutters,
|
||||||
|
/obj/item/device/multitool
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/toolbox/syndicate/powertools
|
/obj/item/weapon/storage/toolbox/syndicate/powertools
|
||||||
powertools = TRUE
|
starts_with = list(
|
||||||
|
/obj/item/clothing/gloves/yellow,
|
||||||
/obj/item/weapon/storage/toolbox/syndicate/New() // This is found in maint, so it should have the basics, plus some gloves.
|
/obj/item/weapon/screwdriver/power,
|
||||||
..() //all storage items need this to work properly!
|
/obj/item/weapon/weldingtool/experimental,
|
||||||
if(powertools)
|
/obj/item/weapon/crowbar/power,
|
||||||
new /obj/item/clothing/gloves/yellow(src)
|
/obj/item/device/multitool,
|
||||||
new /obj/item/weapon/screwdriver/power(src)
|
/obj/item/stack/cable_coil/random_belt,
|
||||||
new /obj/item/weapon/weldingtool/experimental(src)
|
/obj/item/device/analyzer
|
||||||
new /obj/item/weapon/crowbar/power(src)
|
)
|
||||||
new /obj/item/device/multitool(src)
|
|
||||||
new /obj/item/stack/cable_coil/random(src,30)
|
|
||||||
new /obj/item/device/analyzer(src)
|
|
||||||
else
|
|
||||||
new /obj/item/clothing/gloves/yellow(src)
|
|
||||||
new /obj/item/weapon/screwdriver(src)
|
|
||||||
new /obj/item/weapon/wrench(src)
|
|
||||||
new /obj/item/weapon/weldingtool(src)
|
|
||||||
new /obj/item/weapon/crowbar(src)
|
|
||||||
new /obj/item/weapon/wirecutters(src)
|
|
||||||
new /obj/item/device/multitool(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/toolbox/lunchbox
|
/obj/item/weapon/storage/toolbox/lunchbox
|
||||||
max_storage_space = ITEMSIZE_COST_SMALL * 4 //slightly smaller than a toolbox
|
max_storage_space = ITEMSIZE_COST_SMALL * 4 //slightly smaller than a toolbox
|
||||||
@@ -103,8 +102,7 @@
|
|||||||
var/filled = FALSE
|
var/filled = FALSE
|
||||||
attack_verb = list("lunched")
|
attack_verb = list("lunched")
|
||||||
|
|
||||||
/obj/item/weapon/storage/toolbox/lunchbox/New()
|
/obj/item/weapon/storage/toolbox/lunchbox/initialize()
|
||||||
..()
|
|
||||||
if(filled)
|
if(filled)
|
||||||
var/list/lunches = lunchables_lunches()
|
var/list/lunches = lunchables_lunches()
|
||||||
var/lunch = lunches[pick(lunches)]
|
var/lunch = lunches[pick(lunches)]
|
||||||
@@ -117,6 +115,7 @@
|
|||||||
var/list/drinks = lunchables_drinks()
|
var/list/drinks = lunchables_drinks()
|
||||||
var/drink = drinks[pick(drinks)]
|
var/drink = drinks[pick(drinks)]
|
||||||
new drink(src)
|
new drink(src)
|
||||||
|
. = ..()
|
||||||
|
|
||||||
/obj/item/weapon/storage/toolbox/lunchbox/filled
|
/obj/item/weapon/storage/toolbox/lunchbox/filled
|
||||||
filled = TRUE
|
filled = TRUE
|
||||||
|
|||||||
@@ -1,19 +1,15 @@
|
|||||||
/obj/item/weapon/storage/box/syndicate/
|
/obj/item/weapon/storage/box/syndicate/initialize()
|
||||||
New()
|
|
||||||
..()
|
|
||||||
switch (pickweight(list("bloodyspai" = 1, "stealth" = 1, "screwed" = 1, "guns" = 1, "murder" = 1, "freedom" = 1, "hacker" = 1, "lordsingulo" = 1, "smoothoperator" = 1)))
|
switch (pickweight(list("bloodyspai" = 1, "stealth" = 1, "screwed" = 1, "guns" = 1, "murder" = 1, "freedom" = 1, "hacker" = 1, "lordsingulo" = 1, "smoothoperator" = 1)))
|
||||||
if("bloodyspai")
|
if("bloodyspai")
|
||||||
new /obj/item/clothing/under/chameleon(src)
|
new /obj/item/clothing/under/chameleon(src)
|
||||||
new /obj/item/clothing/mask/gas/voice(src)
|
new /obj/item/clothing/mask/gas/voice(src)
|
||||||
new /obj/item/weapon/card/id/syndicate(src)
|
new /obj/item/weapon/card/id/syndicate(src)
|
||||||
new /obj/item/clothing/shoes/syndigaloshes(src)
|
new /obj/item/clothing/shoes/syndigaloshes(src)
|
||||||
return
|
|
||||||
|
|
||||||
if("stealth")
|
if("stealth")
|
||||||
new /obj/item/weapon/gun/energy/crossbow(src)
|
new /obj/item/weapon/gun/energy/crossbow(src)
|
||||||
new /obj/item/weapon/pen/reagent/paralysis(src)
|
new /obj/item/weapon/pen/reagent/paralysis(src)
|
||||||
new /obj/item/device/chameleon(src)
|
new /obj/item/device/chameleon(src)
|
||||||
return
|
|
||||||
|
|
||||||
if("screwed")
|
if("screwed")
|
||||||
new /obj/effect/spawner/newbomb/timer/syndicate(src)
|
new /obj/effect/spawner/newbomb/timer/syndicate(src)
|
||||||
@@ -23,7 +19,6 @@
|
|||||||
new /obj/item/clothing/head/helmet/space/syndicate(src)
|
new /obj/item/clothing/head/helmet/space/syndicate(src)
|
||||||
new /obj/item/clothing/mask/gas/syndicate(src)
|
new /obj/item/clothing/mask/gas/syndicate(src)
|
||||||
new /obj/item/weapon/tank/emergency/oxygen/double(src)
|
new /obj/item/weapon/tank/emergency/oxygen/double(src)
|
||||||
return
|
|
||||||
|
|
||||||
if("guns")
|
if("guns")
|
||||||
new /obj/item/weapon/gun/projectile/revolver(src)
|
new /obj/item/weapon/gun/projectile/revolver(src)
|
||||||
@@ -31,28 +26,24 @@
|
|||||||
new /obj/item/weapon/card/emag(src)
|
new /obj/item/weapon/card/emag(src)
|
||||||
new /obj/item/weapon/plastique(src)
|
new /obj/item/weapon/plastique(src)
|
||||||
new /obj/item/weapon/plastique(src)
|
new /obj/item/weapon/plastique(src)
|
||||||
return
|
|
||||||
|
|
||||||
if("murder")
|
if("murder")
|
||||||
new /obj/item/weapon/melee/energy/sword(src)
|
new /obj/item/weapon/melee/energy/sword(src)
|
||||||
new /obj/item/clothing/glasses/thermal/syndi(src)
|
new /obj/item/clothing/glasses/thermal/syndi(src)
|
||||||
new /obj/item/weapon/card/emag(src)
|
new /obj/item/weapon/card/emag(src)
|
||||||
new /obj/item/clothing/shoes/syndigaloshes(src)
|
new /obj/item/clothing/shoes/syndigaloshes(src)
|
||||||
return
|
|
||||||
|
|
||||||
if("freedom")
|
if("freedom")
|
||||||
var/obj/item/weapon/implanter/O = new /obj/item/weapon/implanter(src)
|
var/obj/item/weapon/implanter/O = new /obj/item/weapon/implanter(src)
|
||||||
O.imp = new /obj/item/weapon/implant/freedom(O)
|
O.imp = new /obj/item/weapon/implant/freedom(O)
|
||||||
var/obj/item/weapon/implanter/U = new /obj/item/weapon/implanter(src)
|
var/obj/item/weapon/implanter/U = new /obj/item/weapon/implanter(src)
|
||||||
U.imp = new /obj/item/weapon/implant/uplink(U)
|
U.imp = new /obj/item/weapon/implant/uplink(U)
|
||||||
return
|
|
||||||
|
|
||||||
if("hacker")
|
if("hacker")
|
||||||
new /obj/item/device/encryptionkey/syndicate(src)
|
new /obj/item/device/encryptionkey/syndicate(src)
|
||||||
new /obj/item/weapon/aiModule/syndicate(src)
|
new /obj/item/weapon/aiModule/syndicate(src)
|
||||||
new /obj/item/weapon/card/emag(src)
|
new /obj/item/weapon/card/emag(src)
|
||||||
new /obj/item/device/encryptionkey/binary(src)
|
new /obj/item/device/encryptionkey/binary(src)
|
||||||
return
|
|
||||||
|
|
||||||
if("lordsingulo")
|
if("lordsingulo")
|
||||||
new /obj/item/device/radio/beacon/syndicate(src)
|
new /obj/item/device/radio/beacon/syndicate(src)
|
||||||
@@ -61,7 +52,6 @@
|
|||||||
new /obj/item/clothing/mask/gas/syndicate(src)
|
new /obj/item/clothing/mask/gas/syndicate(src)
|
||||||
new /obj/item/weapon/tank/emergency/oxygen/double(src)
|
new /obj/item/weapon/tank/emergency/oxygen/double(src)
|
||||||
new /obj/item/weapon/card/emag(src)
|
new /obj/item/weapon/card/emag(src)
|
||||||
return
|
|
||||||
|
|
||||||
if("smoothoperator")
|
if("smoothoperator")
|
||||||
new /obj/item/weapon/storage/box/syndie_kit/g9mm(src)
|
new /obj/item/weapon/storage/box/syndie_kit/g9mm(src)
|
||||||
@@ -70,7 +60,7 @@
|
|||||||
new /obj/item/bodybag(src)
|
new /obj/item/bodybag(src)
|
||||||
new /obj/item/clothing/under/suit_jacket(src)
|
new /obj/item/clothing/under/suit_jacket(src)
|
||||||
new /obj/item/clothing/shoes/laceup(src)
|
new /obj/item/clothing/shoes/laceup(src)
|
||||||
return
|
. = ..()
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit
|
/obj/item/weapon/storage/box/syndie_kit
|
||||||
name = "box"
|
name = "box"
|
||||||
@@ -80,118 +70,97 @@
|
|||||||
/obj/item/weapon/storage/box/syndie_kit/imp_freedom
|
/obj/item/weapon/storage/box/syndie_kit/imp_freedom
|
||||||
name = "boxed freedom implant (with injector)"
|
name = "boxed freedom implant (with injector)"
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/imp_freedom/New()
|
/obj/item/weapon/storage/box/syndie_kit/imp_freedom/initialize()
|
||||||
..()
|
|
||||||
var/obj/item/weapon/implanter/O = new(src)
|
var/obj/item/weapon/implanter/O = new(src)
|
||||||
O.imp = new /obj/item/weapon/implant/freedom(O)
|
O.imp = new /obj/item/weapon/implant/freedom(O)
|
||||||
O.update()
|
O.update()
|
||||||
return
|
. = ..()
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/imp_compress
|
/obj/item/weapon/storage/box/syndie_kit/imp_compress
|
||||||
name = "box (C)"
|
name = "box (C)"
|
||||||
|
starts_with = list(/obj/item/weapon/implanter/compressed)
|
||||||
/obj/item/weapon/storage/box/syndie_kit/imp_compress/New()
|
|
||||||
new /obj/item/weapon/implanter/compressed(src)
|
|
||||||
..()
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/imp_explosive
|
/obj/item/weapon/storage/box/syndie_kit/imp_explosive
|
||||||
name = "box (E)"
|
name = "box (E)"
|
||||||
|
starts_with = list(/obj/item/weapon/implanter/explosive)
|
||||||
/obj/item/weapon/storage/box/syndie_kit/imp_explosive/New()
|
|
||||||
new /obj/item/weapon/implanter/explosive(src)
|
|
||||||
..()
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/imp_uplink
|
/obj/item/weapon/storage/box/syndie_kit/imp_uplink
|
||||||
name = "boxed uplink implant (with injector)"
|
name = "boxed uplink implant (with injector)"
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/imp_uplink/New()
|
/obj/item/weapon/storage/box/syndie_kit/imp_uplink/initialize()
|
||||||
..()
|
|
||||||
var/obj/item/weapon/implanter/O = new(src)
|
var/obj/item/weapon/implanter/O = new(src)
|
||||||
O.imp = new /obj/item/weapon/implant/uplink(O)
|
O.imp = new /obj/item/weapon/implant/uplink(O)
|
||||||
O.update()
|
O.update()
|
||||||
return
|
. = ..()
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/space
|
/obj/item/weapon/storage/box/syndie_kit/space
|
||||||
name = "boxed space suit and helmet"
|
name = "boxed space suit and helmet"
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/syndie_kit/space/New()
|
/obj/item/clothing/suit/space/syndicate,
|
||||||
..()
|
/obj/item/clothing/head/helmet/space/syndicate,
|
||||||
new /obj/item/clothing/suit/space/syndicate(src)
|
/obj/item/clothing/mask/gas/syndicate,
|
||||||
new /obj/item/clothing/head/helmet/space/syndicate(src)
|
/obj/item/weapon/tank/emergency/oxygen/double
|
||||||
new /obj/item/clothing/mask/gas/syndicate(src)
|
)
|
||||||
new /obj/item/weapon/tank/emergency/oxygen/double(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/chameleon
|
/obj/item/weapon/storage/box/syndie_kit/chameleon
|
||||||
name = "chameleon kit"
|
name = "chameleon kit"
|
||||||
desc = "Comes with all the clothes you need to impersonate most people. Acting lessons sold seperately."
|
desc = "Comes with all the clothes you need to impersonate most people. Acting lessons sold seperately."
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/syndie_kit/chameleon/New()
|
/obj/item/clothing/under/chameleon,
|
||||||
..()
|
/obj/item/clothing/head/chameleon,
|
||||||
new /obj/item/clothing/under/chameleon(src)
|
/obj/item/clothing/suit/chameleon,
|
||||||
new /obj/item/clothing/head/chameleon(src)
|
/obj/item/clothing/shoes/chameleon,
|
||||||
new /obj/item/clothing/suit/chameleon(src)
|
/obj/item/weapon/storage/backpack/chameleon,
|
||||||
new /obj/item/clothing/shoes/chameleon(src)
|
/obj/item/clothing/gloves/chameleon,
|
||||||
new /obj/item/weapon/storage/backpack/chameleon(src)
|
/obj/item/clothing/mask/chameleon,
|
||||||
new /obj/item/clothing/gloves/chameleon(src)
|
/obj/item/clothing/glasses/chameleon,
|
||||||
new /obj/item/clothing/mask/chameleon(src)
|
/obj/item/clothing/accessory/chameleon,
|
||||||
new /obj/item/clothing/glasses/chameleon(src)
|
/obj/item/weapon/gun/energy/chameleon
|
||||||
new /obj/item/clothing/accessory/chameleon(src)
|
)
|
||||||
new /obj/item/weapon/gun/energy/chameleon(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/clerical
|
/obj/item/weapon/storage/box/syndie_kit/clerical
|
||||||
name = "clerical kit"
|
name = "clerical kit"
|
||||||
desc = "Comes with all you need to fake paperwork. Assumes you have passed basic writing lessons."
|
desc = "Comes with all you need to fake paperwork. Assumes you have passed basic writing lessons."
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/syndie_kit/clerical/New()
|
/obj/item/weapon/stamp/chameleon,
|
||||||
..()
|
/obj/item/weapon/pen/chameleon,
|
||||||
new /obj/item/weapon/stamp/chameleon(src)
|
/obj/item/device/destTagger,
|
||||||
new /obj/item/weapon/pen/chameleon(src)
|
/obj/item/weapon/packageWrap,
|
||||||
new /obj/item/device/destTagger(src)
|
/obj/item/weapon/hand_labeler
|
||||||
new /obj/item/weapon/packageWrap(src)
|
)
|
||||||
new /obj/item/weapon/hand_labeler(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/spy
|
/obj/item/weapon/storage/box/syndie_kit/spy
|
||||||
name = "spy kit"
|
name = "spy kit"
|
||||||
desc = "For when you want to conduct voyeurism from afar."
|
desc = "For when you want to conduct voyeurism from afar."
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/syndie_kit/spy/New()
|
/obj/item/device/camerabug/spy = 6,
|
||||||
..()
|
/obj/item/device/bug_monitor/spy
|
||||||
new /obj/item/device/camerabug/spy(src)
|
)
|
||||||
new /obj/item/device/camerabug/spy(src)
|
|
||||||
new /obj/item/device/camerabug/spy(src)
|
|
||||||
new /obj/item/device/camerabug/spy(src)
|
|
||||||
new /obj/item/device/camerabug/spy(src)
|
|
||||||
new /obj/item/device/camerabug/spy(src)
|
|
||||||
new /obj/item/device/bug_monitor/spy(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/g9mm
|
/obj/item/weapon/storage/box/syndie_kit/g9mm
|
||||||
name = "\improper Smooth operator"
|
name = "\improper Smooth operator"
|
||||||
desc = "Compact 9mm with silencer kit."
|
desc = "Compact 9mm with silencer kit."
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/syndie_kit/g9mm/New()
|
/obj/item/weapon/gun/projectile/pistol,
|
||||||
..()
|
/obj/item/weapon/silencer
|
||||||
new /obj/item/weapon/gun/projectile/pistol(src)
|
)
|
||||||
new /obj/item/weapon/silencer(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/toxin
|
/obj/item/weapon/storage/box/syndie_kit/toxin
|
||||||
name = "toxin kit"
|
name = "toxin kit"
|
||||||
desc = "An apple will not be enough to keep the doctor away after this."
|
desc = "An apple will not be enough to keep the doctor away after this."
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/syndie_kit/toxin/New()
|
/obj/item/weapon/reagent_containers/glass/beaker/vial/random/toxin,
|
||||||
..()
|
/obj/item/weapon/reagent_containers/syringe
|
||||||
new /obj/item/weapon/reagent_containers/glass/beaker/vial/random/toxin(src)
|
)
|
||||||
new /obj/item/weapon/reagent_containers/syringe(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/cigarette
|
/obj/item/weapon/storage/box/syndie_kit/cigarette
|
||||||
name = "\improper Tricky smokes"
|
name = "\improper Tricky smokes"
|
||||||
desc = "Comes with the following brands of cigarettes, in this order: 2xFlash, 2xSmoke, 1xMindBreaker, 1xTricordrazine. Avoid mixing them up."
|
desc = "Comes with the following brands of cigarettes, in this order: 2xFlash, 2xSmoke, 1xMindBreaker, 1xTricordrazine. Avoid mixing them up."
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/cigarette/New()
|
/obj/item/weapon/storage/box/syndie_kit/cigarette/initialize()
|
||||||
..()
|
. = ..()
|
||||||
var/obj/item/weapon/storage/fancy/cigarettes/pack
|
var/obj/item/weapon/storage/fancy/cigarettes/pack
|
||||||
|
|
||||||
pack = new /obj/item/weapon/storage/fancy/cigarettes(src)
|
pack = new /obj/item/weapon/storage/fancy/cigarettes(src)
|
||||||
fill_cigarre_package(pack, list("aluminum" = 5, "potassium" = 5, "sulfur" = 5))
|
fill_cigarre_package(pack, list("aluminum" = 5, "potassium" = 5, "sulfur" = 5))
|
||||||
pack.desc += " 'F' has been scribbled on it."
|
pack.desc += " 'F' has been scribbled on it."
|
||||||
@@ -222,6 +191,8 @@
|
|||||||
|
|
||||||
new /obj/item/weapon/flame/lighter/zippo(src)
|
new /obj/item/weapon/flame/lighter/zippo(src)
|
||||||
|
|
||||||
|
calibrate_size()
|
||||||
|
|
||||||
/proc/fill_cigarre_package(var/obj/item/weapon/storage/fancy/cigarettes/C, var/list/reagents)
|
/proc/fill_cigarre_package(var/obj/item/weapon/storage/fancy/cigarettes/C, var/list/reagents)
|
||||||
for(var/reagent in reagents)
|
for(var/reagent in reagents)
|
||||||
C.reagents.add_reagent(reagent, reagents[reagent] * C.storage_slots)
|
C.reagents.add_reagent(reagent, reagents[reagent] * C.storage_slots)
|
||||||
@@ -229,72 +200,52 @@
|
|||||||
/obj/item/weapon/storage/box/syndie_kit/ewar_voice
|
/obj/item/weapon/storage/box/syndie_kit/ewar_voice
|
||||||
name = "Electrowarfare and Voice Synthesiser kit"
|
name = "Electrowarfare and Voice Synthesiser kit"
|
||||||
desc = "Kit for confounding organic and synthetic entities alike."
|
desc = "Kit for confounding organic and synthetic entities alike."
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/box/syndie_kit/ewar_voice/New()
|
/obj/item/rig_module/electrowarfare_suite,
|
||||||
..()
|
/obj/item/rig_module/voice
|
||||||
new /obj/item/rig_module/electrowarfare_suite(src)
|
)
|
||||||
new /obj/item/rig_module/voice(src)
|
|
||||||
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/secure/briefcase/money
|
/obj/item/weapon/storage/secure/briefcase/money
|
||||||
name = "suspicious briefcase"
|
name = "suspicious briefcase"
|
||||||
desc = "An ominous briefcase that has the unmistakeable smell of old, stale, cigarette smoke, and gives those who look at it a bad feeling."
|
desc = "An ominous briefcase that has the unmistakeable smell of old, stale, cigarette smoke, and gives those who look at it a bad feeling."
|
||||||
|
starts_with = list(/obj/item/weapon/spacecash/c1000 = 10)
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/secure/briefcase/money/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
new /obj/item/weapon/spacecash/c1000(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/combat_armor
|
/obj/item/weapon/storage/box/syndie_kit/combat_armor
|
||||||
name = "combat armor kit"
|
name = "combat armor kit"
|
||||||
desc = "Contains a full set of combat armor."
|
desc = "Contains a full set of combat armor."
|
||||||
|
starts_with = list(
|
||||||
|
/obj/item/clothing/head/helmet/combat,
|
||||||
|
/obj/item/clothing/suit/armor/combat,
|
||||||
|
/obj/item/clothing/gloves/arm_guard/combat,
|
||||||
|
/obj/item/clothing/shoes/leg_guard/combat
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/combat_armor/New()
|
/obj/item/weapon/storage/box/syndie_kit/demolitions
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/clothing/head/helmet/combat(src)
|
/obj/item/weapon/syndie/c4explosive,
|
||||||
new /obj/item/clothing/suit/armor/combat(src)
|
/obj/item/weapon/screwdriver
|
||||||
new /obj/item/clothing/gloves/arm_guard/combat(src)
|
)
|
||||||
new /obj/item/clothing/shoes/leg_guard/combat(src)
|
|
||||||
return
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/demolitions/New()
|
/obj/item/weapon/storage/box/syndie_kit/demolitions_heavy
|
||||||
..()
|
starts_with = list(
|
||||||
new /obj/item/weapon/syndie/c4explosive(src)
|
/obj/item/weapon/syndie/c4explosive/heavy,
|
||||||
new /obj/item/weapon/screwdriver(src)
|
/obj/item/weapon/screwdriver
|
||||||
|
)
|
||||||
/obj/item/weapon/storage/box/syndie_kit/demolitions_heavy/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/syndie/c4explosive/heavy(src)
|
|
||||||
new /obj/item/weapon/screwdriver(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/box/syndie_kit/demolitions_super_heavy/New()
|
|
||||||
..()
|
|
||||||
new /obj/item/weapon/syndie/c4explosive/heavy/super_heavy(src)
|
|
||||||
new /obj/item/weapon/screwdriver(src)
|
|
||||||
|
|
||||||
|
/obj/item/weapon/storage/box/syndie_kit/demolitions_super_heavy
|
||||||
|
starts_with = list(
|
||||||
|
/obj/item/weapon/syndie/c4explosive/heavy/super_heavy,
|
||||||
|
/obj/item/weapon/screwdriver
|
||||||
|
)
|
||||||
|
|
||||||
/obj/item/weapon/storage/secure/briefcase/rifle
|
/obj/item/weapon/storage/secure/briefcase/rifle
|
||||||
name = "secure briefcase"
|
name = "secure briefcase"
|
||||||
|
starts_with = list(
|
||||||
/obj/item/weapon/storage/secure/briefcase/rifle/New()
|
/obj/item/sniper_rifle_part/barrel,
|
||||||
..()
|
/obj/item/sniper_rifle_part/stock,
|
||||||
new /obj/item/sniper_rifle_part/barrel(src)
|
/obj/item/sniper_rifle_part/trigger_group,
|
||||||
new /obj/item/sniper_rifle_part/stock(src)
|
/obj/item/ammo_casing/a145 = 4
|
||||||
new /obj/item/sniper_rifle_part/trigger_group(src)
|
)
|
||||||
|
|
||||||
for(var/i = 1 to 4)
|
|
||||||
new /obj/item/ammo_casing/a145(src)
|
|
||||||
|
|
||||||
/obj/item/weapon/storage/secure/briefcase/fuelrod
|
/obj/item/weapon/storage/secure/briefcase/fuelrod
|
||||||
name = "heavy briefcase"
|
name = "heavy briefcase"
|
||||||
@@ -303,14 +254,12 @@
|
|||||||
description_antag = "This case will likely contain a charged fuel rod gun, and a few fuel rods to go with it. It can only hold the fuel rod gun, fuel rods, batteries, a screwdriver, and stock machine parts."
|
description_antag = "This case will likely contain a charged fuel rod gun, and a few fuel rods to go with it. It can only hold the fuel rod gun, fuel rods, batteries, a screwdriver, and stock machine parts."
|
||||||
force = 12 //Anti-rad lined i.e. Lead, probably gonna hurt a bit if you get bashed with it.
|
force = 12 //Anti-rad lined i.e. Lead, probably gonna hurt a bit if you get bashed with it.
|
||||||
can_hold = list(/obj/item/weapon/gun/magnetic/fuelrod, /obj/item/weapon/fuel_assembly, /obj/item/weapon/cell, /obj/item/weapon/stock_parts, /obj/item/weapon/screwdriver)
|
can_hold = list(/obj/item/weapon/gun/magnetic/fuelrod, /obj/item/weapon/fuel_assembly, /obj/item/weapon/cell, /obj/item/weapon/stock_parts, /obj/item/weapon/screwdriver)
|
||||||
|
starts_with = list(
|
||||||
|
/obj/item/weapon/gun/magnetic/fuelrod,
|
||||||
/obj/item/weapon/storage/secure/briefcase/fuelrod/New()
|
/obj/item/weapon/fuel_assembly/deuterium,
|
||||||
..()
|
/obj/item/weapon/fuel_assembly/deuterium,
|
||||||
new /obj/item/weapon/gun/magnetic/fuelrod(src)
|
/obj/item/weapon/fuel_assembly/tritium,
|
||||||
new /obj/item/weapon/fuel_assembly/deuterium(src)
|
/obj/item/weapon/fuel_assembly/tritium,
|
||||||
new /obj/item/weapon/fuel_assembly/deuterium(src)
|
/obj/item/weapon/fuel_assembly/phoron,
|
||||||
new /obj/item/weapon/fuel_assembly/tritium(src)
|
/obj/item/weapon/screwdriver
|
||||||
new /obj/item/weapon/fuel_assembly/tritium(src)
|
)
|
||||||
new /obj/item/weapon/fuel_assembly/phoron(src)
|
|
||||||
new /obj/item/weapon/screwdriver(src)
|
|
||||||
|
|||||||
@@ -882,6 +882,12 @@ obj/structure/cable/proc/cableColor(var/colorC)
|
|||||||
color = pick(COLOR_RED, COLOR_BLUE, COLOR_LIME, COLOR_WHITE, COLOR_PINK, COLOR_YELLOW, COLOR_CYAN, COLOR_SILVER, COLOR_GRAY, COLOR_BLACK, COLOR_MAROON, COLOR_OLIVE, COLOR_LIME, COLOR_TEAL, COLOR_NAVY, COLOR_PURPLE, COLOR_BEIGE, COLOR_BROWN)
|
color = pick(COLOR_RED, COLOR_BLUE, COLOR_LIME, COLOR_WHITE, COLOR_PINK, COLOR_YELLOW, COLOR_CYAN, COLOR_SILVER, COLOR_GRAY, COLOR_BLACK, COLOR_MAROON, COLOR_OLIVE, COLOR_LIME, COLOR_TEAL, COLOR_NAVY, COLOR_PURPLE, COLOR_BEIGE, COLOR_BROWN)
|
||||||
..()
|
..()
|
||||||
|
|
||||||
|
/obj/item/stack/cable_coil/random_belt/New()
|
||||||
|
stacktype = /obj/item/stack/cable_coil
|
||||||
|
color = pick(COLOR_RED, COLOR_YELLOW, COLOR_ORANGE)
|
||||||
|
amount = 30
|
||||||
|
..()
|
||||||
|
|
||||||
//Endless alien cable coil
|
//Endless alien cable coil
|
||||||
|
|
||||||
/obj/item/stack/cable_coil/alien
|
/obj/item/stack/cable_coil/alien
|
||||||
|
|||||||
Binary file not shown.
|
Before Width: | Height: | Size: 23 KiB After Width: | Height: | Size: 23 KiB |
Binary file not shown.
|
Before Width: | Height: | Size: 23 KiB After Width: | Height: | Size: 23 KiB |
Reference in New Issue
Block a user