Merge branch 'dev' of https://github.com/Baystation12/Baystation12 into outpost-power

baystation12.dme

@@ -93,8 +93,10 @@
 #include "code\controllers\lighting_controller.dm"
 #include "code\controllers\master_controller.dm"
 #include "code\controllers\shuttle_controller.dm"
+#include "code\controllers\subsystems.dm"
 #include "code\controllers\verbs.dm"
 #include "code\controllers\voting.dm"
+#include "code\controllers\subsystem\alarms.dm"
 #include "code\datums\ai_laws.dm"
 #include "code\datums\browser.dm"
 #include "code\datums\computerfiles.dm"
@@ -238,14 +240,12 @@
 #include "code\game\gamemodes\cult\ritual.dm"
 #include "code\game\gamemodes\cult\runes.dm"
 #include "code\game\gamemodes\cult\talisman.dm"
-#include "code\game\gamemodes\events\biomass.dm"
 #include "code\game\gamemodes\events\black_hole.dm"
 #include "code\game\gamemodes\events\clang.dm"
 #include "code\game\gamemodes\events\dust.dm"
 #include "code\game\gamemodes\events\miniblob.dm"
 #include "code\game\gamemodes\events\power_failure.dm"
 #include "code\game\gamemodes\events\space_ninja.dm"
-#include "code\game\gamemodes\events\spacevines.dm"
 #include "code\game\gamemodes\events\wormholes.dm"
 #include "code\game\gamemodes\events\holidays\Christmas.dm"
 #include "code\game\gamemodes\events\holidays\Holidays.dm"
@@ -305,8 +305,8 @@
 #include "code\game\machinery\autolathe.dm"
 #include "code\game\machinery\autolathe_datums.dm"
 #include "code\game\machinery\Beacon.dm"
-#include "code\game\machinery\bees_apiary.dm"
 #include "code\game\machinery\bees_items.dm"
+#include "code\game\machinery\biogenerator.dm"
 #include "code\game\machinery\bioprinter.dm"
 #include "code\game\machinery\buttons.dm"
 #include "code\game\machinery\cell_charger.dm"
@@ -452,9 +452,7 @@
 #include "code\game\machinery\embedded_controller\embedded_program_base.dm"
 #include "code\game\machinery\embedded_controller\simple_docking_controller.dm"
 #include "code\game\machinery\kitchen\gibber.dm"
-#include "code\game\machinery\kitchen\juicer.dm"
 #include "code\game\machinery\kitchen\microwave.dm"
-#include "code\game\machinery\kitchen\processor.dm"
 #include "code\game\machinery\kitchen\smartfridge.dm"
 #include "code\game\machinery\pipe\construction.dm"
 #include "code\game\machinery\pipe\pipe_dispenser.dm"
@@ -812,6 +810,13 @@
 #include "code\modules\admin\verbs\ticklag.dm"
 #include "code\modules\admin\verbs\tripAI.dm"
 #include "code\modules\admin\verbs\vox_raiders.dm"
+#include "code\modules\alarm\alarm.dm"
+#include "code\modules\alarm\alarm_handler.dm"
+#include "code\modules\alarm\atmosphere_alarm.dm"
+#include "code\modules\alarm\camera_alarm.dm"
+#include "code\modules\alarm\fire_alarm.dm"
+#include "code\modules\alarm\motion_alarm.dm"
+#include "code\modules\alarm\power_alarm.dm"
 #include "code\modules\assembly\assembly.dm"
 #include "code\modules\assembly\bomb.dm"
 #include "code\modules\assembly\helpers.dm"
@@ -918,7 +923,6 @@
 #include "code\modules\detectivework\forensics.dm"
 #include "code\modules\detectivework\scanner.dm"
 #include "code\modules\detectivework\scanning_console.dm"
-#include "code\modules\distillery\main.dm"
 #include "code\modules\economy\Accounts.dm"
 #include "code\modules\economy\Accounts_DB.dm"
 #include "code\modules\economy\ATM.dm"
@@ -975,16 +979,27 @@
 #include "code\modules\genetics\side_effects.dm"
 #include "code\modules\holodeck\HolodeckControl.dm"
 #include "code\modules\holodeck\HolodeckObjects.dm"
-#include "code\modules\hydroponics\biogenerator.dm"
+#include "code\modules\hydroponics\_hydro_setup.dm"
+#include "code\modules\hydroponics\grown.dm"
 #include "code\modules\hydroponics\grown_inedible.dm"
-#include "code\modules\hydroponics\hydro_tools.dm"
-#include "code\modules\hydroponics\hydro_tray.dm"
+#include "code\modules\hydroponics\grown_predefined.dm"
+#include "code\modules\hydroponics\seed.dm"
+#include "code\modules\hydroponics\seed_controller.dm"
 #include "code\modules\hydroponics\seed_datums.dm"
 #include "code\modules\hydroponics\seed_machines.dm"
 #include "code\modules\hydroponics\seed_mobs.dm"
+#include "code\modules\hydroponics\seed_packets.dm"
 #include "code\modules\hydroponics\seed_storage.dm"
-#include "code\modules\hydroponics\seeds.dm"
-#include "code\modules\hydroponics\vines.dm"
+#include "code\modules\hydroponics\spreading\spreading.dm"
+#include "code\modules\hydroponics\spreading\spreading_growth.dm"
+#include "code\modules\hydroponics\spreading\spreading_response.dm"
+#include "code\modules\hydroponics\trays\tray.dm"
+#include "code\modules\hydroponics\trays\tray_apiary.dm"
+#include "code\modules\hydroponics\trays\tray_process.dm"
+#include "code\modules\hydroponics\trays\tray_reagents.dm"
+#include "code\modules\hydroponics\trays\tray_soil.dm"
+#include "code\modules\hydroponics\trays\tray_tools.dm"
+#include "code\modules\hydroponics\trays\tray_update_icons.dm"
 #include "code\modules\library\lib_items.dm"
 #include "code\modules\library\lib_machines.dm"
 #include "code\modules\library\lib_readme.dm"
@@ -1130,7 +1145,6 @@
 #include "code\modules\mob\living\carbon\monkey\login.dm"
 #include "code\modules\mob\living\carbon\monkey\monkey.dm"
 #include "code\modules\mob\living\carbon\monkey\update_icons.dm"
-#include "code\modules\mob\living\silicon\alarm.dm"
 #include "code\modules\mob\living\silicon\death.dm"
 #include "code\modules\mob\living\silicon\laws.dm"
 #include "code\modules\mob\living\silicon\login.dm"
@@ -1144,8 +1158,8 @@
 #include "code\modules\mob\living\silicon\ai\life.dm"
 #include "code\modules\mob\living\silicon\ai\login.dm"
 #include "code\modules\mob\living\silicon\ai\logout.dm"
-#include "code\modules\mob\living\silicon\ai\nano.dm"
 #include "code\modules\mob\living\silicon\ai\say.dm"
+#include "code\modules\mob\living\silicon\ai\subsystems.dm"
 #include "code\modules\mob\living\silicon\ai\freelook\cameranet.dm"
 #include "code\modules\mob\living\silicon\ai\freelook\chunk.dm"
 #include "code\modules\mob\living\silicon\ai\freelook\eye.dm"
@@ -1178,6 +1192,7 @@
 #include "code\modules\mob\living\silicon\robot\robot_items.dm"
 #include "code\modules\mob\living\silicon\robot\robot_modules.dm"
 #include "code\modules\mob\living\silicon\robot\robot_movement.dm"
+#include "code\modules\mob\living\silicon\robot\subsystems.dm"
 #include "code\modules\mob\living\silicon\robot\drone\drone.dm"
 #include "code\modules\mob\living\silicon\robot\drone\drone_abilities.dm"
 #include "code\modules\mob\living\silicon\robot\drone\drone_console.dm"
@@ -1236,6 +1251,7 @@
 #include "code\modules\nano\nanomanager.dm"
 #include "code\modules\nano\nanomapgen.dm"
 #include "code\modules\nano\nanoui.dm"
+#include "code\modules\nano\modules\alarm_monitor.dm"
 #include "code\modules\nano\modules\crew_monitor.dm"
 #include "code\modules\nano\modules\power_monitor.dm"
 #include "code\modules\nano\modules\rcon.dm"
@@ -1389,7 +1405,6 @@
 #include "code\modules\reagents\reagent_containers\food\drinks\drinkingglass.dm"
 #include "code\modules\reagents\reagent_containers\food\drinks\jar.dm"
 #include "code\modules\reagents\reagent_containers\food\drinks\bottle\robot.dm"
-#include "code\modules\reagents\reagent_containers\food\snacks\grown.dm"
 #include "code\modules\reagents\reagent_containers\food\snacks\meat.dm"
 #include "code\modules\reagents\reagent_containers\glass\bottle.dm"
 #include "code\modules\reagents\reagent_containers\glass\bottle\robot.dm"
@@ -1449,7 +1464,6 @@
 #include "code\modules\research\xenoarchaeology\finds\finds_special.dm"
 #include "code\modules\research\xenoarchaeology\finds\finds_talkingitem.dm"
 #include "code\modules\research\xenoarchaeology\genetics\prehistoric_animals.dm"
-#include "code\modules\research\xenoarchaeology\genetics\prehistoric_plants.dm"
 #include "code\modules\research\xenoarchaeology\genetics\reconstitutor.dm"
 #include "code\modules\research\xenoarchaeology\machinery\artifact_analyser.dm"
 #include "code\modules\research\xenoarchaeology\machinery\artifact_harvester.dm"

code/__HELPERS/game.dm

@@ -491,5 +491,8 @@ datum/projectile_data
 		temps[direction] = rstats
 	return temps
 
-/proc/MinutesToTicks(var/minutes as num)
-	return minutes * 60 * 10
+/proc/MinutesToTicks(var/minutes)
+	return SecondsToTicks(60 * minutes)
+	
+/proc/SecondsToTicks(var/seconds)
+	return seconds * 10

code/__HELPERS/lists.dm

@@ -596,3 +596,7 @@ datum/proc/dd_SortValue()
 
 /obj/machinery/camera/dd_SortValue()
 	return "[c_tag]"
+
+/datum/alarm/dd_SortValue()
+	return "[sanitize(last_name)]"
+

code/__HELPERS/unsorted.dm

@@ -1378,3 +1378,15 @@ var/list/WALLITEMS = list(
 	if(istype(arglist,/list))
 		arglist = list2params(arglist)
 	return "<a href='?src=\ref[D];[arglist]'>[content]</a>"
+
+/proc/get_random_colour(var/simple, var/lower, var/upper)
+	var/colour
+	if(simple)
+		colour = pick(list("FF0000","FF7F00","FFFF00","00FF00","0000FF","4B0082","8F00FF"))
+	else
+		for(var/i=1;i<=3;i++)
+			var/temp_col = "[num2hex(rand(lower,upper))]"
+			if(length(temp_col )<2)
+				temp_col  = "0[temp_col]"
+			colour += temp_col
+	return colour

code/_onclick/hud/hud.dm

@@ -256,59 +256,99 @@ datum/hud/New(mob/owner)
 	set name = "F12"
 	set hidden = 1
 
-	if(hud_used)
-		if(ishuman(src))
-			if(!client) return
-			if(client.view != world.view)
-				return
-			if(hud_used.hud_shown)
-				hud_used.hud_shown = 0
-				if(src.hud_used.adding)
-					src.client.screen -= src.hud_used.adding
-				if(src.hud_used.other)
-					src.client.screen -= src.hud_used.other
-				if(src.hud_used.hotkeybuttons)
-					src.client.screen -= src.hud_used.hotkeybuttons
-				if(src.hud_used.item_action_list)
-					src.client.screen -= src.hud_used.item_action_list
-
-				//Due to some poor coding some things need special treatment:
-				//These ones are a part of 'adding', 'other' or 'hotkeybuttons' but we want them to stay
-				if(!full)
-					src.client.screen += src.hud_used.l_hand_hud_object	//we want the hands to be visible
-					src.client.screen += src.hud_used.r_hand_hud_object	//we want the hands to be visible
-					src.client.screen += src.hud_used.action_intent		//we want the intent swticher visible
-					src.hud_used.action_intent.screen_loc = ui_acti_alt	//move this to the alternative position, where zone_select usually is.
-				else
-					src.client.screen -= src.healths
-					src.client.screen -= src.internals
-					src.client.screen -= src.gun_setting_icon
-
-				//These ones are not a part of 'adding', 'other' or 'hotkeybuttons' but we want them gone.
-				src.client.screen -= src.zone_sel	//zone_sel is a mob variable for some reason.
-
-			else
-				hud_used.hud_shown = 1
-				if(src.hud_used.adding)
-					src.client.screen += src.hud_used.adding
-				if(src.hud_used.other && src.hud_used.inventory_shown)
-					src.client.screen += src.hud_used.other
-				if(src.hud_used.hotkeybuttons && !src.hud_used.hotkey_ui_hidden)
-					src.client.screen += src.hud_used.hotkeybuttons
-				if(src.healths)
-					src.client.screen |= src.healths
-				if(src.internals)
-					src.client.screen |= src.internals
-				if(src.gun_setting_icon)
-					src.client.screen |= src.gun_setting_icon
-
-				src.hud_used.action_intent.screen_loc = ui_acti //Restore intent selection to the original position
-				src.client.screen += src.zone_sel				//This one is a special snowflake
-
-			hud_used.hidden_inventory_update()
-			hud_used.persistant_inventory_update()
-			update_action_buttons()
-		else
-			usr << "\red Inventory hiding is currently only supported for human mobs, sorry."
-	else
+	if(!hud_used)
 		usr << "\red This mob type does not use a HUD."
+		return
+		
+	if(!ishuman(src))
+		usr << "\red Inventory hiding is currently only supported for human mobs, sorry."
+		return
+	
+	if(!client) return
+	if(client.view != world.view)
+		return
+	if(hud_used.hud_shown)
+		hud_used.hud_shown = 0
+		if(src.hud_used.adding)
+			src.client.screen -= src.hud_used.adding
+		if(src.hud_used.other)
+			src.client.screen -= src.hud_used.other
+		if(src.hud_used.hotkeybuttons)
+			src.client.screen -= src.hud_used.hotkeybuttons
+		if(src.hud_used.item_action_list)
+			src.client.screen -= src.hud_used.item_action_list
+
+		//Due to some poor coding some things need special treatment:
+		//These ones are a part of 'adding', 'other' or 'hotkeybuttons' but we want them to stay
+		if(!full)
+			src.client.screen += src.hud_used.l_hand_hud_object	//we want the hands to be visible
+			src.client.screen += src.hud_used.r_hand_hud_object	//we want the hands to be visible
+			src.client.screen += src.hud_used.action_intent		//we want the intent swticher visible
+			src.hud_used.action_intent.screen_loc = ui_acti_alt	//move this to the alternative position, where zone_select usually is.
+		else
+			src.client.screen -= src.healths
+			src.client.screen -= src.internals
+			src.client.screen -= src.gun_setting_icon
+
+		//These ones are not a part of 'adding', 'other' or 'hotkeybuttons' but we want them gone.
+		src.client.screen -= src.zone_sel	//zone_sel is a mob variable for some reason.
+
+	else
+		hud_used.hud_shown = 1
+		if(src.hud_used.adding)
+			src.client.screen += src.hud_used.adding
+		if(src.hud_used.other && src.hud_used.inventory_shown)
+			src.client.screen += src.hud_used.other
+		if(src.hud_used.hotkeybuttons && !src.hud_used.hotkey_ui_hidden)
+			src.client.screen += src.hud_used.hotkeybuttons
+		if(src.healths)
+			src.client.screen |= src.healths
+		if(src.internals)
+			src.client.screen |= src.internals
+		if(src.gun_setting_icon)
+			src.client.screen |= src.gun_setting_icon
+
+		src.hud_used.action_intent.screen_loc = ui_acti //Restore intent selection to the original position
+		src.client.screen += src.zone_sel				//This one is a special snowflake
+
+	hud_used.hidden_inventory_update()
+	hud_used.persistant_inventory_update()
+	update_action_buttons()
+
+//Similar to button_pressed_F12() but keeps zone_sel, gun_setting_icon, and healths.
+/mob/proc/toggle_zoom_hud()
+	if(!hud_used)
+		return
+	if(!ishuman(src))
+		return
+	if(!client)
+		return
+	if(client.view != world.view)
+		return
+	
+	if(hud_used.hud_shown)
+		hud_used.hud_shown = 0
+		if(src.hud_used.adding)
+			src.client.screen -= src.hud_used.adding
+		if(src.hud_used.other)
+			src.client.screen -= src.hud_used.other
+		if(src.hud_used.hotkeybuttons)
+			src.client.screen -= src.hud_used.hotkeybuttons
+		if(src.hud_used.item_action_list)
+			src.client.screen -= src.hud_used.item_action_list
+		src.client.screen -= src.internals
+	else
+		hud_used.hud_shown = 1
+		if(src.hud_used.adding)
+			src.client.screen += src.hud_used.adding
+		if(src.hud_used.other && src.hud_used.inventory_shown)
+			src.client.screen += src.hud_used.other
+		if(src.hud_used.hotkeybuttons && !src.hud_used.hotkey_ui_hidden)
+			src.client.screen += src.hud_used.hotkeybuttons
+		if(src.internals)
+			src.client.screen |= src.internals
+		src.hud_used.action_intent.screen_loc = ui_acti //Restore intent selection to the original position
+
+	hud_used.hidden_inventory_update()
+	hud_used.persistant_inventory_update()
+	update_action_buttons()

code/controllers/configuration.dm

@@ -182,6 +182,8 @@
 	var/dooc_allowed = 1
 	var/dsay_allowed = 1
 
+	var/starlight = 0	// Whether space turfs have ambient light or not
+
 /datum/configuration/New()
 	var/list/L = typesof(/datum/game_mode) - /datum/game_mode
 	for (var/T in L)
@@ -603,6 +605,9 @@
 					config.event_delay_upper[EVENT_LEVEL_MODERATE] = MinutesToTicks(values[2])
 					config.event_delay_upper[EVENT_LEVEL_MAJOR] = MinutesToTicks(values[3])
 
+				if("starlight")
+					config.starlight = 1
+
 				else
 					log_misc("Unknown setting in configuration: '[name]'")
 

code/controllers/master_controller.dm

@@ -26,6 +26,7 @@ datum/controller/game_controller
 	var/powernets_cost	= 0
 	var/nano_cost		= 0
 	var/events_cost		= 0
+	var/alarms_cost		= 0
 	var/ticker_cost		= 0
 	var/total_cost		= 0
 
@@ -231,6 +232,11 @@ datum/controller/game_controller/proc/process()
 				process_events()
 				events_cost = (world.timeofday - timer) / 10
 
+				//ALARMS
+				timer = world.timeofday
+				process_alarms()
+				alarms_cost = (world.timeofday - timer) / 10
+
 				//TICKER
 				timer = world.timeofday
 				last_thing_processed = ticker.type
@@ -238,7 +244,7 @@ datum/controller/game_controller/proc/process()
 				ticker_cost = (world.timeofday - timer) / 10
 
 				//TIMING
-				total_cost = air_cost + sun_cost + mobs_cost + diseases_cost + machines_cost + objects_cost + networks_cost + powernets_cost + nano_cost + events_cost + ticker_cost
+				total_cost = air_cost + sun_cost + mobs_cost + diseases_cost + machines_cost + objects_cost + networks_cost + powernets_cost + nano_cost + events_cost + alarms_cost + ticker_cost
 
 				var/end_time = world.timeofday
 				if(end_time < start_time)	//why not just use world.time instead?
@@ -334,9 +340,13 @@ datum/controller/game_controller/proc/process_nano()
 		nanomanager.processing_uis.Cut(i,i+1)
 
 datum/controller/game_controller/proc/process_events()
-	last_thing_processed = /datum/event
+	last_thing_processed = /datum/event_manager
 	event_manager.process()
 
+datum/controller/game_controller/proc/process_alarms()
+	last_thing_processed = /datum/subsystem/alarm
+	alarm_manager.fire()
+
 datum/controller/game_controller/proc/Recover()		//Mostly a placeholder for now.
 	var/msg = "## DEBUG: [time2text(world.timeofday)] MC restarted. Reports:\n"
 	for(var/varname in master_controller.vars)

code/controllers/subsystem/alarms.dm

@@ -0,0 +1,33 @@
+// We manually initialize the alarm handlers instead of looping over all existing types
+// to make it possible to write: camera.triggerAlarm() rather than alarm_manager.managers[datum/alarm_handler/camera].triggerAlarm() or a variant thereof.
+/var/global/datum/alarm_handler/atmosphere/atmosphere_alarm	= new()
+/var/global/datum/alarm_handler/camera/camera_alarm			= new()
+/var/global/datum/alarm_handler/fire/fire_alarm				= new()
+/var/global/datum/alarm_handler/motion/motion_alarm			= new()
+/var/global/datum/alarm_handler/power/power_alarm			= new()
+
+/datum/subsystem/alarm
+	name = "Alarm"
+	var/list/datum/alarm/all_handlers
+
+/datum/subsystem/alarm/New()
+	all_handlers = list(atmosphere_alarm, camera_alarm, fire_alarm, motion_alarm, power_alarm)
+
+/datum/subsystem/alarm/stat_entry()
+	stat(null,"Alarm-[master_controller.alarms_cost]\t#[number_of_active_alarms()]")
+
+/datum/subsystem/alarm/fire()
+	for(var/datum/alarm_handler/AH in all_handlers)
+		AH.process()
+
+/datum/subsystem/alarm/proc/active_alarms()
+	var/list/all_alarms = new
+	for(var/datum/alarm_handler/AH in all_handlers)
+		var/list/alarms = AH.alarms
+		all_alarms += alarms
+
+	return all_alarms
+
+/datum/subsystem/alarm/proc/number_of_active_alarms()
+	var/list/alarms = active_alarms()
+	return alarms.len

code/controllers/subsystems.dm

@@ -0,0 +1,46 @@
+#define NEW_SS_GLOBAL(varname) if(varname != src){if(istype(varname)){Recover();qdel(varname);}varname = src;}
+
+/datum/subsystem
+	//things you will want to define
+	var/name			//name of the subsystem
+	var/priority = 0	//priority affects order of initialization. Higher priorities are initialized first, lower priorities later. Can be decimal and negative values.
+	var/wait = 20		//time to wait (in deciseconds) between each call to fire(). Must be a positive integer.
+
+	//things you will probably want to leave alone
+	var/can_fire = 0	//prevent fire() calls
+	var/last_fire = 0	//last world.time we called fire()
+	var/next_fire = 0	//scheduled world.time for next fire()
+	var/cpu = 0			//cpu-usage stats (somewhat vague)
+	var/cost = 0		//average time to execute
+	var/times_fired = 0	//number of times we have called fire()
+
+//used to initialize the subsystem BEFORE the map has loaded
+/datum/subsystem/New()
+
+//previously, this would have been named 'process()' but that name is used everywhere for different things!
+//fire() seems more suitable. This is the procedure that gets called every 'wait' deciseconds.
+//fire(), and the procs it calls, SHOULD NOT HAVE ANY SLEEP OPERATIONS in them!
+//YE BE WARNED!
+/datum/subsystem/proc/fire()
+	can_fire = 0
+
+//used to initialize the subsystem AFTER the map has loaded
+/datum/subsystem/proc/Initialize(start_timeofday)
+	var/time = (world.timeofday - start_timeofday) / 10
+	var/msg = "Initialized [name] SubSystem within [time] seconds"
+	world << "<span class='userdanger'>[msg]</span>"
+	world.log << msg
+
+//hook for printing stats to the "MC" statuspanel for admins to see performance and related stats etc.
+/datum/subsystem/proc/stat_entry()
+	stat(name, "[round(cost,0.001)]ds\t(CPU:[round(cpu,1)]%)")
+
+//could be used to postpone a costly subsystem for one cycle
+//for instance, during cpu intensive operations like explosions
+/datum/subsystem/proc/postpone()
+	if(next_fire - world.time < wait)
+		next_fire += wait
+
+//usually called via datum/subsystem/New() when replacing a subsystem (i.e. due to a recurring crash)
+//should attempt to salvage what it can from the old instance of subsystem
+/datum/subsystem/proc/Recover()

code/controllers/verbs.dm

@@ -56,7 +56,7 @@
 	message_admins("Admin [key_name_admin(usr)] has restarted the [controller] controller.")
 	return
 
-/client/proc/debug_controller(controller in list("Master","Failsafe","Ticker","Lighting","Air","Jobs","Sun","Radio","Supply","Shuttles","Emergency Shuttle","Configuration","pAI", "Cameras", "Transfer Controller", "Gas Data","Event"))
+/client/proc/debug_controller(controller in list("Master","Failsafe","Ticker","Lighting","Air","Jobs","Sun","Radio","Supply","Shuttles","Emergency Shuttle","Configuration","pAI", "Cameras", "Transfer Controller", "Gas Data","Event","Plants","Alarm"))
 	set category = "Debug"
 	set name = "Debug Controller"
 	set desc = "Debug the various periodic loop controllers for the game (be careful!)"
@@ -114,5 +114,11 @@
 		if("Event")
 			debug_variables(event_manager)
 			feedback_add_details("admin_verb", "DEvent")
+		if("Plants")
+			debug_variables(plant_controller)
+			feedback_add_details("admin_verb", "DPlants")
+		if("Alarm")
+			debug_variables(alarm_manager)
+			feedback_add_details("admin_verb", "DAlarm")
 	message_admins("Admin [key_name_admin(usr)] is debugging the [controller] controller.")
 	return

code/datums/datacore.dm

@@ -51,7 +51,6 @@
 			assignment = "Unassigned"
 
 		var/id = add_zero(num2hex(rand(1, 1.6777215E7)), 6)	//this was the best they could come up with? A large random number? *sigh*
-
 		var/icon/front = new(get_id_photo(H), dir = SOUTH)
 		var/icon/side = new(get_id_photo(H), dir = WEST)
 		//General Record

code/datums/recipe.dm

@@ -26,52 +26,68 @@
  *
  *  Functions you do not need to call directly but could:
  *  /datum/recipe/proc/check_reagents(var/datum/reagents/avail_reagents)
- *    //1=precisely,  0=insufficiently, -1=superfluous
- *
  *  /datum/recipe/proc/check_items(var/obj/container as obj)
- *    //1=precisely, 0=insufficiently, -1=superfluous
  *
  * */
 
 /datum/recipe
-	var/list/reagents // example:  = list("berryjuice" = 5) // do not list same reagent twice
-	var/list/items // example: =list(/obj/item/weapon/crowbar, /obj/item/weapon/welder) // place /foo/bar before /foo
-	var/result //example: = /obj/item/weapon/reagent_containers/food/snacks/donut/normal
-	var/time = 100 // 1/10 part of second
+	var/list/reagents // example: = list("berryjuice" = 5) // do not list same reagent twice
+	var/list/items    // example: = list(/obj/item/weapon/crowbar, /obj/item/weapon/welder) // place /foo/bar before /foo
+	var/list/fruit    // example: = list("fruit" = 3)
+	var/result        // example: = /obj/item/weapon/reagent_containers/food/snacks/donut/normal
+	var/time = 100    // 1/10 part of second
 
-
-/datum/recipe/proc/check_reagents(var/datum/reagents/avail_reagents) //1=precisely, 0=insufficiently, -1=superfluous
+/datum/recipe/proc/check_reagents(var/datum/reagents/avail_reagents)
 	. = 1
 	for (var/r_r in reagents)
 		var/aval_r_amnt = avail_reagents.get_reagent_amount(r_r)
 		if (!(abs(aval_r_amnt - reagents[r_r])<0.5)) //if NOT equals
 			if (aval_r_amnt>reagents[r_r])
-				. = -1
+				. = 0
 			else
-				return 0
+				return -1
 	if ((reagents?(reagents.len):(0)) < avail_reagents.reagent_list.len)
-		return -1
+		return 0
 	return .
 
-/datum/recipe/proc/check_items(var/obj/container as obj) //1=precisely, 0=insufficiently, -1=superfluous
-	if (!items)
-		if (locate(/obj/) in container)
-			return -1
-		else
-			return 1
+/datum/recipe/proc/check_fruit(var/obj/container)
 	. = 1
-	var/list/checklist = items.Copy()
-	for (var/obj/O in container)
-		var/found = 0
-		for (var/type in checklist)
-			if (istype(O,type))
-				checklist-=type
-				found = 1
-				break
-		if (!found)
+	if(fruit && fruit.len)
+		var/list/checklist = list()
+		for(var/fruittype in fruit) // I do not trust Copy().
+			checklist[fruittype] = fruit[fruittype]
+		for(var/obj/item/weapon/reagent_containers/food/snacks/grown/G in container)
+			if(!G.seed || !G.seed.kitchen_tag || isnull(checklist[G.seed.kitchen_tag]))
+				continue
+			checklist[G.seed.kitchen_tag]--
+		for(var/ktag in checklist)
+			if(!isnull(checklist[ktag]))
+				if(checklist[ktag] < 0)
+					. = 0
+				else if(checklist[ktag] > 0)
+					. = -1
+					break
+	return .
+
+/datum/recipe/proc/check_items(var/obj/container as obj)
+	. = 1
+	if (items && items.len)
+		var/list/checklist = list()
+		for(var/item_type in items)
+			checklist |= item_type //Still don't trust Copy().
+		for(var/obj/O in container)
+			if(istype(O,/obj/item/weapon/reagent_containers/food/snacks/grown))
+				continue // Fruit is handled in check_fruit().
+			var/found = 0
+			for(var/item_type in checklist)
+				if (istype(O,item_type))
+					checklist-=item_type
+					found = 1
+					break
+			if (!found)
+				. = 0
+		if (checklist.len)
 			. = -1
-	if (checklist.len)
-		return 0
 	return .
 
 //general version
@@ -85,6 +101,9 @@
 
 // food-related
 /datum/recipe/proc/make_food(var/obj/container as obj)
+	if(!result)
+		world << "<span class='danger'>Recipe [type] is defined without a result, please bug this.</span>"
+		return
 	var/obj/result_obj = new result(container)
 	for (var/obj/O in (container.contents-result_obj))
 		if (O.reagents)
@@ -95,26 +114,23 @@
 	container.reagents.clear_reagents()
 	return result_obj
 
-/proc/select_recipe(var/list/datum/recipe/avaiable_recipes, var/obj/obj as obj, var/exact = 1 as num)
-	if (!exact)
-		exact = -1
+/proc/select_recipe(var/list/datum/recipe/avaiable_recipes, var/obj/obj as obj, var/exact)
 	var/list/datum/recipe/possible_recipes = new
+	var/target = exact ? 0 : 1
 	for (var/datum/recipe/recipe in avaiable_recipes)
-		if (recipe.check_reagents(obj.reagents)==exact && recipe.check_items(obj)==exact)
-			possible_recipes+=recipe
+		if((recipe.check_reagents(obj.reagents) < target) || (recipe.check_items(obj) < target) || (recipe.check_fruit(obj) < target))
+			continue
+		possible_recipes |= recipe
 	if (possible_recipes.len==0)
 		return null
 	else if (possible_recipes.len==1)
 		return possible_recipes[1]
 	else //okay, let's select the most complicated recipe
-		var/r_count = 0
-		var/i_count = 0
+		var/highest_count = 0
 		. = possible_recipes[1]
 		for (var/datum/recipe/recipe in possible_recipes)
-			var/N_i = (recipe.items)?(recipe.items.len):0
-			var/N_r = (recipe.reagents)?(recipe.reagents.len):0
-			if (N_i > i_count || (N_i== i_count && N_r > r_count ))
-				r_count = N_r
-				i_count = N_i
+			var/count = ((recipe.items)?(recipe.items.len):0) + ((recipe.reagents)?(recipe.reagents.len):0) + ((recipe.fruit)?(recipe.fruit.len):0)
+			if (count >= highest_count)
+				highest_count = count
 				. = recipe
 		return .

code/datums/supplypacks.dm

@@ -53,9 +53,8 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
 					/obj/item/weapon/reagent_containers/food/snacks/tofu,
 					/obj/item/weapon/reagent_containers/food/snacks/tofu,
 					/obj/item/weapon/reagent_containers/food/snacks/meat,
-					/obj/item/weapon/reagent_containers/food/snacks/meat,
-					/obj/item/weapon/reagent_containers/food/snacks/grown/banana,
-					/obj/item/weapon/reagent_containers/food/snacks/grown/banana)
+					/obj/item/weapon/reagent_containers/food/snacks/meat
+					)
 	cost = 10
 	containertype = /obj/structure/closet/crate/freezer
 	containername = "Food crate"
@@ -267,6 +266,8 @@ var/list/all_supply_groups = list("Operations","Security","Hospitality","Enginee
 /datum/supply_packs/hydroponics // -- Skie
 	name = "Hydroponics Supply Crate"
 	contains = list(/obj/item/weapon/reagent_containers/spray/plantbgone,
+					/obj/item/weapon/reagent_containers/spray/plantbgone,
+					/obj/item/weapon/reagent_containers/spray/plantbgone,
 					/obj/item/weapon/reagent_containers/spray/plantbgone,
 					/obj/item/weapon/reagent_containers/glass/bottle/ammonia,
 					/obj/item/weapon/reagent_containers/glass/bottle/ammonia,

code/datums/wires/alarm.dm

@@ -46,7 +46,7 @@ var/const/AALARM_WIRE_AALARM = 16
 				//world << "Syphon Wire Cut"
 
 		if(AALARM_WIRE_AALARM)
-			if (A.alarm_area.atmosalert(2))
+			if (A.alarm_area.atmosalert(2, A))
 				A.post_alert(2)
 			A.update_icon()
 
@@ -88,6 +88,6 @@ var/const/AALARM_WIRE_AALARM = 16
 
 		if(AALARM_WIRE_AALARM)
 		//	world << "Aalarm wire pulsed"
-			if (A.alarm_area.atmosalert(0))
+			if (A.alarm_area.atmosalert(0, A))
 				A.post_alert(0)
 			A.update_icon()

code/defines/obj/weapon.dm

@@ -24,17 +24,6 @@
 	var/mode = 1
 	w_class = 3.0
 
-/obj/item/weapon/bananapeel
-	name = "banana peel"
-	desc = "A peel from a banana."
-	icon = 'icons/obj/items.dmi'
-	icon_state = "banana_peel"
-	item_state = "banana_peel"
-	w_class = 2.0
-	throwforce = 0
-	throw_speed = 4
-	throw_range = 20
-
 /obj/item/weapon/soap
 	name = "soap"
 	desc = "A cheap bar of soap. Doesn't smell."

code/game/area/Space Station 13 areas.dm

@@ -110,7 +110,13 @@ var/list/ghostteleportlocs = list()
 	power_environ = 0
 	ambience = list('sound/ambience/ambispace.ogg','sound/music/title2.ogg','sound/music/space.ogg','sound/music/main.ogg','sound/music/traitor.ogg')
 
-/area/space/firealert()
+area/space/atmosalert()
+	return
+
+/area/space/fire_alert()
+	return
+
+/area/space/fire_reset()
 	return
 
 /area/space/readyalert()

code/game/area/areas.dm

@@ -30,37 +30,14 @@
 	power_change()		// all machines set to current power level, also updates lighting icon
 	InitializeLighting()
 
+/area/proc/get_cameras()
+	var/list/cameras = list()
+	for (var/area/RA in related)
+		for (var/obj/machinery/camera/C in RA)
+			cameras += C
+	return cameras
 
-/area/proc/poweralert(var/state, var/obj/source as obj)
-	if (state != poweralm)
-		poweralm = state
-		if(istype(source))	//Only report power alarms on the z-level where the source is located.
-			var/list/cameras = list()
-			for (var/area/RA in related)
-				for (var/obj/machinery/camera/C in RA)
-					cameras += C
-					if(state == 1)
-						C.network.Remove("Power Alarms")
-					else
-						C.network.Add("Power Alarms")
-			for (var/mob/living/silicon/aiPlayer in player_list)
-				if(aiPlayer.z == source.z)
-					if (state == 1)
-						aiPlayer.cancelAlarm("Power", src, source)
-					else
-						aiPlayer.triggerAlarm("Power", src, cameras, source)
-			for(var/obj/machinery/computer/station_alert/a in machines)
-				if(a.z == source.z)
-					if(state == 1)
-						a.cancelAlarm("Power", src, source)
-					else
-						a.triggerAlarm("Power", src, cameras, source)
-	return
-
-/area/proc/atmosalert(danger_level, var/set_firelocks=1)
-//	if(type==/area) //No atmos alarms in space
-//		return 0 //redudant
-
+/area/proc/atmosalert(danger_level, var/alarm_source)
 	//Check all the alarms before lowering atmosalm. Raising is perfectly fine.
 	for (var/area/RA in related)
 		for (var/obj/machinery/alarm/AA in RA)
@@ -68,32 +45,16 @@
 				danger_level = max(danger_level, AA.danger_level)
 
 	if(danger_level != atmosalm)
-		if (set_firelocks && danger_level < 1 && atmosalm >= 1)
+		if (danger_level < 1 && atmosalm >= 1)
 			//closing the doors on red and opening on green provides a bit of hysteresis that will hopefully prevent fire doors from opening and closing repeatedly due to noise
 			air_doors_open()
+		else if (danger_level >= 2 && atmosalm < 2)
+			air_doors_close()
 
-		if (danger_level < 2 && atmosalm >= 2)
-			for(var/area/RA in related)
-				for(var/obj/machinery/camera/C in RA)
-					C.network.Remove("Atmosphere Alarms")
-			for(var/mob/living/silicon/aiPlayer in player_list)
-				aiPlayer.cancelAlarm("Atmosphere", src, src)
-			for(var/obj/machinery/computer/station_alert/a in machines)
-				a.cancelAlarm("Atmosphere", src, src)
-
-		if (danger_level >= 2 && atmosalm < 2)
-			var/list/cameras = list()
-			for(var/area/RA in related)
-				//updateicon()
-				for(var/obj/machinery/camera/C in RA)
-					cameras += C
-					C.network.Add("Atmosphere Alarms")
-			for(var/mob/living/silicon/aiPlayer in player_list)
-				aiPlayer.triggerAlarm("Atmosphere", src, cameras, src)
-			for(var/obj/machinery/computer/station_alert/a in machines)
-				a.triggerAlarm("Atmosphere", src, cameras, src)
-			if (set_firelocks)
-				air_doors_close()
+		if (danger_level == 0)
+			atmosphere_alarm.clearAlarm(master, alarm_source)
+		else
+			atmosphere_alarm.triggerAlarm(master, alarm_source, severity = danger_level)
 
 		atmosalm = danger_level
 		for(var/area/RA in related)
@@ -107,9 +68,9 @@
 	if(!src.master.air_doors_activated)
 		src.master.air_doors_activated = 1
 		for(var/obj/machinery/door/firedoor/E in src.master.all_doors)
-			if(!E:blocked)
+			if(!E.blocked)
 				if(E.operating)
-					E:nextstate = CLOSED
+					E.nextstate = CLOSED
 				else if(!E.density)
 					spawn(0)
 						E.close()
@@ -118,21 +79,21 @@
 	if(src.master.air_doors_activated)
 		src.master.air_doors_activated = 0
 		for(var/obj/machinery/door/firedoor/E in src.master.all_doors)
-			if(!E:blocked)
+			if(!E.blocked)
 				if(E.operating)
-					E:nextstate = OPEN
+					E.nextstate = OPEN
 				else if(E.density)
 					spawn(0)
 						E.open()
 
 
-/area/proc/firealert()
-	if(name == "Space") //no fire alarms in space
-		return
-	if( !fire )
-		fire = 1
-		master.fire = 1		//used for firedoor checks
-		updateicon()
+/area/proc/fire_alert()
+	if(!fire)
+		master.fire = 1	//used for firedoor checks
+		master.updateicon()
+		for(var/area/A in related)
+			A.fire = 1
+			A.updateicon()
 		mouse_opacity = 0
 		for(var/obj/machinery/door/firedoor/D in all_doors)
 			if(!D.blocked)
@@ -141,22 +102,15 @@
 				else if(!D.density)
 					spawn()
 						D.close()
-		var/list/cameras = list()
-		for(var/area/RA in related)
-			for (var/obj/machinery/camera/C in RA)
-				cameras.Add(C)
-				C.network.Add("Fire Alarms")
-		for (var/mob/living/silicon/ai/aiPlayer in player_list)
-			aiPlayer.triggerAlarm("Fire", src, cameras, src)
-		for (var/obj/machinery/computer/station_alert/a in machines)
-			a.triggerAlarm("Fire", src, cameras, src)
 
-/area/proc/firereset()
+/area/proc/fire_reset()
 	if (fire)
-		fire = 0
-		master.fire = 0		//used for firedoor checks
+		master.fire = 0	//used for firedoor checks
+		master.updateicon()
+		for(var/area/A in related)
+			A.fire = 0
+			A.updateicon()
 		mouse_opacity = 0
-		updateicon()
 		for(var/obj/machinery/door/firedoor/D in all_doors)
 			if(!D.blocked)
 				if(D.operating)
@@ -164,13 +118,6 @@
 				else if(D.density)
 					spawn(0)
 					D.open()
-		for(var/area/RA in related)
-			for (var/obj/machinery/camera/C in RA)
-				C.network.Remove("Fire Alarms")
-		for (var/mob/living/silicon/ai/aiPlayer in player_list)
-			aiPlayer.cancelAlarm("Fire", src, src)
-		for (var/obj/machinery/computer/station_alert/a in machines)
-			a.cancelAlarm("Fire", src, src)
 
 /area/proc/readyalert()
 	if(!eject)

code/game/gamemodes/cult/cult.dm

@@ -28,7 +28,6 @@
 	recommended_enemies = 4
 
 	uplink_welcome = "Nar-Sie Uplink Console:"
-	uplink_uses = 10
 
 	var/datum/mind/sacrifice_target = null
 	var/finished = 0

code/game/gamemodes/events/biomass.dm

@@ -1,176 +0,0 @@
-// BIOMASS (Note that this code is very similar to Space Vine code)
-/obj/effect/biomass
-	name = "biomass"
-	desc = "Space barf from another dimension. It just keeps spreading!"
-	icon = 'icons/obj/biomass.dmi'
-	icon_state = "stage1"
-	anchored = 1
-	density = 0
-	layer = 5
-	pass_flags = PASSTABLE | PASSGRILLE
-	var/energy = 0
-	var/obj/effect/biomass_controller/master = null
-
-	New()
-		return
-
-	Del()
-		if(master)
-			master.vines -= src
-			master.growth_queue -= src
-		..()
-
-/obj/effect/biomass/attackby(obj/item/weapon/W as obj, mob/user as mob)
-	if (!W || !user || !W.type) return
-	switch(W.type)
-		if(/obj/item/weapon/circular_saw) del src
-		if(/obj/item/weapon/kitchen/utensil/knife) del src
-		if(/obj/item/weapon/scalpel) del src
-		if(/obj/item/weapon/twohanded/fireaxe) del src
-		if(/obj/item/weapon/hatchet) del src
-		if(/obj/item/weapon/melee/energy) del src
-		if(/obj/item/weapon/pickaxe/plasmacutter) del src
-
-		//less effective weapons
-		if(/obj/item/weapon/wirecutters)
-			if(prob(25)) del src
-		if(/obj/item/weapon/shard)
-			if(prob(25)) del src
-
-		else //weapons with subtypes
-			if(istype(W, /obj/item/weapon/melee/energy/sword)) del src
-			else if(istype(W, /obj/item/weapon/weldingtool))
-				var/obj/item/weapon/weldingtool/WT = W
-				if(WT.remove_fuel(0, user)) del src
-			else
-				return
-	..()
-
-/obj/effect/biomass_controller
-	var/list/obj/effect/biomass/vines = list()
-	var/list/growth_queue = list()
-	var/reached_collapse_size
-	var/reached_slowdown_size
-	//What this does is that instead of having the grow minimum of 1, required to start growing, the minimum will be 0,
-	//meaning if you get the biomasssss..s' size to something less than 20 plots, it won't grow anymore.
-
-	New()
-		if(!istype(src.loc,/turf/simulated/floor))
-			del(src)
-
-		spawn_biomass_piece(src.loc)
-		processing_objects.Add(src)
-
-	Del()
-		processing_objects.Remove(src)
-		..()
-
-	proc/spawn_biomass_piece(var/turf/location)
-		var/obj/effect/biomass/BM = new(location)
-		growth_queue += BM
-		vines += BM
-		BM.master = src
-
-	process()
-		if(!vines)
-			del(src) //space  vines exterminated. Remove the controller
-			return
-		if(!growth_queue)
-			del(src) //Sanity check
-			return
-		if(vines.len >= 250 && !reached_collapse_size)
-			reached_collapse_size = 1
-		if(vines.len >= 30 && !reached_slowdown_size )
-			reached_slowdown_size = 1
-
-		var/maxgrowth = 0
-		if(reached_collapse_size)
-			maxgrowth = 0
-		else if(reached_slowdown_size)
-			if(prob(25))
-				maxgrowth = 1
-			else
-				maxgrowth = 0
-		else
-			maxgrowth = 4
-		var/length = min( 30 , vines.len / 5 )
-		var/i = 0
-		var/growth = 0
-		var/list/obj/effect/biomass/queue_end = list()
-
-		for( var/obj/effect/biomass/BM in growth_queue )
-			i++
-			queue_end += BM
-			growth_queue -= BM
-			if(BM.energy < 2) //If tile isn't fully grown
-				if(prob(20))
-					BM.grow()
-
-			if(BM.spread())
-				growth++
-				if(growth >= maxgrowth)
-					break
-			if(i >= length)
-				break
-
-		growth_queue = growth_queue + queue_end
-
-/obj/effect/biomass/proc/grow()
-	if(!energy)
-		src.icon_state = "stage2"
-		energy = 1
-		src.opacity = 0
-		src.density = 0
-		layer = 5
-	else
-		src.icon_state = "stage3"
-		src.opacity = 0
-		src.density = 1
-		energy = 2
-
-/obj/effect/biomass/proc/spread()
-	var/direction = pick(cardinal)
-	var/step = get_step(src,direction)
-	if(istype(step,/turf/simulated/floor))
-		var/turf/simulated/floor/F = step
-		if(!locate(/obj/effect/biomass,F))
-			if(F.Enter(src))
-				if(master)
-					master.spawn_biomass_piece( F )
-					return 1
-	return 0
-
-/obj/effect/biomass/ex_act(severity)
-	switch(severity)
-		if(1.0)
-			del(src)
-			return
-		if(2.0)
-			if (prob(90))
-				del(src)
-				return
-		if(3.0)
-			if (prob(50))
-				del(src)
-				return
-	return
-
-/obj/effect/biomass/fire_act(null, temp, volume) //hotspots kill biomass
-	del src
-
-
-/proc/biomass_infestation()
-
-	spawn() //to stop the secrets panel hanging
-		var/list/turf/simulated/floor/turfs = list() //list of all the empty floor turfs in the hallway areas
-		for(var/areapath in typesof(/area/hallway))
-			var/area/A = locate(areapath)
-			for(var/area/B in A.related)
-				for(var/turf/simulated/floor/F in B.contents)
-					if(!F.contents.len)
-						turfs += F
-
-		if(turfs.len) //Pick a turf to spawn at if we can
-			var/turf/simulated/floor/T = pick(turfs)
-			new/obj/effect/biomass_controller(T) //spawn a controller at turf
-			message_admins("\blue Event: Biomass spawned at [T.loc.loc] ([T.x],[T.y],[T.z])")

code/game/gamemodes/events/spacevines.dm

@@ -1,16 +0,0 @@
-//Carn: Spacevines random event.
-/proc/spacevine_infestation()
-
-	spawn() //to stop the secrets panel hanging
-		var/list/turf/simulated/floor/turfs = list() //list of all the empty floor turfs in the hallway areas
-		for(var/areapath in typesof(/area/hallway))
-			var/area/A = locate(areapath)
-			for(var/area/B in A.related)
-				for(var/turf/simulated/floor/F in B.contents)
-					if(!F.contents.len)
-						turfs += F
-
-		if(turfs.len) //Pick a turf to spawn at if we can
-			var/turf/simulated/floor/T = pick(turfs)
-			new/obj/effect/plant_controller(T) //spawn a controller at turf
-			message_admins("\blue Event: Spacevines spawned at [T.loc] ([T.x],[T.y],[T.z])")

code/game/gamemodes/game_mode.dm

@@ -30,30 +30,37 @@
 	var/newscaster_announcements = null
 	var/ert_disabled = 0
 	var/uplink_welcome = "Illegal Uplink Console:"
-	var/uplink_uses = 10
+	var/uplink_uses = 12
 	var/list/datum/uplink_item/uplink_items = list(
+		"Ammunition" = list(
+			new/datum/uplink_item(/obj/item/ammo_magazine/a357, 2, ".357", "RA"),
+			new/datum/uplink_item(/obj/item/ammo_magazine/mc9mm, 2, "9mm", "R9"),
+			new/datum/uplink_item(/obj/item/ammo_magazine/chemdart, 2, "Darts", "AD"),
+			new/datum/uplink_item(/obj/item/weapon/storage/box/sniperammo, 3, "14.5mm", "RA")
+			),
 		"Highly Visible and Dangerous Weapons" = list(
-			 new/datum/uplink_item(/obj/item/ammo_magazine/mc9mm, 2, "Ammo-9mm", "R9"),
-			 new/datum/uplink_item(/obj/item/ammo_magazine/a357, 2, "Ammo-357", "RA"),
 			 new/datum/uplink_item(/obj/item/weapon/storage/box/emps, 3, "5 EMP Grenades", "EM"),
 			 new/datum/uplink_item(/obj/item/weapon/melee/energy/sword, 4, "Energy Sword", "ES"),
+			 new/datum/uplink_item(/obj/item/weapon/gun/projectile/dartgun, 5, "Dart Gun", "DG"),
 			 new/datum/uplink_item(/obj/item/weapon/gun/energy/crossbow, 5, "Energy Crossbow", "XB"),
 			 new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/g9mm, 5, "Silenced 9mm", "S9"),
 			 new/datum/uplink_item(/obj/item/mecha_parts/mecha_equipment/weapon/energy/riggedlaser, 6, "Exosuit Rigged Laser", "RL"),
 			 new/datum/uplink_item(/obj/item/weapon/gun/projectile/revolver, 6, "Revolver", "RE"),
-			 new/datum/uplink_item(/obj/item/weapon/storage/box/syndicate, 10, "Mercenary Bundle", "BU")
+			 new/datum/uplink_item(/obj/item/weapon/storage/box/syndicate, 10, "Mercenary Bundle", "BU"),
+			 new/datum/uplink_item(/obj/item/weapon/gun/projectile/heavysniper, 12, "PTRS Rifle", "BU")
 			),
 		"Stealthy and Inconspicuous Weapons" = list(
 			new/datum/uplink_item(/obj/item/weapon/soap/syndie, 1, "Subversive Soap", "SP"),
 			new/datum/uplink_item(/obj/item/weapon/cane/concealed, 2, "Concealed Cane Sword", "CC"),
 			new/datum/uplink_item(/obj/item/weapon/cartridge/syndicate, 3, "Detomatix PDA Cartridge", "DC"),
 			new/datum/uplink_item(/obj/item/weapon/pen/paralysis, 3, "Paralysis Pen", "PP"),
-			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/cigarette, 4, "Cigarette Kit", "BH")
+			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/cigarette, 4, "Cigarette Kit", "BH"),
+			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/toxin, 4, "Random Toxin - Beaker", "RT")
 			),
 		"Stealth and Camouflage Items" = list(
 			new/datum/uplink_item(/obj/item/weapon/card/id/syndicate, 2, "Agent ID card", "AC"),
 			new/datum/uplink_item(/obj/item/clothing/shoes/syndigaloshes, 2, "No-Slip Shoes", "SH"),
-			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/spy, 2, "Bug Kit", "SK"),
+			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/spy, 2, "Bug Kit", "BK"),
 			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/chameleon, 3, "Chameleon Kit", "CB"),
 			new/datum/uplink_item(/obj/item/device/chameleon, 4, "Chameleon-Projector", "CP"),
 			new/datum/uplink_item(/obj/item/clothing/mask/gas/voice, 4, "Voice Changer", "VC"),
@@ -62,11 +69,13 @@
 		"Devices and Tools" = list(
 			new/datum/uplink_item(/obj/item/weapon/storage/toolbox/syndicate, 1, "Fully Loaded Toolbox", "ST"),
 			new/datum/uplink_item(/obj/item/weapon/plastique, 2, "C-4 (Destroys walls)", "C4"),
+			new/datum/uplink_item(/obj/item/device/encryptionkey/syndicate, 2, "Encrypted Radio Channel Key", "ER"),
 			new/datum/uplink_item(/obj/item/device/encryptionkey/binary, 3, "Binary Translator Key", "BT"),
 			new/datum/uplink_item(/obj/item/weapon/card/emag, 3, "Cryptographic Sequencer", "EC"),
 			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/clerical, 3, "Morphic Clerical Kit", "CK"),
 			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/space, 3, "Space Suit", "SS"),
 			new/datum/uplink_item(/obj/item/clothing/glasses/thermal/syndi, 3, "Thermal Imaging Glasses", "TM"),
+			new/datum/uplink_item(/obj/item/clothing/suit/storage/vest/heavy/merc, 4, "Heavy Armor Vest", "HAV"),
 			new/datum/uplink_item(/obj/item/weapon/aiModule/syndicate, 7, "Hacked AI Upload Module", "AI"),
 			new/datum/uplink_item(/obj/item/device/powersink, 5, "Powersink (DANGER!)", "PS",),
 			new/datum/uplink_item(/obj/item/device/radio/beacon/syndicate, 7, "Singularity Beacon (DANGER!)", "SB"),
@@ -78,10 +87,20 @@
 			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/imp_explosive, 6, "Explosive Implant (DANGER!)", "EI"),
 			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/imp_uplink, 10, "Uplink Implant (Contains 5 Telecrystals)", "UI")
 			),
-		"Health Aids" = list(
-			new/datum/uplink_item(/obj/item/weapon/storage/box/donkpockets, 1, "Box of Donk-Pockets", "DP"),
+		"Medical" = list(
+			new/datum/uplink_item(/obj/item/weapon/storage/box/donkpockets, 1, "Box of Sin-Pockets", "DP"),
+			new/datum/uplink_item(/obj/item/weapon/storage/firstaid/surgery, 5, "Surgery kit", "SK"),
 			new/datum/uplink_item(/obj/item/weapon/storage/firstaid/combat, 5, "Combat medical kit", "CM")
 		),
+		"Hardsuit Modules" = list(
+			new/datum/uplink_item(/obj/item/rig_module/vision/thermal, 2, "Thermal Scanner", "RTS"),
+			new/datum/uplink_item(/obj/item/rig_module/fabricator/energy_net, 3, "Net Projector", "REN"),
+			new/datum/uplink_item(/obj/item/weapon/storage/box/syndie_kit/ewar_voice, 4, "Electrowarfare Suite and Voice Synthesiser", "REV"),
+			new/datum/uplink_item(/obj/item/rig_module/maneuvering_jets, 4, "Maneuvering Jets", "RMJ"),
+			new/datum/uplink_item(/obj/item/rig_module/mounted/egun, 6, "Mounted Energy Gun", "REG"),
+			new/datum/uplink_item(/obj/item/rig_module/power_sink, 6, "Power Sink", "RPS"),
+			new/datum/uplink_item(/obj/item/rig_module/mounted, 8, "Mounted Laser Cannon", "RLC")
+		),
 		"(Pointless) Badassery" = list(
 			new/datum/uplink_item(/obj/item/toy/syndicateballoon, 10, "For showing that You Are The BOSS (Useless Balloon)", "BS"),
 			new/datum/uplink_item(/obj/item/toy/nanotrasenballoon, 10, "For showing that you love NT SOO much (Useless Balloon)", "NT")
@@ -251,16 +270,6 @@
 		   special_role == "Head Revolutionary" && prob(30))
 			suspects += man
 
-			// If they're a traitor or likewise, give them extra TC in exchange.
-			var/obj/item/device/uplink/hidden/suplink = man.mind.find_syndicate_uplink()
-			if(suplink)
-				var/extra = 4
-				suplink.uses += extra
-				man << "\red We have received notice that enemy intelligence suspects you to be linked with us. We have thus invested significant resources to increase your uplink's capacity."
-			else
-				// Give them a warning!
-				man << "\red They are on to you!"
-
 		// Some poor people who were just in the wrong place at the wrong time..
 		else if(prob(10))
 			suspects += man

code/game/gamemodes/malfunction/malfunction.dm

@@ -10,7 +10,6 @@
 	recommended_enemies = 1
 
 	uplink_welcome = "Crazy AI Uplink Console:"
-	uplink_uses = 10
 
 	var/const/waittime_l = 600
 	var/const/waittime_h = 1800 // started at 1800

code/game/gamemodes/meteor/meteor.dm

@@ -9,7 +9,6 @@
 	votable = 0
 
 	uplink_welcome = "EVIL METEOR Uplink Console:"
-	uplink_uses = 10
 
 
 /datum/game_mode/meteor/announce()

code/game/gamemodes/revolution/rp_revolution.dm

@@ -9,7 +9,7 @@
 	recommended_enemies = 3
 
 	uplink_welcome = "AntagCorp Uplink Console:"
-	uplink_uses = 5
+	uplink_uses = 7
 
 	newscaster_announcements = /datum/news_announcement/revolution_inciting_event
 

code/game/gamemodes/traitor/traitor.dm

@@ -13,7 +13,6 @@
 
 
 	uplink_welcome = "AntagCorp Portable Teleportation Relay:"
-	uplink_uses = 10
 
 	var/const/waittime_l = 600 //lower bound on time before intercept arrives (in tenths of seconds)
 	var/const/waittime_h = 1800 //upper bound on time before intercept arrives (in tenths of seconds)

code/game/gamemodes/wizard/artifact.dm

@@ -15,7 +15,7 @@
 /obj/effect/rend
 	name = "Tear in the fabric of reality"
 	desc = "You should run now"
-	icon = 'icons/obj/biomass.dmi'
+	icon = 'icons/obj/wizard.dmi'
 	icon_state = "rift"
 	density = 1
 	unacidable = 1

code/game/jobs/job/science.dm

@@ -42,13 +42,13 @@
 	flag = SCIENTIST
 	department_flag = MEDSCI
 	faction = "Station"
-	total_positions = 6
+	total_positions = 5
 	spawn_positions = 3
 	supervisors = "the research director"
 	selection_color = "#ffeeff"
 	access = list(access_robotics, access_tox, access_tox_storage, access_research, access_xenobiology, access_xenoarch)
 	minimal_access = list(access_tox, access_tox_storage, access_research, access_xenoarch)
-	alt_titles = list("Xenoarcheologist", "Anomalist", "Phoron Researcher", "Xenobotanist")
+	alt_titles = list("Xenoarcheologist", "Anomalist", "Phoron Researcher")
 
 	minimal_player_age = 14
 
@@ -74,12 +74,13 @@
 	flag = XENOBIOLOGIST
 	department_flag = MEDSCI
 	faction = "Station"
-	total_positions = 2
+	total_positions = 3
 	spawn_positions = 2
 	supervisors = "the research director"
 	selection_color = "#ffeeff"
 	access = list(access_robotics, access_tox, access_tox_storage, access_research, access_xenobiology)
 	minimal_access = list(access_research, access_xenobiology)
+	alt_titles = list("Xenobotanist")
 
 	minimal_player_age = 14
 

code/game/machinery/alarm.dm

@@ -117,19 +117,6 @@
 
 	first_run()
 
-/obj/machinery/alarm/Del()
-	//If there's an active alarm, clear it after minute so that alarms don't keep going forver
-	delayed_reset()
-	..()
-
-//needed to cancel the alarm after it is deleted
-/obj/machinery/alarm/proc/delayed_reset()
-	var/area/A = alarm_area
-	src = null
-	spawn(600)
-		//It makes sense not to touch firelocks here. The alarm itself is gone, we have no idea what the atmos is like.
-		A.atmosalert(0, set_firelocks=0)
-
 /obj/machinery/alarm/proc/first_run()
 	alarm_area = get_area(src)
 	if (alarm_area.master)
@@ -441,7 +428,7 @@
 				send_signal(device_id, list("power"= 0) )
 
 /obj/machinery/alarm/proc/apply_danger_level(var/new_danger_level)
-	if (report_danger_level && alarm_area.atmosalert(new_danger_level))
+	if (report_danger_level && alarm_area.atmosalert(new_danger_level, src))
 		post_alert(new_danger_level)
 
 	update_icon()
@@ -769,13 +756,13 @@
 			return 1
 
 		if(href_list["atmos_alarm"])
-			if (alarm_area.atmosalert(2))
+			if (alarm_area.atmosalert(2, src))
 				apply_danger_level(2)
 			update_icon()
 			return 1
 
 		if(href_list["atmos_reset"])
-			if (alarm_area.atmosalert(0))
+			if (alarm_area.atmosalert(0, src))
 				apply_danger_level(0)
 			update_icon()
 			return 1
@@ -947,7 +934,6 @@ FIRE ALARM
 	var/buildstage = 2 // 2 = complete, 1 = no wires,  0 = circuit gone
 
 /obj/machinery/firealarm/update_icon()
-
 	if(wiresexposed)
 		switch(buildstage)
 			if(2)
@@ -981,7 +967,8 @@ FIRE ALARM
 	return src.alarm()
 
 /obj/machinery/firealarm/emp_act(severity)
-	if(prob(50/severity)) alarm()
+	if(prob(50/severity))
+		alarm(rand(30/severity, 60/severity))
 	..()
 
 /obj/machinery/firealarm/attackby(obj/item/W as obj, mob/user as mob)
@@ -1080,6 +1067,7 @@ FIRE ALARM
 	var/d2
 	if (istype(user, /mob/living/carbon/human) || istype(user, /mob/living/silicon))
 		A = A.loc
+		A = A.master
 
 		if (A.fire)
 			d1 = text("<A href='?src=\ref[];reset=1'>Reset - Lockdown</A>", src)
@@ -1145,26 +1133,26 @@ FIRE ALARM
 /obj/machinery/firealarm/proc/reset()
 	if (!( src.working ))
 		return
-	var/area/A = src.loc
-	A = A.loc
-	if (!( istype(A, /area) ))
-		return
-	A.firereset()
+	var/area/area = get_area(src)
+	for(var/area/A in area.related)
+		for(var/obj/machinery/firealarm/FA in A)
+			fire_alarm.clearAlarm(loc, FA)
 	update_icon()
 	return
 
-/obj/machinery/firealarm/proc/alarm()
-	if (!( src.working ))
+/obj/machinery/firealarm/proc/alarm(var/duration = 0)
+	if (!( src.working))
 		return
-	var/area/A = src.loc
-	A = A.loc
-	if (!( istype(A, /area) ))
-		return
-	A.firealert()
+	var/area/area = get_area(src)
+	for(var/area/A in area.related)
+		for(var/obj/machinery/firealarm/FA in A)
+			fire_alarm.triggerAlarm(loc, FA, duration)
 	update_icon()
 	//playsound(src.loc, 'sound/ambience/signal.ogg', 75, 0)
 	return
 
+
+
 /obj/machinery/firealarm/New(loc, dir, building)
 	..()
 
@@ -1180,20 +1168,6 @@ FIRE ALARM
 		pixel_x = (dir & 3)? 0 : (dir == 4 ? -24 : 24)
 		pixel_y = (dir & 3)? (dir ==1 ? -24 : 24) : 0
 
-/obj/machinery/firealarm/Del()
-	//so fire alarms don't keep going forever
-	delayed_reset()
-	..()
-
-//needed to cancel the alarm after it is deleted
-/obj/machinery/firealarm/proc/delayed_reset()
-	var/area/A = get_area(src)
-	if (!A) return
-
-	src = null
-	spawn(600)
-		A.firereset()
-
 /obj/machinery/firealarm/initialize()
 	if(z in config.contact_levels)
 		if(security_level)

code/game/machinery/camera/camera.dm

@@ -53,13 +53,6 @@
 		ASSERT(src.network.len > 0)
 	..()
 
-/obj/machinery/camera/Del()
-	if(!alarm_on)
-		triggerCameraAlarm()
-
-	cancelCameraAlarm()
-	..()
-
 /obj/machinery/camera/emp_act(severity)
 	if(!isEmpProof())
 		if(prob(100/severity))
@@ -67,7 +60,7 @@
 			stat |= EMPED
 			SetLuminosity(0)
 			kick_viewers()
-			triggerCameraAlarm()
+			triggerCameraAlarm(10 * severity)
 			update_icon()
 
 			spawn(900)
@@ -261,22 +254,16 @@
 	else
 		icon_state = initial(icon_state)
 
-/obj/machinery/camera/proc/triggerCameraAlarm()
+/obj/machinery/camera/proc/triggerCameraAlarm(var/duration = 0)
 	alarm_on = 1
-	if(!get_area(src))
-		return
-
-	for(var/mob/living/silicon/S in mob_list)
-		S.triggerAlarm("Camera", get_area(src), list(src), src)
-
+	camera_alarm.triggerAlarm(loc, src, duration)
 
 /obj/machinery/camera/proc/cancelCameraAlarm()
-	alarm_on = 0
-	if(!get_area(src))
+	if(wires.IsIndexCut(CAMERA_WIRE_ALARM))
 		return
 
-	for(var/mob/living/silicon/S in mob_list)
-		S.cancelAlarm("Camera", get_area(src), src)
+	alarm_on = 0
+	camera_alarm.clearAlarm(loc, src)
 
 //if false, then the camera is listed as DEACTIVATED and cannot be used
 /obj/machinery/camera/proc/can_use()
@@ -361,3 +348,13 @@
 
 	user.set_machine(src)
 	wires.Interact(user)
+
+/obj/machinery/camera/proc/nano_structure()
+	var/cam[0]
+	cam["name"] = sanitize(c_tag)
+	cam["deact"] = !can_use()
+	cam["camera"] = "\ref[src]"
+	cam["x"] = x
+	cam["y"] = y
+	cam["z"] = z
+	return cam

code/game/machinery/camera/motion.dm

@@ -45,8 +45,7 @@
 	if (!status || (stat & NOPOWER))
 		return 0
 	if (detectTime == -1)
-		for (var/mob/living/silicon/aiPlayer in player_list)
-			aiPlayer.cancelAlarm("Motion", get_area(src), src)
+		motion_alarm.clearAlarm(loc, src)
 	detectTime = 0
 	return 1
 
@@ -54,8 +53,7 @@
 	if (!status || (stat & NOPOWER))
 		return 0
 	if (!detectTime) return 0
-	for (var/mob/living/silicon/aiPlayer in player_list)
-		aiPlayer.triggerAlarm("Motion", get_area(src), list(src), src)
+	motion_alarm.triggerAlarm(loc, src)
 	detectTime = -1
 	return 1
 

code/game/machinery/computer/atmos_alert.dm

@@ -1,116 +1,85 @@
 //This file was auto-corrected by findeclaration.exe on 25.5.2012 20:42:31
 
-// Converting these to global lists may be a bit laggy when removal procs are called. Consider
-// rewriting this properly to fix the update bug, rather than unifying all monitors. ~Z
-
 var/global/list/priority_air_alarms = list()
 var/global/list/minor_air_alarms = list()
 
+
 /obj/machinery/computer/atmos_alert
 	name = "atmospheric alert computer"
 	desc = "Used to access the station's atmospheric sensors."
 	circuit = "/obj/item/weapon/circuitboard/atmos_alert"
 	icon_state = "alert:0"
-	var/receive_frequency = 1437
-	var/datum/radio_frequency/radio_connection
 
-
-/obj/machinery/computer/atmos_alert/initialize()
+/obj/machinery/computer/atmos_alert/New()
 	..()
-	set_frequency(receive_frequency)
-
-/obj/machinery/computer/atmos_alert/receive_signal(datum/signal/signal)
-	if(!signal || signal.encryption) return
-
-	var/zone = signal.data["zone"]
-	var/severity = signal.data["alert"]
-
-	if(!zone || !severity) return
-
-	minor_air_alarms -= zone
-	priority_air_alarms -= zone
-	if(severity=="severe")
-		priority_air_alarms |= zone
-	else if (severity=="minor")
-		minor_air_alarms |= zone
-	update_icon()
-	return
-
-
-/obj/machinery/computer/atmos_alert/proc/set_frequency(new_frequency)
-	radio_controller.remove_object(src, receive_frequency)
-	receive_frequency = new_frequency
-	radio_connection = radio_controller.add_object(src, receive_frequency, RADIO_ATMOSIA)
+	atmosphere_alarm.register(src, /obj/machinery/computer/station_alert/update_icon)
     
+/obj/machinery/computer/atmos_alert/Del()
+    atmosphere_alarm.unregister(src)
+    ..()
 
 /obj/machinery/computer/atmos_alert/attack_hand(mob/user)
-	if(..(user))
-		return
-	user << browse(return_text(),"window=computer")
-	user.set_machine(src)
-	onclose(user, "computer")
+	ui_interact(user)
 
-/obj/machinery/computer/atmos_alert/process()
-	if(..())
-		src.updateDialog()
+/obj/machinery/computer/atmos_alert/ui_interact(mob/user, ui_key = "main", var/datum/nanoui/ui = null, var/force_open = 1)
+	var/data[0]
+	var/major_alarms[0]
+	var/minor_alarms[0]
+
+	for(var/datum/alarm/alarm in atmosphere_alarm.major_alarms())
+		major_alarms[++major_alarms.len] = list("name" = sanitize(alarm.alarm_name()), "ref" = "\ref[alarm]")
+
+	for(var/datum/alarm/alarm in atmosphere_alarm.minor_alarms())
+		minor_alarms[++minor_alarms.len] = list("name" = sanitize(alarm.alarm_name()), "ref" = "\ref[alarm]")
+
+	data["priority_alarms"] = major_alarms
+	data["minor_alarms"] = minor_alarms
+
+	ui = nanomanager.try_update_ui(user, src, ui_key, ui, data, force_open)
+	if(!ui)
+		ui = new(user, src, ui_key, "atmos_alert.tmpl", src.name, 500, 500)
+		ui.set_initial_data(data)
+		ui.open()
+		ui.set_auto_update(1)
 
 /obj/machinery/computer/atmos_alert/update_icon()
 	..()
 	if(stat & (NOPOWER|BROKEN))
 		return
-	if(priority_air_alarms.len)
+	var/list/alarms = atmosphere_alarm.major_alarms()
+	if(alarms.len)
 		icon_state = "alert:2"
-
-	else if(minor_air_alarms.len)
-		icon_state = "alert:1"
-
 	else
-		icon_state = "alert:0"
+		alarms = atmosphere_alarm.minor_alarms()
+		if(alarms.len)
+			icon_state = "alert:1"
+		else
+			icon_state = initial(icon_state)
 	return
 
-
-/obj/machinery/computer/atmos_alert/proc/return_text()
-	var/priority_text
-	var/minor_text
-
-	if(priority_air_alarms.len)
-		for(var/zone in priority_air_alarms)
-			priority_text += "<FONT color='red'><B>[zone]</B></FONT>  <A href='?src=\ref[src];priority_clear=[ckey(zone)]'>X</A><BR>"
-	else
-		priority_text = "No priority alerts detected.<BR>"
-
-	if(minor_air_alarms.len)
-		for(var/zone in minor_air_alarms)
-			minor_text += "<B>[zone]</B>  <A href='?src=\ref[src];minor_clear=[ckey(zone)]'>X</A><BR>"
-	else
-		minor_text = "No minor alerts detected.<BR>"
-
-	var/output = {"<B>[name]</B><HR>
-<B>Priority Alerts:</B><BR>
-[priority_text]
-<BR>
-<HR>
-<B>Minor Alerts:</B><BR>
-[minor_text]
-<BR>"}
-
-	return output
-
-
 /obj/machinery/computer/atmos_alert/Topic(href, href_list)
 	if(..())
-		return
+		return 1
 
-	if(href_list["priority_clear"])
-		var/removing_zone = href_list["priority_clear"]
-		for(var/zone in priority_air_alarms)
-			if(ckey(zone) == removing_zone)
-				priority_air_alarms -= zone
+	if(href_list["clear_alarm"])
+		var/datum/alarm/alarm = locate(href_list["clear_alarm"]) in atmosphere_alarm.alarms
+		if(alarm)
+			for(var/datum/alarm_source/alarm_source in alarm.sources)
+				var/obj/machinery/alarm/air_alarm = alarm_source.source
+				if(istype(air_alarm))
+					var/list/new_ref = list("atmos_reset" = 1)
+					air_alarm.Topic(href, new_ref, custom_state = atmos_alert_topic)
+		return 1
 
-	if(href_list["minor_clear"])
-		var/removing_zone = href_list["minor_clear"]
-		for(var/zone in minor_air_alarms)
-			if(ckey(zone) == removing_zone)
-				minor_air_alarms -= zone
-	update_icon()
-	return
+
+var/datum/topic_state/atmos_alert/atmos_alert_topic = new()
+
+/datum/topic_state/atmos_alert
+	flags = NANO_IGNORE_DISTANCE
+
+/datum/topic_state/air_alarm/href_list(var/mob/user)
+	var/list/extra_href = list()
+	extra_href["remote_connection"] = 1
+	extra_href["remote_access"] = 1
+
+	return extra_href

code/game/machinery/computer/camera.dm

@@ -3,6 +3,8 @@
 /proc/invalidateCameraCache()
 	for(var/obj/machinery/computer/security/s in world)
 		s.camera_cache = null
+	for(var/datum/alarm/A in world)
+		A.cameras = null
 
 /obj/machinery/computer/security
 	name = "security camera monitor"
@@ -43,33 +45,17 @@
 				if(!can_access_camera(C))
 					continue
 
-				var/cam[0]
-				cam["name"] = sanitize(C.c_tag)
-				cam["deact"] = !C.can_use()
-				cam["camera"] = "\ref[C]"
-				cam["x"] = C.x
-				cam["y"] = C.y
-				cam["z"] = C.z
-
+				var/cam = C.nano_structure()
 				cameras[++cameras.len] = cam
 
 				if(C == current)
 					data["current"] = cam
 
-				var/list/camera_list = list("cameras" = cameras)
-				camera_cache=list2json(camera_list)
-
+			var/list/camera_list = list("cameras" = cameras)
+			camera_cache=list2json(camera_list)
 		else
 			if(current)
-				var/cam[0]
-				cam["name"] = current.c_tag
-				cam["deact"] = !current.can_use()
-				cam["camera"] = "\ref[current]"
-				cam["x"] = current.x
-				cam["y"] = current.y
-				cam["z"] = current.z
-
-				data["current"] = cam
+				data["current"] = current.nano_structure()
 
 
 		if(ui)

code/game/machinery/computer/station_alert.dm

@@ -5,106 +5,42 @@
 	icon_state = "alert:0"
 	circuit = "/obj/item/weapon/circuitboard/stationalert"
 	var/alarms = list("Fire"=list(), "Atmosphere"=list(), "Power"=list())
+	var/obj/nano_module/alarm_monitor/engineering/alarm_monitor
 
+/obj/machinery/computer/station_alert/New()
+	..()
+	alarm_monitor = new(src)
+	alarm_monitor.register(src, /obj/machinery/computer/station_alert/update_icon)
 
-	attack_ai(mob/user)
-		add_fingerprint(user)
-		if(stat & (BROKEN|NOPOWER))
-			return
-		interact(user)
+/obj/machinery/computer/station_alert/Del()
+	alarm_monitor.unregister(src)
+	..()
+
+/obj/machinery/computer/station_alert/attack_ai(mob/user)
+	add_fingerprint(user)
+	if(stat & (BROKEN|NOPOWER))
+		return
+	interact(user)
+	return
+
+/obj/machinery/computer/station_alert/attack_hand(mob/user)
+	add_fingerprint(user)
+	if(stat & (BROKEN|NOPOWER))
+		return
+	interact(user)
+	return
+
+/obj/machinery/computer/station_alert/interact(mob/user)
+	alarm_monitor.ui_interact(user)
+
+/obj/machinery/computer/station_alert/update_icon()
+	..()
+	if(stat & (BROKEN|NOPOWER))
 		return
 
-
-	attack_hand(mob/user)
-		add_fingerprint(user)
-		if(stat & (BROKEN|NOPOWER))
-			return
-		interact(user)
-		return
-
-
-	interact(mob/user)
-		usr.set_machine(src)
-		var/dat = "<HEAD><TITLE>Current Station Alerts</TITLE><META HTTP-EQUIV='Refresh' CONTENT='10'></HEAD><BODY>\n"
-		dat += "<A HREF='?src=\ref[user];mach_close=alerts'>Close</A><br><br>"
-		for (var/cat in src.alarms)
-			dat += text("<B>[]</B><BR>\n", cat)
-			var/list/L = src.alarms[cat]
-			if (L.len)
-				for (var/alarm in L)
-					var/list/alm = L[alarm]
-					var/area/A = alm[1]
-					var/list/sources = alm[3]
-					dat += "<NOBR>"
-					dat += "&bull; "
-					dat += "[A.name]"
-					if (sources.len > 1)
-						dat += text(" - [] sources", sources.len)
-					dat += "</NOBR><BR>\n"
-			else
-				dat += "-- All Systems Nominal<BR>\n"
-			dat += "<BR>\n"
-		user << browse(dat, "window=alerts")
-		onclose(user, "alerts")
-
-
-	Topic(href, href_list)
-		if(..())
-			return
-		return
-
-
-	proc/triggerAlarm(var/class, area/A, var/O, var/alarmsource)
-		if(stat & (BROKEN))
-			return
-		var/list/L = src.alarms[class]
-		for (var/I in L)
-			if (I == A.name)
-				var/list/alarm = L[I]
-				var/list/sources = alarm[3]
-				if (!(alarmsource in sources))
-					sources += alarmsource
-				return 1
-		var/obj/machinery/camera/C = null
-		var/list/CL = null
-		if (O && istype(O, /list))
-			CL = O
-			if (CL.len == 1)
-				C = CL[1]
-		else if (O && istype(O, /obj/machinery/camera))
-			C = O
-		L[A.name] = list(A, (C) ? C : O, list(alarmsource))
-		return 1
-
-
-	proc/cancelAlarm(var/class, area/A as area, obj/origin)
-		if(stat & (BROKEN))
-			return
-		var/list/L = src.alarms[class]
-		var/cleared = 0
-		for (var/I in L)
-			if (I == A.name)
-				var/list/alarm = L[I]
-				var/list/srcs  = alarm[3]
-				if (origin in srcs)
-					srcs -= origin
-				if (srcs.len == 0)
-					cleared = 1
-					L -= I
-		return !cleared
-
-
-	process()
-		if(stat & (BROKEN|NOPOWER))
-			icon_state = "atmos0"
-			return
-		var/active_alarms = 0
-		for (var/cat in src.alarms)
-			var/list/L = src.alarms[cat]
-			if(L.len) active_alarms = 1
-		if(active_alarms)
-			icon_state = "alert:2"
-		else
-			icon_state = "alert:0"
-		..()
-		return
+	var/list/alarms = alarm_monitor.active_alarms()
+	if(alarms.len)
+		icon_state = "alert:2"
+	else
+		icon_state = initial(icon_state)
+	return

code/game/machinery/kitchen/juicer.dm

@@ -1,172 +0,0 @@
-
-/obj/machinery/juicer
-	name = "Juicer"
-	icon = 'icons/obj/kitchen.dmi'
-	icon_state = "juicer1"
-	layer = 2.9
-	density = 0
-	anchored = 0
-	use_power = 1
-	idle_power_usage = 5
-	active_power_usage = 100
-	var/obj/item/weapon/reagent_containers/beaker = null
-	var/global/list/allowed_items = list (
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato  = "tomatojuice",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot  = "carrotjuice",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/berries = "berryjuice",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/banana  = "banana",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/potato = "potato",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/lemon = "lemonjuice",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/orange = "orangejuice",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/lime = "limejuice",
-		/obj/item/weapon/reagent_containers/food/snacks/watermelonslice = "watermelonjuice",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/grapes = "grapejuice",
-		/obj/item/weapon/reagent_containers/food/snacks/grown/poisonberries = "poisonberryjuice",
-	)
-
-/obj/machinery/juicer/New()
-	beaker = new /obj/item/weapon/reagent_containers/glass/beaker/large(src)
-
-/obj/machinery/juicer/update_icon()
-	icon_state = "juicer"+num2text(!isnull(beaker))
-	return
-
-
-/obj/machinery/juicer/attackby(var/obj/item/O as obj, var/mob/user as mob)
-	if (istype(O,/obj/item/weapon/reagent_containers/glass) || \
-		istype(O,/obj/item/weapon/reagent_containers/food/drinks/drinkingglass))
-		if (beaker)
-			return 1
-		else
-			user.before_take_item(O)
-			O.loc = src
-			beaker = O
-			src.verbs += /obj/machinery/juicer/verb/detach
-			update_icon()
-			src.updateUsrDialog()
-			return 0
-	if (!is_type_in_list(O, allowed_items))
-		user << "It looks as not containing any juice."
-		return 1
-	user.before_take_item(O)
-	O.loc = src
-	src.updateUsrDialog()
-	return 0
-
-/obj/machinery/juicer/attack_ai(mob/user as mob)
-	return 0
-
-/obj/machinery/juicer/attack_hand(mob/user as mob)
-	user.set_machine(src)
-	interact(user)
-
-/obj/machinery/juicer/interact(mob/user as mob) // The microwave Menu
-	var/is_chamber_empty = 0
-	var/is_beaker_ready = 0
-	var/processing_chamber = ""
-	var/beaker_contents = ""
-
-	for (var/i in allowed_items)
-		for (var/obj/item/O in src.contents)
-			if (!istype(O,i))
-				continue
-			processing_chamber+= "some <B>[O]</B><BR>"
-			break
-	if (!processing_chamber)
-		is_chamber_empty = 1
-		processing_chamber = "Nothing."
-	if (!beaker)
-		beaker_contents = "\The [src] has no beaker attached."
-	else if (!beaker.reagents.total_volume)
-		beaker_contents = "\The [src]  has attached an empty beaker."
-		is_beaker_ready = 1
-	else if (beaker.reagents.total_volume < beaker.reagents.maximum_volume)
-		beaker_contents = "\The [src]  has attached a beaker with something."
-		is_beaker_ready = 1
-	else
-		beaker_contents = "\The [src]  has attached a beaker and beaker is full!"
-
-	var/dat = {"
-<b>Processing chamber contains:</b><br>
-[processing_chamber]<br>
-[beaker_contents]<hr>
-"}
-	if (is_beaker_ready && !is_chamber_empty && !(stat & (NOPOWER|BROKEN)))
-		dat += "<A href='?src=\ref[src];action=juice'>Turn on!<BR>"
-	if (beaker)
-		dat += "<A href='?src=\ref[src];action=detach'>Detach a beaker!<BR>"
-	user << browse("<HEAD><TITLE>Juicer</TITLE></HEAD><TT>[dat]</TT>", "window=juicer")
-	onclose(user, "juicer")
-	return
-
-
-/obj/machinery/juicer/Topic(href, href_list)
-	if(..())
-		return
-	usr.set_machine(src)
-	switch(href_list["action"])
-		if ("juice")
-			juice()
-
-		if ("detach")
-			detach()
-	src.updateUsrDialog()
-	return
-
-/obj/machinery/juicer/verb/detach()
-	set category = "Object"
-	set name = "Detach Beaker from the juicer"
-	set src in oview(1)
-	if (usr.stat != 0)
-		return
-	if (!beaker)
-		return
-	src.verbs -= /obj/machinery/juicer/verb/detach
-	beaker.loc = src.loc
-	beaker = null
-	update_icon()
-
-/obj/machinery/juicer/proc/get_juice_id(var/obj/item/weapon/reagent_containers/food/snacks/grown/O)
-	for (var/i in allowed_items)
-		if (istype(O, i))
-			return allowed_items[i]
-
-/obj/machinery/juicer/proc/get_juice_amount(var/obj/item/weapon/reagent_containers/food/snacks/grown/O)
-	if (!istype(O))
-		return 5
-	else if (O.potency == -1)
-		return 5
-	else
-		return round(5*sqrt(O.potency))
-
-/obj/machinery/juicer/proc/juice()
-	power_change() //it is a portable machine
-	if(stat & (NOPOWER|BROKEN))
-		return
-	if (!beaker || beaker.reagents.total_volume >= beaker.reagents.maximum_volume)
-		return
-	playsound(src.loc, 'sound/machines/juicer.ogg', 50, 1)
-	for (var/obj/item/weapon/reagent_containers/food/snacks/O in src.contents)
-		var/r_id = get_juice_id(O)
-		beaker.reagents.add_reagent(r_id,get_juice_amount(O))
-		del(O)
-		if (beaker.reagents.total_volume >= beaker.reagents.maximum_volume)
-			break
-
-/obj/structure/closet/crate/juice
-	New()
-		..()
-		new/obj/machinery/juicer(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/tomato(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/carrot(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/berries(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/banana(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/tomato(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/carrot(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/berries(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/banana(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/tomato(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/carrot(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/berries(src)
-		new/obj/item/weapon/reagent_containers/food/snacks/grown/banana(src)
-

code/game/machinery/kitchen/microwave.dm

@@ -42,11 +42,11 @@
 				acceptable_reagents |= reagent
 			if (recipe.items)
 				max_n_of_items = max(max_n_of_items,recipe.items.len)
-
 		// This will do until I can think of a fun recipe to use dionaea in -
 		// will also allow anything using the holder item to be microwaved into
 		// impure carbon. ~Z
 		acceptable_items |= /obj/item/weapon/holder
+		acceptable_items |= /obj/item/weapon/reagent_containers/food/snacks/grown
 
 /*******************
 *   Item Adding
@@ -274,7 +274,7 @@
 			cooked.loc = src.loc
 		return
 
-/obj/machinery/microwave/proc/wzhzhzh(var/seconds as num)
+/obj/machinery/microwave/proc/wzhzhzh(var/seconds as num) // Whoever named this proc is fucking literally Satan. ~ Z
 	for (var/i=1 to seconds)
 		if (stat & (NOPOWER|BROKEN))
 			return 0

code/game/machinery/kitchen/processor.dm

@@ -1,148 +0,0 @@
-/obj/machinery/processor
-	name = "Food Processor"
-	icon = 'icons/obj/kitchen.dmi'
-	icon_state = "processor"
-	layer = 2.9
-	density = 1
-	anchored = 1
-	var/broken = 0
-	var/processing = 0
-	use_power = 1
-	idle_power_usage = 5
-	active_power_usage = 50
-
-
-
-/datum/food_processor_process
-	var/input
-	var/output
-	var/time = 40
-	proc/process(loc, what)
-		if (src.output && loc)
-			new src.output(loc)
-		if (what)
-			del(what)
-
-	/* objs */
-	meat
-		input = /obj/item/weapon/reagent_containers/food/snacks/meat
-		output = /obj/item/weapon/reagent_containers/food/snacks/meatball
-
-	potato
-		input = /obj/item/weapon/reagent_containers/food/snacks/grown/potato
-		output = /obj/item/weapon/reagent_containers/food/snacks/rawsticks
-
-	carrot
-		input = /obj/item/weapon/reagent_containers/food/snacks/grown/carrot
-		output = /obj/item/weapon/reagent_containers/food/snacks/carrotfries
-
-	soybeans
-		input = /obj/item/weapon/reagent_containers/food/snacks/grown/soybeans
-		output = /obj/item/weapon/reagent_containers/food/snacks/soydope
-
-	wheat
-		input = /obj/item/weapon/reagent_containers/food/snacks/grown/wheat
-		output = /obj/item/weapon/reagent_containers/food/snacks/flour
-
-	spaghetti
-		input = /obj/item/weapon/reagent_containers/food/snacks/flour
-		output = /obj/item/weapon/reagent_containers/food/snacks/spagetti
-
-	/* mobs */
-	mob
-		process(loc, what)
-			..()
-
-
-		slime
-			input = /mob/living/carbon/slime
-			output = /obj/item/weapon/reagent_containers/glass/beaker/slime
-
-		monkey
-			process(loc, what)
-				var/mob/living/carbon/monkey/O = what
-				if (O.client) //grief-proof
-					O.loc = loc
-					O.visible_message("\blue Suddenly [O] jumps out from the processor!", \
-							"You jump out from the processor", \
-							"You hear chimp")
-					return
-				var/obj/item/weapon/reagent_containers/glass/bucket/bucket_of_blood = new(loc)
-				var/datum/reagent/blood/B = new()
-				B.holder = bucket_of_blood
-				B.volume = 70
-				//set reagent data
-				B.data["donor"] = O
-
-				for(var/datum/disease/D in O.viruses)
-					if(D.spread_type != SPECIAL)
-						B.data["viruses"] += D.Copy()
-
-				B.data["blood_DNA"] = copytext(O.dna.unique_enzymes,1,0)
-				if(O.resistances&&O.resistances.len)
-					B.data["resistances"] = O.resistances.Copy()
-				bucket_of_blood.reagents.reagent_list += B
-				bucket_of_blood.reagents.update_total()
-				bucket_of_blood.on_reagent_change()
-				//bucket_of_blood.reagents.handle_reactions() //blood doesn't react
-				..()
-
-			input = /mob/living/carbon/monkey
-			output = null
-
-/obj/machinery/processor/proc/select_recipe(var/X)
-	for (var/Type in typesof(/datum/food_processor_process) - /datum/food_processor_process - /datum/food_processor_process/mob)
-		var/datum/food_processor_process/P = new Type()
-		if (!istype(X, P.input))
-			continue
-		return P
-	return 0
-
-/obj/machinery/processor/attackby(var/obj/item/O as obj, var/mob/user as mob)
-	if(src.processing)
-		user << "\red The processor is in the process of processing."
-		return 1
-	if(src.contents.len > 0) //TODO: several items at once? several different items?
-		user << "\red Something is already in the processing chamber."
-		return 1
-	var/what = O
-	if (istype(O, /obj/item/weapon/grab))
-		var/obj/item/weapon/grab/G = O
-		what = G.affecting
-
-	var/datum/food_processor_process/P = select_recipe(what)
-	if (!P)
-		user << "\red That probably won't blend."
-		return 1
-	user.visible_message("[user] put [what] into [src].", \
-		"You put the [what] into [src].")
-	user.drop_item()
-	what:loc = src
-	return
-
-/obj/machinery/processor/attack_hand(var/mob/user as mob)
-	if (src.stat != 0) //NOPOWER etc
-		return
-	if(src.processing)
-		user << "\red The processor is in the process of processing."
-		return 1
-	if(src.contents.len == 0)
-		user << "\red The processor is empty."
-		return 1
-	for(var/O in src.contents)
-		var/datum/food_processor_process/P = select_recipe(O)
-		if (!P)
-			log_admin("DEBUG: [O] in processor havent suitable recipe. How do you put it in?") //-rastaf0
-			continue
-		src.processing = 1
-		user.visible_message("\blue [user] turns on \a [src].", \
-			"You turn on \a [src].", \
-			"You hear a food processor.")
-		playsound(src.loc, 'sound/machines/blender.ogg', 50, 1)
-		use_power(500)
-		sleep(P.time)
-		P.process(src.loc, O)
-		src.processing = 0
-	src.visible_message("\blue \the [src] finished processing.", \
-		"You hear the food processor stopping/")
-

code/game/machinery/seed_extractor.dm

@@ -1,7 +1,7 @@
 /obj/machinery/seed_extractor
 	name = "seed extractor"
 	desc = "Extracts and bags seeds from produce."
-	icon = 'icons/obj/hydroponics.dmi'
+	icon = 'icons/obj/hydroponics_machines.dmi'
 	icon_state = "sextractor"
 	density = 1
 	anchored = 1
@@ -16,10 +16,10 @@ obj/machinery/seed_extractor/attackby(var/obj/item/O as obj, var/mob/user as mob
 		var/datum/seed/new_seed_type
 		if(istype(O, /obj/item/weapon/grown))
 			var/obj/item/weapon/grown/F = O
-			new_seed_type = seed_types[F.plantname]
+			new_seed_type = plant_controller.seeds[F.plantname]
 		else
 			var/obj/item/weapon/reagent_containers/food/snacks/grown/F = O
-			new_seed_type = seed_types[F.plantname]
+			new_seed_type = plant_controller.seeds[F.plantname]
 
 		if(new_seed_type)
 			user << "<span class='notice'>You extract some seeds from [O].</span>"

code/game/objects/effects/biomass_rift.dm

@@ -1,126 +0,0 @@
-/*
-/obj/effect/biomass
-	icon = 'icons/obj/biomass.dmi'
-	icon_state = "stage1"
-	opacity = 0
-	density = 0
-	anchored = 1
-	layer = 20 //DEBUG
-	var/health = 10
-	var/stage = 1
-	var/obj/effect/rift/originalRift = null //the originating rift of that biomass
-	var/maxDistance = 15 //the maximum length of a thread
-	var/newSpreadDistance = 10 //the length of a thread at which new ones are created
-	var/curDistance = 1 //the current length of a thread
-	var/continueChance = 3 //weighed chance of continuing in the same direction. turning left or right has 1 weight both
-	var/spreadDelay = 1 //will change to something bigger later, but right now I want it to spread as fast as possible for testing
-
-/obj/effect/rift
-	icon = 'icons/obj/biomass.dmi'
-	icon_state = "rift"
-	var/list/obj/effect/biomass/linkedBiomass = list() //all the biomass patches that have spread from it
-	var/newicon = 1 //DEBUG
-
-/obj/effect/rift/New()
-	set background = 1
-
-	..()
-
-	for(var/turf/T in orange(1,src))
-		if(!IsValidBiomassLoc(T))
-			continue
-		var/obj/effect/biomass/starting = new /obj/effect/biomass(T)
-		starting.set_dir(get_dir(src,starting))
-		starting.originalRift = src
-		linkedBiomass += starting
-		spawn(1) //DEBUG
-			starting.icon_state = "[newicon]"
-
-/obj/effect/rift/Del()
-	for(var/obj/effect/biomass/biomass in linkedBiomass)
-		del(biomass)
-	..()
-
-/obj/effect/biomass/New()
-	set background = 1
-
-	..()
-	if(!IsValidBiomassLoc(loc,src))
-		del(src)
-		return
-	spawn(1) //so that the dir and stuff can be set by the source first
-		if(curDistance >= maxDistance)
-			return
-		switch(dir)
-			if(NORTHWEST)
-				set_dir(NORTH)
-			if(NORTHEAST)
-				set_dir(EAST)
-			if(SOUTHWEST)
-				set_dir(WEST)
-			if(SOUTHEAST)
-				set_dir(SOUTH)
-		sleep(spreadDelay)
-		Spread()
-
-/obj/effect/biomass/proc/Spread(var/direction = dir)
-	set background = 1
-	var/possibleDirsInt = 0
-
-	for(var/newDirection in cardinal)
-		if(newDirection == turn(direction,180)) //can't go backwards
-			continue
-		var/turf/T = get_step(loc,newDirection)
-		if(!IsValidBiomassLoc(T,src))
-			continue
-		possibleDirsInt |= newDirection
-
-	var/list/possibleDirs = list()
-
-	if(possibleDirsInt & direction)
-		for(var/i=0 , i<continueChance , i++)
-			possibleDirs += direction
-	if(possibleDirsInt & turn(direction,90))
-		possibleDirs += turn(direction,90)
-	if(possibleDirsInt & turn(direction,-90))
-		possibleDirs += turn(direction,-90)
-
-	if(!possibleDirs.len)
-		return
-
-	direction = pick(possibleDirs)
-
-	var/obj/effect/biomass/newBiomass = new /obj/effect/biomass(get_step(src,direction))
-	newBiomass.curDistance = curDistance + 1
-	newBiomass.maxDistance = maxDistance
-	newBiomass.set_dir(direction)
-	newBiomass.originalRift = originalRift
-	newBiomass.icon_state = "[originalRift.newicon]" //DEBUG
-	originalRift.linkedBiomass += newBiomass
-
-	if(!(curDistance%newSpreadDistance))
-		var/obj/effect/rift/newrift = new /obj/effect/rift(loc)
-		if(originalRift.newicon <= 3)
-			newrift.newicon = originalRift.newicon + 1
-//		NewSpread()
-
-/obj/effect/biomass/proc/NewSpread(maxDistance = 15)
-	set background = 1
-	for(var/turf/T in orange(1,src))
-		if(!IsValidBiomassLoc(T,src))
-			continue
-		var/obj/effect/biomass/starting = new /obj/effect/biomass(T)
-		starting.set_dir(get_dir(src,starting))
-		starting.maxDistance = maxDistance
-
-/proc/IsValidBiomassLoc(turf/location,obj/effect/biomass/source = null)
-	set background = 1
-	for(var/obj/effect/biomass/biomass in location)
-		if(biomass != source)
-			return 0
-	if(istype(location,/turf/space))
-		return 0
-	if(location.density)
-		return 0
-	return 1
-*/

code/game/objects/effects/chemsmoke.dm

@@ -21,7 +21,18 @@
 	var/list/targetTurfs
 	var/list/wallList
 	var/density
+	var/show_log = 1
 
+/datum/effect/effect/system/smoke_spread/chem/spores
+	show_log = 0
+	var/datum/seed/seed
+
+/datum/effect/effect/system/smoke_spread/chem/spores/New(seed_name)
+	if(seed_name && plant_controller)
+		seed = plant_controller.seeds[seed_name]
+	if(!seed)
+		del(src)
+	..()
 
 /datum/effect/effect/system/smoke_spread/chem/New()
 	..()
@@ -78,16 +89,17 @@
 	var/where = "[A.name] | [location.x], [location.y]"
 	var/whereLink = "<A HREF='?_src_=holder;adminplayerobservecoodjump=1;X=[location.x];Y=[location.y];Z=[location.z]'>[where]</a>"
 
-	if(carry.my_atom.fingerprintslast)
-		var/mob/M = get_mob_by_key(carry.my_atom.fingerprintslast)
-		var/more = ""
-		if(M)
-			more = "(<A HREF='?_src_=holder;adminmoreinfo=\ref[M]'>?</a>)"
-		message_admins("A chemical smoke reaction has taken place in ([whereLink])[contained]. Last associated key is [carry.my_atom.fingerprintslast][more].", 0, 1)
-		log_game("A chemical smoke reaction has taken place in ([where])[contained]. Last associated key is [carry.my_atom.fingerprintslast].")
-	else
-		message_admins("A chemical smoke reaction has taken place in ([whereLink]). No associated key.", 0, 1)
-		log_game("A chemical smoke reaction has taken place in ([where])[contained]. No associated key.")
+	if(show_log)
+		if(carry.my_atom.fingerprintslast)
+			var/mob/M = get_mob_by_key(carry.my_atom.fingerprintslast)
+			var/more = ""
+			if(M)
+				more = "(<A HREF='?_src_=holder;adminmoreinfo=\ref[M]'>?</a>)"
+			message_admins("A chemical smoke reaction has taken place in ([whereLink])[contained]. Last associated key is [carry.my_atom.fingerprintslast][more].", 0, 1)
+			log_game("A chemical smoke reaction has taken place in ([where])[contained]. Last associated key is [carry.my_atom.fingerprintslast].")
+		else
+			message_admins("A chemical smoke reaction has taken place in ([whereLink]). No associated key.", 0, 1)
+			log_game("A chemical smoke reaction has taken place in ([where])[contained]. No associated key.")
 
 
 //------------------------------------------
@@ -186,8 +198,14 @@
 // Randomizes and spawns the smoke effect.
 // Also handles deleting the smoke once the effect is finished.
 //------------------------------------------
-/datum/effect/effect/system/smoke_spread/chem/proc/spawnSmoke(var/turf/T, var/icon/I, var/dist = 1)
-	var/obj/effect/effect/smoke/chem/smoke = new(location)
+/datum/effect/effect/system/smoke_spread/chem/proc/spawnSmoke(var/turf/T, var/icon/I, var/dist = 1, var/obj/effect/effect/smoke/chem/passed_smoke)
+
+	var/obj/effect/effect/smoke/chem/smoke
+	if(passed_smoke)
+		smoke = passed_smoke
+	else
+		smoke = new(location)
+
 	if(chemholder.reagents.reagent_list.len)
 		chemholder.reagents.copy_to(smoke, chemholder.reagents.total_volume / dist, safety = 1)	//copy reagents to the smoke so mob/breathe() can handle inhaling the reagents
 	smoke.icon = I
@@ -202,6 +220,11 @@
 	fadeOut(smoke)
 	smoke.delete()
 
+/datum/effect/effect/system/smoke_spread/chem/spores/spawnSmoke(var/turf/T, var/icon/I, var/dist = 1)
+	var/obj/effect/effect/smoke/chem/spores = new(location)
+	spores.name = "cloud of [seed.seed_name] [seed.seed_noun]"
+	..(T, I, dist, spores)
+
 //------------------------------------------
 // Fades out the smoke smoothly using it's alpha variable.
 //------------------------------------------

code/game/objects/effects/decals/Cleanable/humans.dm

@@ -42,7 +42,7 @@ var/global/list/image/splatter_cache=list()
 		dry()
 
 /obj/effect/decal/cleanable/blood/update_icon()
-	if(basecolor == "rainbow") basecolor = "#[pick(list("FF0000","FF7F00","FFFF00","00FF00","0000FF","4B0082","8F00FF"))]"
+	if(basecolor == "rainbow") basecolor = "#[get_random_colour(1)]"
 	color = basecolor
 
 /obj/effect/decal/cleanable/blood/Crossed(mob/living/carbon/human/perp)
@@ -165,11 +165,11 @@ var/global/list/image/splatter_cache=list()
 
 	var/image/giblets = new(base_icon, "[icon_state]_flesh", dir)
 	if(!fleshcolor || fleshcolor == "rainbow")
-		fleshcolor = "#[pick(list("FF0000","FF7F00","FFFF00","00FF00","0000FF","4B0082","8F00FF"))]"
+		fleshcolor = "#[get_random_colour(1)]"
 	giblets.color = fleshcolor
 
 	var/icon/blood = new(base_icon,"[icon_state]",dir)
-	if(basecolor == "rainbow") basecolor = "#[pick(list("FF0000","FF7F00","FFFF00","00FF00","0000FF","4B0082","8F00FF"))]"
+	if(basecolor == "rainbow") basecolor = "#[get_random_colour(1)]"
 	blood.Blend(basecolor,ICON_MULTIPLY)
 
 	icon = blood

code/game/objects/effects/decals/Cleanable/misc.dm

@@ -133,3 +133,13 @@
 	layer = 2
 	icon = 'icons/effects/tomatodecal.dmi'
 	random_icon_states = list("smashed_pie")
+
+/obj/effect/decal/cleanable/fruit_smudge
+	name = "smudge"
+	desc = "Some kind of fruit smear."
+	density = 0
+	anchored = 1
+	layer = 2
+	icon = 'icons/effects/blood.dmi'
+	icon_state = "mfloor1"
+	random_icon_states = list("mfloor1", "mfloor2", "mfloor3", "mfloor4", "mfloor5", "mfloor6", "mfloor7")

code/game/objects/effects/decals/remains.dm

@@ -17,6 +17,14 @@
 	icon = 'icons/mob/robots.dmi'
 	icon_state = "remainsrobot"
 
+/obj/effect/decal/remains/mouse
+	desc = "They look like the remains of a small rodent."
+	icon_state = "mouse"
+
+/obj/effect/decal/remains/lizard
+	desc = "They look like the remains of a small rodent."
+	icon_state = "lizard"
+
 /obj/effect/decal/remains/attack_hand(mob/user as mob)
 	user << "<span class='notice'>[src] sinks together into a pile of ash.</span>"
 	var/turf/simulated/floor/F = get_turf(src)

code/game/objects/effects/glowshroom.dm

@@ -1,166 +0,0 @@
-//separate dm since hydro is getting bloated already
-
-/obj/effect/glowshroom
-	name = "glowshroom"
-	anchored = 1
-	opacity = 0
-	density = 0
-	icon = 'icons/obj/lighting.dmi'
-	icon_state = "glowshroomf"
-	layer = 2.1
-	l_color = "#003300"
-
-	var/endurance = 30
-	var/potency = 30
-	var/delay = 1200
-	var/floor = 0
-	var/yield = 3
-	var/spreadChance = 40
-	var/spreadIntoAdjacentChance = 60
-	var/evolveChance = 2
-	var/lastTick = 0
-	var/spreaded = 1
-
-/obj/effect/glowshroom/single
-	spreadChance = 0
-
-/obj/effect/glowshroom/New()
-
-	..()
-
-	set_dir(CalcDir())
-
-	if(!floor)
-		switch(dir) //offset to make it be on the wall rather than on the floor
-			if(NORTH)
-				pixel_y = 32
-			if(SOUTH)
-				pixel_y = -32
-			if(EAST)
-				pixel_x = 32
-			if(WEST)
-				pixel_x = -32
-		icon_state = "glowshroom[rand(1,3)]"
-	else //if on the floor, glowshroom on-floor sprite
-		icon_state = "glowshroomf"
-
-	processing_objects += src
-
-	SetLuminosity(round(potency/15))
-	lastTick = world.timeofday
-
-/obj/effect/glowshroom/Del()
-	processing_objects -= src
-	..()
-
-/obj/effect/glowshroom/process()
-	if(!spreaded)
-		return
-
-	if(((world.timeofday - lastTick) > delay) || ((world.timeofday - lastTick) < 0))
-		lastTick = world.timeofday
-		spreaded = 0
-
-		for(var/i=1,i<=yield,i++)
-			if(prob(spreadChance))
-				var/list/possibleLocs = list()
-				var/spreadsIntoAdjacent = 0
-
-				if(prob(spreadIntoAdjacentChance))
-					spreadsIntoAdjacent = 1
-
-				for(var/turf/simulated/floor/plating/airless/asteroid/earth in view(3,src))
-					if(spreadsIntoAdjacent || !locate(/obj/effect/glowshroom) in view(1,earth))
-						possibleLocs += earth
-
-				if(!possibleLocs.len)
-					break
-
-				var/turf/newLoc = pick(possibleLocs)
-
-				var/shroomCount = 0 //hacky
-				var/placeCount = 1
-				for(var/obj/effect/glowshroom/shroom in newLoc)
-					shroomCount++
-				for(var/wallDir in cardinal)
-					var/turf/isWall = get_step(newLoc,wallDir)
-					if(isWall.density)
-						placeCount++
-				if(shroomCount >= placeCount)
-					continue
-
-				var/obj/effect/glowshroom/child = new /obj/effect/glowshroom(newLoc)
-				child.potency = potency
-				child.yield = yield
-				child.delay = delay
-				child.endurance = endurance
-
-				spreaded++
-
-		if(prob(evolveChance)) //very low chance to evolve on its own
-			potency += rand(4,6)
-
-/obj/effect/glowshroom/proc/CalcDir(turf/location = loc)
-	set background = 1
-	var/direction = 16
-
-	for(var/wallDir in cardinal)
-		var/turf/newTurf = get_step(location,wallDir)
-		if(newTurf.density)
-			direction |= wallDir
-
-	for(var/obj/effect/glowshroom/shroom in location)
-		if(shroom == src)
-			continue
-		if(shroom.floor) //special
-			direction &= ~16
-		else
-			direction &= ~shroom.dir
-
-	var/list/dirList = list()
-
-	for(var/i=1,i<=16,i <<= 1)
-		if(direction & i)
-			dirList += i
-
-	if(dirList.len)
-		var/newDir = pick(dirList)
-		if(newDir == 16)
-			floor = 1
-			newDir = 1
-		return newDir
-
-	floor = 1
-	return 1
-
-/obj/effect/glowshroom/attackby(obj/item/weapon/W as obj, mob/user as mob)
-	..()
-
-	endurance -= W.force
-
-	CheckEndurance()
-
-/obj/effect/glowshroom/ex_act(severity)
-	switch(severity)
-		if(1.0)
-			del(src)
-			return
-		if(2.0)
-			if (prob(50))
-				del(src)
-				return
-		if(3.0)
-			if (prob(5))
-				del(src)
-				return
-		else
-	return
-
-/obj/effect/glowshroom/fire_act(datum/gas_mixture/air, exposed_temperature, exposed_volume)
-	if(exposed_temperature > 300)
-		endurance -= 5
-		CheckEndurance()
-
-/obj/effect/glowshroom/proc/CheckEndurance()
-	if(endurance <= 0)
-		del(src)

code/game/objects/items.dm

@@ -198,11 +198,7 @@
 // apparently called whenever an item is removed from a slot, container, or anything else.
 /obj/item/proc/dropped(mob/user as mob)
 	..()
-	if(zoom) //binoculars, scope, etc
-		user.client.view = world.view
-		user.client.pixel_x = 0
-		user.client.pixel_y = 0
-		zoom = 0
+	if(zoom) zoom() //binoculars, scope, etc
 
 // called just as an item is picked up (loc is not yet changed)
 /obj/item/proc/pickup(mob/user)
@@ -660,9 +656,8 @@ modules/mob/living/carbon/human/life.dm if you die, you will be zoomed out.
 		cannotzoom = 1
 
 	if(!zoom && !cannotzoom)
-		if(!usr.hud_used.hud_shown)
-			usr.button_pressed_F12(1)	// If the user has already limited their HUD this avoids them having a HUD when they zoom in
-		usr.button_pressed_F12(1)
+		if(usr.hud_used.hud_shown)
+			usr.toggle_zoom_hud()	// If the user has already limited their HUD this avoids them having a HUD when they zoom in
 		usr.client.view = viewsize
 		zoom = 1
 
@@ -688,7 +683,7 @@ modules/mob/living/carbon/human/life.dm if you die, you will be zoomed out.
 	else
 		usr.client.view = world.view
 		if(!usr.hud_used.hud_shown)
-			usr.button_pressed_F12(1)
+			usr.toggle_zoom_hud()
 		zoom = 0
 
 		usr.client.pixel_x = 0

code/game/objects/items/contraband.dm

@@ -28,3 +28,30 @@
 	new /obj/item/weapon/reagent_containers/pill/zoom( src )
 	new /obj/item/weapon/reagent_containers/pill/zoom( src )
 	new /obj/item/weapon/reagent_containers/pill/zoom( src )
+
+/obj/item/weapon/reagent_containers/glass/beaker/vial/random
+	flags = 0
+	var/list/random_reagent_list = list(list("water" = 15) = 1, list("cleaner" = 15) = 1)
+
+/obj/item/weapon/reagent_containers/glass/beaker/vial/random/toxin
+	random_reagent_list = list(
+		list("mindbreaker" = 10, "space_drugs" = 20)	= 3,
+		list("carpotoxin" = 15)							= 2,
+		list("impedrezene" = 15)						= 2,
+		list("zombiepowder" = 10)						= 1)
+
+/obj/item/weapon/reagent_containers/glass/beaker/vial/random/New()
+	..()
+	if(is_open_container())
+		flags ^= OPENCONTAINER
+
+	var/list/picked_reagents = pickweight(random_reagent_list)
+	for(var/reagent in picked_reagents)
+		reagents.add_reagent(reagent, picked_reagents[reagent])
+
+	var/list/names = new
+	for(var/datum/reagent/R in reagents.reagent_list)
+		names += R.name
+
+	desc = "Contains [english_list(names)]."
+	update_icon()

code/game/objects/items/devices/scanners.dm

@@ -4,7 +4,6 @@ T-RAY
 DETECTIVE SCANNER
 HEALTH ANALYZER
 GAS ANALYZER
-PLANT ANALYZER
 MASS SPECTROMETER
 REAGENT SCANNER
 */

code/game/objects/items/devices/uplinks.dm

@@ -27,6 +27,15 @@ datum/uplink_item/proc/description()
 		description = replacetext(initial(temp.desc), "\n", "<br>")
 	return description
 
+/datum/uplink_item/proc/generate_item(var/newloc)
+	var/list/L = list()
+	if(ispath(path))
+		L += new path(newloc)
+	else if(islist(path))
+		for(var/item_path in path)
+			L += new item_path(newloc)
+	return L
+
 datum/nano_item_lists
 	var/list/items_nano
 	var/list/items_reference
@@ -136,10 +145,11 @@ datum/nano_item_lists
 		used_TC += UI.cost
 		feedback_add_details("traitor_uplink_items_bought", reference)
 
-		var/obj/I = new UI.path(get_turf(usr))
+		var/list/L = UI.generate_item(get_turf(usr))
 		if(ishuman(usr))
 			var/mob/living/carbon/human/A = usr
-			A.put_in_any_hand_if_possible(I)
+			for(var/obj/I in L)
+				A.put_in_any_hand_if_possible(I)
 
 		purchase_log[UI] = purchase_log[UI] + 1
 

code/game/objects/items/stacks/medical.dm

@@ -127,7 +127,7 @@
 	name = "\improper S'rendarr's Hand leaf"
 	singular_name = "S'rendarr's Hand leaf"
 	desc = "A poultice made of soft leaves that is rubbed on bruises."
-	icon = 'icons/obj/harvest.dmi'
+	//icon = 'icons/obj/harvest.dmi'
 	icon_state = "shandp"
 	heal_brute = 7
 
@@ -135,7 +135,7 @@
 	name = "\improper Messa's Tear petals"
 	singular_name = "Messa's Tear petals"
 	desc = "A poultice made of cold, blue petals that is rubbed on burns."
-	icon = 'icons/obj/harvest.dmi'
+	//icon = 'icons/obj/harvest.dmi'
 	icon_state = "mtearp"
 	heal_burn = 7
 

code/game/objects/items/toys.dm

@@ -440,7 +440,7 @@
 /obj/item/toy/waterflower
 	name = "water flower"
 	desc = "A seemingly innocent sunflower...with a twist."
-	icon = 'icons/obj/harvest.dmi'
+	//icon = 'icons/obj/harvest.dmi'
 	icon_state = "sunflower"
 	item_state = "sunflower"
 	var/empty = 0

code/game/objects/items/weapons/hydroponics.dm

@@ -4,7 +4,7 @@
 //uncomment when this is updated to match storage update
 /*
 /obj/item/weapon/seedbag
-	icon = 'icons/obj/hydroponics.dmi'
+	icon = 'icons/obj/hydroponics_machines.dmi'
 	icon_state = "seedbag"
 	name = "Seed Bag"
 	desc = "A small satchel made for organizing seeds."

code/game/objects/items/weapons/storage/bags.dm

@@ -88,7 +88,7 @@
 
 /obj/item/weapon/storage/bag/plants
 	name = "plant bag"
-	icon = 'icons/obj/hydroponics.dmi'
+	icon = 'icons/obj/hydroponics_machines.dmi'
 	icon_state = "plantbag"
 	storage_slots = 50; //the number of plant pieces it can carry.
 	max_combined_w_class = 200 //Doesn't matter what this is, so long as it's more or equal to storage_slots * plants.w_class

code/game/objects/items/weapons/storage/boxes.dm

@@ -219,8 +219,8 @@
 		new /obj/item/ammo_casing/shotgun/stunshell(src)
 		new /obj/item/ammo_casing/shotgun/stunshell(src)
 
-/obj/item/weapon/storage/box/heavysniperammo
-	name = "box of 14.5mm AP shells"
+/obj/item/weapon/storage/box/sniperammo
+	name = "box of 14.5mm shells"
 	desc = "It has a picture of a gun and several warning symbols on the front.<br>WARNING: Live ammunition. Misuse may result in serious injury or death."
 
 	New()

code/game/objects/items/weapons/storage/firstaid.dm

@@ -128,6 +128,22 @@
 	new /obj/item/stack/medical/splint(src)
 	return
 
+/obj/item/weapon/storage/firstaid/surgery
+	name = "surgery kit"
+	desc = "Contains tools for surgery."
+
+/obj/item/weapon/storage/firstaid/surgery/New()
+	..()
+	if (empty) return
+	new /obj/item/weapon/bonesetter(src)
+	new /obj/item/weapon/cautery(src)
+	new /obj/item/weapon/circular_saw(src)
+	new /obj/item/weapon/hemostat(src)
+	new /obj/item/weapon/retractor(src)
+	new /obj/item/weapon/scalpel(src)
+	new /obj/item/weapon/surgicaldrill(src)
+	return
+
 /*
  * Pill Bottles
  */

code/game/objects/items/weapons/storage/uplink_kits.dm

@@ -30,6 +30,7 @@
 				new /obj/item/ammo_magazine/a357(src)
 				new /obj/item/weapon/card/emag(src)
 				new /obj/item/weapon/plastique(src)
+				new /obj/item/weapon/plastique(src)
 				return
 
 			if("murder")
@@ -47,6 +48,7 @@
 				return
 
 			if("hacker")
+				new /obj/item/device/encryptionkey/syndicate(src)
 				new /obj/item/weapon/aiModule/syndicate(src)
 				new /obj/item/weapon/card/emag(src)
 				new /obj/item/device/encryptionkey/binary(src)
@@ -62,10 +64,9 @@
 				return
 
 			if("smoothoperator")
-				new /obj/item/weapon/gun/projectile/pistol(src)
-				new /obj/item/weapon/silencer(src)
-				new /obj/item/weapon/soap/syndie(src)
+				new /obj/item/weapon/storage/box/syndie_kit/g9mm(src)
 				new /obj/item/weapon/storage/bag/trash(src)
+				new /obj/item/weapon/soap/syndie(src)
 				new /obj/item/bodybag(src)
 				new /obj/item/clothing/under/suit_jacket(src)
 				new /obj/item/clothing/shoes/laceup(src)
@@ -176,6 +177,15 @@
 	new /obj/item/weapon/gun/projectile/pistol(src)
 	new /obj/item/weapon/silencer(src)
 
+/obj/item/weapon/storage/box/syndie_kit/toxin
+	name = "toxin kit"
+	desc = "An apple will not be enough to keep the doctor away after this."
+
+/obj/item/weapon/storage/box/syndie_kit/toxin/New()
+	..()
+	new /obj/item/weapon/reagent_containers/glass/beaker/vial/random/toxin(src)
+	new /obj/item/weapon/reagent_containers/syringe(src)
+
 /obj/item/weapon/storage/box/syndie_kit/cigarette
 	name = "\improper Tricky smokes"
 	desc = "Comes with the following brands of cigarettes, in this order: 2xFlash, 2xSmoke, 1xMindBreaker, 1xTricordrazine. Avoid mixing them up."
@@ -217,3 +227,11 @@
 	for(var/reagent in reagents)
 		C.reagents.add_reagent(reagent, reagents[reagent] * C.storage_slots)
 
+/obj/item/weapon/storage/box/syndie_kit/ewar_voice
+	name = "Electrowarfare and Voice Synthesiser kit"
+	desc = "Kit for confounding organic and synthetic entities alike."
+
+/obj/item/weapon/storage/box/syndie_kit/ewar_voice/New()
+	..()
+	new /obj/item/rig_module/electrowarfare_suite(src)
+	new /obj/item/rig_module/voice(src)

code/game/smoothwall.dm

@@ -109,10 +109,10 @@
 			W.relativewall()
 
 	for(var/direction in cardinal)
-		for(var/obj/effect/glowshroom/shroom in get_step(src,direction))
+		for(var/obj/effect/plant/shroom in get_step(src,direction))
 			if(!shroom.floor) //shrooms drop to the floor
 				shroom.floor = 1
-				shroom.icon_state = "glowshroomf"
+				shroom.update_icon()
 				shroom.pixel_x = 0
 				shroom.pixel_y = 0
 

code/game/turfs/simulated.dm

@@ -25,11 +25,17 @@
 		usr << "\red Movement is admin-disabled." //This is to identify lag problems
 		return
 
-	if (istype(A,/mob/living/carbon))
-		var/mob/living/carbon/M = A
+	if (istype(A,/mob/living))
+		var/mob/living/M = A
 		if(M.lying)
 			..()
 			return
+
+		// Ugly hack :( Should never have multiple plants in the same tile.
+		var/obj/effect/plant/plant = locate() in contents
+		if(plant) plant.trodden_on(M)
+
+		// Dirt overlays.
 		dirt++
 		var/obj/effect/decal/cleanable/dirt/dirtoverlay = locate(/obj/effect/decal/cleanable/dirt, src)
 		if (dirt >= 50)
@@ -41,30 +47,21 @@
 
 		if(istype(M, /mob/living/carbon/human))
 			var/mob/living/carbon/human/H = M
-			if(istype(H.shoes, /obj/item/clothing/shoes/clown_shoes))
-				var/obj/item/clothing/shoes/clown_shoes/O = H.shoes
-				if(H.m_intent == "run")
-					if(O.footstep >= 2)
-						O.footstep = 0
-						playsound(src, "clownstep", 50, 1) // this will get annoying very fast.
-					else
-						O.footstep++
-				else
-					playsound(src, "clownstep", 20, 1)
-
 			// Tracking blood
 			var/list/bloodDNA = null
 			var/bloodcolor=""
 			if(H.shoes)
 				var/obj/item/clothing/shoes/S = H.shoes
-				if(S.track_blood && S.blood_DNA)
-					bloodDNA = S.blood_DNA
-					bloodcolor=S.blood_color
-					S.track_blood--
+				if(istype(S))
+					S.handle_movement(src,(H.m_intent == "run" ? 1 : 0))
+					if(S.track_blood && S.blood_DNA)
+						bloodDNA = S.blood_DNA
+						bloodcolor=S.blood_color
+						S.track_blood--
 			else
 				if(H.track_blood && H.feet_blood_DNA)
 					bloodDNA = H.feet_blood_DNA
-					bloodcolor=H.feet_blood_color
+					bloodcolor = H.feet_blood_color
 					H.track_blood--
 
 			if (bloodDNA)
@@ -75,14 +72,11 @@
 
 				bloodDNA = null
 
-		var/noslip = 0
-		for (var/obj/structure/bed/chair/C in loc)
-			if (C.buckled_mob == M)
-				noslip = 1
-		if((wet == 1 && M.m_intent == "walk") || noslip)
-			return // no slipping while sitting in a chair, plz
-
 		if(src.wet)
+
+			if(M.buckled || (src.wet == 1 && M.m_intent == "walk"))
+				return
+
 			var/slip_dist = 1
 			var/slip_stun = 6
 			var/floor_type = "wet"

code/game/turfs/simulated/walls.dm

@@ -51,6 +51,8 @@
 
 /turf/simulated/wall/ChangeTurf(var/newtype)
 	for(var/obj/effect/E in src) if(E.name == "Wallrot") del E
+	for(var/obj/effect/plant/plant in range(1))
+		plant.update_neighbors()
 	..(newtype)
 
 //Appearance

code/game/turfs/space/space.dm

@@ -14,6 +14,15 @@ var/list/accessible_z_levels = list("1" = 5, "3" = 10, "4" = 15, "5" = 10, "6" =
 /turf/space/New()
 	if(!istype(src, /turf/space/transit))
 		icon_state = "[((x + y) ^ ~(x * y) + z) % 25]"
+	update_starlight()
+
+/turf/space/proc/update_starlight()
+	if(!config.starlight)
+		return
+	if(locate(/turf/simulated) in orange(src,1))
+		SetLuminosity(3)
+	else
+		SetLuminosity(0)
 
 /turf/space/attackby(obj/item/C as obj, mob/user as mob)
 

code/game/turfs/turf.dm

@@ -251,6 +251,9 @@
 		if(air_master)
 			air_master.mark_for_update(src)
 
+		for(var/turf/space/S in range(W,1))
+			S.update_starlight()
+
 		W.levelupdate()
 		return W
 
@@ -272,6 +275,9 @@
 		if(air_master)
 			air_master.mark_for_update(src)
 
+		for(var/turf/space/S in range(W,1))
+			S.update_starlight()
+
 		W.levelupdate()
 		return W
 

code/global.dm

@@ -174,8 +174,9 @@ var/gravity_is_on = 1
 var/join_motd = null
 var/forceblob = 0
 
-var/datum/nanomanager/nanomanager     = new() // NanoManager, the manager for Nano UIs.
-var/datum/event_manager/event_manager = new() // Event Manager, the manager for events.
+var/datum/nanomanager/nanomanager		= new() // NanoManager, the manager for Nano UIs.
+var/datum/event_manager/event_manager	= new() // Event Manager, the manager for events.
+var/datum/subsystem/alarm/alarm_manager	= new() // Alarm Manager, the manager for alarms.
 
 var/list/awaydestinations = list() // Away missions. A list of landmarks that the warpgate can take you to.
 

code/modules/admin/admin.dm

@@ -993,6 +993,32 @@ var/global/floorIsLava = 0
 		else
 			return "Error: Invalid sabotage target: [target]"
 */
+
+/datum/admins/proc/spawn_fruit()
+	set category = "Debug"
+	set desc = "Spawn the product of a seed."
+	set name = "Spawn Fruit"
+
+	if(!check_rights(R_SPAWN))	return
+
+	var/seedtype = input("Select a seed type", "Spawn Fruit") as null|anything in plant_controller.seeds
+	if(!seedtype || !plant_controller.seeds[seedtype])
+		return
+	var/datum/seed/S = plant_controller.seeds[seedtype]
+	S.harvest(usr,0,0,1)
+
+/datum/admins/proc/spawn_plant()
+	set category = "Debug"
+	set desc = "Spawn a spreading plant effect."
+	set name = "Spawn Plant"
+
+	if(!check_rights(R_SPAWN))	return
+
+	var/seedtype = input("Select a seed type", "Spawn Plant") as null|anything in plant_controller.seeds
+	if(!seedtype || !plant_controller.seeds[seedtype])
+		return
+	new /obj/effect/plant(get_turf(usr), plant_controller.seeds[seedtype])
+
 /datum/admins/proc/spawn_atom(var/object as text)
 	set category = "Debug"
 	set desc = "(atom path) Spawn an atom"

code/modules/admin/admin_verbs.dm

@@ -107,6 +107,8 @@ var/list/admin_verbs_fun = list(
 	/client/proc/editappear
 	)
 var/list/admin_verbs_spawn = list(
+	/datum/admins/proc/spawn_fruit,
+	/datum/admins/proc/spawn_plant,
 	/datum/admins/proc/spawn_atom,		/*allows us to spawn instances*/
 	/client/proc/respawn_character,
 	/client/proc/FireLaser,

code/modules/admin/topic.dm

@@ -2432,11 +2432,6 @@
 				var/show_log = alert(usr, "Show ion message?", "Message", "Yes", "No")
 				if(show_log == "Yes")
 					command_announcement.Announce("Ion storm detected near the station. Please check all AI-controlled equipment for errors.", "Anomaly Alert", new_sound = 'sound/AI/ionstorm.ogg')
-			if("spacevines")
-				feedback_inc("admin_secrets_fun_used",1)
-				feedback_add_details("admin_secrets_fun_used","K")
-				new /datum/event/spacevine
-				message_admins("[key_name_admin(usr)] has spawned spacevines", 1)
 			if("onlyone")
 				feedback_inc("admin_secrets_fun_used",1)
 				feedback_add_details("admin_secrets_fun_used","OO")

code/modules/admin/verbs/debug.dm

@@ -662,7 +662,6 @@ But you can call procs that are of type /mob/living/carbon/human/proc/ for that
 			M.equip_to_slot_or_del(new /obj/item/device/radio/headset(M), slot_l_ear)
 			M.equip_to_slot_or_del(new /obj/item/clothing/glasses/thermal/monocle(M), slot_glasses)
 			M.equip_to_slot_or_del(new /obj/item/clothing/suit/chaplain_hoodie(M), slot_wear_suit)
-			M.equip_to_slot_or_del(new /obj/item/weapon/reagent_containers/food/snacks/grown/banana(M), slot_l_store)
 			M.equip_to_slot_or_del(new /obj/item/weapon/bikehorn(M), slot_r_store)
 
 			var/obj/item/weapon/card/id/W = new(M)

code/modules/alarm/alarm.dm

@@ -0,0 +1,138 @@
+#define ALARM_RESET_DELAY 100 // How long will the alarm/trigger remain active once origin/source has been found to be gone?
+
+/datum/alarm_source
+	var/source		= null	// The source trigger
+	var/source_name = ""	// The name of the source should it be lost (for example a destroyed camera)
+	var/duration	= 0		// How long this source will be alarming, 0 for indefinetely.
+	var/severity 	= 1		// How severe the alarm from this source is.
+	var/start_time	= 0		// When this source began alarming.
+	var/end_time	= 0		// Use to set when this trigger should clear, in case the source is lost.
+
+/datum/alarm_source/New(var/atom/source)
+	src.source = source
+	start_time = world.time
+	source_name = source.get_source_name()
+
+/datum/alarm
+	var/atom/origin					//Used to identify the alarm area.
+	var/list/sources = new()		//List of sources triggering the alarm. Used to determine when the alarm should be cleared.
+	var/list/sources_assoc = new()	//Associative list of source triggers. Used to efficiently acquire the alarm source.
+	var/list/cameras				//List of cameras that can be switched to, if the player has that capability.
+	var/area/last_area				//The last acquired area, used should origin be lost (for example a destroyed borg containing an alarming camera).
+	var/area/last_name				//The last acquired name, used should origin be lost
+	var/area/last_camera_area		//The last area in which cameras where fetched, used to see if the camera list should be updated.
+	var/end_time					//Used to set when this alarm should clear, in case the origin is lost.
+
+/datum/alarm/New(var/atom/origin, var/atom/source, var/duration, var/severity)
+	src.origin = origin
+
+	cameras()	// Sets up both cameras and last alarm area.
+	set_source_data(source, duration, severity)
+
+/datum/alarm/proc/process()
+	// Has origin gone missing?
+	if(!origin && !end_time)
+		end_time = world.time + ALARM_RESET_DELAY
+	for(var/datum/alarm_source/AS in sources)
+		// Has the alarm passed its best before date?
+		if((AS.end_time && world.time > AS.end_time) || (AS.duration && world.time > (AS.start_time + AS.duration)))
+			sources -= AS
+		// Has the source gone missing?	Then reset the normal duration and set end_time
+		if(!AS.source && !AS.end_time)	// end_time is used instead of duration to ensure the reset doesn't remain in the future indefinetely.
+			AS.duration = 0
+			AS.end_time = world.time + ALARM_RESET_DELAY
+
+/datum/alarm/proc/set_source_data(var/atom/source, var/duration, var/severity)
+	var/datum/alarm_source/AS = sources_assoc[source]
+	if(!AS)
+		AS = new/datum/alarm_source(source)
+		sources += AS
+		sources_assoc[source] = AS
+	// Currently only non-0 durations can be altered (normal alarms VS EMP blasts)
+	if(AS.duration)
+		duration = SecondsToTicks(duration)
+		AS.duration = duration
+	AS.severity = severity
+
+/datum/alarm/proc/clear(var/source)
+	var/datum/alarm_source/AS = sources_assoc[source]
+	sources -= AS
+	sources_assoc -= source
+
+/datum/alarm/proc/alarm_area()
+	if(!origin)
+		return last_area
+
+	last_area = origin.get_alarm_area()
+	return last_area
+
+/datum/alarm/proc/alarm_name()
+	if(!origin)
+		return last_name
+
+	last_name = origin.get_alarm_name()
+	return last_name
+
+/datum/alarm/proc/cameras()
+	// If the alarm origin has changed area, for example a borg containing an alarming camera, reset the list of cameras
+	if(cameras && (last_camera_area != alarm_area()))
+		cameras = null
+
+	// The list of cameras is also reset by /proc/invalidateCameraCache()
+	if(!cameras)
+		cameras = origin ? origin.get_alarm_cameras() : last_area.get_alarm_cameras()
+
+	last_camera_area = last_area
+	return cameras
+
+/datum/alarm/proc/max_severity()
+	var/max_severity = 0
+	for(var/datum/alarm_source/AS in sources)
+		max_severity = max(AS.severity, max_severity)
+
+	return max_severity
+
+/******************
+* Assisting procs *
+******************/
+/atom/proc/get_alarm_area()
+	var/area/A = get_area(src)
+	return A.master
+
+/area/get_alarm_area()
+	return src.master
+
+/atom/proc/get_alarm_name()
+	var/area/A = get_area(src)
+	return A.master.name
+
+/area/get_alarm_name()
+	return master.name
+
+/mob/get_alarm_name()
+	return name
+
+/atom/proc/get_source_name()
+	return name
+
+/obj/machinery/camera/get_source_name()
+	return c_tag
+
+/atom/proc/get_alarm_cameras()
+	var/area/A = get_area(src)
+	return A.get_cameras()
+
+/area/get_alarm_cameras()
+	return get_cameras()
+
+/mob/living/silicon/robot/get_alarm_cameras()
+	var/list/cameras = ..()
+	if(camera)
+		cameras += camera
+
+	return cameras
+
+/mob/living/silicon/robot/syndicate/get_alarm_cameras()
+	return list()
+
+#undef ALARM_LOSS_DELAY

code/modules/alarm/alarm_handler.dm

@@ -0,0 +1,99 @@
+#define ALARM_RAISED 1
+#define ALARM_CLEARED 0
+
+/datum/alarm_handler
+	var/category = ""
+	var/list/datum/alarm/alarms = new		// All alarms, to handle cases when an origin has been deleted with one or more active alarms
+	var/list/datum/alarm/alarms_assoc = new	// Associative list of alarms, to efficiently acquire them based on origin.
+	var/list/listeners = new				// A list of all objects interested in alarm changes.
+
+/datum/alarm_handler/proc/process()
+	for(var/datum/alarm/A in alarms)
+		A.process()
+		check_alarm_cleared(A)
+
+/datum/alarm_handler/proc/triggerAlarm(var/atom/origin, var/atom/source, var/duration = 0, var/severity = 1)
+	var/new_alarm
+	//Proper origin and source mandatory
+	if(!(origin && source))
+		return
+	origin = origin.get_alarm_origin()
+
+	new_alarm = 0
+	//see if there is already an alarm of this origin
+	var/datum/alarm/existing = alarms_assoc[origin]
+	if(existing)
+		existing.set_source_data(source, duration, severity)
+	else
+		existing = new/datum/alarm(origin, source, duration, severity)
+		new_alarm = 1
+
+	alarms |= existing
+	alarms_assoc[origin] = existing
+	if(new_alarm)
+		alarms = dd_sortedObjectList(alarms)
+		on_alarm_change(existing, ALARM_RAISED)
+
+	return new_alarm
+
+/datum/alarm_handler/proc/clearAlarm(var/atom/origin, var/source)
+	//Proper origin and source mandatory
+	if(!(origin && source))
+		return
+	origin = origin.get_alarm_origin()
+
+	var/datum/alarm/existing = alarms_assoc[origin]
+	if(existing)
+		existing.clear(source)
+		return check_alarm_cleared(existing)
+
+/datum/alarm_handler/proc/major_alarms()
+	return alarms
+
+/datum/alarm_handler/proc/minor_alarms()
+	return alarms
+
+/datum/alarm_handler/proc/check_alarm_cleared(var/datum/alarm/alarm)
+	if ((alarm.end_time && world.time > alarm.end_time) || !alarm.sources.len)
+		alarms -= alarm
+		alarms_assoc -= alarm.origin
+		on_alarm_change(alarm, ALARM_CLEARED)
+		return 1
+	return 0
+
+/datum/alarm_handler/proc/on_alarm_change(var/datum/alarm/alarm, var/was_raised)
+	for(var/obj/machinery/camera/C in alarm.cameras())
+		if(was_raised)
+			C.network.Add(category)
+			invalidateCameraCache()
+		else
+			C.network.Remove(category)
+	notify_listeners(alarm, was_raised)
+
+/datum/alarm_handler/proc/get_alarm_severity_for_origin(var/atom/origin)
+	if(!origin)
+		return
+
+	origin = origin.get_alarm_origin()
+	var/datum/alarm/existing = alarms_assoc[origin]
+	if(!existing)
+		return
+
+	return existing.max_severity()
+
+/atom/proc/get_alarm_origin()
+	return src
+
+/turf/get_alarm_origin()
+	var/area/area = get_area(src)
+	return area.master	// Very important to get area.master, as dynamic lightning can and will split areas.
+
+/datum/alarm_handler/proc/register(var/object, var/procName)
+	listeners[object] = procName
+
+/datum/alarm_handler/proc/unregister(var/object)
+	listeners -= object
+
+/datum/alarm_handler/proc/notify_listeners(var/alarm, var/was_raised)
+	for(var/listener in listeners)
+		call(listener, listeners[listener])(src, alarm, was_raised)

code/modules/alarm/atmosphere_alarm.dm

@@ -0,0 +1,19 @@
+/datum/alarm_handler/atmosphere
+	category = "Atmosphere Alarms"
+
+/datum/alarm_handler/atmosphere/triggerAlarm(var/atom/origin, var/atom/source, var/duration = 0, var/severity = 1)
+	..()
+
+/datum/alarm_handler/atmosphere/major_alarms()
+	var/list/major_alarms = new()
+	for(var/datum/alarm/A in alarms)
+		if(A.max_severity() > 1)
+			major_alarms.Add(A)
+	return major_alarms
+
+/datum/alarm_handler/atmosphere/minor_alarms()
+	var/list/minor_alarms = new()
+	for(var/datum/alarm/A in alarms)
+		if(A.max_severity() == 1)
+			minor_alarms.Add(A)
+	return minor_alarms

code/modules/alarm/camera_alarm.dm

@@ -0,0 +1,2 @@
+/datum/alarm_handler/camera
+	category = "Camera Alarms"

code/modules/alarm/fire_alarm.dm

@@ -0,0 +1,11 @@
+/datum/alarm_handler/fire
+	category = "Fire Alarms"
+
+/datum/alarm_handler/fire/on_alarm_change(var/datum/alarm/alarm, var/was_raised)
+	var/area/A = alarm.origin
+	if(istype(A))
+		if(was_raised)
+			A.fire_alert()
+		else
+			A.fire_reset()
+	..()

code/modules/alarm/motion_alarm.dm

@@ -0,0 +1,2 @@
+/datum/alarm_handler/motion
+	category = "Motion Alarms"

code/modules/alarm/power_alarm.dm

@@ -0,0 +1,10 @@
+/datum/alarm_handler/power
+	category = "Power Alarms"
+
+/datum/alarm_handler/power/on_alarm_change(var/datum/alarm/alarm, var/was_raised)
+	var/area/A = alarm.origin
+	if(istype(A))
+		A.power_alert(was_raised)
+	..()
+
+/area/proc/power_alert(var/alarming)

code/modules/clothing/clothing.dm

@@ -360,6 +360,9 @@ BLIND     // can't see anything
 	species_restricted = list("exclude","Unathi","Tajara")
 	sprite_sheets = list("Vox" = 'icons/mob/species/vox/shoes.dmi')
 
+/obj/item/clothing/shoes/proc/handle_movement(var/turf/walking, var/running)
+	return
+
 /obj/item/clothing/shoes/update_clothing_icon()
 	if (ismob(src.loc))
 		var/mob/M = src.loc

code/modules/clothing/shoes/miscellaneous.dm

@@ -71,6 +71,16 @@
 	var/footstep = 1	//used for squeeks whilst walking
 	species_restricted = null
 
+/obj/item/clothing/shoes/clown_shoes/handle_movement(var/turf/walking, var/running)
+	if(running)
+		if(footstep >= 2)
+			footstep = 0
+			playsound(src, "clownstep", 50, 1) // this will get annoying very fast.
+		else
+			footstep++
+	else
+		playsound(src, "clownstep", 20, 1)
+
 /obj/item/clothing/shoes/jackboots
 	name = "jackboots"
 	desc = "Nanotrasen-issue Security combat boots for combat scenarios or combat situations. All combat, all the time."

code/modules/clothing/spacesuits/rig/suits/merc.dm

@@ -25,3 +25,10 @@
 		/obj/item/rig_module/chem_dispenser/combat,
 		/obj/item/rig_module/fabricator/energy_net
 		)
+
+//Has most of the modules removed
+/obj/item/weapon/rig/merc/empty
+	initial_modules = list(
+		/obj/item/rig_module/ai_container,
+		/obj/item/rig_module/electrowarfare_suite, //might as well
+		)

code/modules/distillery/main.dm

@@ -1,268 +0,0 @@
-// This dreammaker file includes the food processing machines:
-// - I.   Mill
-// - II.  Fermenter
-// - III. Still
-// - IV.  Squeezer
-// - V.   Centrifuge
-
-// I. The mill is intended to be loaded with produce and returns ground up items. For example: Wheat should become flour and grapes should become raisins.
-/obj/machinery/mill
-	var/list/obj/item/weapon/reagent_containers/food/input  = list()
-	var/list/obj/item/weapon/reagent_containers/food/output = list()
-	var/obj/item/weapon/reagent_containers/food/milled_item
-	var/busy     = 0
-	var/progress = 0
-	var/error    = 0
-	name = "\improper Mill"
-	desc = "It is a machine that grinds produce."
-	icon_state = "autolathe"
-	density   = 1
-	anchored  = 1
-	use_power = 1
-	idle_power_usage   = 10
-	active_power_usage = 1000
-
-/obj/machinery/mill/process()
-	if (error)
-		return
-	
-	if (!busy)
-		use_power = 1
-		if (input.len)
-			milled_item = input[1]
-			input -= milled_item
-			progress = 0
-			busy = 1
-			use_power = 2
-		return
-	
-	progress++
-	if (progress < 10) // Edit this value to make milling faster or slower.
-		return // Not done yet.
-	
-	switch (milled_item.type)
-		if (/obj/item/weapon/reagent_containers/food/snacks/grown/wheat) // Wheat becomes flour.
-			var/obj/item/weapon/reagent_containers/food/snacks/flour/F = new(src)
-			output += F
-		if (/obj/item/weapon/reagent_containers/food/snacks/flour) // Flour is still flour.
-			var/obj/item/weapon/reagent_containers/food/snacks/flour/F = new(src)
-			output += F
-		else
-			error = 1
-	
-	del(milled_item)
-	busy = 0
-
-/obj/machinery/mill/attackby(var/obj/item/weapon/W as obj, mob/user as mob)
-	if (istype(W,/obj/item/weapon/reagent_containers/food))
-		user.u_equip(W)
-		W.loc = src
-		input += W
-	else
-		..()
-
-/obj/machinery/mill/attack_hand(var/mob/user as mob)
-	for (var/obj/item/weapon/reagent_containers/food/F in output)
-		F.loc = src.loc
-		output -= F
-
-// II. The fermenter is intended to be loaded with food items and returns medium-strength alcohol items, sucha s wine and beer.
-/obj/machinery/fermenter
-	var/list/obj/item/weapon/reagent_containers/food/input = list()
-	var/list/obj/item/weapon/reagent_containers/food/output = list()
-	var/obj/item/weapon/reagent_containers/food/fermenting_item
-	var/water_level = 0
-	var/busy = 0
-	var/progress = 0
-	var/error = 0
-	name = "\improper Fermenter"
-	desc = "It is a machine that ferments produce into alcoholic drinks."
-	icon_state = "autolathe"
-	density = 1
-	anchored = 1
-	use_power = 1
-	idle_power_usage = 10
-	active_power_usage = 500
-
-/obj/machinery/fermenter/process()
-	if (error)
-		return
-	
-	if (!busy)
-		use_power = 1
-		if (input.len)
-			fermenting_item = input[1]
-			input -= fermenting_item
-			progress = 0
-			busy = 1
-			use_power = 2
-		return
-	
-	if (!water_level)
-		return
-	
-	water_level--
-	
-	progress++
-	if (progress < 10) // Edit this value to make milling faster or slower.
-		return // Not done yet.
-	
-	switch (fermenting_item.type)
-		if (/obj/item/weapon/reagent_containers/food/snacks/flour) // Flour is still flour.
-			var/obj/item/weapon/reagent_containers/food/drinks/cans/beer/B = new(src)
-			output += B
-		else
-			error = 1
-	
-	del(fermenting_item)
-	busy = 0
-
-/obj/machinery/fermenter/attackby(var/obj/item/weapon/W as obj, mob/user as mob)
-	if (istype(W,/obj/item/weapon/reagent_containers/food))
-		user.u_equip(W)
-		W.loc = src
-		input += W
-	else
-		..()
-
-/obj/machinery/fermenter/attack_hand(var/mob/user as mob)
-	for (var/obj/item/weapon/reagent_containers/food/F in output)
-		F.loc = src.loc
-		output -= F
-
-// III. The still is a machine that is loaded with food items and returns hard liquor, such as vodka.
-/obj/machinery/still
-	var/list/obj/item/weapon/reagent_containers/food/input  = list()
-	var/list/obj/item/weapon/reagent_containers/food/output = list()
-	var/obj/item/weapon/reagent_containers/food/distilling_item
-	var/busy     = 0
-	var/progress = 0
-	var/error    = 0
-	name = "\improper Still"
-	desc = "It is a machine that produces hard liquor from alcoholic drinks."
-	icon_state = "autolathe"
-	density   = 1
-	anchored  = 1
-	use_power = 1
-	idle_power_usage = 10
-	active_power_usage = 10000
-
-/obj/machinery/still/process()
-	if (error)
-		return
-	
-	if (!busy)
-		use_power = 1
-		if (input.len)
-			distilling_item = input[1]
-			input -= distilling_item
-			progress = 0
-			busy = 1
-			use_power = 2
-		return
-	
-	progress++
-	if (progress < 10) // Edit this value to make distilling faster or slower.
-		return // Not done yet.
-	
-	switch (distilling_item.type)
-		if (/obj/item/weapon/reagent_containers/food/drinks/cans/beer) // Flour is still flour.
-			var/obj/item/weapon/reagent_containers/food/drinks/bottle/vodka/V = new(src)
-			output += V
-		else
-			error = 1
-	
-	del(distilling_item)
-	busy = 0
-
-/obj/machinery/still/attackby(var/obj/item/weapon/W as obj, mob/user as mob)
-	if (istype(W,/obj/item/weapon/reagent_containers/food))
-		user.u_equip(W)
-		W.loc = src
-		input += W
-	else
-		..()
-
-/obj/machinery/still/attack_hand(var/mob/user as mob)
-	for (var/obj/item/weapon/reagent_containers/food/F in output)
-		F.loc = src.loc
-		output -= F
-
-// IV. The squeezer is intended to destroy inserted food items, but return some of the reagents they contain.
-/obj/machinery/squeezer
-	var/list/obj/item/weapon/reagent_containers/food/input = list()
-	var/obj/item/weapon/reagent_containers/food/squeezed_item
-	var/water_level = 0
-	var/busy        = 0
-	var/progress    = 0
-	var/error       = 0
-	name = "\improper Squeezer"
-	desc = "It is a machine that squeezes extracts from produce."
-	icon_state = "autolathe"
-	density   = 1
-	anchored  = 1
-	use_power = 1
-	idle_power_usage   = 10
-	active_power_usage = 500
-
-// V. The centrifuge spins inserted food items. It is intended to squeeze out the reagents that are common food catalysts (enzymes currently)
-/obj/machinery/centrifuge
-	var/list/obj/item/weapon/reagent_containers/food/input = list()
-	var/list/obj/item/weapon/reagent_containers/food/output = list()
-	var/obj/item/weapon/reagent_containers/food/spinning_item
-	var/busy     = 0
-	var/progress = 0
-	var/error    = 0
-	var/enzymes  = 0
-	var/water    = 0
-	name = "\improper Centrifuge"
-	desc = "It is a machine that spins produce."
-	icon_state = "autolathe"
-	density   = 1
-	anchored  = 1
-	use_power = 1
-	idle_power_usage   = 10
-	active_power_usage = 10000
-
-/obj/machinery/centrifuge/process()
-	if (error)
-		return
-	
-	if (!busy)
-		use_power = 1
-		if (input.len)
-			spinning_item = input[1]
-			input -= spinning_item
-			progress = 0
-			busy = 1
-			use_power = 2
-		return
-	
-	progress++
-	if (progress < 10) // Edit this value to make milling faster or slower.
-		return // Not done yet.
-	
-	var/transfer_enzymes = spinning_item.reagents.get_reagent_amount("enzyme")
-	
-	if (transfer_enzymes)
-		enzymes += transfer_enzymes
-		spinning_item.reagents.remove_reagent("enzyme",transfer_enzymes)
-	
-	output += spinning_item
-	busy = 0
-
-/obj/machinery/centrifuge/attackby(var/obj/item/weapon/W as obj, mob/user as mob)
-	if (istype(W,/obj/item/weapon/reagent_containers/food))
-		user.u_equip(W)
-		W.loc = src
-		input += W
-	else
-		..()
-
-/obj/machinery/centrifuge/attack_hand(var/mob/user as mob)
-	for (var/obj/item/weapon/reagent_containers/food/F in output)
-		F.loc = src.loc
-		output -= F
-	while (enzymes >= 50)
-		enzymes -= 50
-		new/obj/item/weapon/reagent_containers/food/condiment/enzyme(src.loc)

code/modules/events/spacevine.dm

@@ -1,9 +1,5 @@
 /var/global/spacevines_spawned = 0
 
 /datum/event/spacevine/start()
-	//biomass is basically just a resprited version of space vines
-	if(prob(50))
-		spacevine_infestation()
-	else
-		biomass_infestation()
+	spacevine_infestation()
 	spacevines_spawned = 1

code/modules/food/recipes_microwave.dm

@@ -34,24 +34,11 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/boiledegg
 
 /datum/recipe/dionaroast
+	fruit = list("apple" = 1)
 	reagents = list("pacid" = 5) //It dissolves the carapace. Still poisonous, though.
-	items = list(
-		/obj/item/weapon/holder/diona,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/apple
-	)
+	items = list(/obj/item/weapon/holder/diona)
 	result = /obj/item/weapon/reagent_containers/food/snacks/dionaroast
 
-
-/*
-/datum/recipe/bananaphone
-	reagents = list("psilocybin" = 5) //Trippin' balls, man.
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/banana,
-		/obj/item/device/radio
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/bananaphone
-*/
-
 /datum/recipe/jellydonut
 	reagents = list("berryjuice" = 5, "sugar" = 5)
 	items = list(
@@ -80,7 +67,7 @@ I said no!
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/donut/normal
 
-/datum/recipe/human/burger
+/datum/recipe/humanburger
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/meat/human,
 		/obj/item/weapon/reagent_containers/food/snacks/bun
@@ -110,7 +97,7 @@ I said no!
 
 /datum/recipe/roburger
 	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
+		/obj/item/weapon/reagent_containers/food/snacks/bun,
 		/obj/item/robot_parts/head
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/roburger
@@ -146,8 +133,7 @@ I said no!
 /datum/recipe/clownburger
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/bun,
-		/obj/item/clothing/mask/gas/clown_hat,
-		/* /obj/item/weapon/reagent_containers/food/snacks/grown/banana, */
+		/obj/item/clothing/mask/gas/clown_hat
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/clownburger
 
@@ -241,12 +227,12 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/xenomeatbread
 
 /datum/recipe/bananabread
+	fruit = list("banana" = 1)
 	reagents = list("milk" = 5, "sugar" = 15)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/dough,
 		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/banana,
+		/obj/item/weapon/reagent_containers/food/snacks/dough
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/bananabread
 
@@ -267,64 +253,26 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/muffin
 
 /datum/recipe/eggplantparm
+	fruit = list("eggplant" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/eggplant
-	)
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge
+		)
 	result = /obj/item/weapon/reagent_containers/food/snacks/eggplantparm
 
 /datum/recipe/soylenviridians
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/soybeans
-	)
+	fruit = list("soybeans" = 1)
+	reagents = list("flour" = 10)
 	result = /obj/item/weapon/reagent_containers/food/snacks/soylenviridians
 
 /datum/recipe/soylentgreen
+	reagents = list("flour" = 10)
 	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/meat/human,
 		/obj/item/weapon/reagent_containers/food/snacks/meat/human,
+		/obj/item/weapon/reagent_containers/food/snacks/meat/human
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/soylentgreen
 
-/datum/recipe/carrotcake
-	reagents = list("milk" = 5, "sugar" = 15)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/carrotcake
-
-/datum/recipe/cheesecake
-	reagents = list("milk" = 5, "sugar" = 15)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/cheesecake
-
-/datum/recipe/plaincake
-	reagents = list("milk" = 5, "sugar" = 15)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/plaincake
-
 /datum/recipe/meatpie
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
@@ -347,25 +295,23 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/xemeatpie
 
 /datum/recipe/pie
+	fruit = list("banana" = 1)
 	reagents = list("sugar" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/banana,
-	)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough)
 	result = /obj/item/weapon/reagent_containers/food/snacks/pie
 
 /datum/recipe/cherrypie
+	fruit = list("cherries" = 1)
 	reagents = list("sugar" = 10)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/cherries,
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/cherrypie
 
 /datum/recipe/berryclafoutis
+	fruit = list("berries" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/berries,
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/berryclafoutis
 
@@ -383,7 +329,7 @@ I said no!
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/donut/chaos
 
-/datum/recipe/human/kabob
+/datum/recipe/humankabob
 	items = list(
 		/obj/item/stack/rods,
 		/obj/item/weapon/reagent_containers/food/snacks/meat/human,
@@ -430,10 +376,8 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/tofubread
 
 /datum/recipe/loadedbakedpotato
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/potato,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-	)
+	fruit = list("potato" = 1)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/cheesewedge)
 	result = /obj/item/weapon/reagent_containers/food/snacks/loadedbakedpotato
 
 /datum/recipe/cheesyfries
@@ -444,20 +388,17 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/cheesyfries
 
 /datum/recipe/cubancarp
+	fruit = list("chili" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/chili,
-		/obj/item/weapon/reagent_containers/food/snacks/carpmeat,
+		/obj/item/weapon/reagent_containers/food/snacks/carpmeat
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/cubancarp
 
 /datum/recipe/popcorn
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/corn
-	)
+	fruit = list("corn" = 1)
 	result = /obj/item/weapon/reagent_containers/food/snacks/popcorn
 
-
 /datum/recipe/cookie
 	reagents = list("milk" = 5, "sugar" = 5)
 	items = list(
@@ -490,91 +431,69 @@ I said no!
 
 /datum/recipe/meatsteak
 	reagents = list("sodiumchloride" = 1, "blackpepper" = 1)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/meat
-	)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/meat)
 	result = /obj/item/weapon/reagent_containers/food/snacks/meatsteak
 
 /datum/recipe/syntisteak
 	reagents = list("sodiumchloride" = 1, "blackpepper" = 1)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/meat/syntiflesh
-	)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/meat/syntiflesh)
 	result = /obj/item/weapon/reagent_containers/food/snacks/meatsteak
 
 /datum/recipe/pizzamargherita
+	fruit = list("tomato" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
 		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
 		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
 		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/pizza/margherita
 
 /datum/recipe/meatpizza
+	fruit = list("tomato" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
 		/obj/item/weapon/reagent_containers/food/snacks/meat,
 		/obj/item/weapon/reagent_containers/food/snacks/meat,
 		/obj/item/weapon/reagent_containers/food/snacks/meat,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/pizza/meatpizza
 
 /datum/recipe/syntipizza
+	fruit = list("tomato" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
 		/obj/item/weapon/reagent_containers/food/snacks/meat/syntiflesh,
 		/obj/item/weapon/reagent_containers/food/snacks/meat/syntiflesh,
 		/obj/item/weapon/reagent_containers/food/snacks/meat/syntiflesh,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/pizza/meatpizza
 
 /datum/recipe/mushroompizza
+	fruit = list("mushroom" = 5, "tomato" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/pizza/mushroompizza
 
 /datum/recipe/vegetablepizza
+	fruit = list("eggplant" = 1, "carrot" = 1, "corn" = 1, "tomato" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/eggplant,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/corn,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/pizza/vegetablepizza
 
 /datum/recipe/spacylibertyduff
-	reagents = list("water" = 5, "vodka" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/libertycap,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/libertycap,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/libertycap,
-	)
+	reagents = list("water" = 5, "vodka" = 5, "psilocybin" = 5)
 	result = /obj/item/weapon/reagent_containers/food/snacks/spacylibertyduff
 
 /datum/recipe/amanitajelly
-	reagents = list("water" = 5, "vodka" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/amanita,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/amanita,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/amanita,
-	)
+	reagents = list("water" = 5, "vodka" = 5, "amatoxin" = 5)
 	result = /obj/item/weapon/reagent_containers/food/snacks/amanitajelly
 	make_food(var/obj/container as obj)
 		var/obj/item/weapon/reagent_containers/food/snacks/amanitajelly/being_cooked = ..(container)
@@ -582,30 +501,21 @@ I said no!
 		return being_cooked
 
 /datum/recipe/meatballsoup
+	fruit = list("carrot" = 1, "potato" = 1)
 	reagents = list("water" = 10)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/meatball ,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/potato,
-	)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/meatball)
 	result = /obj/item/weapon/reagent_containers/food/snacks/meatballsoup
 
 /datum/recipe/vegetablesoup
+	fruit = list("carrot" = 1, "potato" = 1, "corn" = 1, "eggplant" = 1)
 	reagents = list("water" = 10)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/corn,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/eggplant,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/potato,
-	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/vegetablesoup
 
 /datum/recipe/nettlesoup
+	fruit = list("nettle" = 1, "potato" = 1)
 	reagents = list("water" = 10)
 	items = list(
-		/obj/item/weapon/grown/nettle,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/potato,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
+		/obj/item/weapon/reagent_containers/food/snacks/egg
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/nettlesoup
 
@@ -614,33 +524,23 @@ I said no!
 	result= /obj/item/weapon/reagent_containers/food/snacks/wishsoup
 
 /datum/recipe/hotchili
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/meat,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/chili,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-	)
+	fruit = list("chili" = 1, "tomato" = 1)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/meat)
 	result = /obj/item/weapon/reagent_containers/food/snacks/hotchili
 
 /datum/recipe/coldchili
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/meat,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/icepepper,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-	)
+	fruit = list("icechili" = 1, "tomato" = 1)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/meat)
 	result = /obj/item/weapon/reagent_containers/food/snacks/coldchili
 
 /datum/recipe/amanita_pie
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/amanita,
-	)
+	reagents = list("amatoxin" = 5)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough)
 	result = /obj/item/weapon/reagent_containers/food/snacks/amanita_pie
 
 /datum/recipe/plump_pie
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/plumphelmet,
-	)
+	fruit = list("plumphelmet" = 1)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough)
 	result = /obj/item/weapon/reagent_containers/food/snacks/plump_pie
 
 /datum/recipe/spellburger
@@ -668,30 +568,24 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/bigbiteburger
 
 /datum/recipe/enchiladas
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/cutlet,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/chili,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/chili,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/corn,
-	)
+	fruit = list("chili" = 2, "corn" = 1)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/cutlet)
 	result = /obj/item/weapon/reagent_containers/food/snacks/enchiladas
 
 /datum/recipe/creamcheesebread
 	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
+		/obj/item/weapon/reagent_containers/food/snacks/dough,
+		/obj/item/weapon/reagent_containers/food/snacks/dough,
 		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
 		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/creamcheesebread
 
 /datum/recipe/monkeysdelight
-	reagents = list("sodiumchloride" = 1, "blackpepper" = 1)
+	fruit = list("banana" = 1)
+	reagents = list("sodiumchloride" = 1, "blackpepper" = 1, "flour" = 10)
 	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/monkeycube,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/banana,
+		/obj/item/weapon/reagent_containers/food/snacks/monkeycube
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/monkeysdelight
 
@@ -710,16 +604,6 @@ I said no!
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/fishandchips
 
-/datum/recipe/birthdaycake
-	reagents = list("milk" = 5, "sugar" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/clothing/head/cakehat
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/birthdaycake
-
 /datum/recipe/bread
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/dough,
@@ -751,11 +635,8 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/grilledcheese
 
 /datum/recipe/tomatosoup
+	fruit = list("tomato" = 2)
 	reagents = list("water" = 10)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/tomatosoup
 
 /datum/recipe/rofflewaffles
@@ -767,15 +648,9 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/rofflewaffles
 
 /datum/recipe/stew
+	fruit = list("potato" = 1, "tomato" = 1, "carrot" = 1, "eggplant" = 1, "mushroom" = 1)
 	reagents = list("water" = 10)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-		/obj/item/weapon/reagent_containers/food/snacks/meat,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/potato,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/eggplant,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom,
-	)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/meat)
 	result = /obj/item/weapon/reagent_containers/food/snacks/stew
 
 /datum/recipe/slimetoast
@@ -803,11 +678,10 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/milosoup
 
 /datum/recipe/stewedsoymeat
+	fruit = list("carrot" = 1, "tomato" = 1)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/soydope,
-		/obj/item/weapon/reagent_containers/food/snacks/soydope,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
+		/obj/item/weapon/reagent_containers/food/snacks/soydope
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/stewedsoymeat
 
@@ -833,19 +707,14 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/ricepudding
 
 /datum/recipe/pastatomato
+	fruit = list("tomato" = 2)
 	reagents = list("water" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/spagetti,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-	)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/spagetti)
 	result = /obj/item/weapon/reagent_containers/food/snacks/pastatomato
 
 /datum/recipe/poppypretzel
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/poppy,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-	)
+	fruit = list("poppy" = 1)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/dough)
 	result = /obj/item/weapon/reagent_containers/food/snacks/poppypretzel
 
 /datum/recipe/meatballspagetti
@@ -869,42 +738,27 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/spesslaw
 
 /datum/recipe/superbiteburger
+	fruit = list("tomato" = 1)
 	reagents = list("sodiumchloride" = 5, "blackpepper" = 5)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/bigbiteburger,
 		/obj/item/weapon/reagent_containers/food/snacks/dough,
 		/obj/item/weapon/reagent_containers/food/snacks/meat,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
 		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
 		/obj/item/weapon/reagent_containers/food/snacks/boiledegg,
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/superbiteburger
 
 /datum/recipe/candiedapple
+	fruit = list("apple" = 1)
 	reagents = list("water" = 5, "sugar" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/apple
-	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/candiedapple
 
 /datum/recipe/applepie
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/apple,
-	)
+	fruit = list("apple" = 1)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/sliceable/flatdough)
 	result = /obj/item/weapon/reagent_containers/food/snacks/applepie
 
-/datum/recipe/applecake
-	reagents = list("milk" = 5, "sugar" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/dough,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/apple,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/apple,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/applecake
-
 /datum/recipe/slimeburger
 	reagents = list("slimejelly" = 5)
 	items = list(
@@ -943,68 +797,8 @@ I said no!
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/jellysandwich/cherry
 
-/datum/recipe/orangecake
-	reagents = list("milk" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/orange,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/orange,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/orangecake
-
-/datum/recipe/limecake
-	reagents = list("milk" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/lime,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/lime,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/limecake
-
-/datum/recipe/lemoncake
-	reagents = list("milk" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/lemon,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/lemon,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/lemoncake
-
-/datum/recipe/chocolatecake
-	reagents = list("milk" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/chocolatebar,
-		/obj/item/weapon/reagent_containers/food/snacks/chocolatebar,
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/chocolatecake
-
 /datum/recipe/bloodsoup
-	reagents = list("blood" = 10)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/bloodtomato,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/bloodtomato,
-	)
+	reagents = list("blood" = 30)
 	result = /obj/item/weapon/reagent_containers/food/snacks/bloodsoup
 
 /datum/recipe/slimesoup
@@ -1019,19 +813,6 @@ I said no!
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/boiledslimecore
 
-/datum/recipe/braincake
-	reagents = list("milk" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/organ/brain
-	)
-	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/braincake
-
 /datum/recipe/chocolateegg
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/egg,
@@ -1047,9 +828,8 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/sausage
 
 /datum/recipe/fishfingers
+	reagents = list("flour" = 10)
 	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
 		/obj/item/weapon/reagent_containers/food/snacks/egg,
 		/obj/item/weapon/reagent_containers/food/snacks/carpmeat,
 	)
@@ -1066,84 +846,53 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/mysterysoup
 
 /datum/recipe/pumpkinpie
-	reagents = list("milk" = 5, "sugar" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/pumpkin,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-	)
+	fruit = list("pumpkin" = 1)
+	reagents = list("milk" = 5, "sugar" = 5, "egg" = 3, "flour" = 10)
 	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/pumpkinpie
 
 /datum/recipe/plumphelmetbiscuit
-	reagents = list("water" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/plumphelmet,
-	)
+	fruit = list("plumphelmet" = 1)
+	reagents = list("water" = 5, "flour" = 5)
 	result = /obj/item/weapon/reagent_containers/food/snacks/plumphelmetbiscuit
 
 /datum/recipe/mushroomsoup
+	fruit = list("mushroom" = 1)
 	reagents = list("water" = 5, "milk" = 5)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/chanterelle,
-	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/mushroomsoup
 
 /datum/recipe/chawanmushi
+	fruit = list("mushroom" = 1)
 	reagents = list("water" = 5, "soysauce" = 5)
 	items = list(
 		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/chanterelle,
+		/obj/item/weapon/reagent_containers/food/snacks/egg
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/chawanmushi
 
 /datum/recipe/beetsoup
+	fruit = list("whitebeet" = 1, "cabbage" = 1)
 	reagents = list("water" = 10)
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/whitebeet,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/cabbage,
-	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/beetsoup
 
 /datum/recipe/appletart
-	reagents = list("sugar" = 5, "milk" = 5)
+	fruit = list("goldapple" = 1)
+	reagents = list("sugar" = 5, "milk" = 5, "flour" = 10)
 	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/flour,
-		/obj/item/weapon/reagent_containers/food/snacks/egg,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/goldapple,
+		/obj/item/weapon/reagent_containers/food/snacks/egg
 	)
 	result = /obj/item/weapon/reagent_containers/food/snacks/appletart
 
 /datum/recipe/tossedsalad
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/cabbage,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/cabbage,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/tomato,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/carrot,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/apple,
-	)
+	fruit = list("cabbage" = 2, "tomato" = 1, "carrot" = 1, "apple" = 1)
 	result = /obj/item/weapon/reagent_containers/food/snacks/tossedsalad
 
 /datum/recipe/aesirsalad
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiadeus,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiadeus,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiadeus,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/goldapple,
-	)
+	fruit = list("goldapple" = 1, "ambrosiadeus" = 1)
 	result = /obj/item/weapon/reagent_containers/food/snacks/aesirsalad
 
 /datum/recipe/validsalad
-	items = list(
-		/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiavulgaris,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiavulgaris,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiavulgaris,
-		/obj/item/weapon/reagent_containers/food/snacks/grown/potato,
-		/obj/item/weapon/reagent_containers/food/snacks/meatball,
-	)
+	fruit = list("potato" = 1, "ambrosia" = 3)
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/meatball)
 	result = /obj/item/weapon/reagent_containers/food/snacks/validsalad
 	make_food(var/obj/container as obj)
 		var/obj/item/weapon/reagent_containers/food/snacks/validsalad/being_cooked = ..(container)
@@ -1226,3 +975,50 @@ I said no!
 	result = /obj/item/weapon/reagent_containers/food/snacks/mint
 
 
+// Cakes.
+/datum/recipe/cake
+	reagents = list("milk" = 5, "flour" = 15, "sugar" = 15, "egg" = 9)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/plaincake
+
+/datum/recipe/cake/carrot
+	fruit = list("carrot" = 3)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/carrotcake
+
+/datum/recipe/cake/cheese
+	items = list(
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge,
+		/obj/item/weapon/reagent_containers/food/snacks/cheesewedge
+	)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/cheesecake
+
+/datum/recipe/cake/orange
+	fruit = list("orange" = 1)
+	reagents = list("milk" = 5, "flour" = 15, "egg" = 9, "orangejuice" = 3, "sugar" = 5)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/orangecake
+
+/datum/recipe/cake/lime
+	fruit = list("lime" = 1)
+	reagents = list("milk" = 5, "flour" = 15, "egg" = 9, "limejuice" = 3, "sugar" = 5)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/limecake
+
+/datum/recipe/cake/lemon
+	fruit = list("lemon" = 1)
+	reagents = list("milk" = 5, "flour" = 15, "egg" = 9, "lemonjuice" = 3, "sugar" = 5)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/lemoncake
+
+/datum/recipe/cake/chocolate
+	items = list(/obj/item/weapon/reagent_containers/food/snacks/chocolatebar)
+	reagents = list("milk" = 5, "flour" = 15, "egg" = 9, "coco" = 4, "sugar" = 5)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/chocolatecake
+
+/datum/recipe/cake/birthday
+	items = list(/obj/item/clothing/head/cakehat)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/birthdaycake
+
+/datum/recipe/cake/apple
+	fruit = list("apple" = 2)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/applecake
+
+/datum/recipe/cake/brain
+	items = list(/obj/item/organ/brain)
+	result = /obj/item/weapon/reagent_containers/food/snacks/sliceable/braincake

code/modules/hydroponics/_hydro_setup.dm

@@ -0,0 +1,58 @@
+//Misc
+#define DEAD_PLANT_COLOUR "#C2A180"
+
+// Definitions for genes (trait groupings)
+#define GENE_BIOCHEMISTRY "biochemistry"
+#define GENE_HARDINESS "hardiness"
+#define GENE_ENVIRONMENT "environment"
+#define GENE_METABOLISM "metabolism"
+#define GENE_STRUCTURE "appearance"
+#define GENE_DIET "diet"
+#define GENE_PIGMENT "pigment"
+#define GENE_OUTPUT "output"
+#define GENE_ATMOSPHERE "atmosphere"
+#define GENE_VIGOUR "vigour"
+#define GENE_FRUIT "fruit"
+#define GENE_SPECIAL "special"
+
+#define ALL_GENES list(GENE_BIOCHEMISTRY,GENE_HARDINESS,GENE_ENVIRONMENT,GENE_METABOLISM,GENE_STRUCTURE,GENE_DIET,GENE_PIGMENT,GENE_OUTPUT,GENE_ATMOSPHERE,GENE_VIGOUR,GENE_FRUIT,GENE_SPECIAL)
+
+//Definitions for traits (individual descriptors)
+#define TRAIT_CHEMS                1
+#define TRAIT_EXUDE_GASSES         2
+#define TRAIT_ALTER_TEMP           3
+#define TRAIT_POTENCY              4
+#define TRAIT_HARVEST_REPEAT       5
+#define TRAIT_PRODUCES_POWER       6
+#define TRAIT_JUICY                7
+#define TRAIT_PRODUCT_ICON         8
+#define TRAIT_PLANT_ICON           0
+#define TRAIT_CONSUME_GASSES       10
+#define TRAIT_REQUIRES_NUTRIENTS   11
+#define TRAIT_NUTRIENT_CONSUMPTION 12
+#define TRAIT_REQUIRES_WATER       13
+#define TRAIT_WATER_CONSUMPTION    14
+#define TRAIT_CARNIVOROUS          15
+#define TRAIT_PARASITE             16
+#define TRAIT_STINGS               17
+#define TRAIT_IDEAL_HEAT           18
+#define TRAIT_HEAT_TOLERANCE       19
+#define TRAIT_IDEAL_LIGHT          20
+#define TRAIT_LIGHT_TOLERANCE      21
+#define TRAIT_LOWKPA_TOLERANCE     22
+#define TRAIT_HIGHKPA_TOLERANCE    23
+#define TRAIT_EXPLOSIVE            24
+#define TRAIT_TOXINS_TOLERANCE     25
+#define TRAIT_PEST_TOLERANCE       26
+#define TRAIT_WEED_TOLERANCE       27
+#define TRAIT_ENDURANCE            28
+#define TRAIT_YIELD                29
+#define TRAIT_SPREAD               30
+#define TRAIT_MATURATION           31
+#define TRAIT_PRODUCTION           32
+#define TRAIT_TELEPORTING          33
+#define TRAIT_PLANT_COLOUR         34
+#define TRAIT_PRODUCT_COLOUR       35
+#define TRAIT_BIOLUM               36
+#define TRAIT_BIOLUM_COLOUR        37
+#define TRAIT_IMMUTABLE            38

code/modules/hydroponics/grown.dm

@@ -0,0 +1,352 @@
+//Grown foods.
+/obj/item/weapon/reagent_containers/food/snacks/grown
+
+	name = "fruit"
+	icon = 'icons/obj/hydroponics_products.dmi'
+	icon_state = "blank"
+	desc = "Nutritious! Probably."
+
+	var/plantname
+	var/datum/seed/seed
+	var/potency = -1
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/New(newloc,planttype)
+
+	..()
+
+	src.pixel_x = rand(-5.0, 5)
+	src.pixel_y = rand(-5.0, 5)
+
+	// Fill the object up with the appropriate reagents.
+	if(planttype)
+		plantname = planttype
+
+	if(!plantname)
+		return
+
+	if(!plant_controller)
+		sleep(250) // ugly hack, should mean roundstart plants are fine.
+	if(!plant_controller)
+		world << "<span class='danger'>Plant controller does not exist and [src] requires it. Aborting.</span>"
+		del(src)
+		return
+
+	seed = plant_controller.seeds[plantname]
+
+	if(!seed)
+		return
+
+	name = "[seed.seed_name]"
+
+	update_icon()
+
+	if(!seed.chems)
+		return
+
+	potency = seed.get_trait(TRAIT_POTENCY)
+
+	for(var/rid in seed.chems)
+		var/list/reagent_data = seed.chems[rid]
+		if(reagent_data && reagent_data.len)
+			var/rtotal = reagent_data[1]
+			if(reagent_data.len > 1 && potency > 0)
+				rtotal += round(potency/reagent_data[2])
+			reagents.add_reagent(rid,max(1,rtotal))
+	update_desc()
+	if(reagents.total_volume > 0)
+		bitesize = 1+round(reagents.total_volume / 2, 1)
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/proc/update_desc()
+
+	if(!seed)
+		return
+	if(!plant_controller)
+		sleep(250) // ugly hack, should mean roundstart plants are fine.
+	if(!plant_controller)
+		world << "<span class='danger'>Plant controller does not exist and [src] requires it. Aborting.</span>"
+		del(src)
+		return
+
+	if(plant_controller.product_descs["[seed.uid]"])
+		desc = plant_controller.product_descs["[seed.uid]"]
+	else
+		var/list/descriptors = list()
+		if(reagents.has_reagent("sugar") || reagents.has_reagent("cherryjelly") || reagents.has_reagent("honey") || reagents.has_reagent("berryjuice"))
+			descriptors |= "sweet"
+		if(reagents.has_reagent("anti_toxin"))
+			descriptors |= "astringent"
+		if(reagents.has_reagent("frostoil"))
+			descriptors |= "numbing"
+		if(reagents.has_reagent("nutriment"))
+			descriptors |= "nutritious"
+		if(reagents.has_reagent("condensedcapsaicin") || reagents.has_reagent("capsaicin"))
+			descriptors |= "spicy"
+		if(reagents.has_reagent("coco"))
+			descriptors |= "bitter"
+		if(reagents.has_reagent("orangejuice") || reagents.has_reagent("lemonjuice") || reagents.has_reagent("limejuice"))
+			descriptors |= "sweet-sour"
+		if(reagents.has_reagent("radium") || reagents.has_reagent("uranium"))
+			descriptors |= "radioactive"
+		if(reagents.has_reagent("amatoxin") || reagents.has_reagent("toxin"))
+			descriptors |= "poisonous"
+		if(reagents.has_reagent("psilocybin") || reagents.has_reagent("space_drugs"))
+			descriptors |= "hallucinogenic"
+		if(reagents.has_reagent("bicaridine"))
+			descriptors |= "medicinal"
+		if(reagents.has_reagent("gold"))
+			descriptors |= "shiny"
+		if(reagents.has_reagent("lube"))
+			descriptors |= "slippery"
+		if(reagents.has_reagent("pacid") || reagents.has_reagent("sacid"))
+			descriptors |= "acidic"
+		if(seed.get_trait(TRAIT_JUICY))
+			descriptors |= "juicy"
+		if(seed.get_trait(TRAIT_STINGS))
+			descriptors |= "stinging"
+		if(seed.get_trait(TRAIT_TELEPORTING))
+			descriptors |= "glowing"
+		if(seed.get_trait(TRAIT_EXPLOSIVE))
+			descriptors |= "bulbous"
+
+		var/descriptor_num = rand(2,4)
+		var/descriptor_count = descriptor_num
+		desc = "A"
+		while(descriptors.len && descriptor_num > 0)
+			var/chosen = pick(descriptors)
+			descriptors -= chosen
+			desc += "[(descriptor_count>1 && descriptor_count!=descriptor_num) ? "," : "" ] [chosen]"
+			descriptor_num--
+		if(seed.seed_noun == "spores")
+			desc += " mushroom"
+		else
+			desc += " fruit"
+		plant_controller.product_descs["[seed.uid]"] = desc
+	desc += ". Delicious! Probably."
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/update_icon()
+	if(!seed || !plant_controller || !plant_controller.plant_icon_cache)
+		return
+	overlays.Cut()
+	var/image/plant_icon
+	var/icon_key = "fruit-[seed.get_trait(TRAIT_PRODUCT_ICON)]-[seed.get_trait(TRAIT_PRODUCT_COLOUR)]-[seed.get_trait(TRAIT_PLANT_COLOUR)]"
+	if(plant_controller.plant_icon_cache[icon_key])
+		plant_icon = plant_controller.plant_icon_cache[icon_key]
+	else
+		plant_icon = image('icons/obj/hydroponics_products.dmi',"blank")
+		var/image/fruit_base = image('icons/obj/hydroponics_products.dmi',"[seed.get_trait(TRAIT_PRODUCT_ICON)]-product")
+		fruit_base.color = "[seed.get_trait(TRAIT_PRODUCT_COLOUR)]"
+		plant_icon.overlays |= fruit_base
+		if("[seed.get_trait(TRAIT_PRODUCT_ICON)]-leaf" in icon_states('icons/obj/hydroponics_products.dmi'))
+			var/image/fruit_leaves = image('icons/obj/hydroponics_products.dmi',"[seed.get_trait(TRAIT_PRODUCT_ICON)]-leaf")
+			fruit_leaves.color = "[seed.get_trait(TRAIT_PLANT_COLOUR)]"
+			plant_icon.overlays |= fruit_leaves
+		plant_controller.plant_icon_cache[icon_key] = plant_icon
+	overlays |= plant_icon
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/Crossed(var/mob/living/M)
+	if(seed && seed.get_trait(TRAIT_JUICY) == 2)
+		if(istype(M))
+
+			if(M.buckled)
+				return
+
+			if(istype(M,/mob/living/carbon/human))
+				var/mob/living/carbon/human/H = M
+				if(H.shoes && H.shoes.flags & NOSLIP)
+					return
+
+			M.stop_pulling()
+			M << "<span class='notice'>You slipped on the [name]!</span>"
+			playsound(src.loc, 'sound/misc/slip.ogg', 50, 1, -3)
+			M.Stun(8)
+			M.Weaken(5)
+			seed.thrown_at(src,M)
+			sleep(-1)
+			if(src) del(src)
+			return
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/throw_impact(atom/hit_atom)
+	..()
+	if(seed) seed.thrown_at(src,hit_atom)
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/attackby(var/obj/item/weapon/W, var/mob/user)
+
+	if(seed)
+		if(seed.get_trait(TRAIT_PRODUCES_POWER) && istype(W, /obj/item/stack/cable_coil))
+			var/obj/item/stack/cable_coil/C = W
+			if(C.use(5))
+				//TODO: generalize this.
+				user << "<span class='notice'>You add some cable to the [src.name] and slide it inside the battery casing.</span>"
+				var/obj/item/weapon/cell/potato/pocell = new /obj/item/weapon/cell/potato(get_turf(user))
+				if(src.loc == user && !(user.l_hand && user.r_hand) && istype(user,/mob/living/carbon/human))
+					user.put_in_hands(pocell)
+				pocell.maxcharge = src.potency * 10
+				pocell.charge = pocell.maxcharge
+				del(src)
+				return
+		else if(W.sharp)
+			if(seed.kitchen_tag == "pumpkin") // Ugggh these checks are awful.
+				user.show_message("<span class='notice'>You carve a face into [src]!</span>", 1)
+				new /obj/item/clothing/head/pumpkinhead (user.loc)
+				del(src)
+				return
+			else if(seed.chems)
+				if(istype(W,/obj/item/weapon/hatchet) && !isnull(seed.chems["woodpulp"]))
+					user.show_message("<span class='notice'>You make planks out of \the [src]!</span>", 1)
+					for(var/i=0,i<2,i++)
+						var/obj/item/stack/sheet/wood/NG = new (user.loc)
+						NG.color = seed.get_trait(TRAIT_PRODUCT_COLOUR)
+						for (var/obj/item/stack/sheet/wood/G in user.loc)
+							if(G==NG)
+								continue
+							if(G.amount>=G.max_amount)
+								continue
+							G.attackby(NG, user)
+						user << "You add the newly-formed wood to the stack. It now contains [NG.amount] planks."
+					del(src)
+					return
+				else if(!isnull(seed.chems["potato"]))
+					user << "You slice \the [src] into sticks."
+					new /obj/item/weapon/reagent_containers/food/snacks/rawsticks(get_turf(src))
+					del(src)
+					return
+				else if(!isnull(seed.chems["carrotjuice"]))
+					user << "You slice \the [src] into sticks."
+					new /obj/item/weapon/reagent_containers/food/snacks/carrotfries(get_turf(src))
+					del(src)
+					return
+				else if(!isnull(seed.chems["soymilk"]))
+					user << "You roughly chop up \the [src]."
+					new /obj/item/weapon/reagent_containers/food/snacks/soydope(get_turf(src))
+					del(src)
+					return
+	..()
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/attack(var/mob/living/carbon/M, var/mob/user, var/def_zone)
+	if(user == M)
+		return ..()
+
+	if(user.a_intent == "hurt")
+
+		// This is being copypasted here because reagent_containers (WHY DOES FOOD DESCEND FROM THAT) overrides it completely.
+		// TODO: refactor all food paths to be less horrible and difficult to work with in this respect. ~Z
+		if(!istype(M) || (can_operate(M) && do_surgery(M,user,src))) return 0
+
+		user.lastattacked = M
+		M.lastattacker = user
+		user.attack_log += "\[[time_stamp()]\]<font color='red'> Attacked [M.name] ([M.ckey]) with [name] (INTENT: [uppertext(user.a_intent)]) (DAMTYE: [uppertext(damtype)])</font>"
+		M.attack_log += "\[[time_stamp()]\]<font color='orange'> Attacked by [user.name] ([user.ckey]) with [name] (INTENT: [uppertext(user.a_intent)]) (DAMTYE: [uppertext(damtype)])</font>"
+		msg_admin_attack("[key_name(user)] attacked [key_name(M)] with [name] (INTENT: [uppertext(user.a_intent)]) (DAMTYE: [uppertext(damtype)])" )
+
+		if(istype(M, /mob/living/carbon/human))
+			var/mob/living/carbon/human/H = M
+			var/hit = H.attacked_by(src, user, def_zone)
+			if(hit && hitsound)
+				playsound(loc, hitsound, 50, 1, -1)
+			return hit
+		else
+			if(attack_verb.len)
+				user.visible_message("<span class='danger'>[M] has been [pick(attack_verb)] with [src] by [user]!</span>")
+			else
+				user.visible_message("<span class='danger'>[M] has been attacked with [src] by [user]!</span>")
+
+			if (hitsound)
+				playsound(loc, hitsound, 50, 1, -1)
+			switch(damtype)
+				if("brute")
+					M.take_organ_damage(force)
+					if(prob(33))
+						var/turf/simulated/location = get_turf(M)
+						if(istype(location)) location.add_blood_floor(M)
+				if("fire")
+					if (!(COLD_RESISTANCE in M.mutations))
+						M.take_organ_damage(0, force)
+			M.updatehealth()
+
+		if(seed && seed.get_trait(TRAIT_STINGS))
+			if(!reagents || reagents.total_volume <= 0)
+				return
+			reagents.remove_any(rand(1,3))
+			seed.thrown_at(src,M)
+			sleep(-1)
+			if(!src)
+				return
+			if(prob(35))
+				if(user)
+					user << "<span class='danger'>\The [src] has fallen to bits.</span>"
+					user.drop_from_inventory(src)
+				del(src)
+
+		add_fingerprint(user)
+		return 1
+
+	else
+		..()
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/attack_self(mob/user as mob)
+
+	if(!seed)
+		return
+
+	if(istype(user.loc,/turf/space))
+		return
+
+	if(user.a_intent == "hurt")
+		user.visible_message("<span class='danger'>\The [user] squashes \the [src]!</span>")
+		seed.thrown_at(src,user)
+		sleep(-1)
+		if(src) del(src)
+		return
+
+	if(seed.get_trait(TRAIT_SPREAD) > 0)
+		user << "<span class='notice'>You plant the [src.name].</span>"
+		new /obj/machinery/portable_atmospherics/hydroponics/soil/invisible(get_turf(user),src.seed)
+		del(src)
+		return
+
+	if(seed.kitchen_tag)
+		switch(seed.kitchen_tag)
+			if("shand")
+				var/obj/item/stack/medical/bruise_pack/tajaran/poultice = new /obj/item/stack/medical/bruise_pack/tajaran(user.loc)
+				poultice.heal_brute = potency
+				user << "<span class='notice'>You mash the leaves into a poultice.</span>"
+				del(src)
+				return
+			if("mtear")
+				var/obj/item/stack/medical/ointment/tajaran/poultice = new /obj/item/stack/medical/ointment/tajaran(user.loc)
+				poultice.heal_burn = potency
+				user << "<span class='notice'>You mash the petals into a poultice.</span>"
+				del(src)
+				return
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/pickup(mob/user)
+	..()
+	if(!seed)
+		return
+	if(seed.get_trait(TRAIT_BIOLUM))
+		user.SetLuminosity(user.luminosity + seed.get_trait(TRAIT_BIOLUM))
+		SetLuminosity(0)
+	if(seed.get_trait(TRAIT_STINGS))
+		var/mob/living/carbon/human/H = user
+		if(istype(H) && H.gloves)
+			return
+		if(!reagents || reagents.total_volume <= 0)
+			return
+		reagents.remove_any(rand(1,3)) //Todo, make it actually remove the reagents the seed uses.
+		seed.do_thorns(H,src)
+		seed.do_sting(H,src,pick("r_hand","l_hand"))
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/dropped(mob/user)
+	if(!..() || !seed)
+		return
+	if(seed.get_trait(TRAIT_BIOLUM))
+		user.SetLuminosity(user.luminosity - seed.get_trait(TRAIT_BIOLUM))
+		SetLuminosity(seed.get_trait(TRAIT_BIOLUM))
+
+// Predefined types for placing on the map.
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/mushroom/libertycap
+	plantname = "libertycap"
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiavulgaris
+	plantname = "ambrosia"

code/modules/hydroponics/grown_inedible.dm

@@ -8,7 +8,7 @@
 	var/plantname
 	var/potency = 1
 
-/obj/item/weapon/grown/New()
+/obj/item/weapon/grown/New(newloc,planttype)
 
 	..()
 
@@ -17,158 +17,25 @@
 	R.my_atom = src
 
 	//Handle some post-spawn var stuff.
-	spawn(1)
-		// Fill the object up with the appropriate reagents.
-		if(!isnull(plantname))
-			var/datum/seed/S = seed_types[plantname]
-			if(!S || !S.chems)
-				return
-
-			potency = S.potency
-
-			for(var/rid in S.chems)
-				var/list/reagent_data = S.chems[rid]
-				var/rtotal = reagent_data[1]
-				if(reagent_data.len > 1 && potency > 0)
-					rtotal += round(potency/reagent_data[2])
-				reagents.add_reagent(rid,max(1,rtotal))
-
-/obj/item/weapon/grown/log
-	name = "towercap"
-	name = "tower-cap log"
-	desc = "It's better than bad, it's good!"
-	icon = 'icons/obj/harvest.dmi'
-	icon_state = "logs"
-	force = 5
-	throwforce = 5
-	w_class = 3.0
-	throw_speed = 3
-	throw_range = 3
-	origin_tech = "materials=1"
-	attack_verb = list("bashed", "battered", "bludgeoned", "whacked")
-
-	attackby(obj/item/weapon/W as obj, mob/user as mob)
-		if(istype(W, /obj/item/weapon/circular_saw) || istype(W, /obj/item/weapon/hatchet) || (istype(W, /obj/item/weapon/twohanded/fireaxe) && W:wielded) || istype(W, /obj/item/weapon/melee/energy))
-			user.show_message("<span class='notice'>You make planks out of \the [src]!</span>", 1)
-			for(var/i=0,i<2,i++)
-				var/obj/item/stack/sheet/wood/NG = new (user.loc)
-				for (var/obj/item/stack/sheet/wood/G in user.loc)
-					if(G==NG)
-						continue
-					if(G.amount>=G.max_amount)
-						continue
-					G.attackby(NG, user)
-					usr << "You add the newly-formed wood to the stack. It now contains [NG.amount] planks."
-			del(src)
+	if(planttype)
+		plantname = planttype
+		var/datum/seed/S = plant_controller.seeds[plantname]
+		if(!S || !S.chems)
 			return
 
-/obj/item/weapon/grown/sunflower // FLOWER POWER!
-	plantname = "sunflowers"
-	name = "sunflower"
-	desc = "It's beautiful! A certain person might beat you to death if you trample these."
-	icon = 'icons/obj/harvest.dmi'
-	icon_state = "sunflower"
-	damtype = "fire"
-	force = 0
-	throwforce = 1
-	w_class = 1.0
-	throw_speed = 1
-	throw_range = 3
+		potency = S.get_trait(TRAIT_POTENCY)
 
-/obj/item/weapon/grown/sunflower/attack(mob/M as mob, mob/user as mob)
-	M << "<font color='green'><b> [user] smacks you with a sunflower!</font><font color='yellow'><b>FLOWER POWER<b></font>"
-	user << "<font color='green'> Your sunflower's </font><font color='yellow'><b>FLOWER POWER</b></font><font color='green'> strikes [M]</font>"
-
-/obj/item/weapon/grown/nettle // -- Skie
-	plantname = "nettle"
-	desc = "It's probably <B>not</B> wise to touch it with bare hands..."
-	icon = 'icons/obj/weapons.dmi'
-	name = "nettle"
-	icon_state = "nettle"
-	damtype = "fire"
-	force = 15
-	throwforce = 1
-	w_class = 2.0
-	throw_speed = 1
-	throw_range = 3
-	origin_tech = "combat=1"
-	attack_verb = list("stung")
-	hitsound = ""
-
-	var/potency_divisior = 5
-
-/obj/item/weapon/grown/nettle/New()
-	..()
-	spawn(5)
-		force = round((5+potency/potency_divisior), 1)
-
-/obj/item/weapon/grown/nettle/pickup(mob/living/carbon/human/user as mob)
-	if(istype(user) && !user.gloves)
-		user << "\red The nettle burns your bare hand!"
-		if(istype(user, /mob/living/carbon/human))
-			var/organ = ((user.hand ? "l_":"r_") + "arm")
-			var/datum/organ/external/affecting = user.get_organ(organ)
-			if(affecting.take_damage(0,force))
-				user.UpdateDamageIcon()
-		else
-			user.take_organ_damage(0,force)
-		return 1
-	return 0
-
-/obj/item/weapon/grown/nettle/proc/lose_leaves(var/mob/user)
-	if(force > 0)
-		playsound(loc, 'sound/weapons/bladeslice.ogg', 50, 1, -1)
-		force -= rand(1,(force/3)+1) // When you whack someone with it, leaves fall off
-
-	sleep(1)
-
-	if(force <= 0)
-		if(user)
-			user << "All the leaves have fallen off \the [src] from violent whacking."
-			user.drop_from_inventory(src)
-		del(src)
-
-/obj/item/weapon/grown/nettle/death // -- Skie
-	plantname = "deathnettle"
-	desc = "The \red glowing \black nettle incites \red<B>rage</B>\black in you just from looking at it!"
-	name = "deathnettle"
-	icon_state = "deathnettle"
-	origin_tech = "combat=3"
-	potency_divisior = 2.5
-
-/obj/item/weapon/grown/nettle/death/pickup(mob/living/carbon/human/user as mob)
-
-	if(..() && prob(50))
-		user.Paralyse(5)
-		user << "\red You are stunned by the deathnettle when you try picking it up!"
-
-/obj/item/weapon/grown/nettle/attack(mob/living/carbon/M as mob, mob/user as mob)
-
-	if(!..()) return
-
-	lose_leaves(user)
-
-/obj/item/weapon/grown/nettle/death/attack(mob/living/carbon/M as mob, mob/user as mob)
-
-	if(!..()) return
-
-	if(istype(M, /mob/living))
-		M << "\red You are stunned by the powerful acid of the deathnettle!"
-
-		M.attack_log += text("\[[time_stamp()]\] <font color='orange'>Had the [src.name] used on them by [user.name] ([user.ckey])</font>")
-		user.attack_log += text("\[[time_stamp()]\] <font color='red'>Used the [src.name] on [M.name] ([M.ckey])</font>")
-		msg_admin_attack("[user.name] ([user.ckey]) used the [src.name] on [M.name] ([M.ckey]) (<A HREF='?_src_=holder;adminplayerobservecoodjump=1;X=[user.x];Y=[user.y];Z=[user.z]'>JMP</a>)")
-
-		M.eye_blurry += force/7
-		if(prob(20))
-			M.Paralyse(force/6)
-			M.Weaken(force/15)
-		M.drop_item()
+		for(var/rid in S.chems)
+			var/list/reagent_data = S.chems[rid]
+			var/rtotal = reagent_data[1]
+			if(reagent_data.len > 1 && potency > 0)
+				rtotal += round(potency/reagent_data[2])
+			reagents.add_reagent(rid,max(1,rtotal))
 
 /obj/item/weapon/corncob
 	name = "corn cob"
 	desc = "A reminder of meals gone by."
-	icon = 'icons/obj/harvest.dmi'
+	icon = 'icons/obj/trash.dmi'
 	icon_state = "corncob"
 	item_state = "corncob"
 	w_class = 2.0
@@ -183,3 +50,14 @@
 		new /obj/item/clothing/mask/smokable/pipe/cobpipe (user.loc)
 		del(src)
 		return
+
+/obj/item/weapon/bananapeel
+	name = "banana peel"
+	desc = "A peel from a banana."
+	icon = 'icons/obj/items.dmi'
+	icon_state = "banana_peel"
+	item_state = "banana_peel"
+	w_class = 2.0
+	throwforce = 0
+	throw_speed = 4
+	throw_range = 20

code/modules/hydroponics/grown_predefined.dm

@@ -0,0 +1,5 @@
+/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiavulgaris
+	plantname = "ambrosia"
+
+/obj/item/weapon/reagent_containers/food/snacks/grown/ambrosiadeus
+	plantname = "ambrosiadeus"

code/modules/hydroponics/hydro_tools.dm

@@ -1,366 +0,0 @@
-//Analyzer, pestkillers, weedkillers, nutrients, hatchets, cutters.
-
-/obj/item/weapon/wirecutters/clippers
-	name = "plant clippers"
-	desc = "A tool used to take samples from plants."
-
-/obj/item/device/analyzer/plant_analyzer
-	name = "plant analyzer"
-	icon = 'icons/obj/device.dmi'
-	icon_state = "hydro"
-	item_state = "analyzer"
-
-/obj/item/device/analyzer/plant_analyzer/attack_self(mob/user as mob)
-	return 0
-
-/obj/item/device/analyzer/plant_analyzer/afterattack(obj/target, mob/user, flag)
-	if(!flag) return
-
-	var/datum/seed/grown_seed
-	var/datum/reagents/grown_reagents
-	if(istype(target,/obj/structure/table))
-		return ..()
-	else if(istype(target,/obj/item/weapon/reagent_containers/food/snacks/grown))
-
-		var/obj/item/weapon/reagent_containers/food/snacks/grown/G = target
-		grown_seed = seed_types[G.plantname]
-		grown_reagents = G.reagents
-
-	else if(istype(target,/obj/item/weapon/grown))
-
-		var/obj/item/weapon/grown/G = target
-		grown_seed = seed_types[G.plantname]
-		grown_reagents = G.reagents
-
-	else if(istype(target,/obj/item/seeds))
-
-		var/obj/item/seeds/S = target
-		grown_seed = S.seed
-
-	else if(istype(target,/obj/machinery/portable_atmospherics/hydroponics))
-
-		var/obj/machinery/portable_atmospherics/hydroponics/H = target
-		grown_seed = H.seed
-		grown_reagents = H.reagents
-
-	if(!grown_seed)
-		user << "\red [src] can tell you nothing about [target]."
-		return
-
-	var/dat = "<h3>Plant data for [target]</h3>"
-	user.visible_message("\blue [user] runs the scanner over [target].")
-
-	dat += "<h2>General Data</h2>"
-
-	dat += "<table>"
-	dat += "<tr><td><b>Endurance</b></td><td>[grown_seed.endurance]</td></tr>"
-	dat += "<tr><td><b>Yield</b></td><td>[grown_seed.yield]</td></tr>"
-	dat += "<tr><td><b>Lifespan</b></td><td>[grown_seed.lifespan]</td></tr>"
-	dat += "<tr><td><b>Maturation time</b></td><td>[grown_seed.maturation]</td></tr>"
-	dat += "<tr><td><b>Production time</b></td><td>[grown_seed.production]</td></tr>"
-	dat += "<tr><td><b>Potency</b></td><td>[grown_seed.potency]</td></tr>"
-	dat += "</table>"
-
-	if(grown_reagents && grown_reagents.reagent_list && grown_reagents.reagent_list.len)
-		dat += "<h2>Reagent Data</h2>"
-
-		dat += "<br>This sample contains: "
-		for(var/datum/reagent/R in grown_reagents.reagent_list)
-			dat += "<br>- [R.id], [grown_reagents.get_reagent_amount(R.id)] unit(s)"
-
-	dat += "<h2>Other Data</h2>"
-
-	if(grown_seed.harvest_repeat)
-		dat += "This plant can be harvested repeatedly.<br>"
-
-	if(grown_seed.immutable == -1)
-		dat += "This plant is highly mutable.<br>"
-	else if(grown_seed.immutable > 0)
-		dat += "This plant does not possess genetics that are alterable.<br>"
-
-	if(grown_seed.products && grown_seed.products.len)
-		dat += "The mature plant will produce [grown_seed.products.len == 1 ? "fruit" : "[grown_seed.products.len] varieties of fruit"].<br>"
-
-	if(grown_seed.requires_nutrients)
-		if(grown_seed.nutrient_consumption < 0.05)
-			dat += "It consumes a small amount of nutrient fluid.<br>"
-		else if(grown_seed.nutrient_consumption > 0.2)
-			dat += "It requires a heavy supply of nutrient fluid.<br>"
-		else
-			dat += "It requires a supply of nutrient fluid.<br>"
-
-	if(grown_seed.requires_water)
-		if(grown_seed.water_consumption < 1)
-			dat += "It requires very little water.<br>"
-		else if(grown_seed.water_consumption > 5)
-			dat += "It requires a large amount of water.<br>"
-		else
-			dat += "It requires a stable supply of water.<br>"
-
-	if(grown_seed.mutants && grown_seed.mutants.len)
-		dat += "It exhibits a high degree of potential subspecies shift.<br>"
-
-	dat += "It thrives in a temperature of [grown_seed.ideal_heat] Kelvin."
-
-	if(grown_seed.lowkpa_tolerance < 20)
-		dat += "<br>It is well adapted to low pressure levels."
-	if(grown_seed.highkpa_tolerance > 220)
-		dat += "<br>It is well adapted to high pressure levels."
-
-	if(grown_seed.heat_tolerance > 30)
-		dat += "<br>It is well adapted to a range of temperatures."
-	else if(grown_seed.heat_tolerance < 10)
-		dat += "<br>It is very sensitive to temperature shifts."
-
-	dat += "<br>It thrives in a light level of [grown_seed.ideal_light] lumen\s."
-
-	if(grown_seed.light_tolerance > 10)
-		dat += "<br>It is well adapted to a range of light levels."
-	else if(grown_seed.light_tolerance < 3)
-		dat += "<br>It is very sensitive to light level shifts."
-
-	if(grown_seed.toxins_tolerance < 3)
-		dat += "<br>It is highly sensitive to toxins."
-	else if(grown_seed.toxins_tolerance > 6)
-		dat += "<br>It is remarkably resistant to toxins."
-
-	if(grown_seed.pest_tolerance < 3)
-		dat += "<br>It is highly sensitive to pests."
-	else if(grown_seed.pest_tolerance > 6)
-		dat += "<br>It is remarkably resistant to pests."
-
-	if(grown_seed.weed_tolerance < 3)
-		dat += "<br>It is highly sensitive to weeds."
-	else if(grown_seed.weed_tolerance > 6)
-		dat += "<br>It is remarkably resistant to weeds."
-
-	switch(grown_seed.spread)
-		if(1)
-			dat += "<br>It is capable of growing beyond the confines of a tray."
-		if(2)
-			dat += "<br>It is a robust and vigorous vine that will spread rapidly."
-
-	switch(grown_seed.carnivorous)
-		if(1)
-			dat += "<br>It is carniovorous and will eat tray pests for sustenance."
-		if(2)
-			dat	+= "<br>It is carnivorous and poses a significant threat to living things around it."
-
-	if(grown_seed.parasite)
-		dat += "<br>It is capable of parisitizing and gaining sustenance from tray weeds."
-	if(grown_seed.alter_temp)
-		dat += "<br>It will periodically alter the local temperature by [grown_seed.alter_temp] degrees Kelvin."
-
-	if(grown_seed.biolum)
-		dat += "<br>It is [grown_seed.biolum_colour ? "<font color='[grown_seed.biolum_colour]'>bio-luminescent</font>" : "bio-luminescent"]."
-	if(grown_seed.flowers)
-		dat += "<br>It has [grown_seed.flower_colour ? "<font color='[grown_seed.flower_colour]'>flowers</font>" : "flowers"]."
-
-	if(dat)
-		user << browse(dat,"window=plant_analyzer")
-
-	return
-
-// *************************************
-// Hydroponics Tools
-// *************************************
-
-/obj/item/weapon/plantspray
-	icon = 'icons/obj/hydroponics.dmi'
-	item_state = "spray"
-	flags = NOBLUDGEON
-	slot_flags = SLOT_BELT
-	throwforce = 4
-	w_class = 2.0
-	throw_speed = 2
-	throw_range = 10
-	var/toxicity = 4
-	var/pest_kill_str = 0
-	var/weed_kill_str = 0
-
-/obj/item/weapon/plantspray/weeds // -- Skie
-
-	name = "weed-spray"
-	desc = "It's a toxic mixture, in spray form, to kill small weeds."
-	icon_state = "weedspray"
-	weed_kill_str = 6
-
-/obj/item/weapon/plantspray/pests
-	name = "pest-spray"
-	desc = "It's some pest eliminator spray! <I>Do not inhale!</I>"
-	icon_state = "pestspray"
-	pest_kill_str = 6
-
-/obj/item/weapon/plantspray/pests/old
-	name = "bottle of pestkiller"
-	icon = 'icons/obj/chemical.dmi'
-	icon_state = "bottle16"
-
-/obj/item/weapon/plantspray/pests/old/carbaryl
-	name = "bottle of carbaryl"
-	icon_state = "bottle16"
-	toxicity = 4
-	pest_kill_str = 2
-
-/obj/item/weapon/plantspray/pests/old/lindane
-	name = "bottle of lindane"
-	icon_state = "bottle18"
-	toxicity = 6
-	pest_kill_str = 4
-
-/obj/item/weapon/plantspray/pests/old/phosmet
-	name = "bottle of phosmet"
-	icon_state = "bottle15"
-	toxicity = 8
-	pest_kill_str = 7
-
-/obj/item/weapon/minihoe // -- Numbers
-	name = "mini hoe"
-	desc = "It's used for removing weeds or scratching your back."
-	icon = 'icons/obj/weapons.dmi'
-	icon_state = "hoe"
-	item_state = "hoe"
-	flags = CONDUCT | NOBLUDGEON
-	force = 5.0
-	throwforce = 7.0
-	w_class = 2.0
-	matter = list("metal" = 50)
-	attack_verb = list("slashed", "sliced", "cut", "clawed")
-
-
-// *************************************
-// Weedkiller defines for hydroponics
-// *************************************
-
-/obj/item/weedkiller
-	name = "bottle of weedkiller"
-	icon = 'icons/obj/chemical.dmi'
-	icon_state = "bottle16"
-	var/toxicity = 0
-	var/weed_kill_str = 0
-
-/obj/item/weedkiller/triclopyr
-	name = "bottle of glyphosate"
-	icon = 'icons/obj/chemical.dmi'
-	icon_state = "bottle16"
-	toxicity = 4
-	weed_kill_str = 2
-
-/obj/item/weedkiller/lindane
-	name = "bottle of triclopyr"
-	icon = 'icons/obj/chemical.dmi'
-	icon_state = "bottle18"
-	toxicity = 6
-	weed_kill_str = 4
-
-/obj/item/weedkiller/D24
-	name = "bottle of 2,4-D"
-	icon = 'icons/obj/chemical.dmi'
-	icon_state = "bottle15"
-	toxicity = 8
-	weed_kill_str = 7
-
-
-// *************************************
-// Nutrient defines for hydroponics
-// *************************************
-
-/obj/item/weapon/reagent_containers/glass/fertilizer
-	name = "fertilizer bottle"
-	desc = "A small glass bottle. Can hold up to 10 units."
-	icon = 'icons/obj/chemical.dmi'
-	icon_state = "bottle-4"
-	flags = 0
-	possible_transfer_amounts = null
-	w_class = 2.0
-
-	var/fertilizer //Reagent contained, if any.
-
-	//Like a shot glass!
-	amount_per_transfer_from_this = 10
-	volume = 10
-
-/obj/item/weapon/reagent_containers/glass/fertilizer/New()
-	..()
-
-	src.pixel_x = rand(-5.0, 5)
-	src.pixel_y = rand(-5.0, 5)
-
-	if(fertilizer)
-		reagents.add_reagent(fertilizer,10)
-		update_icon()
-
-/obj/item/weapon/reagent_containers/glass/fertilizer/ez
-	name = "bottle of E-Z-Nutrient"
-	icon_state = "bottle-4"
-	fertilizer = "eznutrient"
-
-/obj/item/weapon/reagent_containers/glass/fertilizer/l4z
-	name = "bottle of Left 4 Zed"
-	icon_state = "bottle-4"
-	fertilizer = "left4zed"
-
-/obj/item/weapon/reagent_containers/glass/fertilizer/rh
-	name = "bottle of Robust Harvest"
-	icon_state = "bottle-4"
-	fertilizer = "robustharvest"
-
-//Hatchets and things to kill kudzu
-/obj/item/weapon/hatchet
-	name = "hatchet"
-	desc = "A very sharp axe blade upon a short fibremetal handle. It has a long history of chopping things, but now it is used for chopping wood."
-	icon = 'icons/obj/weapons.dmi'
-	icon_state = "hatchet"
-	flags = CONDUCT
-	force = 12.0
-	w_class = 2.0
-	throwforce = 15.0
-	throw_speed = 4
-	throw_range = 4
-	sharp = 1
-	edge = 1
-	matter = list("metal" = 15000)
-	origin_tech = "materials=2;combat=1"
-	attack_verb = list("chopped", "torn", "cut")
-
-/obj/item/weapon/hatchet/attack(mob/living/carbon/M as mob, mob/living/carbon/user as mob)
-	playsound(loc, 'sound/weapons/bladeslice.ogg', 50, 1, -1)
-	return ..()
-
-//If it's a hatchet it goes here. I guess
-/obj/item/weapon/hatchet/unathiknife
-	name = "duelling knife"
-	desc = "A length of leather-bound wood studded with razor-sharp teeth. How crude."
-	icon = 'icons/obj/weapons.dmi'
-	icon_state = "unathiknife"
-	attack_verb = list("ripped", "torn", "cut")
-
-/obj/item/weapon/hatchet/tacknife
-	name = "tactical knife"
-	desc = "You'd be killing loads of people if this was Medal of Valor: Heroes of Nyx."
-	icon = 'icons/obj/weapons.dmi'
-	icon_state = "tacknife"
-	item_state = "knife"
-	attack_verb = list("stabbed", "chopped", "cut")
-
-/obj/item/weapon/scythe
-	icon_state = "scythe0"
-	name = "scythe"
-	desc = "A sharp and curved blade on a long fibremetal handle, this tool makes it easy to reap what you sow."
-	force = 13.0
-	throwforce = 5.0
-	throw_speed = 1
-	throw_range = 3
-	w_class = 4.0
-	flags = NOSHIELD
-	slot_flags = SLOT_BACK
-	origin_tech = "materials=2;combat=2"
-	attack_verb = list("chopped", "sliced", "cut", "reaped")
-
-/obj/item/weapon/scythe/afterattack(atom/A, mob/user as mob, proximity)
-	if(!proximity) return
-	if(istype(A, /obj/effect/plantsegment))
-		for(var/obj/effect/plantsegment/B in orange(A,1))
-			if(prob(80))
-				del B
-		del A

code/modules/hydroponics/seed.dm

@@ -0,0 +1,733 @@
+/datum/plantgene
+	var/genetype    // Label used when applying trait.
+	var/list/values // Values to copy into the target seed datum.
+
+/datum/seed
+	//Tracking.
+	var/uid                        // Unique identifier.
+	var/name                       // Index for global list.
+	var/seed_name                  // Plant name for seed packet.
+	var/seed_noun = "seeds"        // Descriptor for packet.
+	var/display_name               // Prettier name.
+	var/roundstart                 // If set, seed will not display variety number.
+	var/mysterious                 // Only used for the random seed packets.
+	var/can_self_harvest = 0       // Mostly used for living mobs.
+	var/growth_stages = 0          // Number of stages the plant passes through before it is mature.
+	var/list/traits = list()       // Initialized in New()
+	var/list/mutants               // Possible predefined mutant varieties, if any.
+	var/list/chems                 // Chemicals that plant produces in products/injects into victim.
+	var/list/consume_gasses        // The plant will absorb these gasses during its life.
+	var/list/exude_gasses          // The plant will exude these gasses during its life.
+	var/kitchen_tag                // Used by the reagent grinder.
+	var/trash_type                 // Garbage item produced when eaten.
+	var/splat_type = /obj/effect/decal/cleanable/fruit_smudge // Graffiti decal.
+	var/has_mob_product
+
+/datum/seed/New()
+
+	set_trait(TRAIT_IMMUTABLE,            0)            // If set, plant will never mutate. If -1, plant is highly mutable.
+	set_trait(TRAIT_HARVEST_REPEAT,       0)            // If 1, this plant will fruit repeatedly.
+	set_trait(TRAIT_PRODUCES_POWER,       0)            // Can be used to make a battery.
+	set_trait(TRAIT_JUICY,                0)            // When thrown, causes a splatter decal.
+	set_trait(TRAIT_EXPLOSIVE,            0)            // When thrown, acts as a grenade.
+	set_trait(TRAIT_CARNIVOROUS,          0)            // 0 = none, 1 = eat pests in tray, 2 = eat living things  (when a vine).
+	set_trait(TRAIT_PARASITE,             0)            // 0 = no, 1 = gain health from weed level.
+	set_trait(TRAIT_STINGS,               0)            // Can cause damage/inject reagents when thrown or handled.
+	set_trait(TRAIT_YIELD,                0)            // Amount of product.
+	set_trait(TRAIT_SPREAD,               0)            // 0 limits plant to tray, 1 = creepers, 2 = vines.
+	set_trait(TRAIT_MATURATION,           0)            // Time taken before the plant is mature.
+	set_trait(TRAIT_PRODUCTION,           0)            // Time before harvesting can be undertaken again.
+	set_trait(TRAIT_TELEPORTING,          0)            // Uses the bluespace tomato effect.
+	set_trait(TRAIT_BIOLUM,               0)            // Plant is bioluminescent.
+	set_trait(TRAIT_ALTER_TEMP,           0)            // If set, the plant will periodically alter local temp by this amount.
+	set_trait(TRAIT_PRODUCT_ICON,         0)            // Icon to use for fruit coming from this plant.
+	set_trait(TRAIT_PLANT_ICON,           0)            // Icon to use for the plant growing in the tray.
+	set_trait(TRAIT_PRODUCT_COLOUR,       0)            // Colour to apply to product icon.
+	set_trait(TRAIT_BIOLUM_COLOUR,        0)            // The colour of the plant's radiance.
+	set_trait(TRAIT_POTENCY,              1)            // General purpose plant strength value.
+	set_trait(TRAIT_REQUIRES_NUTRIENTS,   1)            // The plant can starve.
+	set_trait(TRAIT_REQUIRES_WATER,       1)            // The plant can become dehydrated.
+	set_trait(TRAIT_WATER_CONSUMPTION,    3)            // Plant drinks this much per tick.
+	set_trait(TRAIT_LIGHT_TOLERANCE,      5)            // Departure from ideal that is survivable.
+	set_trait(TRAIT_TOXINS_TOLERANCE,     5)            // Resistance to poison.
+	set_trait(TRAIT_PEST_TOLERANCE,       5)            // Threshold for pests to impact health.
+	set_trait(TRAIT_WEED_TOLERANCE,       5)            // Threshold for weeds to impact health.
+	set_trait(TRAIT_IDEAL_LIGHT,          8)            // Preferred light level in luminosity.
+	set_trait(TRAIT_HEAT_TOLERANCE,       20)           // Departure from ideal that is survivable.
+	set_trait(TRAIT_LOWKPA_TOLERANCE,     25)           // Low pressure capacity.
+	set_trait(TRAIT_ENDURANCE,            100)          // Maximum plant HP when growing.
+	set_trait(TRAIT_HIGHKPA_TOLERANCE,    200)          // High pressure capacity.
+	set_trait(TRAIT_IDEAL_HEAT,           293)          // Preferred temperature in Kelvin.
+	set_trait(TRAIT_NUTRIENT_CONSUMPTION, 0.25)         // Plant eats this much per tick.
+	set_trait(TRAIT_PLANT_COLOUR,         "#6EF86A")    // Colour of the plant icon.
+
+	spawn(5)
+		sleep(-1)
+		update_growth_stages()
+
+/datum/seed/proc/get_trait(var/trait)
+	return traits["[trait]"]
+
+/datum/seed/proc/set_trait(var/trait,var/nval,var/ubound,var/lbound, var/degrade)
+	if(!isnull(degrade)) nval *= degrade
+	if(!isnull(ubound))  nval = min(nval,ubound)
+	if(!isnull(lbound))  nval = max(nval,lbound)
+	traits["[trait]"] =  nval
+
+/datum/seed/proc/create_spores(var/turf/T)
+	if(!T)
+		return
+	if(!istype(T))
+		T = get_turf(T)
+	if(!T)
+		return
+
+	var/datum/reagents/R = new/datum/reagents(100)
+	if(chems.len)
+		for(var/rid in chems)
+			var/injecting = min(5,max(1,get_trait(TRAIT_POTENCY)/3))
+			R.add_reagent(rid,injecting)
+
+	var/datum/effect/effect/system/smoke_spread/chem/spores/S = new(name)
+	S.attach(T)
+	S.set_up(R, round(get_trait(TRAIT_POTENCY)/4), 0, T)
+	S.start()
+
+// Does brute damage to a target.
+/datum/seed/proc/do_thorns(var/mob/living/carbon/human/target, var/obj/item/fruit, var/target_limb)
+
+	if(!get_trait(TRAIT_CARNIVOROUS))
+		return
+
+	if(!istype(target))
+		if(istype(target, /mob/living/simple_animal/mouse))
+			new /obj/effect/decal/remains/mouse(get_turf(target))
+			del(target)
+		else if(istype(target, /mob/living/simple_animal/lizard))
+			new /obj/effect/decal/remains/lizard(get_turf(target))
+			del(target)
+		return
+
+
+	if(!target_limb) target_limb = pick("l_foot","r_foot","l_leg","r_leg","l_hand","r_hand","l_arm", "r_arm","head","chest","groin")
+	var/datum/organ/external/affecting = target.get_organ(target_limb)
+	var/damage = 0
+
+	if(get_trait(TRAIT_CARNIVOROUS))
+		if(get_trait(TRAIT_CARNIVOROUS) == 2)
+			if(affecting)
+				target << "<span class='danger'>\The [fruit]'s thorns pierce your [affecting.display_name] greedily!</span>"
+			else
+				target << "<span class='danger'>\The [fruit]'s thorns pierce your flesh greedily!</span>"
+			damage = get_trait(TRAIT_POTENCY)/2
+		else
+			if(affecting)
+				target << "<span class='danger'>\The [fruit]'s thorns dig deeply into your [affecting.display_name]!</span>"
+			else
+				target << "<span class='danger'>\The [fruit]'s thorns dig deeply into your flesh!</span>"
+			damage = get_trait(TRAIT_POTENCY)/5
+	else
+		return
+
+	if(affecting)
+		affecting.take_damage(damage, 0)
+		affecting.add_autopsy_data("Thorns",damage)
+	else
+		target.adjustBruteLoss(damage)
+	target.UpdateDamageIcon()
+	target.updatehealth()
+
+// Adds reagents to a target.
+/datum/seed/proc/do_sting(var/mob/living/carbon/human/target, var/obj/item/fruit)
+	if(!get_trait(TRAIT_STINGS))
+		return
+	if(chems && chems.len)
+		target << "<span class='danger'>You are stung by \the [fruit]!</span>"
+		for(var/rid in chems)
+			var/injecting = min(5,max(1,get_trait(TRAIT_POTENCY)/5))
+			target.reagents.add_reagent(rid,injecting)
+
+//Splatter a turf.
+/datum/seed/proc/splatter(var/turf/T,var/obj/item/thrown)
+	if(splat_type)
+		var/obj/effect/plant/splat = new splat_type(T, src)
+		if(!istype(splat)) // Plants handle their own stuff.
+			splat.name = "[thrown.name] [pick("smear","smudge","splatter")]"
+			if(get_trait(TRAIT_BIOLUM))
+				if(get_trait(TRAIT_BIOLUM_COLOUR))
+					splat.l_color = get_trait(TRAIT_BIOLUM_COLOUR)
+				splat.SetLuminosity(get_trait(TRAIT_BIOLUM))
+			if(get_trait(TRAIT_PRODUCT_COLOUR))
+				splat.color = get_trait(TRAIT_PRODUCT_COLOUR)
+
+	if(chems)
+		for(var/mob/living/M in T.contents)
+			if(!M.reagents)
+				continue
+			for(var/chem in chems)
+				var/injecting = min(5,max(1,get_trait(TRAIT_POTENCY)/3))
+				M.reagents.add_reagent(chem,injecting)
+
+//Applies an effect to a target atom.
+/datum/seed/proc/thrown_at(var/obj/item/thrown,var/atom/target, var/force_explode)
+
+	var/splatted
+	var/turf/origin_turf = get_turf(target)
+
+	if(force_explode || get_trait(TRAIT_EXPLOSIVE))
+
+		create_spores(origin_turf)
+
+		var/flood_dist = min(10,max(1,get_trait(TRAIT_POTENCY)/15))
+		var/list/open_turfs = list()
+		var/list/closed_turfs = list()
+		var/list/valid_turfs = list()
+		open_turfs |= origin_turf
+
+		// Flood fill to get affected turfs.
+		while(open_turfs.len)
+			var/turf/T = pick(open_turfs)
+			open_turfs -= T
+			closed_turfs |= T
+			valid_turfs |= T
+
+			for(var/dir in alldirs)
+				var/turf/neighbor = get_step(T,dir)
+				if(!neighbor || (neighbor in closed_turfs) || (neighbor in open_turfs))
+					continue
+				if(neighbor.density || get_dist(neighbor,origin_turf) > flood_dist || istype(neighbor,/turf/space))
+					closed_turfs |= neighbor
+					continue
+				// Check for windows.
+				var/no_los
+				var/turf/last_turf = origin_turf
+				for(var/turf/target_turf in getline(origin_turf,neighbor))
+					if(!last_turf.Enter(target_turf) || target_turf.density)
+						no_los = 1
+						break
+					last_turf = target_turf
+				if(!no_los && !origin_turf.Enter(neighbor))
+					no_los = 1
+				if(no_los)
+					closed_turfs |= neighbor
+					continue
+				open_turfs |= neighbor
+
+		for(var/turf/T in valid_turfs)
+			for(var/mob/living/M in T.contents)
+				apply_special_effect(M)
+			splatter(T,thrown)
+		origin_turf.visible_message("<span class='danger'>The [thrown.name] explodes!</span>")
+		del(thrown)
+		return
+
+	if(istype(target,/mob/living))
+		splatted = apply_special_effect(target,thrown)
+	else if(istype(target,/turf))
+		splatted = 1
+		for(var/mob/living/M in target.contents)
+			apply_special_effect(M)
+
+	if(get_trait(TRAIT_JUICY) && splatted)
+		splatter(origin_turf,thrown)
+		origin_turf.visible_message("<span class='danger'>The [thrown.name] splatters against [target]!</span>")
+		del(thrown)
+
+/datum/seed/proc/handle_environment(var/turf/current_turf, var/datum/gas_mixture/environment, var/light_supplied, var/check_only)
+
+	var/health_change = 0
+	// Handle gas consumption.
+	if(consume_gasses && consume_gasses.len)
+		var/missing_gas = 0
+		for(var/gas in consume_gasses)
+			if(environment && environment.gas && environment.gas[gas] && \
+			 environment.gas[gas] >= consume_gasses[gas])
+				if(!check_only)
+					environment.adjust_gas(gas,-consume_gasses[gas],1)
+			else
+				missing_gas++
+
+		if(missing_gas > 0)
+			health_change += missing_gas * HYDRO_SPEED_MULTIPLIER
+
+	// Process it.
+	var/pressure = environment.return_pressure()
+	if(pressure < get_trait(TRAIT_LOWKPA_TOLERANCE)|| pressure > get_trait(TRAIT_HIGHKPA_TOLERANCE))
+		health_change += rand(1,3) * HYDRO_SPEED_MULTIPLIER
+
+	if(abs(environment.temperature - get_trait(TRAIT_IDEAL_HEAT)) > get_trait(TRAIT_HEAT_TOLERANCE))
+		health_change += rand(1,3) * HYDRO_SPEED_MULTIPLIER
+
+	// Handle gas production.
+	if(exude_gasses && exude_gasses.len && !check_only)
+		for(var/gas in exude_gasses)
+			environment.adjust_gas(gas, max(1,round((exude_gasses[gas]*(get_trait(TRAIT_POTENCY)/5))/exude_gasses.len)))
+
+	// Handle light requirements.
+	if(!light_supplied)
+		var/area/A = get_area(current_turf)
+		if(A)
+			if(A.lighting_use_dynamic)
+				light_supplied = max(0,min(10,current_turf.lighting_lumcount)-5)
+			else
+				light_supplied =  5
+	if(light_supplied)
+		if(abs(light_supplied - get_trait(TRAIT_IDEAL_LIGHT)) > get_trait(TRAIT_LIGHT_TOLERANCE))
+			health_change += rand(1,3) * HYDRO_SPEED_MULTIPLIER
+
+	return health_change
+
+/datum/seed/proc/apply_special_effect(var/mob/living/target,var/obj/item/thrown)
+
+	var/impact = 1
+	do_sting(target,thrown)
+	do_thorns(target,thrown)
+
+	// Bluespace tomato code copied over from grown.dm.
+	if(get_trait(TRAIT_TELEPORTING))
+
+		//Plant potency determines radius of teleport.
+		var/outer_teleport_radius = get_trait(TRAIT_POTENCY)/5
+		var/inner_teleport_radius = get_trait(TRAIT_POTENCY)/15
+
+		var/list/turfs = list()
+		if(inner_teleport_radius > 0)
+			for(var/turf/T in orange(target,outer_teleport_radius))
+				if(get_dist(target,T) >= inner_teleport_radius)
+					turfs |= T
+
+		if(turfs.len)
+			// Moves the mob, causes sparks.
+			var/datum/effect/effect/system/spark_spread/s = new /datum/effect/effect/system/spark_spread
+			s.set_up(3, 1, get_turf(target))
+			s.start()
+			var/turf/picked = get_turf(pick(turfs))                      // Just in case...
+			new/obj/effect/decal/cleanable/molten_item(get_turf(target)) // Leave a pile of goo behind for dramatic effect...
+			target.loc = picked                                          // And teleport them to the chosen location.
+
+			impact = 1
+
+	return impact
+
+//Creates a random seed. MAKE SURE THE LINE HAS DIVERGED BEFORE THIS IS CALLED.
+/datum/seed/proc/randomize()
+
+	roundstart = 0
+	seed_name = "strange plant"     // TODO: name generator.
+	display_name = "strange plants" // TODO: name generator.
+	mysterious = 1
+	seed_noun = pick("spores","nodes","cuttings","seeds")
+
+	set_trait(TRAIT_POTENCY,rand(5,30),200,0)
+	set_trait(TRAIT_PRODUCT_ICON,pick(plant_controller.plant_product_sprites))
+	set_trait(TRAIT_PLANT_ICON,pick(plant_controller.plant_sprites))
+	set_trait(TRAIT_PLANT_COLOUR,"#[get_random_colour(0,75,190)]")
+	set_trait(TRAIT_PRODUCT_COLOUR,"#[get_random_colour(0,75,190)]")
+	update_growth_stages()
+
+	if(prob(20))
+		set_trait(TRAIT_HARVEST_REPEAT,1)
+
+	if(prob(15))
+		if(prob(15))
+			set_trait(TRAIT_JUICY,2)
+		else
+			set_trait(TRAIT_JUICY,1)
+
+	if(prob(5))
+		set_trait(TRAIT_STINGS,1)
+
+	if(prob(5))
+		set_trait(TRAIT_PRODUCES_POWER,1)
+
+	if(prob(1))
+		set_trait(TRAIT_EXPLOSIVE,1)
+	else if(prob(1))
+		set_trait(TRAIT_TELEPORTING,1)
+
+	if(prob(5))
+		consume_gasses = list()
+		var/gas = pick("oxygen","nitrogen","phoron","carbon_dioxide")
+		consume_gasses[gas] = rand(3,9)
+
+	if(prob(5))
+		exude_gasses = list()
+		var/gas = pick("oxygen","nitrogen","phoron","carbon_dioxide")
+		exude_gasses[gas] = rand(3,9)
+
+	chems = list()
+	if(prob(80))
+		chems["nutriment"] = list(rand(1,10),rand(10,20))
+
+	var/additional_chems = rand(0,5)
+
+	if(additional_chems)
+		var/list/possible_chems = list(
+			"woodpulp",
+			"bicaridine",
+			"hyperzine",
+			"cryoxadone",
+			"blood",
+			"water",
+			"potassium",
+			"plasticide",
+			"mutationtoxin",
+			"amutationtoxin",
+			"inaprovaline",
+			"space_drugs",
+			"paroxetine",
+			"mercury",
+			"sugar",
+			"radium",
+			"ryetalyn",
+			"alkysine",
+			"thermite",
+			"tramadol",
+			"cryptobiolin",
+			"dermaline",
+			"dexalin",
+			"phoron",
+			"synaptizine",
+			"impedrezene",
+			"hyronalin",
+			"peridaxon",
+			"toxin",
+			"rezadone",
+			"ethylredoxrazine",
+			"slimejelly",
+			"cyanide",
+			"mindbreaker",
+			"stoxin"
+			)
+
+		for(var/x=1;x<=additional_chems;x++)
+			if(!possible_chems.len)
+				break
+			var/new_chem = pick(possible_chems)
+			possible_chems -= new_chem
+			chems[new_chem] = list(rand(1,10),rand(10,20))
+
+	if(prob(90))
+		set_trait(TRAIT_REQUIRES_NUTRIENTS,1)
+		set_trait(TRAIT_NUTRIENT_CONSUMPTION,rand(25)/25)
+	else
+		set_trait(TRAIT_REQUIRES_NUTRIENTS,0)
+
+	if(prob(90))
+		set_trait(TRAIT_REQUIRES_WATER,1)
+		set_trait(TRAIT_WATER_CONSUMPTION,rand(10))
+	else
+		set_trait(TRAIT_REQUIRES_WATER,0)
+
+	set_trait(TRAIT_IDEAL_HEAT,       rand(100,400))
+	set_trait(TRAIT_HEAT_TOLERANCE,   rand(10,30))
+	set_trait(TRAIT_IDEAL_LIGHT,      rand(2,10))
+	set_trait(TRAIT_LIGHT_TOLERANCE,  rand(2,7))
+	set_trait(TRAIT_TOXINS_TOLERANCE, rand(2,7))
+	set_trait(TRAIT_PEST_TOLERANCE,   rand(2,7))
+	set_trait(TRAIT_WEED_TOLERANCE,   rand(2,7))
+	set_trait(TRAIT_LOWKPA_TOLERANCE, rand(10,50))
+	set_trait(TRAIT_HIGHKPA_TOLERANCE,rand(100,300))
+
+	if(prob(5))
+		set_trait(TRAIT_ALTER_TEMP,rand(-5,5))
+
+	if(prob(1))
+		set_trait(TRAIT_IMMUTABLE,-1)
+
+	var/carnivore_prob = rand(100)
+	if(carnivore_prob < 5)
+		set_trait(TRAIT_CARNIVOROUS,2)
+	else if(carnivore_prob < 10)
+		set_trait(TRAIT_CARNIVOROUS,1)
+
+	if(prob(10))
+		set_trait(TRAIT_PARASITE,1)
+
+	var/vine_prob = rand(100)
+	if(vine_prob < 5)
+		set_trait(TRAIT_SPREAD,2)
+	else if(vine_prob < 10)
+		set_trait(TRAIT_SPREAD,1)
+
+	if(prob(5))
+		set_trait(TRAIT_BIOLUM,1)
+		set_trait(TRAIT_BIOLUM_COLOUR,"#[get_random_colour(0,75,190)]")
+
+	set_trait(TRAIT_ENDURANCE,rand(60,100))
+	set_trait(TRAIT_YIELD,rand(3,15))
+	set_trait(TRAIT_MATURATION,rand(5,15))
+	set_trait(TRAIT_PRODUCTION,get_trait(TRAIT_MATURATION)+rand(2,5))
+
+//Returns a key corresponding to an entry in the global seed list.
+/datum/seed/proc/get_mutant_variant()
+	if(!mutants || !mutants.len || get_trait(TRAIT_IMMUTABLE) > 0) return 0
+	return pick(mutants)
+
+//Mutates the plant overall (randomly).
+/datum/seed/proc/mutate(var/degree,var/turf/source_turf)
+
+	if(!degree || get_trait(TRAIT_IMMUTABLE) > 0) return
+
+	source_turf.visible_message("<span class='notice'>\The [display_name] quivers!</span>")
+
+	//This looks like shit, but it's a lot easier to read/change this way.
+	var/total_mutations = rand(1,1+degree)
+	for(var/i = 0;i<total_mutations;i++)
+		switch(rand(0,11))
+			if(0) //Plant cancer!
+				set_trait(TRAIT_ENDURANCE,get_trait(TRAIT_ENDURANCE)-rand(10,20),null,0)
+				source_turf.visible_message("<span class='danger'>\The [display_name] withers rapidly!</span>")
+			if(1)
+				set_trait(TRAIT_NUTRIENT_CONSUMPTION,get_trait(TRAIT_NUTRIENT_CONSUMPTION)+rand(-(degree*0.1),(degree*0.1)),5,0)
+				set_trait(TRAIT_WATER_CONSUMPTION,   get_trait(TRAIT_WATER_CONSUMPTION)   +rand(-degree,degree),50,0)
+				set_trait(TRAIT_JUICY,              !get_trait(TRAIT_JUICY))
+				set_trait(TRAIT_STINGS,             !get_trait(TRAIT_STINGS))
+			if(2)
+				set_trait(TRAIT_IDEAL_HEAT,          get_trait(TRAIT_IDEAL_HEAT) +      (rand(-5,5)*degree),800,70)
+				set_trait(TRAIT_HEAT_TOLERANCE,      get_trait(TRAIT_HEAT_TOLERANCE) +  (rand(-5,5)*degree),800,70)
+				set_trait(TRAIT_LOWKPA_TOLERANCE,    get_trait(TRAIT_LOWKPA_TOLERANCE)+ (rand(-5,5)*degree),80,0)
+				set_trait(TRAIT_HIGHKPA_TOLERANCE,   get_trait(TRAIT_HIGHKPA_TOLERANCE)+(rand(-5,5)*degree),500,110)
+				set_trait(TRAIT_EXPLOSIVE,1)
+			if(3)
+				set_trait(TRAIT_IDEAL_LIGHT,         get_trait(TRAIT_IDEAL_LIGHT)+(rand(-1,1)*degree),30,0)
+				set_trait(TRAIT_LIGHT_TOLERANCE,     get_trait(TRAIT_LIGHT_TOLERANCE)+(rand(-2,2)*degree),10,0)
+			if(4)
+				set_trait(TRAIT_TOXINS_TOLERANCE,    get_trait(TRAIT_TOXINS_TOLERANCE)+(rand(-2,2)*degree),10,0)
+			if(5)
+				set_trait(TRAIT_WEED_TOLERANCE,      get_trait(TRAIT_WEED_TOLERANCE)+(rand(-2,2)*degree),10, 0)
+				if(prob(degree*5))
+					set_trait(TRAIT_CARNIVOROUS,     get_trait(TRAIT_CARNIVOROUS)+rand(-degree,degree),2, 0)
+					if(get_trait(TRAIT_CARNIVOROUS))
+						source_turf.visible_message("<span class='notice'>\The [display_name] shudders hungrily.</span>")
+			if(6)
+				set_trait(TRAIT_WEED_TOLERANCE,      get_trait(TRAIT_WEED_TOLERANCE)+(rand(-2,2)*degree),10, 0)
+				if(prob(degree*5))
+					set_trait(TRAIT_PARASITE,!get_trait(TRAIT_PARASITE))
+			if(7)
+				if(get_trait(TRAIT_YIELD) != -1)
+					set_trait(TRAIT_YIELD,           get_trait(TRAIT_YIELD)+(rand(-2,2)*degree),10,0)
+			if(8)
+				set_trait(TRAIT_ENDURANCE,           get_trait(TRAIT_ENDURANCE)+(rand(-5,5)*degree),100,10)
+				set_trait(TRAIT_PRODUCTION,          get_trait(TRAIT_PRODUCTION)+(rand(-1,1)*degree),10, 1)
+				set_trait(TRAIT_POTENCY,             get_trait(TRAIT_POTENCY)+(rand(-20,20)*degree),200, 0)
+				if(prob(degree*5))
+					set_trait(TRAIT_SPREAD,          get_trait(TRAIT_SPREAD)+rand(-1,1),2, 0)
+					source_turf.visible_message("<span class='notice'>\The [display_name] spasms visibly, shifting in the tray.</span>")
+			if(9)
+				set_trait(TRAIT_MATURATION,          get_trait(TRAIT_MATURATION)+(rand(-1,1)*degree),30, 0)
+				if(prob(degree*5))
+					set_trait(TRAIT_HARVEST_REPEAT, !get_trait(TRAIT_HARVEST_REPEAT))
+			if(10)
+				if(prob(degree*2))
+					set_trait(TRAIT_BIOLUM,         !get_trait(TRAIT_BIOLUM))
+					if(get_trait(TRAIT_BIOLUM))
+						source_turf.visible_message("<span class='notice'>\The [display_name] begins to glow!</span>")
+						if(prob(degree*2))
+							set_trait(TRAIT_BIOLUM_COLOUR,"#[get_random_colour(0,75,190)]")
+							source_turf.visible_message("<span class='notice'>\The [display_name]'s glow </span><font color='[get_trait(TRAIT_BIOLUM_COLOUR)]'>changes colour</font>!")
+					else
+						source_turf.visible_message("<span class='notice'>\The [display_name]'s glow dims...</span>")
+			if(11)
+				set_trait(TRAIT_TELEPORTING,1)
+
+	return
+
+//Mutates a specific trait/set of traits.
+/datum/seed/proc/apply_gene(var/datum/plantgene/gene)
+
+	if(!gene || !gene.values || get_trait(TRAIT_IMMUTABLE) > 0) return
+
+	// Splicing products has some detrimental effects on yield and lifespan.
+	// We handle this before we do the rest of the looping, as normal traits don't really include lists.
+	switch(gene.genetype)
+		if(GENE_BIOCHEMISTRY)
+			for(var/trait in list(TRAIT_YIELD, TRAIT_ENDURANCE))
+				if(get_trait(trait) > 0) set_trait(trait,get_trait(trait),null,1,0.85)
+
+			if(!chems) chems = list()
+
+			var/list/gene_value = gene.values["[TRAIT_CHEMS]"]
+			for(var/rid in gene_value)
+
+				var/list/gene_chem = gene_value[rid]
+
+				if(!chems[rid])
+					chems[rid] = gene_chem.Copy()
+					continue
+
+				for(var/i=1;i<=gene_chem.len;i++)
+
+					if(isnull(gene_chem[i])) gene_chem[i] = 0
+
+					if(chems[rid][i])
+						chems[rid][i] = max(1,round((gene_chem[i] + chems[rid][i])/2))
+					else
+						chems[rid][i] = gene_chem[i]
+
+			var/list/new_gasses = gene.values["[TRAIT_EXUDE_GASSES]"]
+			if(islist(new_gasses))
+				if(!exude_gasses) exude_gasses = list()
+				exude_gasses |= new_gasses
+				for(var/gas in exude_gasses)
+					exude_gasses[gas] = max(1,round(exude_gasses[gas]*0.8))
+
+			gene.values["[TRAIT_EXUDE_GASSES]"] = null
+			gene.values["[TRAIT_CHEMS]"] = null
+
+		if(GENE_DIET)
+			var/list/new_gasses = gene.values["[TRAIT_CONSUME_GASSES]"]
+			consume_gasses |= new_gasses
+			gene.values["[TRAIT_CONSUME_GASSES]"] = null
+		if(GENE_METABOLISM)
+			has_mob_product = gene.values["mob_product"]
+			gene.values["mob_product"] = null
+
+	for(var/trait in gene.values)
+		set_trait(trait,gene.values["[trait]"])
+
+	update_growth_stages()
+
+//Returns a list of the desired trait values.
+/datum/seed/proc/get_gene(var/genetype)
+
+	if(!genetype) return 0
+
+	var/list/traits_to_copy
+	var/datum/plantgene/P = new()
+	P.genetype = genetype
+	P.values = list()
+
+	switch(genetype)
+		if(GENE_BIOCHEMISTRY)
+			P.values["[TRAIT_CHEMS]"] =        chems
+			P.values["[TRAIT_EXUDE_GASSES]"] = exude_gasses
+			traits_to_copy = list(TRAIT_POTENCY)
+		if(GENE_OUTPUT)
+			traits_to_copy = list(TRAIT_PRODUCES_POWER,TRAIT_BIOLUM)
+		if(GENE_ATMOSPHERE)
+			traits_to_copy = list(TRAIT_HEAT_TOLERANCE,TRAIT_LOWKPA_TOLERANCE,TRAIT_HIGHKPA_TOLERANCE)
+		if(GENE_HARDINESS)
+			traits_to_copy = list(TRAIT_TOXINS_TOLERANCE,TRAIT_PEST_TOLERANCE,TRAIT_WEED_TOLERANCE,TRAIT_ENDURANCE)
+		if(GENE_METABOLISM)
+			P.values["mob_product"] = has_mob_product
+			traits_to_copy = list(TRAIT_REQUIRES_NUTRIENTS,TRAIT_REQUIRES_WATER,TRAIT_ALTER_TEMP)
+		if(GENE_VIGOUR)
+			traits_to_copy = list(TRAIT_PRODUCTION,TRAIT_MATURATION,TRAIT_YIELD,TRAIT_SPREAD)
+		if(GENE_DIET)
+			P.values["[TRAIT_CONSUME_GASSES]"] = consume_gasses
+			traits_to_copy = list(TRAIT_CARNIVOROUS,TRAIT_PARASITE,TRAIT_NUTRIENT_CONSUMPTION,TRAIT_WATER_CONSUMPTION)
+		if(GENE_ENVIRONMENT)
+			traits_to_copy = list(TRAIT_IDEAL_HEAT,TRAIT_IDEAL_LIGHT,TRAIT_LIGHT_TOLERANCE)
+		if(GENE_PIGMENT)
+			traits_to_copy = list(TRAIT_PLANT_COLOUR,TRAIT_PRODUCT_COLOUR,TRAIT_BIOLUM_COLOUR)
+		if(GENE_STRUCTURE)
+			traits_to_copy = list(TRAIT_PLANT_ICON,TRAIT_PRODUCT_ICON,TRAIT_HARVEST_REPEAT)
+		if(GENE_FRUIT)
+			traits_to_copy = list(TRAIT_STINGS,TRAIT_EXPLOSIVE,TRAIT_JUICY)
+		if(GENE_SPECIAL)
+			traits_to_copy = list(TRAIT_TELEPORTING)
+
+	for(var/trait in traits_to_copy)
+		P.values["[trait]"] = get_trait(trait)
+	return (P ? P : 0)
+
+//Place the plant products at the feet of the user.
+/datum/seed/proc/harvest(var/mob/user,var/yield_mod,var/harvest_sample,var/force_amount)
+
+	if(!user)
+		return
+
+	if(!force_amount && get_trait(TRAIT_YIELD) == 0 && !harvest_sample)
+		if(istype(user)) user << "<span class='danger'>You fail to harvest anything useful.</span>"
+	else
+		if(istype(user)) user << "You [harvest_sample ? "take a sample" : "harvest"] from the [display_name]."
+
+		//This may be a new line. Update the global if it is.
+		if(name == "new line" || !(name in plant_controller.seeds))
+			uid = plant_controller.seeds.len + 1
+			name = "[uid]"
+			plant_controller.seeds[name] = src
+
+		if(harvest_sample)
+			var/obj/item/seeds/seeds = new(get_turf(user))
+			seeds.seed_type = name
+			seeds.update_seed()
+			return
+
+		var/total_yield = 0
+		if(!isnull(force_amount))
+			total_yield = force_amount
+		else
+			if(get_trait(TRAIT_YIELD) > -1)
+				if(isnull(yield_mod) || yield_mod < 1)
+					yield_mod = 0
+					total_yield = get_trait(TRAIT_YIELD)
+				else
+					total_yield = get_trait(TRAIT_YIELD) + rand(yield_mod)
+				total_yield = max(1,total_yield)
+
+		currently_querying = list()
+		for(var/i = 0;i<total_yield;i++)
+			var/obj/item/product
+			if(has_mob_product)
+				product = new has_mob_product(get_turf(user),name)
+			else
+				product = new /obj/item/weapon/reagent_containers/food/snacks/grown(get_turf(user),name)
+			if(get_trait(TRAIT_PRODUCT_COLOUR))
+				product.color = get_trait(TRAIT_PRODUCT_COLOUR)
+				if(istype(product,/obj/item/weapon/reagent_containers/food))
+					var/obj/item/weapon/reagent_containers/food/food = product
+					food.filling_color = get_trait(TRAIT_PRODUCT_COLOUR)
+
+			if(mysterious)
+				product.name += "?"
+				product.desc += " On second thought, something about this one looks strange."
+
+			if(get_trait(TRAIT_BIOLUM))
+				if(get_trait(TRAIT_BIOLUM_COLOUR))
+					product.l_color = get_trait(TRAIT_BIOLUM_COLOUR)
+				product.SetLuminosity(get_trait(TRAIT_BIOLUM))
+
+			//Handle spawning in living, mobile products (like dionaea).
+			if(istype(product,/mob/living))
+				product.visible_message("<span class='notice'>The pod disgorges [product]!</span>")
+				handle_living_product(product)
+				if(istype(product,/mob/living/simple_animal/mushroom)) // Gross.
+					var/mob/living/simple_animal/mushroom/mush = product
+					mush.seed = src
+
+// When the seed in this machine mutates/is modified, the tray seed value
+// is set to a new datum copied from the original. This datum won't actually
+// be put into the global datum list until the product is harvested, though.
+/datum/seed/proc/diverge(var/modified)
+
+	if(get_trait(TRAIT_IMMUTABLE) > 0) return
+
+	//Set up some basic information.
+	var/datum/seed/new_seed = new
+	new_seed.name =            "new line"
+	new_seed.uid =              0
+	new_seed.roundstart =       0
+	new_seed.can_self_harvest = can_self_harvest
+	new_seed.kitchen_tag =      kitchen_tag
+	new_seed.trash_type =       trash_type
+	new_seed.has_mob_product =  has_mob_product
+	//Copy over everything else.
+	if(mutants)        new_seed.mutants = mutants.Copy()
+	if(chems)          new_seed.chems = chems.Copy()
+	if(consume_gasses) new_seed.consume_gasses = consume_gasses.Copy()
+	if(exude_gasses)   new_seed.exude_gasses = exude_gasses.Copy()
+
+	new_seed.seed_name =            "[(roundstart ? "[(modified ? "modified" : "mutant")] " : "")][seed_name]"
+	new_seed.display_name =         "[(roundstart ? "[(modified ? "modified" : "mutant")] " : "")][display_name]"
+	new_seed.seed_noun =            seed_noun
+	new_seed.traits = traits.Copy()
+	new_seed.update_growth_stages()
+	return new_seed
+
+/datum/seed/proc/update_growth_stages()
+	if(get_trait(TRAIT_PLANT_ICON))
+		growth_stages = plant_controller.plant_sprites[get_trait(TRAIT_PLANT_ICON)]
+	else
+		growth_stages = 0

code/modules/hydroponics/seed_controller.dm

@@ -0,0 +1,148 @@
+// Attempts to offload processing for the spreading plants from the MC.
+// Processes vines/spreading plants.
+
+#define PLANTS_PER_TICK 500 // Cap on number of plant segments processed.
+#define PLANT_TICK_TIME 25  // Number of ticks between the plant processor cycling.
+
+// Debug for testing seed genes.
+/client/proc/show_plant_genes()
+	set category = "Debug"
+	set name = "Show Plant Genes"
+	set desc = "Prints the round's plant gene masks."
+
+	if(!holder)	return
+
+	if(!plant_controller || !plant_controller.gene_tag_masks)
+		usr << "Gene masks not set."
+		return
+
+	for(var/mask in plant_controller.gene_tag_masks)
+		usr << "[mask]: [plant_controller.gene_tag_masks[mask]]"
+
+var/global/datum/controller/plants/plant_controller // Set in New().
+
+/datum/controller/plants
+
+	var/plants_per_tick = PLANTS_PER_TICK
+	var/plant_tick_time = PLANT_TICK_TIME
+	var/list/product_descs = list()         // Stores generated fruit descs.
+	var/list/plant_queue = list()           // All queued plants.
+	var/list/seeds = list()                 // All seed data stored here.
+	var/list/gene_tag_masks = list()        // Gene obfuscation for delicious trial and error goodness.
+	var/list/plant_icon_cache = list()      // Stores images of growth, fruits and seeds.
+	var/list/plant_sprites = list()         // List of all harvested product sprites.
+	var/list/plant_product_sprites = list() // List of all growth sprites plus number of growth stages.
+	var/processing = 0                      // Off/on.
+
+/datum/controller/plants/New()
+	if(plant_controller && plant_controller != src)
+		log_debug("Rebuilding plant controller.")
+		del(plant_controller)
+	plant_controller = src
+	setup()
+	process()
+
+// Predefined/roundstart varieties use a string key to make it
+// easier to grab the new variety when mutating. Post-roundstart
+// and mutant varieties use their uid converted to a string instead.
+// Looks like shit but it's sort of necessary.
+/datum/controller/plants/proc/setup()
+
+	// Build the icon lists.
+	for(var/icostate in icon_states('icons/obj/hydroponics_growing.dmi'))
+		var/split = findtext(icostate,"-")
+		if(!split)
+			// invalid icon_state
+			continue
+
+		var/ikey = copytext(icostate,(split+1))
+		if(ikey == "dead")
+			// don't count dead icons
+			continue
+		ikey = text2num(ikey)
+		var/base = copytext(icostate,1,split)
+
+		if(!(plant_sprites[base]) || (plant_sprites[base]<ikey))
+			plant_sprites[base] = ikey
+
+	for(var/icostate in icon_states('icons/obj/hydroponics_products.dmi'))
+		plant_product_sprites |= icostate
+
+	// Populate the global seed datum list.
+	for(var/type in typesof(/datum/seed)-/datum/seed)
+		var/datum/seed/S = new type
+		seeds[S.name] = S
+		S.uid = "[seeds.len]"
+		S.roundstart = 1
+
+	// Make sure any seed packets that were mapped in are updated
+	// correctly (since the seed datums did not exist a tick ago).
+	for(var/obj/item/seeds/S in world)
+		S.update_seed()
+
+	//Might as well mask the gene types while we're at it.
+	var/list/used_masks = list()
+	var/list/plant_traits = ALL_GENES
+	while(plant_traits && plant_traits.len)
+		var/gene_tag = pick(plant_traits)
+		var/gene_mask = "[uppertext(num2hex(rand(0,255)))]"
+
+		while(gene_mask in used_masks)
+			gene_mask = "[uppertext(num2hex(rand(0,255)))]"
+
+		used_masks += gene_mask
+		plant_traits -= gene_tag
+		gene_tag_masks[gene_tag] = gene_mask
+
+// Proc for creating a random seed type.
+/datum/controller/plants/proc/create_random_seed(var/survive_on_station)
+	var/datum/seed/seed = new()
+	seed.randomize()
+	seed.uid = plant_controller.seeds.len + 1
+	seed.name = "[seed.uid]"
+	seeds[seed.name] = seed
+
+	if(survive_on_station)
+		if(seed.consume_gasses)
+			seed.consume_gasses["phoron"] = null
+			seed.consume_gasses["carbon_dioxide"] = null
+		if(seed.chems && !isnull(seed.chems["pacid"]))
+			seed.chems["pacid"] = null // Eating through the hull will make these plants completely inviable, albeit very dangerous.
+			seed.chems -= null // Setting to null does not actually remove the entry, which is weird.
+		seed.set_trait(TRAIT_IDEAL_HEAT,293)
+		seed.set_trait(TRAIT_HEAT_TOLERANCE,20)
+		seed.set_trait(TRAIT_IDEAL_LIGHT,8)
+		seed.set_trait(TRAIT_LIGHT_TOLERANCE,5)
+		seed.set_trait(TRAIT_LOWKPA_TOLERANCE,25)
+		seed.set_trait(TRAIT_HIGHKPA_TOLERANCE,200)
+	return seed
+
+/datum/controller/plants/proc/process()
+	processing = 1
+	spawn(0)
+		set background = 1
+		var/processed = 0
+		while(1)
+			if(!processing)
+				sleep(plant_tick_time)
+			else
+				processed = 0
+				if(plant_queue.len)
+					var/target_to_process = min(plant_queue.len,plants_per_tick)
+					for(var/x=0;x<target_to_process;x++)
+						if(!plant_queue.len)
+							break
+						var/obj/effect/plant/plant = pick(plant_queue)
+						plant_queue -= plant
+						if(!istype(plant))
+							continue
+						plant.process()
+						processed++
+						sleep(1) // Stagger processing out so previous tick can resolve (overlapping plant segments etc)
+				sleep(max(1,(plant_tick_time-processed)))
+
+/datum/controller/plants/proc/add_plant(var/obj/effect/plant/plant)
+	plant_queue |= plant
+
+/datum/controller/plants/proc/remove_plant(var/obj/effect/plant/plant)
+	plant_queue -= plant

code/modules/hydroponics/seed_machines.dm

@@ -1,7 +1,7 @@
 /obj/item/weapon/disk/botany
 	name = "flora data disk"
 	desc = "A small disk used for carrying data on plant genetics."
-	icon = 'icons/obj/hydroponics.dmi'
+	icon = 'icons/obj/hydroponics_machines.dmi'
 	icon_state = "disk"
 	w_class = 1.0
 
@@ -16,7 +16,7 @@
 /obj/item/weapon/disk/botany/attack_self(var/mob/user as mob)
 	if(genes.len)
 		var/choice = alert(user, "Are you sure you want to wipe the disk?", "Xenobotany Data", "No", "Yes")
-		if(src && user && genes && choice == "Yes")
+		if(src && user && genes && choice && choice == "Yes" && user.Adjacent(get_turf(src)))
 			user << "You wipe the disk data."
 			name = initial(name)
 			desc = initial(name)
@@ -33,7 +33,7 @@
 		new /obj/item/weapon/disk/botany(src)
 
 /obj/machinery/botany
-	icon = 'icons/obj/hydroponics.dmi'
+	icon = 'icons/obj/hydroponics_machines.dmi'
 	icon_state = "hydrotray3"
 	density = 1
 	anchored = 1
@@ -44,7 +44,7 @@
 
 	var/open = 0
 	var/active = 0
-	var/action_time = 50
+	var/action_time = 5
 	var/last_action = 0
 	var/eject_disk = 0
 	var/failed_task = 0
@@ -85,7 +85,7 @@
 			user << "There is already a seed loaded."
 			return
 		var/obj/item/seeds/S =W
-		if(S.seed && S.seed.immutable > 0)
+		if(S.seed && S.seed.get_trait(TRAIT_IMMUTABLE) > 0)
 			user << "That seed is not compatible with our genetics technology."
 		else
 			user.drop_item(W)
@@ -96,7 +96,7 @@
 
 	if(istype(W,/obj/item/weapon/screwdriver))
 		open = !open
-		user << "\blue You [open ? "open" : "close"] the maintenance panel."
+		user << "<span class='notice'>You [open ? "open" : "close"] the maintenance panel.</span>"
 		return
 
 	if(open)
@@ -144,8 +144,8 @@
 	var/list/data = list()
 
 	var/list/geneMasks[0]
-	for(var/gene_tag in gene_tag_masks)
-		geneMasks.Add(list(list("tag" = gene_tag, "mask" = gene_tag_masks[gene_tag])))
+	for(var/gene_tag in plant_controller.gene_tag_masks)
+		geneMasks.Add(list(list("tag" = gene_tag, "mask" = plant_controller.gene_tag_masks[gene_tag])))
 	data["geneMasks"] = geneMasks
 
 	data["activity"] = active
@@ -186,10 +186,10 @@
 		if(!seed) return
 		seed.loc = get_turf(src)
 
-		if(seed.seed.name == "new line" || isnull(seed_types[seed.seed.name]))
-			seed.seed.uid = seed_types.len + 1
+		if(seed.seed.name == "new line" || isnull(plant_controller.seeds[seed.seed.name]))
+			seed.seed.uid = plant_controller.seeds.len + 1
 			seed.seed.name = "[seed.seed.uid]"
-			seed_types[seed.seed.name] = seed.seed
+			plant_controller.seeds[seed.seed.name] = seed.seed
 
 		seed.update_seed()
 		visible_message("\icon[src] [src] beeps and spits out [seed].")
@@ -242,8 +242,8 @@
 		if(!genetics.roundstart)
 			loaded_disk.genesource += " (variety #[genetics.uid])"
 
-		loaded_disk.name += " ([gene_tag_masks[href_list["get_gene"]]], #[genetics.uid])"
-		loaded_disk.desc += " The label reads \'gene [gene_tag_masks[href_list["get_gene"]]], sampled from [genetics.display_name]\'."
+		loaded_disk.name += " ([plant_controller.gene_tag_masks[href_list["get_gene"]]], #[genetics.uid])"
+		loaded_disk.desc += " The label reads \'gene [plant_controller.gene_tag_masks[href_list["get_gene"]]], sampled from [genetics.display_name]\'."
 		eject_disk = 1
 
 		degradation += rand(20,60)
@@ -288,7 +288,7 @@
 
 		for(var/datum/plantgene/P in loaded_disk.genes)
 			if(data["locus"] != "") data["locus"] += ", "
-			data["locus"] += "[gene_tag_masks[P.genetype]]"
+			data["locus"] += "[plant_controller.gene_tag_masks[P.genetype]]"
 
 	else
 		data["disk"] = 0
@@ -318,7 +318,7 @@
 		last_action = world.time
 		active = 1
 
-		if(!isnull(seed_types[seed.seed.name]))
+		if(!isnull(plant_controller.seeds[seed.seed.name]))
 			seed.seed = seed.seed.diverge(1)
 			seed.seed_type = seed.seed.name
 			seed.update_seed()

code/modules/hydroponics/seed_mobs.dm

@@ -1,5 +1,4 @@
 /datum/seed
-	var/product_requires_player // If yes, product will ask for a player among the ghosts.
 	var/list/currently_querying // Used to avoid asking the same ghost repeatedly.
 
 // The following procs are used to grab players for mobs produced by a seed (mostly for dionaea).
@@ -7,20 +6,21 @@
 
 	if(!host || !istype(host)) return
 
-	if(product_requires_player)
-		spawn(0)
-			request_player(host)
-		spawn(75)
-			if(!host.ckey && !host.client)
-				host.death()  // This seems redundant, but a lot of mobs don't
-				host.stat = 2 // handle death() properly. Better safe than etc.
-				host.visible_message("\red <b>[host] is malformed and unable to survive. It expires pitifully, leaving behind some seeds.")
+	spawn(0)
+		request_player(host)
+	if(istype(host,/mob/living/simple_animal))
+		return
+	spawn(75)
+		if(!host.ckey && !host.client)
+			host.death()  // This seems redundant, but a lot of mobs don't
+			host.stat = 2 // handle death() properly. Better safe than etc.
+			host.visible_message("<span class='danger'>[host] is malformed and unable to survive. It expires pitifully, leaving behind some seeds.</span>")
 
-				var/total_yield = rand(1,3)
-				for(var/j = 0;j<=total_yield;j++)
-					var/obj/item/seeds/S = new(get_turf(host))
-					S.seed_type = name
-					S.update_seed()
+			var/total_yield = rand(1,3)
+			for(var/j = 0;j<=total_yield;j++)
+				var/obj/item/seeds/S = new(get_turf(host))
+				S.seed_type = name
+				S.update_seed()
 
 /datum/seed/proc/request_player(var/mob/living/host)
 	if(!host) return

code/modules/hydroponics/seed_packets.dm

@@ -1,8 +1,10 @@
+var/global/list/plant_seed_sprites = list()
+
 //Seed packet object/procs.
 /obj/item/seeds
 	name = "packet of seeds"
 	icon = 'icons/obj/seeds.dmi'
-	icon_state = "seed"
+	icon_state = "blank"
 	w_class = 2.0
 
 	var/seed_type
@@ -15,16 +17,45 @@
 
 //Grabs the appropriate seed datum from the global list.
 /obj/item/seeds/proc/update_seed()
-	if(!seed && seed_type && !isnull(seed_types) && seed_types[seed_type])
-		seed = seed_types[seed_type]
+	if(!seed && seed_type && !isnull(plant_controller.seeds) && plant_controller.seeds[seed_type])
+		seed = plant_controller.seeds[seed_type]
 	update_appearance()
 
 //Updates strings and icon appropriately based on seed datum.
 /obj/item/seeds/proc/update_appearance()
 	if(!seed) return
-	icon_state = seed.packet_icon
-	src.name = "packet of [seed.seed_name] [seed.seed_noun]"
-	src.desc = "It has a picture of [seed.display_name] on the front."
+
+	// Update icon.
+	overlays.Cut()
+	var/is_seeds = ((seed.seed_noun in list("seeds","pits","nodes")) ? 1 : 0)
+	var/image/seed_mask
+	var/seed_base_key = "base-[is_seeds ? seed.get_trait(TRAIT_PLANT_COLOUR) : "spores"]"
+	if(plant_seed_sprites[seed_base_key])
+		seed_mask = plant_seed_sprites[seed_base_key]
+	else
+		seed_mask = image('icons/obj/seeds.dmi',"[is_seeds ? "seed" : "spore"]-mask")
+		if(is_seeds) // Spore glass bits aren't coloured.
+			seed_mask.color = seed.get_trait(TRAIT_PLANT_COLOUR)
+		plant_seed_sprites[seed_base_key] = seed_mask
+
+	var/image/seed_overlay
+	var/seed_overlay_key = "[seed.get_trait(TRAIT_PRODUCT_ICON)]-[seed.get_trait(TRAIT_PRODUCT_COLOUR)]"
+	if(plant_seed_sprites[seed_overlay_key])
+		seed_overlay = plant_seed_sprites[seed_overlay_key]
+	else
+		seed_overlay = image('icons/obj/seeds.dmi',"[seed.get_trait(TRAIT_PRODUCT_ICON)]")
+		seed_overlay.color = seed.get_trait(TRAIT_PRODUCT_COLOUR)
+		plant_seed_sprites[seed_overlay_key] = seed_overlay
+
+	overlays |= seed_mask
+	overlays |= seed_overlay
+
+	if(is_seeds)
+		src.name = "packet of [seed.seed_name] [seed.seed_noun]"
+		src.desc = "It has a picture of [seed.display_name] on the front."
+	else
+		src.name = "sample of [seed.seed_name] [seed.seed_noun]"
+		src.desc = "It's labelled as coming from [seed.display_name]."
 
 /obj/item/seeds/examine(mob/user)
 	..(user)
@@ -43,13 +74,8 @@
 	seed_type = null
 
 /obj/item/seeds/random/New()
-	seed = new()
-	seed.randomize()
-
-	seed.uid = seed_types.len + 1
-	seed.name = "[seed.uid]"
-	seed_types[seed.name] = seed
-
+	seed = plant_controller.create_random_seed()
+	seed_type = seed.name
 	update_seed()
 
 /obj/item/seeds/replicapod
@@ -91,9 +117,6 @@
 /obj/item/seeds/eggplantseed
 	seed_type = "eggplant"
 
-/obj/item/seeds/eggyseed
-	seed_type = "realeggplant"
-
 /obj/item/seeds/bloodtomatoseed
 	seed_type = "bloodtomato"
 
@@ -234,3 +257,24 @@
 
 /obj/item/seeds/kudzuseed
 	seed_type = "kudzu"
+
+/obj/item/seeds/jurlmah
+	seed_type = "jurlmah"
+
+/obj/item/seeds/amauri
+	seed_type = "amauri"
+
+/obj/item/seeds/gelthi
+	seed_type = "gelthi"
+
+/obj/item/seeds/vale
+	seed_type = "vale"
+
+/obj/item/seeds/surik
+	seed_type = "surik"
+
+/obj/item/seeds/telriis
+	seed_type = "telriis"
+
+/obj/item/seeds/thaadra
+	seed_type = "thaadra"

code/modules/hydroponics/seed_storage.dm

@@ -34,7 +34,7 @@
 
 /obj/machinery/seed_storage/random // This is mostly for testing, but I guess admins could spawn it
 	name = "Random seed storage"
-	scanner = list("stats", "produce", "soil", "temperature", "light", "mutants")
+	scanner = list("stats", "produce", "soil", "temperature", "light")
 	starting_seeds = list(/obj/item/seeds/random = 50)
 
 /obj/machinery/seed_storage/garden
@@ -44,7 +44,7 @@
 
 /obj/machinery/seed_storage/xenobotany
 	name = "Xenobotany seed storage"
-	scanner = list("stats", "produce", "soil", "temperature", "light", "mutants")
+	scanner = list("stats", "produce", "soil", "temperature", "light")
 	starting_seeds = list(/obj/item/seeds/ambrosiavulgarisseed = 3, /obj/item/seeds/appleseed = 3, /obj/item/seeds/amanitamycelium = 2, /obj/item/seeds/bananaseed = 3, /obj/item/seeds/berryseed = 3, /obj/item/seeds/cabbageseed = 3, /obj/item/seeds/carrotseed = 3, /obj/item/seeds/chantermycelium = 3, /obj/item/seeds/cherryseed = 3, /obj/item/seeds/chiliseed = 3, /obj/item/seeds/cocoapodseed = 3, /obj/item/seeds/cornseed = 3, /obj/item/seeds/replicapod = 3, /obj/item/seeds/eggplantseed = 3, /obj/item/seeds/glowshroom = 2, /obj/item/seeds/grapeseed = 3, /obj/item/seeds/grassseed = 3, /obj/item/seeds/lemonseed = 3, /obj/item/seeds/libertymycelium = 2, /obj/item/seeds/limeseed = 3, /obj/item/seeds/mtearseed = 2, /obj/item/seeds/nettleseed = 2, /obj/item/seeds/orangeseed = 3, /obj/item/seeds/peanutseed = 3, /obj/item/seeds/plastiseed = 3, /obj/item/seeds/plumpmycelium = 3, /obj/item/seeds/poppyseed = 3, /obj/item/seeds/potatoseed = 3, /obj/item/seeds/pumpkinseed = 3, /obj/item/seeds/reishimycelium = 2, /obj/item/seeds/riceseed = 3, /obj/item/seeds/soyaseed = 3, /obj/item/seeds/sugarcaneseed = 3, /obj/item/seeds/sunflowerseed = 3, /obj/item/seeds/shandseed = 2, /obj/item/seeds/tobaccoseed = 3, /obj/item/seeds/tomatoseed = 3, /obj/item/seeds/towermycelium = 3, /obj/item/seeds/watermelonseed = 3, /obj/item/seeds/wheatseed = 3, /obj/item/seeds/whitebeetseed = 3)
 
 /obj/machinery/seed_storage/attack_hand(mob/user as mob)
@@ -69,12 +69,10 @@
 	if (piles.len == 0)
 		dat += "<font color='red'>No seeds</font>"
 	else
-		dat += "<table style='text-align:center;'><tr><td>Name</td>"
+		dat += "<table style='text-align:center;border-style:solid;border-width:1px;padding:4px'><tr><td>Name</td>"
 		dat += "<td>Variety</td>"
 		if ("stats" in scanner)
-			dat += "<td>E</td><td>Y</td><td>L</td><td>M</td><td>Pr</td><td>Pt</td><td>Harvest</td>"
-		if ("produce" in scanner)
-			dat += "<td>Produce</td>"
+			dat += "<td>E</td><td>Y</td><td>M</td><td>Pr</td><td>Pt</td><td>Harvest</td>"
 		if ("temperature" in scanner)
 			dat += "<td>Temp</td>"
 		if ("light" in scanner)
@@ -84,38 +82,35 @@
 		dat += "<td>Notes</td><td>Amount</td><td></td></tr>"
 		for (var/datum/seed_pile/S in piles)
 			var/datum/seed/seed = S.seed_type
+			if(!seed)
+				continue
 			dat += "<tr>"
-			dat += "<td>[S.name]</td>"
+			dat += "<td>[seed.seed_name]</td>"
 			dat += "<td>#[seed.uid]</td>"
 			if ("stats" in scanner)
-				dat += "<td>[seed.endurance]</td><td>[seed.yield]</td><td>[seed.lifespan]</td><td>[seed.maturation]</td><td>[seed.production]</td><td>[seed.potency]</td>"
-				if(seed.harvest_repeat)
+				dat += "<td>[seed.get_trait(TRAIT_ENDURANCE)]</td><td>[seed.get_trait(TRAIT_YIELD)]</td><td>[seed.get_trait(TRAIT_MATURATION)]</td><td>[seed.get_trait(TRAIT_PRODUCTION)]</td><td>[seed.get_trait(TRAIT_POTENCY)]</td>"
+				if(seed.get_trait(TRAIT_HARVEST_REPEAT))
 					dat += "<td>Multiple</td>"
 				else
 					dat += "<td>Single</td>"
-			if ("produce" in scanner)
-				if (seed.products && seed.products.len)
-					dat += "<td>Fruit: [seed.products.len]</td>"
-				else
-					dat += "<td>N/A</td>"
 			if ("temperature" in scanner)
-				dat += "<td>[seed.ideal_heat] K</td>"
+				dat += "<td>[seed.get_trait(TRAIT_IDEAL_HEAT)] K</td>"
 			if ("light" in scanner)
-				dat += "<td>[seed.ideal_light] L</td>"
+				dat += "<td>[seed.get_trait(TRAIT_IDEAL_LIGHT)] L</td>"
 			if ("soil" in scanner)
-				if(seed.requires_nutrients)
-					if(seed.nutrient_consumption < 0.05)
+				if(seed.get_trait(TRAIT_REQUIRES_NUTRIENTS))
+					if(seed.get_trait(TRAIT_NUTRIENT_CONSUMPTION) < 0.05)
 						dat += "<td>Low</td>"
-					else if(seed.nutrient_consumption > 0.2)
+					else if(seed.get_trait(TRAIT_REQUIRES_NUTRIENTS) > 0.2)
 						dat += "<td>High</td>"
 					else
 						dat += "<td>Norm</td>"
 				else
 					dat += "<td>No</td>"
-				if(seed.requires_water)
-					if(seed.water_consumption < 1)
+				if(seed.get_trait(TRAIT_REQUIRES_WATER))
+					if(seed.get_trait(TRAIT_WATER_CONSUMPTION) < 1)
 						dat += "<td>Low</td>"
-					else if(seed.water_consumption > 5)
+					else if(seed.get_trait(TRAIT_WATER_CONSUMPTION) > 5)
 						dat += "<td>High</td>"
 					else
 						dat += "<td>Norm</td>"
@@ -123,61 +118,52 @@
 					dat += "<td>No</td>"
 
 			dat += "<td>"
-			if ("mutants" in scanner)
-				if(seed.mutants && seed.mutants.len)
-					dat += "SUBSP "
-				if(seed.immutable == -1)
-					dat += "MUT "
-				else if(seed.immutable > 0)
-					dat += "NOMUT "
-			switch(seed.carnivorous)
+			switch(seed.get_trait(TRAIT_CARNIVOROUS))
 				if(1)
 					dat += "CARN "
 				if(2)
 					dat	+= "<font color='red'>CARN </font>"
-			switch(seed.spread)
+			switch(seed.get_trait(TRAIT_SPREAD))
 				if(1)
 					dat += "VINE "
 				if(2)
 					dat	+= "<font color='red'>VINE </font>"
 			if ("pressure" in scanner)
-				if(seed.lowkpa_tolerance < 20)
+				if(seed.get_trait(TRAIT_LOWKPA_TOLERANCE) < 20)
 					dat += "LP "
-				if(seed.highkpa_tolerance > 220)
+				if(seed.get_trait(TRAIT_HIGHKPA_TOLERANCE) > 220)
 					dat += "HP "
 			if ("temperature" in scanner)
-				if(seed.heat_tolerance > 30)
+				if(seed.get_trait(TRAIT_HEAT_TOLERANCE) > 30)
 					dat += "TEMRES "
-				else if(seed.heat_tolerance < 10)
+				else if(seed.get_trait(TRAIT_HEAT_TOLERANCE) < 10)
 					dat += "TEMSEN "
 			if ("light" in scanner)
-				if(seed.light_tolerance > 10)
+				if(seed.get_trait(TRAIT_LIGHT_TOLERANCE) > 10)
 					dat += "LIGRES "
-				else if(seed.light_tolerance < 3)
+				else if(seed.get_trait(TRAIT_LIGHT_TOLERANCE) < 3)
 					dat += "LIGSEN "
-			if(seed.toxins_tolerance < 3)
+			if(seed.get_trait(TRAIT_TOXINS_TOLERANCE) < 3)
 				dat += "TOXSEN "
-			else if(seed.toxins_tolerance > 6)
+			else if(seed.get_trait(TRAIT_TOXINS_TOLERANCE) > 6)
 				dat += "TOXRES "
-			if(seed.pest_tolerance < 3)
+			if(seed.get_trait(TRAIT_PEST_TOLERANCE) < 3)
 				dat += "PESTSEN "
-			else if(seed.pest_tolerance > 6)
+			else if(seed.get_trait(TRAIT_PEST_TOLERANCE) > 6)
 				dat += "PESTRES "
-			if(seed.weed_tolerance < 3)
+			if(seed.get_trait(TRAIT_WEED_TOLERANCE) < 3)
 				dat += "WEEDSEN "
-			else if(seed.weed_tolerance > 6)
+			else if(seed.get_trait(TRAIT_WEED_TOLERANCE) > 6)
 				dat += "WEEDRES "
-			if(seed.parasite)
+			if(seed.get_trait(TRAIT_PARASITE))
 				dat += "PAR "
 			if ("temperature" in scanner)
-				if(seed.alter_temp > 0)
+				if(seed.get_trait(TRAIT_ALTER_TEMP) > 0)
 					dat += "TEMP+ "
-				if(seed.alter_temp < 0)
+				if(seed.get_trait(TRAIT_ALTER_TEMP) < 0)
 					dat += "TEMP- "
-			if(seed.biolum)
+			if(seed.get_trait(TRAIT_BIOLUM))
 				dat += "LUM "
-			if(seed.flowers)
-				dat += "<br>[seed.flower_colour ? "<font color='[seed.flower_colour]'>FLOW</font>" : "FLOW"]."
 			dat += "</td>"
 			dat += "<td>[S.amount]</td>"
 			dat += "<td><a href='byond://?src=\ref[src];task=vend;id=[S.ID]'>Vend</a> <a href='byond://?src=\ref[src];task=purge;id=[S.ID]'>Purge</a></td>"

code/modules/hydroponics/spreading/spreading.dm

@@ -0,0 +1,259 @@
+#define DEFAULT_SEED "glowshroom"
+#define VINE_GROWTH_STAGES 5
+
+/proc/spacevine_infestation()
+	spawn() //to stop the secrets panel hanging
+		var/list/turf/simulated/floor/turfs = list() //list of all the empty floor turfs in the hallway areas
+		for(var/areapath in typesof(/area/hallway))
+			var/area/A = locate(areapath)
+			for(var/area/B in A.related)
+				for(var/turf/simulated/floor/F in B.contents)
+					if(!F.contents.len)
+						turfs += F
+
+		if(turfs.len) //Pick a turf to spawn at if we can
+			var/turf/simulated/floor/T = pick(turfs)
+			var/datum/seed/seed = plant_controller.create_random_seed(1)
+			seed.set_trait(TRAIT_SPREAD,2)             // So it will function properly as vines.
+			seed.set_trait(TRAIT_POTENCY,rand(70,100)) // Guarantee a wide spread and powerful effects.
+			new /obj/effect/plant(T,seed)
+			message_admins("<span class='notice'>Event: Spacevines spawned at [T.loc] ([T.x],[T.y],[T.z])</span>")
+
+/obj/effect/dead_plant
+	anchored = 1
+	opacity = 0
+	density = 0
+	color = DEAD_PLANT_COLOUR
+
+/obj/effect/dead_plant/attack_hand()
+	del(src)
+
+/obj/effect/dead_plant/attackby()
+	..()
+	for(var/obj/effect/plant/neighbor in range(1))
+		neighbor.update_neighbors()
+	del(src)
+
+/obj/effect/plant
+	name = "plant"
+	anchored = 1
+	opacity = 0
+	density = 0
+	icon = 'icons/obj/hydroponics_growing.dmi'
+	icon_state = "bush4-1"
+	layer = 3
+	pass_flags = PASSTABLE
+
+	var/health = 10
+	var/max_health = 100
+	var/growth_threshold = 0
+	var/growth_type = 0
+	var/max_growth = 0
+
+	var/list/neighbors = list()
+	var/obj/effect/plant/parent
+	var/datum/seed/seed
+	var/floor = 0
+	var/spread_chance = 40
+	var/spread_distance = 3
+	var/evolve_chance = 2
+	var/last_tick = 0
+	var/obj/machinery/portable_atmospherics/hydroponics/soil/invisible/plant
+
+/obj/effect/plant/Del()
+	if(plant_controller)
+		plant_controller.remove_plant(src)
+	for(var/obj/effect/plant/neighbor in range(1,src))
+		plant_controller.add_plant(neighbor)
+	..()
+/obj/effect/plant/single
+	spread_chance = 0
+
+/obj/effect/plant/New(var/newloc, var/datum/seed/newseed, var/obj/effect/plant/newparent)
+	..()
+
+	if(!newparent)
+		parent = src
+	else
+		parent = newparent
+
+	if(!plant_controller)
+		sleep(250) // ugly hack, should mean roundstart plants are fine.
+	if(!plant_controller)
+		world << "<span class='danger'>Plant controller does not exist and [src] requires it. Aborting.</span>"
+		del(src)
+		return
+
+	if(!istype(newseed))
+		newseed = plant_controller.seeds[DEFAULT_SEED]
+	seed = newseed
+	if(!seed)
+		del(src)
+		return
+
+	name = seed.display_name
+	max_health = round(seed.get_trait(TRAIT_ENDURANCE)/2)
+	if(seed.get_trait(TRAIT_SPREAD)==2)
+		max_growth = VINE_GROWTH_STAGES
+		growth_threshold = max_health/VINE_GROWTH_STAGES
+		icon = 'icons/obj/hydroponics_vines.dmi'
+		growth_type = 2 // Vines by default.
+		if(seed.get_trait(TRAIT_CARNIVOROUS) == 2)
+			growth_type = 1 // WOOOORMS.
+		else if(!(seed.seed_noun in list("seeds","pits")))
+			if(seed.seed_noun == "nodes")
+				growth_type = 3 // Biomass
+			else
+				growth_type = 4 // Mold
+	else
+		max_growth = seed.growth_stages
+		growth_threshold = max_health/seed.growth_stages
+
+	if(max_growth > 2 && prob(50))
+		max_growth-- //Ensure some variation in final sprite, makes the carpet of crap look less wonky.
+
+	spread_chance = seed.get_trait(TRAIT_POTENCY)
+	spread_distance = ((growth_type>0) ? round(spread_chance*0.6) : round(spread_chance*0.3))
+	update_icon()
+
+	spawn(1) // Plants will sometimes be spawned in the turf adjacent to the one they need to end up in, for the sake of correct dir/etc being set.
+		set_dir(calc_dir())
+		update_icon()
+		plant_controller.add_plant(src)
+		// Some plants eat through plating.
+		if(!isnull(seed.chems["pacid"]))
+			var/turf/T = get_turf(src)
+			T.ex_act(prob(80) ? 3 : 2)
+
+/obj/effect/plant/update_icon()
+	//TODO: should really be caching this.
+	refresh_icon()
+	if(growth_type == 0 && !floor)
+		src.transform = null
+		var/matrix/M = matrix()
+		// should make the plant flush against the wall it's meant to be growing from.
+		M.Translate(0,-(rand(12,14)))
+		switch(dir)
+			if(WEST)
+				M.Turn(90)
+			if(NORTH)
+				M.Turn(180)
+			if(EAST)
+				M.Turn(270)
+		src.transform = M
+	var/icon_colour = seed.get_trait(TRAIT_PLANT_COLOUR)
+	if(icon_colour)
+		color = icon_colour
+	// Apply colour and light from seed datum.
+	if(seed.get_trait(TRAIT_BIOLUM))
+		SetLuminosity(1+round(seed.get_trait(TRAIT_POTENCY)/20))
+		if(seed.get_trait(TRAIT_BIOLUM_COLOUR))
+			l_color = seed.get_trait(TRAIT_BIOLUM_COLOUR)
+		else
+			l_color = null
+		return
+	else
+		SetLuminosity(0)
+
+/obj/effect/plant/proc/refresh_icon()
+	var/growth = min(max_growth,round(health/growth_threshold))
+	var/at_fringe = get_dist(src,parent)
+	if(spread_distance > 5)
+		if(at_fringe >= (spread_distance-3))
+			max_growth--
+		if(at_fringe >= (spread_distance-2))
+			max_growth--
+	max_growth = max(1,max_growth)
+	if(growth_type > 0)
+		switch(growth_type)
+			if(1)
+				icon_state = "worms"
+			if(2)
+				icon_state = "vines-[growth]"
+			if(3)
+				icon_state = "mass-[growth]"
+			if(4)
+				icon_state = "mold-[growth]"
+	else
+		icon_state = "[seed.get_trait(TRAIT_PLANT_ICON)]-[growth]"
+
+	if(growth>2 && growth == max_growth)
+		layer = 5
+		opacity = 1
+		if(!isnull(seed.chems["woodpulp"]))
+			density = 1
+	else
+		layer = 3
+		density = 0
+
+/obj/effect/plant/proc/calc_dir(turf/location = loc)
+	set background = 1
+	var/direction = 16
+
+	for(var/wallDir in cardinal)
+		var/turf/newTurf = get_step(location,wallDir)
+		if(newTurf.density)
+			direction |= wallDir
+
+	for(var/obj/effect/plant/shroom in location)
+		if(shroom == src)
+			continue
+		if(shroom.floor) //special
+			direction &= ~16
+		else
+			direction &= ~shroom.dir
+
+	var/list/dirList = list()
+
+	for(var/i=1,i<=16,i <<= 1)
+		if(direction & i)
+			dirList += i
+
+	if(dirList.len)
+		var/newDir = pick(dirList)
+		if(newDir == 16)
+			floor = 1
+			newDir = 1
+		return newDir
+
+	floor = 1
+	return 1
+
+/obj/effect/plant/attackby(var/obj/item/weapon/W, var/mob/user)
+
+	plant_controller.add_plant(src)
+
+	if(istype(W, /obj/item/weapon/wirecutters) || istype(W, /obj/item/weapon/scalpel))
+		if(!seed)
+			user << "There is nothing to take a sample from."
+			return
+		seed.harvest(user,0,1)
+		health -= (rand(3,5)*10)
+	else
+		..()
+		if(W.force)
+			health -= W.force
+	check_health()
+
+/obj/effect/plant/ex_act(severity)
+	switch(severity)
+		if(1.0)
+			die_off()
+			return
+		if(2.0)
+			if (prob(50))
+				die_off()
+				return
+		if(3.0)
+			if (prob(5))
+				die_off()
+				return
+		else
+	return
+
+/obj/effect/plant/proc/check_health()
+	if(health <= 0)
+		die_off()
+
+/obj/effect/plant/proc/is_mature()
+	return (health >= (max_health/3))

code/modules/hydroponics/spreading/spreading_growth.dm

@@ -0,0 +1,89 @@
+#define NEIGHBOR_REFRESH_TIME 100
+
+/obj/effect/plant/proc/update_neighbors()
+	// Update our list of valid neighboring turfs.
+	neighbors = list()
+	for(var/turf/simulated/floor/floor in range(1,src))
+		if(get_dist(parent, floor) > spread_distance)
+			continue
+		if((locate(/obj/effect/plant) in floor.contents) || (locate(/obj/effect/dead_plant) in floor.contents) )
+			continue
+		if(floor.density)
+			if(!isnull(seed.chems["pacid"]))
+				spawn(rand(5,25)) floor.ex_act(3)
+			continue
+		else if(!floor.Enter(src))
+			continue
+		neighbors |= floor
+	// Update all of our friends.
+	var/turf/T = get_turf(src)
+	for(var/obj/effect/plant/neighbor in range(1,src))
+		neighbor.neighbors -= T
+
+/obj/effect/plant/process()
+
+	// Something is very wrong, kill ourselves.
+	if(!seed)
+		die_off()
+		return 0
+
+	// Handle life.
+	var/turf/simulated/T = get_turf(src)
+	if(istype(T))
+		health -= seed.handle_environment(T,T.return_air(),null,1)
+	if(health < max_health)
+		health += rand(3,5)
+		refresh_icon()
+		if(health > max_health)
+			health = max_health
+	else if(health == max_health && !plant)
+		plant = new(T,seed)
+		plant.dir = src.dir
+		plant.transform = src.transform
+		plant.age = seed.get_trait(TRAIT_MATURATION)-1
+		plant.update_icon()
+		if(growth_type==0) //Vines do not become invisible.
+			invisibility = INVISIBILITY_MAXIMUM
+		else
+			plant.layer = layer + 0.1
+
+	if(buckled_mob)
+		seed.do_sting(buckled_mob,src)
+		if(seed.get_trait(TRAIT_CARNIVOROUS))
+			seed.do_thorns(buckled_mob,src)
+
+	if(world.time >= last_tick+NEIGHBOR_REFRESH_TIME)
+		last_tick = world.time
+		update_neighbors()
+
+	if(is_mature() && neighbors.len && prob(spread_chance))
+		for(var/i=1,i<=seed.get_trait(TRAIT_YIELD),i++)
+			if(prob(spread_chance))
+				sleep(rand(3,5))
+				if(!neighbors.len)
+					break
+				var/turf/target_turf = pick(neighbors)
+				var/obj/effect/plant/child = new(get_turf(src),seed,parent)
+				spawn(1) // This should do a little bit of animation.
+					child.loc = target_turf
+					child.update_icon()
+				// Update neighboring squares.
+				for(var/obj/effect/plant/neighbor in range(1,target_turf))
+					neighbor.neighbors -= target_turf
+
+	// We shouldn't have spawned if the controller doesn't exist.
+	check_health()
+	if(neighbors.len || health != max_health)
+		plant_controller.add_plant(src)
+
+/obj/effect/plant/proc/die_off()
+	// Kill off our plant.
+	if(plant) plant.die()
+	// This turf is clear now, let our buddies know.
+	var/turf/T = get_turf(src)
+	for(var/obj/effect/plant/neighbor in range(1,src))
+		neighbor.neighbors |= T
+		plant_controller.add_plant(neighbor)
+	spawn(1) if(src) del(src)
+
+#undef NEIGHBOR_REFRESH_TIME

code/modules/hydroponics/spreading/spreading_response.dm

@@ -0,0 +1,70 @@
+/obj/effect/plant/HasProximity(var/atom/movable/AM)
+
+	if(!is_mature() || seed.get_trait(TRAIT_SPREAD) != 2)
+		return
+
+	var/mob/living/M = AM
+	if(!istype(M))
+		return
+
+	if(!buckled_mob && !M.buckled && !M.anchored && (M.small || prob(round(seed.get_trait(TRAIT_POTENCY)/2))))
+		entangle(M)
+
+/obj/effect/plant/attack_hand(mob/user as mob)
+	// Todo, cause damage.
+	manual_unbuckle(user)
+
+/obj/effect/plant/proc/trodden_on(var/mob/living/victim)
+	if(!is_mature())
+		return
+	var/mob/living/carbon/human/H = victim
+	if(istype(H) && H.shoes)
+		return
+	seed.do_thorns(victim,src)
+	seed.do_sting(victim,src,pick("r_foot","l_foot","r_leg","l_leg"))
+
+/obj/effect/plant/proc/unbuckle()
+	if(buckled_mob)
+		if(buckled_mob.buckled == src)
+			buckled_mob.buckled = null
+			buckled_mob.anchored = initial(buckled_mob.anchored)
+			buckled_mob.update_canmove()
+		buckled_mob = null
+	return
+
+/obj/effect/plant/proc/manual_unbuckle(mob/user as mob)
+	if(buckled_mob)
+		if(prob(seed ? min(max(0,100 - seed.get_trait(TRAIT_POTENCY)/2),100) : 50))
+			if(buckled_mob.buckled == src)
+				if(buckled_mob != user)
+					buckled_mob.visible_message(\
+						"<span class='notice'>[user.name] frees [buckled_mob.name] from \the [src].</span>",\
+						"<span class='notice'>[user.name] frees you from \the [src].</span>",\
+						"<span class='warning'>You hear shredding and ripping.</span>")
+				else
+					buckled_mob.visible_message(\
+						"<span class='notice'>[buckled_mob.name] struggles free of \the [src].</span>",\
+						"<span class='notice'>You untangle \the [src] from around yourself.</span>",\
+						"<span class='warning'>You hear shredding and ripping.</span>")
+			unbuckle()
+		else
+			var/text = pick("rip","tear","pull")
+			user.visible_message(\
+				"<span class='notice'>[user.name] [text]s at \the [src].</span>",\
+				"<span class='notice'>You [text] at \the [src].</span>",\
+				"<span class='warning'>You hear shredding and ripping.</span>")
+	return
+
+/obj/effect/plant/proc/entangle(var/mob/living/victim)
+
+	if(buckled_mob)
+		return
+
+	victim.buckled = src
+	victim.update_canmove()
+	buckled_mob = victim
+
+	if(victim.loc != src.loc)
+		src.visible_message("<span class='danger'>Tendrils lash out from \the [src] and drag \the [victim] in!</span>")
+		victim.loc = src.loc
+	victim << "<span class='danger'>Tendrils [pick("wind", "tangle", "tighten")] around you!</span>"

code/modules/hydroponics/trays/tray.dm

@@ -1,15 +1,14 @@
-#define HYDRO_SPEED_MULTIPLIER 1
-
 /obj/machinery/portable_atmospherics/hydroponics
 	name = "hydroponics tray"
-	icon = 'icons/obj/hydroponics.dmi'
+	icon = 'icons/obj/hydroponics_machines.dmi'
 	icon_state = "hydrotray3"
 	density = 1
 	anchored = 1
 	flags = OPENCONTAINER
 	volume = 100
 
-	var/draw_warnings = 1 //Set to 0 to stop it from drawing the alert lights.
+	var/mechanical = 1         // Set to 0 to stop it from drawing the alert lights.
+	var/base_name = "tray"
 
 	// Plant maintenance vars.
 	var/waterlevel = 100       // Water (max 100)
@@ -21,13 +20,14 @@
 	var/dead = 0               // Is it dead?
 	var/harvest = 0            // Is it ready to harvest?
 	var/age = 0                // Current plant age
-	var/sampled = 0            // Have wa taken a sample?
+	var/sampled = 0            // Have we taken a sample?
 
 	// Harvest/mutation mods.
 	var/yield_mod = 0          // Modifier to yield
 	var/mutation_mod = 0       // Modifier to mutation chance
 	var/toxins = 0             // Toxicity in the tray?
 	var/mutation_level = 0     // When it hits 100, the plant mutates.
+	var/tray_light = 1         // Supplied lighting.
 
 	// Mechanical concerns.
 	var/health = 0             // Plant health.
@@ -37,6 +37,7 @@
 	var/closed_system          // If set, the tray will attempt to take atmos from a pipe.
 	var/force_update           // Set this to bypass the cycle time check.
 	var/obj/temp_chem_holder   // Something to hold reagents during process_reagents()
+	var/labelled
 
 	// Seed details/line data.
 	var/datum/seed/seed = null // The currently planted seed
@@ -122,6 +123,12 @@
 		"mutagen" = 15
 		)
 
+/obj/machinery/portable_atmospherics/hydroponics/AltClick()
+	if(mechanical && !usr.stat && !usr.lying && Adjacent(usr))
+		close_lid(usr)
+		return
+	return ..()
+
 /obj/machinery/portable_atmospherics/hydroponics/attack_generic(var/mob/user)
 	if(istype(user,/mob/living/carbon/alien/diona))
 		var/mob/living/carbon/alien/diona/nymph = user
@@ -146,13 +153,14 @@
 	temp_chem_holder = new()
 	temp_chem_holder.create_reagents(10)
 	create_reagents(200)
-	connect()
+	if(mechanical)
+		connect()
 	update_icon()
 
 /obj/machinery/portable_atmospherics/hydroponics/bullet_act(var/obj/item/projectile/Proj)
 
 	//Don't act on seeds like dionaea that shouldn't change.
-	if(seed && seed.immutable > 0)
+	if(seed && seed.get_trait(TRAIT_IMMUTABLE) > 0)
 		return
 
 	//Override for somatoray projectiles.
@@ -173,174 +181,18 @@
 	else
 		return 0
 
-/obj/machinery/portable_atmospherics/hydroponics/process()
-
-	//Do this even if we're not ready for a plant cycle.
-	process_reagents()
-
-	// Update values every cycle rather than every process() tick.
-	if(force_update)
-		force_update = 0
-	else if(world.time < (lastcycle + cycledelay))
-		return
-	lastcycle = world.time
-
-	// Mutation level drops each main tick.
-	mutation_level -= rand(2,4)
-
-	// Weeds like water and nutrients, there's a chance the weed population will increase.
-	// Bonus chance if the tray is unoccupied.
-	if(waterlevel > 10 && nutrilevel > 2 && prob(isnull(seed) ? 5 : 1))
-		weedlevel += 1 * HYDRO_SPEED_MULTIPLIER
-
-	// There's a chance for a weed explosion to happen if the weeds take over.
-	// Plants that are themselves weeds (weed_tolerance > 10) are unaffected.
-	if (weedlevel >= 10 && prob(10))
-		if(!seed || weedlevel >= seed.weed_tolerance)
-			weed_invasion()
-
-	// If there is no seed data (and hence nothing planted),
-	// or the plant is dead, process nothing further.
-	if(!seed || dead)
-		if(draw_warnings) update_icon() //Harvesting would fail to set alert icons properly.
-		return
-
-	// Advance plant age.
-	if(prob(30)) age += 1 * HYDRO_SPEED_MULTIPLIER
-
-	//Highly mutable plants have a chance of mutating every tick.
-	if(seed.immutable == -1)
-		var/mut_prob = rand(1,100)
-		if(mut_prob <= 5) mutate(mut_prob == 1 ? 2 : 1)
-
-	// Other plants also mutate if enough mutagenic compounds have been added.
-	if(!seed.immutable)
-		if(prob(min(mutation_level,100)))
-			mutate((rand(100) < 15) ? 2 : 1)
-			mutation_level = 0
-
-	// Maintain tray nutrient and water levels.
-	if(seed.nutrient_consumption > 0 && nutrilevel > 0 && prob(25))
-		nutrilevel -= max(0,seed.nutrient_consumption * HYDRO_SPEED_MULTIPLIER)
-	if(seed.water_consumption > 0 && waterlevel > 0  && prob(25))
-		waterlevel -= max(0,seed.water_consumption * HYDRO_SPEED_MULTIPLIER)
-
-	// Make sure the plant is not starving or thirsty. Adequate
-	// water and nutrients will cause a plant to become healthier.
-	var/healthmod = rand(1,3) * HYDRO_SPEED_MULTIPLIER
-	if(seed.requires_nutrients && prob(35))
-		health += (nutrilevel < 2 ? -healthmod : healthmod)
-	if(seed.requires_water && prob(35))
-		health += (waterlevel < 10 ? -healthmod : healthmod)
-
-	// Check that pressure, heat and light are all within bounds.
-	// First, handle an open system or an unconnected closed system.
-
-	var/turf/T = loc
-	var/datum/gas_mixture/environment
-
-	// If we're closed, take from our internal sources.
-	if(closed_system && (connected_port || holding))
-		environment = air_contents
-
-	// If atmos input is not there, grab from turf.
-	if(!environment)
-		if(istype(T))
-			environment = T.return_air()
-
-	if(!environment) return
-
-	// Handle gas consumption.
-	if(seed.consume_gasses && seed.consume_gasses.len)
-		var/missing_gas = 0
-		for(var/gas in seed.consume_gasses)
-			if(environment && environment.gas && environment.gas[gas] && \
-			 environment.gas[gas] >= seed.consume_gasses[gas])
-				environment.adjust_gas(gas,-seed.consume_gasses[gas],1)
-			else
-				missing_gas++
-
-		if(missing_gas > 0)
-			health -= missing_gas * HYDRO_SPEED_MULTIPLIER
-
-	// Process it.
-	var/pressure = environment.return_pressure()
-	if(pressure < seed.lowkpa_tolerance || pressure > seed.highkpa_tolerance)
-		health -= healthmod
-
-	if(abs(environment.temperature - seed.ideal_heat) > seed.heat_tolerance)
-		health -= healthmod
-
-	// Handle gas production.
-	if(seed.exude_gasses && seed.exude_gasses.len)
-		for(var/gas in seed.exude_gasses)
-			environment.adjust_gas(gas, max(1,round((seed.exude_gasses[gas]*seed.potency)/seed.exude_gasses.len)))
-
-	// If we're attached to a pipenet, then we should let the pipenet know we might have modified some gasses
-	if (closed_system && connected_port)
-		update_connected_network()
-
-	// Handle light requirements.
-	var/area/A = T.loc
-	if(A)
-		var/light_available
-		if(A.lighting_use_dynamic)
-			light_available = max(0,min(10,T.lighting_lumcount)-5)
-		else
-			light_available =  5
-		if(abs(light_available - seed.ideal_light) > seed.light_tolerance)
-			health -= healthmod
-
-	// Toxin levels beyond the plant's tolerance cause damage, but
-	// toxins are sucked up each tick and slowly reduce over time.
-	if(toxins > 0)
-		var/toxin_uptake = max(1,round(toxins/10))
-		if(toxins > seed.toxins_tolerance)
-			health -= toxin_uptake
-		toxins -= toxin_uptake
-
-	// Check for pests and weeds.
-	// Some carnivorous plants happily eat pests.
-	if(pestlevel > 0)
-		if(seed.carnivorous)
-			health += HYDRO_SPEED_MULTIPLIER
-			pestlevel -= HYDRO_SPEED_MULTIPLIER
-		else if (pestlevel >= seed.pest_tolerance)
-			health -= HYDRO_SPEED_MULTIPLIER
-
-	// Some plants thrive and live off of weeds.
-	if(weedlevel > 0)
-		if(seed.parasite)
-			health += HYDRO_SPEED_MULTIPLIER
-			weedlevel -= HYDRO_SPEED_MULTIPLIER
-		else if (weedlevel >= seed.weed_tolerance)
-			health -= HYDRO_SPEED_MULTIPLIER
-
-	// Handle life and death.
-	// If the plant is too old, it loses health fast.
-	if(age > seed.lifespan)
-		health -= rand(3,5) * HYDRO_SPEED_MULTIPLIER
-
-	// When the plant dies, weeds thrive and pests die off.
-	if(health <= 0)
-		dead = 1
-		mutation_level = 0
-		harvest = 0
-		weedlevel += 1 * HYDRO_SPEED_MULTIPLIER
-		pestlevel = 0
-
-	// If enough time (in cycles, not ticks) has passed since the plant was harvested, we're ready to harvest again.
-	else if(seed.products && seed.products.len && age > seed.production && \
-	 (age - lastproduce) > seed.production && (!harvest && !dead))
-		harvest = 1
-		lastproduce = age
-
-	if(prob(3))  // On each tick, there's a chance the pest population will increase
-		pestlevel += 0.1 * HYDRO_SPEED_MULTIPLIER
-
+/obj/machinery/portable_atmospherics/hydroponics/proc/check_health()
+	if(seed && !dead && health <= 0)
+		die()
 	check_level_sanity()
 	update_icon()
-	return
+
+/obj/machinery/portable_atmospherics/hydroponics/proc/die()
+	dead = 1
+	mutation_level = 0
+	harvest = 0
+	weedlevel += 1 * HYDRO_SPEED_MULTIPLIER
+	pestlevel = 0
 
 //Process reagents being input into the tray.
 /obj/machinery/portable_atmospherics/hydroponics/proc/process_reagents()
@@ -391,27 +243,29 @@
 			toxins -= round(water_added/4)
 
 	temp_chem_holder.reagents.clear_reagents()
-	check_level_sanity()
-	update_icon()
+	check_health()
 
 //Harvests the product of a plant.
 /obj/machinery/portable_atmospherics/hydroponics/proc/harvest(var/mob/user)
 
 	//Harvest the product of the plant,
-	if(!seed || !harvest || !user)
+	if(!seed || !harvest)
 		return
 
 	if(closed_system)
-		user << "You can't harvest from the plant while the lid is shut."
+		if(user) user << "You can't harvest from the plant while the lid is shut."
 		return
 
-	seed.harvest(user,yield_mod)
+	if(user)
+		seed.harvest(user,yield_mod)
+	else
+		seed.harvest(get_turf(src),yield_mod)
 
 	// Reset values.
 	harvest = 0
 	lastproduce = age
 
-	if(!seed.harvest_repeat)
+	if(!seed.get_trait(TRAIT_HARVEST_REPEAT))
 		yield_mod = 0
 		seed = null
 		dead = 0
@@ -419,8 +273,7 @@
 		sampled = 0
 		mutation_mod = 0
 
-	check_level_sanity()
-	update_icon()
+	check_health()
 	return
 
 //Clears out a dead plant.
@@ -438,85 +291,28 @@
 	yield_mod = 0
 	mutation_mod = 0
 
-	user << "You remove the dead plant from the [src]."
-	check_level_sanity()
-	update_icon()
+	user << "You remove the dead plant."
+	check_health()
 	return
 
-//Refreshes the icon and sets the luminosity
-/obj/machinery/portable_atmospherics/hydroponics/update_icon()
-
-	overlays.Cut()
-
-	// Updates the plant overlay.
-	if(!isnull(seed))
-
-		if(draw_warnings && health <= (seed.endurance / 2))
-			overlays += "over_lowhealth3"
-
-		if(dead)
-			overlays += "[seed.plant_icon]-dead"
-		else if(harvest)
-			overlays += "[seed.plant_icon]-harvest"
-		else if(age < seed.maturation)
-
-			var/t_growthstate
-			if(age >= seed.maturation)
-				t_growthstate = seed.growth_stages
-			else
-				t_growthstate = round(seed.maturation / seed.growth_stages)
-
-			overlays += "[seed.plant_icon]-grow[t_growthstate]"
-			lastproduce = age
-		else
-			overlays += "[seed.plant_icon]-grow[seed.growth_stages]"
-
-	//Draw the cover.
-	if(closed_system)
-		overlays += "hydrocover"
-
-	//Updated the various alert icons.
-	if(draw_warnings)
-		if(waterlevel <= 10)
-			overlays += "over_lowwater3"
-		if(nutrilevel <= 2)
-			overlays += "over_lownutri3"
-		if(weedlevel >= 5 || pestlevel >= 5 || toxins >= 40)
-			overlays += "over_alert3"
-		if(harvest)
-			overlays += "over_harvest3"
-
-	// Update bioluminescence.
-	if(seed)
-		if(seed.biolum)
-			SetLuminosity(round(seed.potency/10))
-			if(seed.biolum_colour)
-				l_color = seed.biolum_colour
-			else
-				l_color = null
-			return
-
-	SetLuminosity(0)
-	return
-
- // If a weed growth is sufficient, this proc is called.
+// If a weed growth is sufficient, this proc is called.
 /obj/machinery/portable_atmospherics/hydroponics/proc/weed_invasion()
 
 	//Remove the seed if something is already planted.
 	if(seed) seed = null
-	seed = seed_types[pick(list("reishi","nettles","amanita","mushrooms","plumphelmet","towercap","harebells","weeds"))]
+	seed = plant_controller.seeds[pick(list("reishi","nettles","amanita","mushrooms","plumphelmet","towercap","harebells","weeds"))]
 	if(!seed) return //Weed does not exist, someone fucked up.
 
 	dead = 0
 	age = 0
-	health = seed.endurance
+	health = seed.get_trait(TRAIT_ENDURANCE)
 	lastcycle = world.time
 	harvest = 0
 	weedlevel = 0
 	pestlevel = 0
 	sampled = 0
 	update_icon()
-	visible_message("\blue [src] has been overtaken by [seed.display_name].")
+	visible_message("<span class='notice'>[src] has been overtaken by [seed.display_name].</span>")
 
 	return
 
@@ -534,16 +330,40 @@
 	// We need to make sure we're not modifying one of the global seed datums.
 	// If it's not in the global list, then no products of the line have been
 	// harvested yet and it's safe to assume it's restricted to this tray.
-	if(!isnull(seed_types[seed.name]))
+	if(!isnull(plant_controller.seeds[seed.name]))
 		seed = seed.diverge()
 	seed.mutate(severity,get_turf(src))
 
 	return
 
+/obj/machinery/portable_atmospherics/hydroponics/verb/remove_label()
+
+	set name = "Remove Label"
+	set category = "Object"
+	set src in view(1)
+
+	if(labelled)
+		usr << "You remove the label."
+		labelled = null
+		update_icon()
+	else
+		usr << "There is no label to remove."
+	return
+
+/obj/machinery/portable_atmospherics/hydroponics/verb/set_light()
+	set name = "Set Light"
+	set category = "Object"
+	set src in view(1)
+
+	var/new_light = input("Specify a light level.") as null|anything in list(0,1,2,3,4,5,6,7,8,9,10)
+	if(new_light)
+		tray_light = new_light
+		usr << "You set the tray to a light level of [tray_light] lumens."
+
 /obj/machinery/portable_atmospherics/hydroponics/proc/check_level_sanity()
 	//Make sure various values are sane.
 	if(seed)
-		health =     max(0,min(seed.endurance,health))
+		health =     max(0,min(seed.get_trait(TRAIT_ENDURANCE),health))
 	else
 		health = 0
 		dead = 0
@@ -559,21 +379,21 @@
 
 	var/previous_plant = seed.display_name
 	var/newseed = seed.get_mutant_variant()
-	if(newseed in seed_types)
-		seed = seed_types[newseed]
+	if(newseed in plant_controller.seeds)
+		seed = plant_controller.seeds[newseed]
 	else
 		return
 
 	dead = 0
 	mutate(1)
 	age = 0
-	health = seed.endurance
+	health = seed.get_trait(TRAIT_ENDURANCE)
 	lastcycle = world.time
 	harvest = 0
 	weedlevel = 0
 
 	update_icon()
-	visible_message("\red The \blue [previous_plant] \red has suddenly mutated into \blue [seed.display_name]!")
+	visible_message("<span class='danger'>The </span><span class='notice'>[previous_plant]</span><span class='danger'> has suddenly mutated into </span><span class='notice'>[seed.display_name]!</span>")
 
 	return
 
@@ -604,7 +424,7 @@
 			sampled = 1
 
 		// Bookkeeping.
-		check_level_sanity()
+		check_health()
 		force_update = 1
 		process()
 
@@ -641,42 +461,28 @@
 				return
 
 			user << "You plant the [S.seed.seed_name] [S.seed.seed_noun]."
-
-			if(S.seed.spread == 1)
-				msg_admin_attack("[key_name(user)] has planted a creeper packet.")
-				var/obj/effect/plant_controller/creeper/PC = new(get_turf(src))
-				if(PC)
-					PC.seed = S.seed
-			else if(S.seed.spread == 2)
-				msg_admin_attack("[key_name(user)] has planted a spreading vine packet.")
-				var/obj/effect/plant_controller/PC = new(get_turf(src))
-				if(PC)
-					PC.seed = S.seed
-			else
-				seed = S.seed //Grab the seed datum.
-				dead = 0
-				age = 1
-				//Snowflakey, maybe move this to the seed datum
-				health = (istype(S, /obj/item/seeds/cutting) ? round(seed.endurance/rand(2,5)) : seed.endurance)
-
-				lastcycle = world.time
+			seed = S.seed //Grab the seed datum.
+			dead = 0
+			age = 1
+			//Snowflakey, maybe move this to the seed datum
+			health = (istype(S, /obj/item/seeds/cutting) ? round(seed.get_trait(TRAIT_ENDURANCE)/rand(2,5)) : seed.get_trait(TRAIT_ENDURANCE))
+			lastcycle = world.time
 
 			del(O)
 
-			check_level_sanity()
-			update_icon()
+			check_health()
 
 		else
-			user << "\red \The [src] already has seeds in it!"
+			user << "<span class='danger'>\The [src] already has seeds in it!</span>"
 
 	else if (istype(O, /obj/item/weapon/minihoe))  // The minihoe
 
 		if(weedlevel > 0)
-			user.visible_message("\red [user] starts uprooting the weeds.", "\red You remove the weeds from the [src].")
+			user.visible_message("<span class='danger'>[user] starts uprooting the weeds.</span>", "<span class='danger'>You remove the weeds from the [src].</span>")
 			weedlevel = 0
 			update_icon()
 		else
-			user << "\red This plot is completely devoid of weeds. It doesn't need uprooting."
+			user << "<span class='danger'>This plot is completely devoid of weeds. It doesn't need uprooting.</span>"
 
 	else if (istype(O, /obj/item/weapon/storage/bag/plants))
 
@@ -698,11 +504,9 @@
 		user << "You spray [src] with [O]."
 		playsound(loc, 'sound/effects/spray3.ogg', 50, 1, -6)
 		del(O)
+		check_health()
 
-		check_level_sanity()
-		update_icon()
-
-	else if(istype(O, /obj/item/weapon/wrench))
+	else if(mechanical && istype(O, /obj/item/weapon/wrench))
 
 		//If there's a connector here, the portable_atmospherics setup can handle it.
 		if(locate(/obj/machinery/atmospherics/portables_connector/) in loc)
@@ -715,7 +519,7 @@
 	else if(istype(O, /obj/item/apiary))
 
 		if(seed)
-			user << "\red [src] is already occupied!"
+			user << "<span class='danger'>[src] is already occupied!</span>"
 		else
 			user.drop_item()
 			del(O)
@@ -725,15 +529,18 @@
 			A.icon_state = src.icon_state
 			A.hydrotray_type = src.type
 			del(src)
+	else if(O.force && seed)
+		user.visible_message("<span class='danger'>\The [seed.display_name] has been attacked by [user] with \the [O]!</span>")
+		if(!dead)
+			health -= O.force
+			check_health()
 	return
 
 /obj/machinery/portable_atmospherics/hydroponics/attack_tk(mob/user as mob)
-
-	if(harvest)
-		harvest(user)
-
-	else if(dead)
+	if(dead)
 		remove_dead(user)
+	else if(harvest)
+		harvest(user)
 
 /obj/machinery/portable_atmospherics/hydroponics/attack_hand(mob/user as mob)
 
@@ -745,76 +552,66 @@
 	else if(dead)
 		remove_dead(user)
 
-	else
-		if(seed && !dead)
-			usr << "[src] has \blue [seed.display_name] \black planted."
-			if(health <= (seed.endurance / 2))
-				usr << "The plant looks \red unhealthy."
-		else
-			usr << "[src] is empty."
-		usr << "Water: [round(waterlevel,0.1)]/100"
-		usr << "Nutrient: [round(nutrilevel,0.1)]/10"
-		if(weedlevel >= 5)
-			usr << "[src] is \red filled with weeds!"
-		if(pestlevel >= 5)
-			usr << "[src] is \red filled with tiny worms!"
+/obj/machinery/portable_atmospherics/hydroponics/examine()
 
-		if(!istype(src,/obj/machinery/portable_atmospherics/hydroponics/soil))
+	..()
 
-			var/turf/T = loc
-			var/datum/gas_mixture/environment
+	if(!seed)
+		usr << "[src] is empty."
+		return
 
-			if(closed_system && (connected_port || holding))
-				environment = air_contents
+	usr << "<span class='notice'>[seed.display_name]</span> are growing here.</span>"
 
-			if(!environment)
-				if(istype(T))
-					environment = T.return_air()
+	if(!Adjacent(usr))
+		return
 
-			if(!environment) //We're in a crate or nullspace, bail out.
-				return
+	usr << "Water: [round(waterlevel,0.1)]/100"
+	usr << "Nutrient: [round(nutrilevel,0.1)]/10"
 
-			var/area/A = T.loc
-			var/light_available
-			if(A)
-				if(A.lighting_use_dynamic)
-					light_available = max(0,min(10,T.lighting_lumcount)-5)
-				else
-					light_available =  5
+	if(weedlevel >= 5)
+		usr << "\The [src] is <span class='danger'>infested with weeds</span>!"
+	if(pestlevel >= 5)
+		usr << "\The [src] is <span class='danger'>infested with tiny worms</span>!"
 
-			usr << "The tray's sensor suite is reporting a light level of [light_available] lumens and a temperature of [environment.temperature]K."
+	if(dead)
+		usr << "<span class='danger'>The plant is dead.</span>"
+	else if(health <= (seed.get_trait(TRAIT_ENDURANCE)/ 2))
+		usr << "The plant looks <span class='danger'>unhealthy</span>."
 
-/obj/machinery/portable_atmospherics/hydroponics/verb/close_lid()
+	if(mechanical)
+		var/turf/T = loc
+		var/datum/gas_mixture/environment
+
+		if(closed_system && (connected_port || holding))
+			environment = air_contents
+
+		if(!environment)
+			if(istype(T))
+				environment = T.return_air()
+
+		if(!environment) //We're in a crate or nullspace, bail out.
+			return
+
+		var/area/A = T.loc
+		var/light_available
+		if(A)
+			if(A.lighting_use_dynamic)
+				light_available = max(0,min(10,T.lighting_lumcount)-5)
+			else
+				light_available =  5
+
+		usr << "The tray's sensor suite is reporting a light level of [light_available] lumens and a temperature of [environment.temperature]K."
+
+/obj/machinery/portable_atmospherics/hydroponics/verb/close_lid_verb()
 	set name = "Toggle Tray Lid"
 	set category = "Object"
 	set src in view(1)
+	close_lid(usr)
 
-	if(!usr || usr.stat || usr.restrained())
+/obj/machinery/portable_atmospherics/hydroponics/proc/close_lid(var/mob/living/user)
+	if(!user || user.stat || user.restrained())
 		return
 
 	closed_system = !closed_system
-	usr << "You [closed_system ? "close" : "open"] the tray's lid."
+	user << "You [closed_system ? "close" : "open"] the tray's lid."
 	update_icon()
-
-/obj/machinery/portable_atmospherics/hydroponics/soil
-	name = "soil"
-	icon = 'icons/obj/hydroponics.dmi'
-	icon_state = "soil"
-	density = 0
-	use_power = 0
-	draw_warnings = 0
-
-/obj/machinery/portable_atmospherics/hydroponics/soil/attackby(var/obj/item/O as obj, var/mob/user as mob)
-	if(istype(O, /obj/item/weapon/shovel))
-		user << "You clear up [src]!"
-		del(src)
-	else if(istype(O,/obj/item/weapon/shovel) || istype(O,/obj/item/weapon/tank))
-		return
-	else
-		..()
-
-/obj/machinery/portable_atmospherics/hydroponics/soil/New()
-	..()
-	verbs -= /obj/machinery/portable_atmospherics/hydroponics/verb/close_lid
-
-#undef HYDRO_SPEED_MULTIPLIER

code/modules/hydroponics/trays/tray_apiary.dm

@@ -3,7 +3,7 @@
 
 /obj/machinery/apiary
 	name = "apiary tray"
-	icon = 'icons/obj/hydroponics.dmi'
+	icon = 'icons/obj/hydroponics_machines.dmi'
 	icon_state = "hydrotray3"
 	density = 1
 	anchored = 1
@@ -188,9 +188,7 @@
 				if(prob(10))
 					H.lastcycle -= 5
 				if(prob(10))
-					H.seed.lifespan = max(initial(H.seed.lifespan) * 1.5, H.seed.lifespan + 1)
-				if(prob(10))
-					H.seed.endurance = max(initial(H.seed.endurance) * 1.5, H.seed.endurance + 1)
+					H.seed.set_trait(TRAIT_ENDURANCE,max(H.seed.get_trait(TRAIT_ENDURANCE)*1.5,H.seed.get_trait(TRAIT_ENDURANCE)+1))
 				if(H.toxins && prob(10))
 					H.toxins = min(0, H.toxins - 1)
 					toxic++

code/modules/hydroponics/trays/tray_process.dm

@@ -0,0 +1,126 @@
+/obj/machinery/portable_atmospherics/hydroponics/process()
+
+	//Do this even if we're not ready for a plant cycle.
+	process_reagents()
+
+	// Update values every cycle rather than every process() tick.
+	if(force_update)
+		force_update = 0
+	else if(world.time < (lastcycle + cycledelay))
+		return
+	lastcycle = world.time
+
+	// Mutation level drops each main tick.
+	mutation_level -= rand(2,4)
+
+	// Weeds like water and nutrients, there's a chance the weed population will increase.
+	// Bonus chance if the tray is unoccupied.
+	if(waterlevel > 10 && nutrilevel > 2 && prob(isnull(seed) ? 5 : 1))
+		weedlevel += 1 * HYDRO_SPEED_MULTIPLIER
+
+	// There's a chance for a weed explosion to happen if the weeds take over.
+	// Plants that are themselves weeds (weed_tolerance > 10) are unaffected.
+	if (weedlevel >= 10 && prob(10))
+		if(!seed || weedlevel >= seed.get_trait(TRAIT_WEED_TOLERANCE))
+			weed_invasion()
+
+	// If there is no seed data (and hence nothing planted),
+	// or the plant is dead, process nothing further.
+	if(!seed || dead)
+		if(mechanical) update_icon() //Harvesting would fail to set alert icons properly.
+		return
+
+	// Advance plant age.
+	if(prob(30)) age += 1 * HYDRO_SPEED_MULTIPLIER
+
+	//Highly mutable plants have a chance of mutating every tick.
+	if(seed.get_trait(TRAIT_IMMUTABLE) == -1)
+		var/mut_prob = rand(1,100)
+		if(mut_prob <= 5) mutate(mut_prob == 1 ? 2 : 1)
+
+	// Other plants also mutate if enough mutagenic compounds have been added.
+	if(!seed.get_trait(TRAIT_IMMUTABLE))
+		if(prob(min(mutation_level,100)))
+			mutate((rand(100) < 15) ? 2 : 1)
+			mutation_level = 0
+
+	// Maintain tray nutrient and water levels.
+	if(seed.get_trait(TRAIT_NUTRIENT_CONSUMPTION) > 0 && nutrilevel > 0 && prob(25))
+		nutrilevel -= max(0,seed.get_trait(TRAIT_NUTRIENT_CONSUMPTION) * HYDRO_SPEED_MULTIPLIER)
+	if(seed.get_trait(TRAIT_WATER_CONSUMPTION) > 0 && waterlevel > 0 && prob(25))
+		waterlevel -= max(0,seed.get_trait(TRAIT_WATER_CONSUMPTION) * HYDRO_SPEED_MULTIPLIER)
+
+	// Make sure the plant is not starving or thirsty. Adequate
+	// water and nutrients will cause a plant to become healthier.
+	var/healthmod = rand(1,3) * HYDRO_SPEED_MULTIPLIER
+	if(seed.get_trait(TRAIT_REQUIRES_NUTRIENTS) && prob(35))
+		health += (nutrilevel < 2 ? -healthmod : healthmod)
+	if(seed.get_trait(TRAIT_REQUIRES_WATER) && prob(35))
+		health += (waterlevel < 10 ? -healthmod : healthmod)
+
+	// Check that pressure, heat and light are all within bounds.
+	// First, handle an open system or an unconnected closed system.
+	var/turf/T = loc
+	var/datum/gas_mixture/environment
+	// If we're closed, take from our internal sources.
+	if(closed_system && (connected_port || holding))
+		environment = air_contents
+	// If atmos input is not there, grab from turf.
+	if(!environment && istype(T)) environment = T.return_air()
+	if(!environment) return
+
+	// Seed datum handles gasses, light and pressure.
+	if(mechanical && closed_system)
+		health -= seed.handle_environment(T,environment,tray_light)
+	else
+		health -= seed.handle_environment(T,environment)
+
+	// If we're attached to a pipenet, then we should let the pipenet know we might have modified some gasses
+	if (closed_system && connected_port)
+		update_connected_network()
+
+	// Toxin levels beyond the plant's tolerance cause damage, but
+	// toxins are sucked up each tick and slowly reduce over time.
+	if(toxins > 0)
+		var/toxin_uptake = max(1,round(toxins/10))
+		if(toxins > seed.get_trait(TRAIT_TOXINS_TOLERANCE))
+			health -= toxin_uptake
+		toxins -= toxin_uptake
+
+	// Check for pests and weeds.
+	// Some carnivorous plants happily eat pests.
+	if(pestlevel > 0)
+		if(seed.get_trait(TRAIT_CARNIVOROUS))
+			health += HYDRO_SPEED_MULTIPLIER
+			pestlevel -= HYDRO_SPEED_MULTIPLIER
+		else if (pestlevel >= seed.get_trait(TRAIT_PEST_TOLERANCE))
+			health -= HYDRO_SPEED_MULTIPLIER
+
+	// Some plants thrive and live off of weeds.
+	if(weedlevel > 0)
+		if(seed.get_trait(TRAIT_PARASITE))
+			health += HYDRO_SPEED_MULTIPLIER
+			weedlevel -= HYDRO_SPEED_MULTIPLIER
+		else if (weedlevel >= seed.get_trait(TRAIT_WEED_TOLERANCE))
+			health -= HYDRO_SPEED_MULTIPLIER
+
+	// Handle life and death.
+	// When the plant dies, weeds thrive and pests die off.
+	check_health()
+
+	// If enough time (in cycles, not ticks) has passed since the plant was harvested, we're ready to harvest again.
+	if((age > seed.get_trait(TRAIT_MATURATION)) && \
+	 ((age - lastproduce) > seed.get_trait(TRAIT_PRODUCTION)) && \
+	 (!harvest && !dead))
+		harvest = 1
+		lastproduce = age
+
+	if(prob(3))  // On each tick, there's a chance the pest population will increase
+		pestlevel += 0.1 * HYDRO_SPEED_MULTIPLIER
+
+	// Some seeds will self-harvest if you don't keep a lid on them.
+	if(seed && seed.can_self_harvest && harvest && !closed_system && prob(5))
+		harvest()
+
+	check_health()
+	return

code/modules/hydroponics/trays/tray_reagents.dm

@@ -0,0 +1,138 @@
+
+/obj/item/weapon/plantspray
+	icon = 'icons/obj/hydroponics_machines.dmi'
+	item_state = "spray"
+	flags = NOBLUDGEON
+	slot_flags = SLOT_BELT
+	throwforce = 4
+	w_class = 2.0
+	throw_speed = 2
+	throw_range = 10
+	var/toxicity = 4
+	var/pest_kill_str = 0
+	var/weed_kill_str = 0
+
+/obj/item/weapon/plantspray/weeds // -- Skie
+
+	name = "weed-spray"
+	desc = "It's a toxic mixture, in spray form, to kill small weeds."
+	icon_state = "weedspray"
+	weed_kill_str = 6
+
+/obj/item/weapon/plantspray/pests
+	name = "pest-spray"
+	desc = "It's some pest eliminator spray! <I>Do not inhale!</I>"
+	icon_state = "pestspray"
+	pest_kill_str = 6
+
+/obj/item/weapon/plantspray/pests/old
+	name = "bottle of pestkiller"
+	icon = 'icons/obj/chemical.dmi'
+	icon_state = "bottle16"
+
+/obj/item/weapon/plantspray/pests/old/carbaryl
+	name = "bottle of carbaryl"
+	icon_state = "bottle16"
+	toxicity = 4
+	pest_kill_str = 2
+
+/obj/item/weapon/plantspray/pests/old/lindane
+	name = "bottle of lindane"
+	icon_state = "bottle18"
+	toxicity = 6
+	pest_kill_str = 4
+
+/obj/item/weapon/plantspray/pests/old/phosmet
+	name = "bottle of phosmet"
+	icon_state = "bottle15"
+	toxicity = 8
+	pest_kill_str = 7
+
+/obj/item/weapon/minihoe // -- Numbers
+	name = "mini hoe"
+	desc = "It's used for removing weeds or scratching your back."
+	icon = 'icons/obj/weapons.dmi'
+	icon_state = "hoe"
+	item_state = "hoe"
+	flags = CONDUCT | NOBLUDGEON
+	force = 5.0
+	throwforce = 7.0
+	w_class = 2.0
+	matter = list("metal" = 50)
+	attack_verb = list("slashed", "sliced", "cut", "clawed")
+
+
+// *************************************
+// Weedkiller defines for hydroponics
+// *************************************
+
+/obj/item/weedkiller
+	name = "bottle of weedkiller"
+	icon = 'icons/obj/chemical.dmi'
+	icon_state = "bottle16"
+	var/toxicity = 0
+	var/weed_kill_str = 0
+
+/obj/item/weedkiller/triclopyr
+	name = "bottle of glyphosate"
+	icon = 'icons/obj/chemical.dmi'
+	icon_state = "bottle16"
+	toxicity = 4
+	weed_kill_str = 2
+
+/obj/item/weedkiller/lindane
+	name = "bottle of triclopyr"
+	icon = 'icons/obj/chemical.dmi'
+	icon_state = "bottle18"
+	toxicity = 6
+	weed_kill_str = 4
+
+/obj/item/weedkiller/D24
+	name = "bottle of 2,4-D"
+	icon = 'icons/obj/chemical.dmi'
+	icon_state = "bottle15"
+	toxicity = 8
+	weed_kill_str = 7
+
+// *************************************
+// Nutrient defines for hydroponics
+// *************************************
+
+/obj/item/weapon/reagent_containers/glass/fertilizer
+	name = "fertilizer bottle"
+	desc = "A small glass bottle. Can hold up to 10 units."
+	icon = 'icons/obj/chemical.dmi'
+	icon_state = "bottle16"
+	flags = OPENCONTAINER
+	possible_transfer_amounts = null
+	w_class = 2.0
+
+	var/fertilizer //Reagent contained, if any.
+
+	//Like a shot glass!
+	amount_per_transfer_from_this = 10
+	volume = 10
+
+/obj/item/weapon/reagent_containers/glass/fertilizer/New()
+	..()
+
+	src.pixel_x = rand(-5.0, 5)
+	src.pixel_y = rand(-5.0, 5)
+
+	if(fertilizer)
+		reagents.add_reagent(fertilizer,10)
+
+/obj/item/weapon/reagent_containers/glass/fertilizer/ez
+	name = "bottle of E-Z-Nutrient"
+	icon_state = "bottle16"
+	fertilizer = "eznutrient"
+
+/obj/item/weapon/reagent_containers/glass/fertilizer/l4z
+	name = "bottle of Left 4 Zed"
+	icon_state = "bottle18"
+	fertilizer = "left4zed"
+
+/obj/item/weapon/reagent_containers/glass/fertilizer/rh
+	name = "bottle of Robust Harvest"
+	icon_state = "bottle15"
+	fertilizer = "robustharvest"

code/modules/hydroponics/trays/tray_soil.dm

@@ -0,0 +1,67 @@
+/obj/machinery/portable_atmospherics/hydroponics/soil
+	name = "soil"
+	icon_state = "soil"
+	density = 0
+	use_power = 0
+	mechanical = 0
+	tray_light = 0
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/attackby(var/obj/item/O as obj, var/mob/user as mob)
+	if(istype(O,/obj/item/weapon/tank))
+		return
+	else
+		..()
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/New()
+	..()
+	verbs -= /obj/machinery/portable_atmospherics/hydroponics/verb/close_lid_verb
+	verbs -= /obj/machinery/portable_atmospherics/hydroponics/verb/remove_label
+	verbs -= /obj/machinery/portable_atmospherics/hydroponics/verb/set_light
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/CanPass()
+	return 1
+
+// Holder for vine plants.
+// Icons for plants are generated as overlays, so setting it to invisible wouldn't work.
+// Hence using a blank icon.
+/obj/machinery/portable_atmospherics/hydroponics/soil/invisible
+	name = "plant"
+	icon = 'icons/obj/seeds.dmi'
+	icon_state = "blank"
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/invisible/New(var/newloc,var/datum/seed/newseed)
+	..()
+	seed = newseed
+	dead = 0
+	age = 1
+	health = seed.get_trait(TRAIT_ENDURANCE)
+	lastcycle = world.time
+	pixel_y = rand(-5,5)
+	check_health()
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/invisible/remove_dead()
+	..()
+	del(src)
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/invisible/harvest()
+	..()
+	if(!seed) // Repeat harvests are a thing.
+		del(src)
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/invisible/die()
+	del(src)
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/invisible/process()
+	if(!seed)
+		del(src)
+		return
+	else if(name=="plant")
+		name = seed.display_name
+	..()
+
+/obj/machinery/portable_atmospherics/hydroponics/soil/invisible/Del()
+	// Check if we're masking a decal that needs to be visible again.
+	for(var/obj/effect/plant/plant in get_turf(src))
+		if(plant.invisibility == INVISIBILITY_MAXIMUM)
+			plant.invisibility = initial(plant.invisibility)
+	..()

code/modules/hydroponics/trays/tray_tools.dm

@@ -0,0 +1,271 @@
+//Analyzer, pestkillers, weedkillers, nutrients, hatchets, cutters.
+
+/obj/item/weapon/wirecutters/clippers
+	name = "plant clippers"
+	desc = "A tool used to take samples from plants."
+
+/obj/item/device/analyzer/plant_analyzer
+	name = "plant analyzer"
+	icon = 'icons/obj/device.dmi'
+	icon_state = "hydro"
+	item_state = "analyzer"
+	var/form_title
+	var/last_data
+
+/obj/item/device/analyzer/plant_analyzer/proc/print_report_verb()
+	set name = "Print Plant Report"
+	set category = "Object"
+	set src = usr
+
+	if(usr.stat || usr.restrained() || usr.lying)
+		return
+	print_report(usr)
+
+/obj/item/device/analyzer/plant_analyzer/Topic(href, href_list)
+	if(..())
+		return
+	if(href_list["print"])
+		print_report(usr)
+
+/obj/item/device/analyzer/plant_analyzer/proc/print_report(var/mob/living/user)
+	if(!last_data)
+		user << "There is no scan data to print."
+		return
+	var/obj/item/weapon/paper/P = new /obj/item/weapon/paper(get_turf(src))
+	P.name = "paper - [form_title]"
+	P.info = "[last_data]"
+	if(istype(user,/mob/living/carbon/human) && !(user.l_hand && user.r_hand))
+		user.put_in_hands(P)
+	user.visible_message("\The [src] spits out a piece of paper.")
+	return
+
+/obj/item/device/analyzer/plant_analyzer/attack_self(mob/user as mob)
+	print_report(user)
+	return 0
+
+/obj/item/device/analyzer/plant_analyzer/afterattack(obj/target, mob/user, flag)
+	if(!flag) return
+
+	var/datum/seed/grown_seed
+	var/datum/reagents/grown_reagents
+	if(istype(target,/obj/structure/table))
+		return ..()
+	else if(istype(target,/obj/item/weapon/reagent_containers/food/snacks/grown))
+
+		var/obj/item/weapon/reagent_containers/food/snacks/grown/G = target
+		grown_seed = plant_controller.seeds[G.plantname]
+		grown_reagents = G.reagents
+
+	else if(istype(target,/obj/item/weapon/grown))
+
+		var/obj/item/weapon/grown/G = target
+		grown_seed = plant_controller.seeds[G.plantname]
+		grown_reagents = G.reagents
+
+	else if(istype(target,/obj/item/seeds))
+
+		var/obj/item/seeds/S = target
+		grown_seed = S.seed
+
+	else if(istype(target,/obj/machinery/portable_atmospherics/hydroponics))
+
+		var/obj/machinery/portable_atmospherics/hydroponics/H = target
+		grown_seed = H.seed
+		grown_reagents = H.reagents
+
+	if(!grown_seed)
+		user << "<span class='danger'>[src] can tell you nothing about \the [target].</span>"
+		return
+
+	form_title = "[grown_seed.seed_name] (#[grown_seed.uid])"
+	var/dat = "<h3>Plant data for [form_title]</h3>"
+	user.visible_message("<span class='notice'>[user] runs the scanner over \the [target].</span>")
+
+	dat += "<h2>General Data</h2>"
+
+	dat += "<table>"
+	dat += "<tr><td><b>Endurance</b></td><td>[grown_seed.get_trait(TRAIT_ENDURANCE)]</td></tr>"
+	dat += "<tr><td><b>Yield</b></td><td>[grown_seed.get_trait(TRAIT_YIELD)]</td></tr>"
+	dat += "<tr><td><b>Maturation time</b></td><td>[grown_seed.get_trait(TRAIT_MATURATION)]</td></tr>"
+	dat += "<tr><td><b>Production time</b></td><td>[grown_seed.get_trait(TRAIT_PRODUCTION)]</td></tr>"
+	dat += "<tr><td><b>Potency</b></td><td>[grown_seed.get_trait(TRAIT_POTENCY)]</td></tr>"
+	dat += "</table>"
+
+	if(grown_reagents && grown_reagents.reagent_list && grown_reagents.reagent_list.len)
+		dat += "<h2>Reagent Data</h2>"
+
+		dat += "<br>This sample contains: "
+		for(var/datum/reagent/R in grown_reagents.reagent_list)
+			dat += "<br>- [R.id], [grown_reagents.get_reagent_amount(R.id)] unit(s)"
+
+	dat += "<h2>Other Data</h2>"
+
+	if(grown_seed.get_trait(TRAIT_HARVEST_REPEAT))
+		dat += "This plant can be harvested repeatedly.<br>"
+
+	if(grown_seed.get_trait(TRAIT_IMMUTABLE) == -1)
+		dat += "This plant is highly mutable.<br>"
+	else if(grown_seed.get_trait(TRAIT_IMMUTABLE) > 0)
+		dat += "This plant does not possess genetics that are alterable.<br>"
+
+	if(grown_seed.get_trait(TRAIT_REQUIRES_NUTRIENTS))
+		if(grown_seed.get_trait(TRAIT_NUTRIENT_CONSUMPTION) < 0.05)
+			dat += "It consumes a small amount of nutrient fluid.<br>"
+		else if(grown_seed.get_trait(TRAIT_NUTRIENT_CONSUMPTION) > 0.2)
+			dat += "It requires a heavy supply of nutrient fluid.<br>"
+		else
+			dat += "It requires a supply of nutrient fluid.<br>"
+
+	if(grown_seed.get_trait(TRAIT_REQUIRES_WATER))
+		if(grown_seed.get_trait(TRAIT_WATER_CONSUMPTION) < 1)
+			dat += "It requires very little water.<br>"
+		else if(grown_seed.get_trait(TRAIT_WATER_CONSUMPTION) > 5)
+			dat += "It requires a large amount of water.<br>"
+		else
+			dat += "It requires a stable supply of water.<br>"
+
+	if(grown_seed.mutants && grown_seed.mutants.len)
+		dat += "It exhibits a high degree of potential subspecies shift.<br>"
+
+	dat += "It thrives in a temperature of [grown_seed.get_trait(TRAIT_IDEAL_HEAT)] Kelvin."
+
+	if(grown_seed.get_trait(TRAIT_LOWKPA_TOLERANCE) < 20)
+		dat += "<br>It is well adapted to low pressure levels."
+	if(grown_seed.get_trait(TRAIT_HIGHKPA_TOLERANCE) > 220)
+		dat += "<br>It is well adapted to high pressure levels."
+
+	if(grown_seed.get_trait(TRAIT_HEAT_TOLERANCE) > 30)
+		dat += "<br>It is well adapted to a range of temperatures."
+	else if(grown_seed.get_trait(TRAIT_HEAT_TOLERANCE) < 10)
+		dat += "<br>It is very sensitive to temperature shifts."
+
+	dat += "<br>It thrives in a light level of [grown_seed.get_trait(TRAIT_IDEAL_LIGHT)] lumen[grown_seed.get_trait(TRAIT_IDEAL_LIGHT) == 1 ? "" : "s"]."
+
+	if(grown_seed.get_trait(TRAIT_LIGHT_TOLERANCE) > 10)
+		dat += "<br>It is well adapted to a range of light levels."
+	else if(grown_seed.get_trait(TRAIT_LIGHT_TOLERANCE) < 3)
+		dat += "<br>It is very sensitive to light level shifts."
+
+	if(grown_seed.get_trait(TRAIT_TOXINS_TOLERANCE) < 3)
+		dat += "<br>It is highly sensitive to toxins."
+	else if(grown_seed.get_trait(TRAIT_TOXINS_TOLERANCE) > 6)
+		dat += "<br>It is remarkably resistant to toxins."
+
+	if(grown_seed.get_trait(TRAIT_PEST_TOLERANCE) < 3)
+		dat += "<br>It is highly sensitive to pests."
+	else if(grown_seed.get_trait(TRAIT_PEST_TOLERANCE) > 6)
+		dat += "<br>It is remarkably resistant to pests."
+
+	if(grown_seed.get_trait(TRAIT_WEED_TOLERANCE) < 3)
+		dat += "<br>It is highly sensitive to weeds."
+	else if(grown_seed.get_trait(TRAIT_WEED_TOLERANCE) > 6)
+		dat += "<br>It is remarkably resistant to weeds."
+
+	switch(grown_seed.get_trait(TRAIT_SPREAD))
+		if(1)
+			dat += "<br>It is able to be planted outside of a tray."
+		if(2)
+			dat += "<br>It is a robust and vigorous vine that will spread rapidly."
+
+	switch(grown_seed.get_trait(TRAIT_CARNIVOROUS))
+		if(1)
+			dat += "<br>It is carniovorous and will eat tray pests for sustenance."
+		if(2)
+			dat	+= "<br>It is carnivorous and poses a significant threat to living things around it."
+
+	if(grown_seed.get_trait(TRAIT_PARASITE))
+		dat += "<br>It is capable of parisitizing and gaining sustenance from tray weeds."
+	if(grown_seed.get_trait(TRAIT_ALTER_TEMP))
+		dat += "<br>It will periodically alter the local temperature by [grown_seed.get_trait(TRAIT_ALTER_TEMP)] degrees Kelvin."
+
+	if(grown_seed.get_trait(TRAIT_BIOLUM))
+		dat += "<br>It is [grown_seed.get_trait(TRAIT_BIOLUM_COLOUR)  ? "<font color='[grown_seed.get_trait(TRAIT_BIOLUM_COLOUR)]'>bio-luminescent</font>" : "bio-luminescent"]."
+
+	if(grown_seed.get_trait(TRAIT_PRODUCES_POWER))
+		dat += "<br>The fruit will function as a battery if prepared appropriately."
+
+	if(grown_seed.get_trait(TRAIT_STINGS))
+		dat += "<br>The fruit is covered in stinging spines."
+
+	if(grown_seed.get_trait(TRAIT_JUICY) == 1)
+		dat += "<br>The fruit is soft-skinned and juicy."
+	else if(grown_seed.get_trait(TRAIT_JUICY) == 2)
+		dat += "<br>The fruit is excessively juicy."
+
+	if(grown_seed.get_trait(TRAIT_EXPLOSIVE))
+		dat += "<br>The fruit is internally unstable."
+
+	if(grown_seed.get_trait(TRAIT_TELEPORTING))
+		dat += "<br>The fruit is temporal/spatially unstable."
+
+	dat += "<br><br>\[<a href='?src=\ref[src];print=1'>print report</a>\]"
+	if(dat)
+		user << browse(dat,"window=plant_analyzer")
+		last_data = dat
+
+	return
+
+/obj/item/weapon/minihoe // -- Numbers
+	name = "mini hoe"
+	desc = "It's used for removing weeds or scratching your back."
+	icon = 'icons/obj/weapons.dmi'
+	icon_state = "hoe"
+	item_state = "hoe"
+	flags = CONDUCT | NOBLUDGEON
+	force = 5.0
+	throwforce = 7.0
+	w_class = 2.0
+	matter = list("metal" = 50)
+	attack_verb = list("slashed", "sliced", "cut", "clawed")
+
+//Hatchets and things to kill kudzu
+/obj/item/weapon/hatchet
+	name = "hatchet"
+	desc = "A very sharp axe blade upon a short fibremetal handle. It has a long history of chopping things, but now it is used for chopping wood."
+	icon = 'icons/obj/weapons.dmi'
+	icon_state = "hatchet"
+	flags = CONDUCT
+	force = 12.0
+	w_class = 2.0
+	throwforce = 15.0
+	throw_speed = 4
+	throw_range = 4
+	sharp = 1
+	edge = 1
+	matter = list("metal" = 15000)
+	origin_tech = "materials=2;combat=1"
+	attack_verb = list("chopped", "torn", "cut")
+
+/obj/item/weapon/hatchet/attack(mob/living/carbon/M as mob, mob/living/carbon/user as mob)
+	playsound(loc, 'sound/weapons/bladeslice.ogg', 50, 1, -1)
+	return ..()
+
+//If it's a hatchet it goes here. I guess
+/obj/item/weapon/hatchet/unathiknife
+	name = "duelling knife"
+	desc = "A length of leather-bound wood studded with razor-sharp teeth. How crude."
+	icon = 'icons/obj/weapons.dmi'
+	icon_state = "unathiknife"
+	attack_verb = list("ripped", "torn", "cut")
+
+/obj/item/weapon/scythe
+	icon_state = "scythe0"
+	name = "scythe"
+	desc = "A sharp and curved blade on a long fibremetal handle, this tool makes it easy to reap what you sow."
+	force = 13.0
+	throwforce = 5.0
+	throw_speed = 1
+	throw_range = 3
+	w_class = 4.0
+	flags = NOSHIELD
+	slot_flags = SLOT_BACK
+	origin_tech = "materials=2;combat=2"
+	attack_verb = list("chopped", "sliced", "cut", "reaped")
+
+/obj/item/weapon/scythe/afterattack(atom/A, mob/user as mob, proximity)
+	if(!proximity) return
+	if(istype(A, /obj/effect/plant))
+		for(var/obj/effect/plant/B in orange(A,1))
+			if(prob(80))
+				B.die_off(1)
+		del A

code/modules/hydroponics/trays/tray_update_icons.dm

@@ -0,0 +1,83 @@
+//Refreshes the icon and sets the luminosity
+/obj/machinery/portable_atmospherics/hydroponics/update_icon()
+	// Update name.
+	if(seed)
+		if(mechanical)
+			name = "[base_name] (#[seed.uid])"
+		else
+			name = "[seed.seed_name]"
+	else
+		name = initial(name)
+
+	if(labelled)
+		name += " ([labelled])"
+
+	overlays.Cut()
+	// Updates the plant overlay.
+	if(!isnull(seed))
+
+		if(mechanical && health <= (seed.get_trait(TRAIT_ENDURANCE) / 2))
+			overlays += "over_lowhealth3"
+
+		if(dead)
+			var/ikey = "[seed.get_trait(TRAIT_PLANT_ICON)]-dead"
+			var/image/dead_overlay = plant_controller.plant_icon_cache["[ikey]"]
+			if(!dead_overlay)
+				dead_overlay = image('icons/obj/hydroponics_growing.dmi', "[ikey]")
+				dead_overlay.color = DEAD_PLANT_COLOUR
+			overlays |= dead_overlay
+		else
+			if(!seed.growth_stages)
+				seed.update_growth_stages()
+			if(!seed.growth_stages)
+				world << "<span class='danger'>Seed type [seed.get_trait(TRAIT_PLANT_ICON)] cannot find a growth stage value.</span>"
+				return
+			var/overlay_stage = 1
+			if(age >= seed.get_trait(TRAIT_MATURATION))
+				overlay_stage = seed.growth_stages
+			else
+				overlay_stage = max(1,round(age/round(seed.get_trait(TRAIT_MATURATION)/seed.growth_stages)))
+			var/ikey = "[seed.get_trait(TRAIT_PLANT_ICON)]-[overlay_stage]"
+			var/image/plant_overlay = plant_controller.plant_icon_cache["[ikey]-[seed.get_trait(TRAIT_PLANT_COLOUR)]"]
+			if(!plant_overlay)
+				plant_overlay = image('icons/obj/hydroponics_growing.dmi', "[ikey]")
+				plant_overlay.color = seed.get_trait(TRAIT_PLANT_COLOUR)
+				plant_controller.plant_icon_cache["[ikey]-[seed.get_trait(TRAIT_PLANT_COLOUR)]"] = plant_overlay
+			overlays |= plant_overlay
+
+			if(harvest && overlay_stage == seed.growth_stages)
+				ikey = "[seed.get_trait(TRAIT_PRODUCT_ICON)]"
+				var/image/harvest_overlay = plant_controller.plant_icon_cache["product-[ikey]-[seed.get_trait(TRAIT_PLANT_COLOUR)]"]
+				if(!harvest_overlay)
+					harvest_overlay = image('icons/obj/hydroponics_products.dmi', "[ikey]")
+					harvest_overlay.color = seed.get_trait(TRAIT_PRODUCT_COLOUR)
+					plant_controller.plant_icon_cache["product-[ikey]-[seed.get_trait(TRAIT_PRODUCT_COLOUR)]"] = harvest_overlay
+				overlays |= harvest_overlay
+
+	//Draw the cover.
+	if(closed_system)
+		overlays += "hydrocover"
+
+	//Updated the various alert icons.
+	if(mechanical)
+		if(waterlevel <= 10)
+			overlays += "over_lowwater3"
+		if(nutrilevel <= 2)
+			overlays += "over_lownutri3"
+		if(weedlevel >= 5 || pestlevel >= 5 || toxins >= 40)
+			overlays += "over_alert3"
+		if(harvest)
+			overlays += "over_harvest3"
+
+	// Update bioluminescence.
+	if(seed)
+		if(seed.get_trait(TRAIT_BIOLUM))
+			SetLuminosity(round(seed.get_trait(TRAIT_POTENCY)/10))
+			if(seed.get_trait(TRAIT_BIOLUM_COLOUR))
+				l_color = seed.get_trait(TRAIT_BIOLUM_COLOUR)
+			else
+				l_color = null
+			return
+
+	SetLuminosity(0)
+	return