Mutiny Mode

baystation12.dme

@@ -231,6 +231,20 @@
 #include "code\game\gamemodes\malfunction\malfunction.dm"
 #include "code\game\gamemodes\meteor\meteor.dm"
 #include "code\game\gamemodes\meteor\meteors.dm"
+#include "code\game\gamemodes\mutiny\auth_key.dm"
+#include "code\game\gamemodes\mutiny\directive.dm"
+#include "code\game\gamemodes\mutiny\emergency_authentication_device.dm"
+#include "code\game\gamemodes\mutiny\key_pinpointer.dm"
+#include "code\game\gamemodes\mutiny\mutiny.dm"
+#include "code\game\gamemodes\mutiny\mutiny_fluff.dm"
+#include "code\game\gamemodes\mutiny\mutiny_hooks.dm"
+#include "code\game\gamemodes\mutiny\directives\alien_fraud_directive.dm"
+#include "code\game\gamemodes\mutiny\directives\bluespace_contagion_directive.dm"
+#include "code\game\gamemodes\mutiny\directives\financial_crisis_directive.dm"
+#include "code\game\gamemodes\mutiny\directives\ipc_virus_directive.dm"
+#include "code\game\gamemodes\mutiny\directives\research_to_ripleys_directive.dm"
+#include "code\game\gamemodes\mutiny\directives\tau_ceti_needs_women_directive.dm"
+#include "code\game\gamemodes\mutiny\directives\terminations_directive.dm"
 #include "code\game\gamemodes\ninja\ninja.dm"
 #include "code\game\gamemodes\nuclear\nuclear.dm"
 #include "code\game\gamemodes\nuclear\nuclearbomb.dm"

code/__HELPERS/time.dm

@@ -1,3 +1,9 @@
+#define SECOND *10
+#define SECONDS *10
+
+#define MINUTE *600
+#define MINUTES *600
+
 //Returns the world time in english
 proc/worldtime2text(time = world.time)
 	return "[round(time / 36000)+12]:[(time / 600 % 60) < 10 ? add_zero(time / 600 % 60, 1) : time / 600 % 60]"

code/controllers/hooks-defs.dm

@@ -15,3 +15,73 @@
  * Called in gameticker.dm when a round ends.
  */
 /hook/roundend
+
+/**
+ * Death hook.
+ * Called in death.dm when someone dies.
+ * Parameters: var/mob/living/carbon/human, var/gibbed
+ */
+/hook/death
+
+/**
+ * Cloning hook.
+ * Called in cloning.dm when someone is brought back by the wonders of modern science.
+ * Parameters: var/mob/living/carbon/human
+ */
+/hook/clone
+
+/**
+ * Debrained hook.
+ * Called in brain_item.dm when someone gets debrained.
+ * Parameters: var/obj/item/brain
+ */
+/hook/debrain
+
+/**
+ * Borged hook.
+ * Called in robot_parts.dm when someone gets turned into a cyborg.
+ * Parameters: var/mob/living/silicon/robot
+ */
+/hook/borgify
+
+/**
+ * Podman hook.
+ * Called in podmen.dm when someone is brought back as a Diona.
+ * Parameters: var/mob/living/carbon/monkey/diona
+ */
+/hook/harvest_podman
+
+/**
+ * Payroll revoked hook.
+ * Called in Accounts_DB.dm when someone's payroll is stolen at the Accounts terminal.
+ * Parameters: var/datum/money_account
+ */
+/hook/revoke_payroll
+
+/**
+ * Account suspension hook.
+ * Called in Accounts_DB.dm when someone's account is suspended or unsuspended at the Accounts terminal.
+ * Parameters: var/datum/money_account
+ */
+/hook/change_account_status
+
+/**
+ * Employee reassignment hook.
+ * Called in card.dm when someone's card is reassigned at the HoP's desk.
+ * Parameters: var/obj/item/weapon/card/id
+ */
+/hook/reassign_employee
+
+/**
+ * Employee terminated hook.
+ * Called in card.dm when someone's card is terminated at the HoP's desk.
+ * Parameters: var/obj/item/weapon/card/id
+ */
+/hook/terminate_employee
+
+/**
+ * Crate sold hook.
+ * Called in supplyshuttle.dm when a crate is sold on the shuttle.
+ * Parameters: var/obj/structure/closet/crate/sold, var/area/shuttle
+ */
+/hook/sell_crate

code/controllers/hooks.dm

@@ -23,7 +23,7 @@
  * @param hook	Identifier of the hook to call.
  * @returns		1 if all hooked code runs successfully, 0 otherwise.
  */
-/proc/callHook(hook)
+/proc/callHook(hook, list/args=null)
 	var/hook_path = text2path("/hook/[hook]")
 	if(!hook_path)
 		error("Invalid hook '/hook/[hook]' called.")
@@ -32,7 +32,7 @@
 	var/caller = new hook_path
 	var/status = 1
 	for(var/P in typesof("[hook_path]/proc"))
-		if(!call(caller, P)())
+		if(!call(caller, P)(arglist(args)))
 			error("Hook '[P]' failed or runtimed.")
 			status = 0
 

code/controllers/shuttle_controller.dm

@@ -36,7 +36,7 @@ datum/shuttle_controller
 			if(direction == -1)
 				setdirection(1)
 		else
-			settimeleft(SHUTTLEARRIVETIME*coeff)
+			settimeleft(get_shuttle_arrive_time()*coeff)
 			online = 1
 			if(always_fake_recall)
 				fake_recall = rand(300,500)		//turning on the red lights in hallways
@@ -45,10 +45,16 @@ datum/shuttle_controller
 				if(istype(A, /area/hallway))
 					A.readyalert()
 
+	proc/get_shuttle_arrive_time()
+		// During mutiny rounds, the shuttle takes twice as long.
+		if(ticker && istype(ticker.mode,/datum/game_mode/mutiny))
+			return SHUTTLEARRIVETIME * 2
+
+		return SHUTTLEARRIVETIME
+
 datum/shuttle_controller/proc/shuttlealert(var/X)
 		alert = X
 
-
 datum/shuttle_controller/proc/recall()
 	if(direction == 1)
 		var/timeleft = timeleft()
@@ -78,9 +84,9 @@ datum/shuttle_controller/proc/timeleft()
 		if(direction == 1 || direction == 2)
 			return timeleft
 		else
-			return SHUTTLEARRIVETIME-timeleft
+			return get_shuttle_arrive_time()-timeleft
 	else
-		return SHUTTLEARRIVETIME
+		return get_shuttle_arrive_time()
 
 	// sets the time left to a given delay (in seconds)
 datum/shuttle_controller/proc/settimeleft(var/delay)
@@ -95,7 +101,7 @@ datum/shuttle_controller/proc/setdirection(var/dirn)
 	direction = dirn
 	// if changing direction, flip the timeleft by SHUTTLEARRIVETIME
 	var/ticksleft = endtime - world.timeofday
-	endtime = world.timeofday + (SHUTTLEARRIVETIME*10 - ticksleft)
+	endtime = world.timeofday + (get_shuttle_arrive_time()*10 - ticksleft)
 	return
 
 datum/shuttle_controller/proc/process()

code/game/gamemodes/game_mode.dm

@@ -28,6 +28,7 @@
 	var/required_enemies = 0
 	var/recommended_enemies = 0
 	var/newscaster_announcements = null
+	var/ert_disabled = 0
 	var/uplink_welcome = "Syndicate Uplink Console:"
 	var/uplink_uses = 10
 	var/uplink_items = {"Highly Visible and Dangerous Weapons;
@@ -407,6 +408,9 @@ Implants;
 			heads += player.mind
 	return heads
 
+/datum/game_mode/proc/check_antagonists_topic(href, href_list[])
+	return 0
+
 /datum/game_mode/New()
 	newscaster_announcements = pick(newscaster_standard_feeds)
 

code/game/gamemodes/mutiny/auth_key.dm

@@ -0,0 +1,39 @@
+/obj/item/weapon/mutiny/auth_key
+  name = "authentication key"
+  desc = "Better keep this safe."
+  icon = 'icons/obj/items.dmi'
+  icon_state = "nucleardisk"
+  item_state = "card-id"
+  w_class = 1
+
+  var/time_entered_space
+  var/obj/item/device/radio/radio
+
+  New()
+    radio = new(src)
+    spawn(20 SECONDS)
+      keep_alive()
+    ..()
+
+  proc/keep_alive()
+    var/in_space = istype(loc, /turf/space)
+    if (!in_space && time_entered_space)
+      // Recovered before the key was lost
+      time_entered_space = null
+    else if (in_space && !time_entered_space)
+      // The key has left the station
+      time_entered_space = world.time
+    else if (in_space && time_entered_space + (10 SECONDS) < world.time)
+      // Time is up
+      radio.autosay("This device has left the station's perimeter. Triggering emergency activation failsafe.", name)
+      del(src)
+      return
+
+    spawn(10 SECONDS)
+      keep_alive()
+
+/obj/item/weapon/mutiny/auth_key/captain
+  name = "Captain's Authentication Key"
+
+/obj/item/weapon/mutiny/auth_key/secondary
+  name = "Emergency Secondary Authentication Key"

code/game/gamemodes/mutiny/directive.dm

@@ -0,0 +1,29 @@
+datum/directive
+  var/datum/game_mode/mutiny/mode
+  var/list/special_orders
+
+  New(var/datum/game_mode/mutiny/M)
+    mode = M
+
+  proc/get_description()
+    return {"
+      <p>
+        NanoTrasen's reasons for the following directives are classified.
+      </p>
+    "}
+
+  proc/meets_prerequisites()
+    return 0
+
+  proc/directives_complete()
+    return 1
+
+  proc/initialize()
+    return 1
+
+/proc/get_directive(type)
+  var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+  if(!mode || !mode.current_directive || !istype(mode.current_directive, text2path("/datum/directive/[type]")))
+    return null
+
+  return mode.current_directive

code/game/gamemodes/mutiny/directives/alien_fraud_directive.dm

@@ -0,0 +1,36 @@
+datum/directive/terminations/alien_fraud
+  special_orders = list(
+    "Suspend financial accounts of all Tajaran and Unathi personnel.",
+    "Transfer their payrolls to the station account.",
+    "Terminate their employment.")
+
+datum/directive/terminations/alien_fraud/get_crew_to_terminate()
+  var/list/aliens[0]
+  for(var/mob/living/carbon/human/H in player_list)
+    if (H.species.name == "Tajaran" || H.species.name == "Unathi")
+      aliens.Add(H)
+  return aliens
+
+datum/directive/terminations/alien_fraud/get_description()
+  return {"
+    <p>
+      An extensive conspiracy network aimed at defrauding NanoTrasen of large amounts of funds has been uncovered
+      operating within Tau Ceti. Human personnel are not suspected to be involved. Further information is classified.
+    </p>
+  "}
+
+datum/directive/terminations/alien_fraud/meets_prerequisites()
+  // There must be at least one Tajaran and at least one Unathi, but the total
+  // of the Tajarans and Unathi combined can't be more than 1/3rd of the crew.
+  var/tajarans = 0
+  var/unathi = 0
+  for(var/mob/living/carbon/human/H in player_list)
+    if (H.species.name == "Tajaran")
+      tajarans++
+    if (H.species.name == "Unathi")
+      unathi++
+
+  if (!tajarans || !unathi)
+    return 0
+
+  return (tajarans + unathi) <= (player_list.len / 3)

code/game/gamemodes/mutiny/directives/bluespace_contagion_directive.dm

@@ -0,0 +1,45 @@
+#define INFECTION_COUNT 5
+
+datum/directive/bluespace_contagion
+  var/infection_count = 5
+  var/list/infected = list()
+
+datum/directive/bluespace_contagion/get_description()
+  return {"
+    <p>
+      A manufactured and near-undetectable virus is spreading on NanoTrasen stations.
+      The pathogen travels by bluespace after maturing for one day.
+      No treatment has yet been discovered. Personnel onboard [station_name()] have been infected. Further information is classified.
+    </p>
+  "}
+
+datum/directive/bluespace_contagion/initialize()
+  var/list/candidates = player_list.Copy()
+  var/list/infected_names = list()
+  for(var/i=0, i < INFECTION_COUNT, i++)
+    if(!candidates.len)
+      break
+
+    var/mob/living/carbon/human/candidate = pick(candidates)
+    candidates.Remove(candidate)
+    infected.Add(candidate)
+    infected_names.Add("[candidate.mind.assigned_role] [candidate.mind.name]")
+
+  special_orders = list(
+    "Quarantine these personnel: [list2text(infected_names, ", ")].",
+    "Allow one hour for a cure to be manufactured.",
+    "If no cure arrives after that time, execute the infected.")
+
+datum/directive/bluespace_contagion/meets_prerequisites()
+  return player_list.len >= 7
+
+datum/directive/bluespace_contagion/directives_complete()
+  return infected.len == 0
+
+/hook/death/proc/infected_killed(mob/living/carbon/human/deceased, gibbed)
+  var/datum/directive/bluespace_contagion/D = get_directive("bluespace_contagion")
+  if(!D) return 1
+
+  if(deceased in D.infected)
+    D.infected.Remove(deceased)
+  return 1

code/game/gamemodes/mutiny/directives/financial_crisis_directive.dm

@@ -0,0 +1,26 @@
+datum/directive/terminations/financial_crisis
+  special_orders = list(
+    "Suspend financial accounts of all civilian personnel, excluding the Head of Personnel.",
+    "Transfer their payrolls to the station account.",
+    "Terminate their employment.")
+
+datum/directive/terminations/financial_crisis/get_crew_to_terminate()
+  var/list/civilians[0]
+  var/list/candidates = civilian_positions - "Head of Personnel"
+  for(var/mob/living/carbon/human/H in player_list)
+    if (candidates.Find(H.mind.assigned_role))
+      civilians.Add(H)
+  return civilians
+
+datum/directive/terminations/financial_crisis/get_description()
+  return {"
+    <p>
+      Tau Ceti system banks in financial crisis. Local emergency situation ongoing.
+      NT Funds redistributed, impact upon civilian department expected.
+      Further information is classified.
+    </p>
+  "}
+
+datum/directive/terminations/financial_crisis/meets_prerequisites()
+  var/list/civilians = get_crew_to_terminate()
+  return civilians.len >= 5

code/game/gamemodes/mutiny/directives/ipc_virus_directive.dm

@@ -0,0 +1,83 @@
+datum/directive/ipc_virus
+  special_orders = list(
+    "Terminate employment of all IPC personnel.",
+    "Extract the Positronic Brains from IPC units.",
+    "Mount the Positronic Brains into Cyborgs.")
+
+  var/list/roboticist_roles = list(
+    "Research Director",
+    "Roboticist"
+  )
+
+  var/list/brains_to_enslave = list()
+  var/list/cyborgs_to_make = list()
+  var/list/ids_to_terminate = list()
+
+  proc/get_ipcs()
+    var/list/machines[0]
+    for(var/mob/living/carbon/human/H in player_list)
+      if (H.species.name == "Machine")
+        machines.Add(H)
+    return machines
+
+  proc/get_roboticists()
+    var/list/roboticists[0]
+    for(var/mob/living/carbon/human/H in player_list)
+      if (roboticist_roles.Find(H.mind.assigned_role))
+        roboticists.Add(H)
+    return roboticists
+
+datum/directive/ipc_virus/initialize()
+  for(var/mob/living/carbon/human/H in get_ipcs())
+    brains_to_enslave.Add(H.mind)
+    cyborgs_to_make.Add(H.mind)
+    ids_to_terminate.Add(H.wear_id)
+
+datum/directive/ipc_virus/get_description()
+  return {"
+    <p>
+      IPC units have been found to be infected with a violent and undesired virus in Virgus Ferrorus system.
+      Risk to NSS Exodus IPC units has not been assessed. Further information is classified.
+    </p>
+  "}
+
+datum/directive/ipc_virus/meets_prerequisites()
+  var/list/ipcs = get_ipcs()
+  var/list/roboticists = get_roboticists()
+  return ipcs.len > 2 && roboticists.len > 1
+
+datum/directive/ipc_virus/directives_complete()
+  return brains_to_enslave.len == 0 && cyborgs_to_make.len == 0 && ids_to_terminate.len == 0
+
+/hook/debrain/proc/debrain_directive(obj/item/brain/B)
+  var/datum/directive/ipc_virus/D = get_directive("ipc_virus")
+  if (!D) return 1
+
+  if(D.brains_to_enslave.Find(B.brainmob.mind))
+    D.brains_to_enslave.Remove(B.brainmob.mind)
+
+  return 1
+
+/hook/borgify/proc/borgify_directive(mob/living/silicon/robot/cyborg)
+  var/datum/directive/ipc_virus/D = get_directive("ipc_virus")
+  if (!D) return 1
+
+  if(D.cyborgs_to_make.Find(cyborg.mind))
+    D.cyborgs_to_make.Remove(cyborg.mind)
+
+  // In case something glitchy happened and the victim got
+  // borged without us tracking the brain removal, go ahead
+  // and update that list too.
+  if(D.brains_to_enslave.Find(cyborg.mind))
+    D.brains_to_enslave.Remove(cyborg.mind)
+
+  return 1
+
+/hook/terminate_employee/proc/ipc_termination(obj/item/weapon/card/id)
+  var/datum/directive/ipc_virus/D = get_directive("ipc_virus")
+  if (!D) return 1
+
+  if(D.ids_to_terminate && D.ids_to_terminate.Find(id))
+    D.ids_to_terminate.Remove(id)
+
+  return 1

code/game/gamemodes/mutiny/directives/research_to_ripleys_directive.dm

@@ -0,0 +1,65 @@
+#define MATERIALS_REQUIRED 200
+
+datum/directive/research_to_ripleys
+  var/list/ids_to_reassign = list()
+  var/materials_shipped = 0
+
+  proc/get_researchers()
+    var/list/researchers[0]
+    for(var/mob/living/carbon/human/H in player_list)
+      if (H.mind.assigned_role in science_positions - "Research Director")
+        researchers.Add(H)
+    return researchers
+
+  proc/count_researchers_reassigned()
+    var/researchers_reassigned = 0
+    for(var/obj/item/weapon/card/id in ids_to_reassign)
+      if (ids_to_reassign[id])
+        researchers_reassigned++
+
+    return researchers_reassigned
+
+datum/directive/research_to_ripleys/get_description()
+  return {"
+    <p>
+      The NanoTrasen Tau Ceti Manufactory faces an ore deficit. Financial crisis imminent. [station_name()] has been reassigned as a mining platform.
+      The Research Director is to assist the Head of Personnel in coordinating assets.
+      Weapons department reports solid sales. Further information is classified.
+    </p>
+  "}
+
+datum/directive/research_to_ripleys/meets_prerequisites()
+  var/list/researchers = get_researchers()
+  return researchers.len > 3
+
+datum/directive/research_to_ripleys/initialize()
+  for(var/mob/living/carbon/human/R in get_researchers())
+    ids_to_reassign[R.wear_id] = 0
+
+  special_orders = list(
+    "Reassign all research personnel, excluding the Research Director, to Shaft Miner.",
+    "Deliver [MATERIALS_REQUIRED] sheets of metal or minerals via the supply shuttle to CentCom.")
+
+datum/directive/research_to_ripleys/directives_complete()
+  if (materials_shipped < MATERIALS_REQUIRED) return 0
+  return count_researchers_reassigned() == ids_to_reassign.len
+
+/hook/reassign_employee/proc/research_reassignments(obj/item/weapon/card/id/id_card)
+  var/datum/directive/research_to_ripleys/D = get_directive("research_to_ripleys")
+  if(!D) return 1
+
+  if(D.ids_to_reassign && D.ids_to_reassign.Find(id_card))
+    D.ids_to_reassign[id_card] = id_card.assignment == "Shaft Miner" ? 1 : 0
+
+  return 1
+
+/hook/sell_crate/proc/deliver_materials(obj/structure/closet/crate/sold, area/shuttle)
+  var/datum/directive/research_to_ripleys/D = get_directive("research_to_ripleys")
+  if(!D) return 1
+
+  for(var/atom/A in sold)
+    if(istype(A, /obj/item/stack/sheet/mineral) || istype(A, /obj/item/stack/sheet/metal))
+      var/obj/item/stack/S = A
+      D.materials_shipped += S.amount
+
+  return 1

code/game/gamemodes/mutiny/directives/tau_ceti_needs_women_directive.dm

@@ -0,0 +1,83 @@
+datum/directive/tau_ceti_needs_women
+  var/list/command_targets = list()
+  var/list/alien_targets = list()
+
+  proc/get_target_gender()
+    if(!mode.head_loyalist) return FEMALE
+    return mode.head_loyalist.current.gender == FEMALE ? MALE : FEMALE
+
+  proc/get_crew_of_target_gender()
+    var/list/targets[0]
+    for(var/mob/living/carbon/human/H in player_list)
+      if(H.species.name != "Machine" && H.gender == get_target_gender())
+        targets.Add(H)
+    return targets
+
+  proc/get_target_heads()
+    var/list/heads[0]
+    for(var/mob/living/carbon/human/H in get_crew_of_target_gender())
+      if(command_positions.Find(H.mind.assigned_role))
+        heads.Add(H)
+    return heads
+
+  proc/get_target_aliens()
+    var/list/aliens[0]
+    for(var/mob/living/carbon/human/H in get_crew_of_target_gender())
+      if (H.species.name == "Tajaran" || H.species.name == "Unathi" || H.species.name == "Skrell")
+        aliens.Add(H)
+    return aliens
+
+  proc/count_heads_reassigned()
+    var/heads_reassigned = 0
+    for(var/obj/item/weapon/card/id in command_targets)
+      if (command_targets[id])
+        heads_reassigned++
+
+    return heads_reassigned
+
+datum/directive/tau_ceti_needs_women/get_description()
+  return {"
+    <p>
+      Recent evidence suggests [get_target_gender()] aptitudes may be effected by radiation from Tau Ceti.
+      Effects were measured under laboratory and station conditions. Humans remain more trusted than Xeno. Further information is classified.
+    </p>
+  "}
+
+datum/directive/tau_ceti_needs_women/initialize()
+  for(var/mob/living/carbon/human/H in get_target_heads())
+    command_targets[H.wear_id] = 0
+
+  for(var/mob/living/carbon/human/H in get_target_aliens())
+    alien_targets.Add(H.wear_id)
+
+  special_orders = list(
+    "Remove [get_target_gender()] personnel from Command positions.",
+    "Terminate employment of all [get_target_gender()] Skrell, Tajara, and Unathi.")
+
+datum/directive/tau_ceti_needs_women/meets_prerequisites()
+  var/list/targets = get_crew_of_target_gender()
+  return targets.len >= 3
+
+datum/directive/tau_ceti_needs_women/directives_complete()
+  return command_targets.len == count_heads_reassigned() && alien_targets.len == 0
+
+/hook/reassign_employee/proc/command_reassignments(obj/item/weapon/card/id/id_card)
+  var/datum/directive/tau_ceti_needs_women/D = get_directive("tau_ceti_needs_women")
+  if(!D) return 1
+
+  if(D.command_targets && D.command_targets.Find(id_card))
+    D.command_targets[id_card] = command_positions.Find(id_card.assignment) ? 0 : 1
+
+  return 1
+
+/hook/terminate_employee/proc/gender_target_termination_directive(obj/item/weapon/card/id)
+  var/datum/directive/tau_ceti_needs_women/D = get_directive("tau_ceti_needs_women")
+  if (!D) return 1
+
+  if(D.alien_targets && D.alien_targets.Find(id))
+    D.alien_targets.Remove(id)
+
+  if(D.command_targets && D.command_targets.Find(id))
+    D.command_targets[id] = 1
+
+  return 1

code/game/gamemodes/mutiny/directives/terminations_directive.dm

@@ -0,0 +1,56 @@
+// This is a parent directive meant to be derived by directives that fit
+// the "fire X type of employee" pattern of directives. Simply apply your
+// flavor text and override get_crew_to_terminate in your child datum.
+// See alien_fraud_directive.dm for an example.
+datum/directive/terminations
+  var/list/accounts_to_revoke = list()
+  var/list/accounts_to_suspend = list()
+  var/list/ids_to_terminate = list()
+
+  proc/get_crew_to_terminate()
+    return list()
+
+datum/directive/terminations/directives_complete()
+  for(var/account_number in accounts_to_suspend)
+    if (!accounts_to_suspend[account_number])
+      return 0
+
+  for(var/account_number in accounts_to_revoke)
+    if (!accounts_to_revoke[account_number])
+      return 0
+
+  return ids_to_terminate.len == 0
+
+datum/directive/terminations/initialize()
+  for(var/mob/living/carbon/human/A in get_crew_to_terminate())
+    var/datum/money_account/account = A.mind.initial_account
+    accounts_to_revoke["[account.account_number]"] = 0
+    accounts_to_suspend["[account.account_number]"] = account.suspended
+    ids_to_terminate.Add(A.wear_id)
+
+/hook/revoke_payroll/proc/payroll_directive(datum/money_account/account)
+  var/datum/directive/terminations/D = get_directive("terminations")
+  if (!D) return 1
+
+  if(D.accounts_to_revoke && D.accounts_to_revoke.Find("[account.account_number]"))
+    D.accounts_to_revoke["[account.account_number]"] = 1
+
+  return 1
+
+/hook/change_account_status/proc/suspension_directive(datum/money_account/account)
+  var/datum/directive/terminations/D = get_directive("terminations")
+  if (!D) return 1
+
+  if(D.accounts_to_suspend && D.accounts_to_suspend.Find("[account.account_number]"))
+    D.accounts_to_suspend["[account.account_number]"] = account.suspended
+
+  return 1
+
+/hook/terminate_employee/proc/termination_directive(obj/item/weapon/card/id)
+  var/datum/directive/terminations/D = get_directive("terminations")
+  if (!D) return 1
+
+  if(D.ids_to_terminate && D.ids_to_terminate.Find(id))
+    D.ids_to_terminate.Remove(id)
+
+  return 1

code/game/gamemodes/mutiny/directives/test_directive.dm

@@ -0,0 +1,23 @@
+// For testing
+datum/directive/terminations/test
+  special_orders = list(
+    "Suspend financial accounts of all ugly personnel.",
+    "Transfer their payrolls to the station account.",
+    "Terminate their employment.")
+
+datum/directive/terminations/test/get_crew_to_terminate()
+  var/list/uglies[0]
+  for(var/mob/living/carbon/human/H in player_list)
+    uglies.Add(H)
+  return uglies
+
+datum/directive/terminations/test/get_description()
+  return {"
+    <p>
+      Wow. Much ugly. So painful.
+      Many terminations. Very classified.
+    </p>
+  "}
+
+datum/directive/terminations/test/meets_prerequisites()
+  return 1

code/game/gamemodes/mutiny/emergency_authentication_device.dm

@@ -0,0 +1,105 @@
+/obj/machinery/emergency_authentication_device
+  var/datum/game_mode/mutiny/mode
+
+  name = "\improper Emergency Authentication Device"
+  icon = 'icons/obj/stationobjs.dmi'
+  icon_state = "blackbox"
+  density = 1
+  anchored = 1
+
+  var/captains_key
+  var/secondary_key
+  var/activated = 0
+
+  flags = FPRINT
+  use_power = 0
+
+  New(loc, mode)
+    src.mode = mode
+    ..(loc)
+
+  proc/check_key_existence()
+    if(!mode.captains_key)
+      captains_key = 1
+
+    if(!mode.secondary_key)
+      secondary_key = 1
+
+  proc/get_status()
+    if(activated)
+      return "Activated"
+    if(captains_key && secondary_key)
+      return "Both Keys Authenticated"
+    if(captains_key)
+      return "Captain's Key Authenticated"
+    if(secondary_key)
+      return "Secondary Key Authenticated"
+    else
+      return "Inactive"
+
+/obj/machinery/emergency_authentication_device/attack_hand(mob/user)
+  if(activated)
+    user << "\blue \The [src] is already active!"
+    return
+
+  if(!mode.current_directive.directives_complete())
+    state("Command aborted. Communication with CentComm is prohibited until Directive X has been completed.")
+    return
+
+  check_key_existence()
+  if(captains_key && secondary_key)
+    activated = 1
+    user << "\blue You activate \the [src]!"
+    state("Command acknowledged. Initiating quantum entanglement relay to NanoTrasen High Command.")
+    return
+
+  if(!captains_key && !secondary_key)
+    state("Command aborted. Please present the authentication keys before proceeding.")
+    return
+
+  if(!captains_key)
+    state("Command aborted. Please present the Captain's Authentication Key.")
+    return
+
+  if(!secondary_key)
+    state("Command aborted. Please present the Emergency Secondary Authentication Key.")
+    return
+
+  // Impossible!
+  state("Command aborted. This unit is defective.")
+
+/obj/machinery/emergency_authentication_device/attackby(obj/item/weapon/O, mob/user)
+  if(activated)
+    user << "\blue \The [src] is already active!"
+    return
+
+  if(!mode.current_directive.directives_complete())
+    state({"Command aborted. Communication with CentCom is prohibited until Directive X has been completed."})
+    return
+
+  check_key_existence()
+  if(istype(O, /obj/item/weapon/mutiny/auth_key/captain) && !captains_key)
+    captains_key = O
+    user.drop_item()
+    O.loc = src
+
+    state("Key received. Thank you, Captain [mode.head_loyalist].")
+    spawn(5)
+      state(secondary_key ? "Your keys have been authenticated. Communication with CentCom is now authorized." : "Please insert the Emergency Secondary Authentication Key now.")
+    return
+
+  if(istype(O, /obj/item/weapon/mutiny/auth_key/secondary) && !secondary_key)
+    secondary_key = O
+    user.drop_item()
+    O.loc = src
+
+    state("Key received. Thank you, Secondary Authenticator [mode.head_mutineer].")
+    spawn(5)
+      state(captains_key ? "Your keys have been authenticated. Communication with CentCom is now authorized." : "Please insert the Captain's Authentication Key now.")
+    return
+  ..()
+
+/obj/machinery/emergency_authentication_device/examine()
+  usr << {"
+This is a specialized communications device that is able to instantly send a message to <b>NanoTrasen High Command</b> via quantum entanglement with a sister device at CentCom.
+The EAD's status is [get_status()]."}

code/game/gamemodes/mutiny/key_pinpointer.dm

@@ -0,0 +1,49 @@
+/obj/item/weapon/pinpointer/advpinpointer/auth_key
+  name = "\improper Authentication Key Pinpointer"
+  desc = "Tracks the positions of the emergency authentication keys."
+  var/datum/game_mode/mutiny/mutiny
+
+  New()
+    mutiny = ticker.mode
+    ..()
+
+/obj/item/weapon/pinpointer/advpinpointer/auth_key/attack_self()
+  switch(mode)
+    if (0)
+      mode = 1
+      active = 1
+      target = mutiny.captains_key
+      workobj()
+      usr << "\blue You calibrate \the [src] to locate the Captain's Authentication Key."
+    if (1)
+      mode = 2
+      target = mutiny.secondary_key
+      usr << "\blue You calibrate \the [src] to locate the Emergency Secondary Authentication Key."
+    else
+      mode = 0
+      active = 0
+      icon_state = "pinoff"
+      usr << "\blue You switch \the [src] off."
+
+/obj/item/weapon/pinpointer/advpinpointer/auth_key/examine()
+  switch(mode)
+    if (0)
+      usr << "Is is calibrated for the Captain's Authentication Key."
+    if (1)
+      usr << "It is calibrated for the Emergency Secondary Authentication Key."
+    else
+      usr << "It is switched off."
+
+/datum/supply_packs/key_pinpointer
+  name = "Authentication Key Pinpointer crate"
+  contains = list(/obj/item/weapon/pinpointer/advpinpointer/auth_key)
+  cost = 250
+  containertype = /obj/structure/closet/crate
+  containername = "Authentication Key Pinpointer crate"
+  access = access_heads
+  group = "Operations"
+
+  New()
+    // This crate is only accessible during mutiny rounds
+    if (istype(ticker.mode,/datum/game_mode/mutiny))
+      ..()

code/game/gamemodes/mutiny/mutiny.dm

@@ -0,0 +1,350 @@
+datum/game_mode/mutiny
+  var/datum/mutiny_fluff/fluff
+  var/datum/directive/current_directive
+  var/obj/item/weapon/mutiny/auth_key/captain/captains_key
+  var/obj/item/weapon/mutiny/auth_key/secondary/secondary_key
+  var/obj/machinery/emergency_authentication_device/ead
+  var/datum/mind/head_loyalist
+  var/datum/mind/head_mutineer
+  var/list/loyalists = list()
+  var/list/mutineers = list()
+  var/list/body_count = list()
+
+  name = "mutiny"
+  config_tag = "mutiny"
+  required_players = 7
+  ert_disabled = 1
+
+  uplink_welcome = "Mutineers Uplink Console:"
+  uplink_uses = 0
+
+  New()
+    fluff = new(src)
+
+  proc/reveal_directives()
+    spawn(rand(1 MINUTE, 3 MINUTES))
+      fluff.announce_incoming_fax()
+      spawn(rand(3 MINUTES, 5 MINUTES))
+        send_pda_message()
+      spawn(rand(3 MINUTES, 5 MINUTES))
+        fluff.announce_directives()
+        spawn(rand(2 MINUTES, 3 MINUTE))
+          fluff.announce_ert_unavailable()
+
+  // Returns an array in case we want to expand on this later.
+  proc/get_head_loyalist_candidates()
+    var/list/candidates[0]
+    for(var/mob/loyalist in player_list)
+      if(loyalist.mind.assigned_role == "Captain")
+        candidates.Add(loyalist.mind)
+    return candidates
+
+  proc/get_head_mutineer_candidates()
+    var/list/candidates[0]
+    for(var/mob/mutineer in player_list)
+      if(mutineer.client.prefs.be_special & BE_MUTINEER)
+        for(var/job in command_positions - "Captain")
+          if(mutineer.mind.assigned_role == job)
+            candidates.Add(mutineer.mind)
+    return candidates
+
+  proc/get_directive_candidates()
+    var/list/candidates[0]
+    for(var/T in typesof(/datum/directive) - /datum/directive)
+      var/datum/directive/D = new T(src)
+      if (D.meets_prerequisites())
+        candidates.Add(D)
+    return candidates
+
+  proc/send_pda_message()
+    var/obj/item/device/pda/pda = null
+    for(var/obj/item/device/pda/P in head_mutineer.current)
+      pda = P
+      break
+
+    if (!pda)
+      return 0
+
+    if (!pda.silent)
+      playsound(pda.loc, 'sound/machines/twobeep.ogg', 50, 1)
+      for (var/mob/O in hearers(3, pda.loc))
+        O.show_message(text("\icon[pda] *[pda.ttone]*"))
+
+    head_mutineer.current << fluff.get_pda_body()
+    return 1
+
+  proc/get_equipment_slots()
+    return list(
+      "left pocket" = slot_l_store,
+      "right pocket" = slot_r_store,
+      "backpack" = slot_in_backpack,
+      "left hand" = slot_l_hand,
+      "right hand" = slot_r_hand)
+
+  proc/equip_head_loyalist()
+    var/mob/living/carbon/human/H = head_loyalist.current
+    captains_key = new(H)
+    H.equip_in_one_of_slots(captains_key, get_equipment_slots())
+    H.update_icons()
+    H.verbs += /mob/living/carbon/human/proc/recruit_loyalist
+
+  proc/equip_head_mutineer()
+    var/mob/living/carbon/human/H = head_mutineer.current
+    secondary_key = new(H)
+    H.equip_in_one_of_slots(secondary_key, get_equipment_slots())
+    H.update_icons()
+    H.verbs += /mob/living/carbon/human/proc/recruit_mutineer
+
+  proc/add_loyalist(datum/mind/M)
+    loyalists.Add(M)
+    if (M in mutineers)
+      mutineers.Remove(M)
+
+    M.current << fluff.loyalist_tag("You have joined the loyalists!")
+    head_loyalist.current << fluff.loyalist_tag("[M] has joined the loyalists!")
+    update_icon(M)
+
+  proc/add_mutineer(datum/mind/M)
+    mutineers.Add(M)
+    if (M in loyalists)
+      loyalists.Remove(M)
+
+    M.current << fluff.mutineer_tag("You have joined the mutineers!")
+    head_mutineer.current << fluff.mutineer_tag("[M] has joined the mutineers!")
+    update_icon(M)
+
+  proc/was_bloodbath()
+    var/list/remaining_loyalists = loyalists - body_count
+    if (!remaining_loyalists.len)
+      return 1
+
+    var/list/remaining_mutineers = mutineers - body_count
+    if (!remaining_mutineers.len)
+      return 1
+
+    return 0
+
+  proc/replace_nuke_with_ead()
+    for(var/obj/machinery/nuclearbomb/N in world)
+      ead = new(N.loc, src)
+      del(N)
+
+  proc/unbolt_vault_door()
+    var/obj/machinery/door/airlock/vault = locate(/obj/machinery/door/airlock/vault)
+    vault.locked = 0
+
+  proc/round_outcome()
+    world << "<center><h4>Breaking News</h4></center><br><hr>"
+    if (was_bloodbath())
+      world << fluff.no_victory()
+      return
+
+    var/directives_completed = current_directive.directives_complete()
+    var/ead_activated = ead.activated
+    if (directives_completed && ead_activated)
+      world << fluff.loyalist_major_victory()
+    else if (directives_completed && !ead_activated)
+      world << fluff.loyalist_minor_victory()
+    else if (!directives_completed && ead_activated)
+      world << fluff.mutineer_minor_victory()
+    else if (!directives_completed && !ead_activated)
+      world << fluff.mutineer_major_victory()
+
+    world << sound('sound/machines/twobeep.ogg')
+
+  proc/update_all_icons()
+    spawn(0)
+      for(var/datum/mind/M in mutineers)
+        update_icon(M)
+
+      for(var/datum/mind/M in loyalists)
+        update_icon(M)
+    return 1
+
+  proc/update_icon(datum/mind/M)
+    if(!M.current || !M.current.client)
+      return 0
+
+    for(var/image/I in M.current.client.images)
+      if (I.icon_state == "loyalist" || I.icon_state == "mutineer")
+        del(I)
+
+    if(M in loyalists)
+      var/I = image('icons/mob/mob.dmi', loc=M.current, icon_state = "loyalist")
+      head_loyalist.current.client.images += I
+
+    if(M in mutineers)
+      var/I = image('icons/mob/mob.dmi', loc=M.current, icon_state = "mutineer")
+      head_mutineer.current.client.images += I
+
+    return 1
+
+  proc/check_antagonists_ui(admins)
+    var/turf/captains_key_loc = captains_key ? captains_key.get_turf() : "Lost or Destroyed"
+    var/turf/secondary_key_loc = secondary_key ? secondary_key.get_turf() : "Lost or Destroyed"
+    var/txt = {"
+      <h5>Context:</h5>
+      <p>
+        [current_directive.get_description()]
+      </p>
+      <h5>Orders:</h5>
+      <ol>
+        [fluff.get_orders()]
+      </ol>
+      <br>
+      <h5>Authentication:</h5>
+      <b>Captain's Key:</b> [captains_key_loc]
+      <a href='?src=\ref[admins];choice=activate_captains_key'>Activate</a><br>
+      <b>Secondary Key:</b> [secondary_key_loc]
+      <a href='?src=\ref[admins];choice=activate_secondary_key'>Activate</a><br>
+      <b>EAD: [ead ? ead.get_status() : "Lost or Destroyed"]</b>
+      <a href='?src=\ref[admins];choice=activate_ead'>Activate</a><br>
+      <hr>
+    "}
+
+    if(head_loyalist)
+      txt += check_role_table("Head Loyalist", list(head_loyalist), admins, 0)
+
+    var/list/loyal_crew = loyalists - head_loyalist
+    if(loyal_crew.len)
+      txt += check_role_table("Loyalists", loyal_crew, admins, 0)
+
+    if(head_mutineer)
+      txt += check_role_table("Head Mutineer", list(head_mutineer), admins, 0)
+
+    var/list/mutiny_crew = mutineers - head_mutineer
+    if(mutiny_crew.len)
+      txt += check_role_table("Mutineers", mutiny_crew, admins, 0)
+
+    if(body_count.len)
+      txt += check_role_table("Casualties", body_count, admins, 0)
+
+    return txt
+
+/datum/game_mode/mutiny/announce()
+  fluff.announce()
+
+/datum/game_mode/mutiny/pre_setup()
+  var/list/loyalist_candidates = get_head_loyalist_candidates()
+  if(!loyalist_candidates || loyalist_candidates.len == 0)
+    world << "Mutiny mode aborted: no valid candidates for head loyalist."
+    return 0
+
+  var/list/mutineer_candidates = get_head_mutineer_candidates()
+  if(!mutineer_candidates || mutineer_candidates.len == 0)
+    world << "Mutiny mode aborted: no valid candidates for head mutineer."
+    return 0
+
+  var/list/directive_candidates = get_directive_candidates()
+  if(!directive_candidates || directive_candidates.len == 0)
+    world << "Mutiny mode aborted: no valid candidates for Directive X."
+    return 0
+
+  head_loyalist = pick(loyalist_candidates)
+  head_mutineer = pick(mutineer_candidates)
+  current_directive = pick(directive_candidates)
+
+  return 1
+
+/datum/game_mode/mutiny/post_setup()
+  head_loyalist.current << "You are the Head Loyalist!"
+  head_loyalist.special_role = "head_loyalist"
+  equip_head_loyalist()
+
+  head_mutineer.current << "You are the Head Mutineer!"
+  head_mutineer.special_role = "head_mutineer"
+  equip_head_mutineer()
+
+  loyalists.Add(head_loyalist)
+  mutineers.Add(head_mutineer)
+
+  replace_nuke_with_ead()
+  current_directive.initialize()
+  unbolt_vault_door()
+
+  update_all_icons()
+  spawn(0)
+    reveal_directives()
+  ..()
+
+/datum/game_mode/mutiny/check_antagonists_topic(href, href_list[])
+  switch(href_list["choice"])
+    if("activate_captains_key")
+      ead.captains_key = 1
+      return 1
+    if("activate_secondary_key")
+      ead.secondary_key = 1
+      return 1
+    if("activate_ead")
+      ead.activated = 1
+      return 1
+    else
+      return 0
+
+/mob/living/carbon/human/proc/recruit_loyalist()
+  set name = "Recruit Loyalist"
+  set category = "Mutiny"
+
+  var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+  if (!mode || src != mode.head_loyalist.current)
+    return
+
+  var/list/candidates = list()
+  for (var/mob/living/carbon/human/P in oview(src))
+    if(!stat && P.client && P.mind && !P.mind.special_role)
+      candidates += P
+
+  if(!candidates.len)
+    src << "\red You aren't close enough to anybody that can be recruited."
+    return
+
+  var/mob/living/carbon/human/M = input("Select a person to recruit", "Loyalist recruitment", null) as mob in candidates
+
+  if (M)
+    src << "Attempting to recruit [M]..."
+    log_admin("[src]([src.ckey]) attempted to recruit [M] as a loyalist.")
+    message_admins("\red [src]([src.ckey]) attempted to recruit [M] as a loyalist.")
+
+    var/choice = alert(M, "Asked by [src]: Will you help me complete Directive X?", "Loyalist recruitment", "No", "Yes")
+    if(choice == "Yes")
+      mode.add_loyalist(M.mind)
+    else if(choice == "No")
+      M << "\red You declined to join the loyalists."
+      mode.head_loyalist.current << "\red <b>[M] declined to support the loyalists.</b>"
+
+/mob/living/carbon/human/proc/recruit_mutineer()
+  set name = "Recruit Mutineer"
+  set category = "Mutiny"
+
+  var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+  if (!mode || src != mode.head_mutineer.current)
+    return
+
+  var/list/candidates = list()
+  for (var/mob/living/carbon/human/P in oview(src))
+    if(!stat && P.client && P.mind && !P.mind.special_role)
+      candidates += P
+
+  if(!candidates.len)
+    src << "\red You aren't close enough to anybody that can be recruited."
+    return
+
+  var/mob/living/carbon/human/M = input("Select a person to recruit", "Mutineer recruitment", null) as mob in candidates
+
+  if (M)
+    src << "Attempting to recruit [M]..."
+    log_admin("[src]([src.ckey]) attempted to recruit [M] as a mutineer.")
+    message_admins("\red [src]([src.ckey]) attempted to recruit [M] as a mutineer.")
+
+    var/choice = alert(M, "Asked by [src]: Will you help me stop Directive X?", "Mutineer recruitment", "No", "Yes")
+    if(choice == "Yes")
+      mode.add_mutineer(M.mind)
+    else if(choice == "No")
+      M << "\red You declined to join the mutineers."
+      mode.head_mutineer.current << "\red <b>[M] declined to support the mutineers.</b>"
+
+/proc/get_mutiny_mode()
+  if(!ticker || !istype(ticker.mode, /datum/game_mode/mutiny))
+    return null
+
+  return ticker.mode

code/game/gamemodes/mutiny/mutiny_fluff.dm

@@ -0,0 +1,209 @@
+/datum/mutiny_fluff
+  var/datum/game_mode/mutiny/mode
+
+  New(datum/game_mode/mutiny/M)
+    mode = M
+
+  proc/centcom_announce(text)
+    world << {"
+<font color='#FFA500'><hr><center><b>:-:=:-: CENTRAL COMMAND ANNOUNCEMENT :-:=:-:</b></center><hr></font>
+[text]
+      "}
+    world << sound('sound/AI/commandreport.ogg')
+
+  proc/announce_incoming_fax()
+    centcom_announce({"
+<b>Incoming Emergency Directive:</b>
+<i>Captain's Office Fax Machine, [station_name()]</i>
+      "})
+
+  proc/announce_directives()
+    for (var/obj/machinery/faxmachine/fax in world)
+      if (fax.department == "Captain's Office")
+        var/obj/item/weapon/paper/directive_x = new(fax.loc)
+        directive_x.name = "emergency action message"
+        directive_x.info = get_fax_body()
+
+  proc/get_fax_body()
+    return {"
+      <center><h5>NOT A DRILL . . . EMERGENCY DIRECTIVE . . . NOT A DRILL</h5></center>
+      <p>
+        <b>TO:</b> Captain [mode.head_loyalist], Commanding Officer, [station_name()]<br>
+        <b>FROM:</b> NanoTrasen Emergency Messaging Relay<br>
+        <b>DATE:</b> [time2text(world.realtime, "MM/DD")]/[game_year]<br>
+        <b>SUBJECT:</b> Directive X<br>
+      </p>
+
+      [mode.current_directive.get_description()]
+
+      <hr>
+      <h5><b>Emergency Authentication Protocol</b></h5>
+      <p>
+        A member of your Command Staff is this shift's designated Emergency Secondary Authenticator.<br>
+        This Emergency Secondary Authenticator is uniquely aware of their role and possesses the Emergency Secondary Authentication Key.<br>
+        As Captain, you possess the Captain's Authentication Key.<br>
+        The Emergency Authentication Device is located in the vault of your station, and requires simultaneous activation of the Authentication Keys.<br>
+        An <b>Authentication Key Pinpointer</b> can be delivered via Cargo Bay to assist recovery of the Authentication Keys should they be lost aboard the station.<br>
+        A key's destruction or removal from the station's perimeter will automatically and irreversibly activate the Emergency Authentication Device.
+      </p>
+      <br>
+
+      <h5><b>Orders</b></h5>
+      <p>
+        Captain [mode.head_loyalist], you are to immediately initiate the following procedure; codenamed Directive X:
+      </p>
+      <ol>
+        [get_orders()]
+      </ol>
+      <br>
+
+      <h5><b>Authentication</b></h5>
+
+      <b>Encoded Authentication String:</b> <small>T0JCJUwoIVFDQA==</small><br>
+      <b>Emergency Action Code:</b> O B B _ L _ _ Q C _<br>
+      <font color='red'><u>ERROR: DECODING INCOMPLETE (40% LOSS)</u></font>
+      <br>
+      <br>
+      <br>
+
+      <center><h5>NOT A DRILL . . . EMERGENCY DIRECTIVE . . . NOT A DRILL</h5></center>
+    "}
+
+  proc/get_orders()
+    var/text = "<li>Immediate external transmission and signals silence. Evacuation and Cargo services will remain available. All ERT teams are engaged elsewhere. Do not communicate with Central Command under any circumstances.</li>"
+    for(var/order in mode.current_directive.special_orders)
+      text += "<li>[order]</li>"
+
+    text += "<li>Upon completion of this Directive, Captain [mode.head_loyalist] and the Emergency Secondary Authenticator must utilise the Captain's Authentication Key and the Emergency Secondary Authentication Key to activate the Emergency Authentication Device.</li>"
+    return text
+
+  proc/get_pda_body()
+    return {"<b>&larr; From Anonymous Channel:</b> <p>\"You must read this! NanoTrasen Chain of Command COMPROMISED. Command Encryptions BROKEN. [station_name()] Captain [mode.head_loyalist] will receive orders that must NOT BE BROUGHT TO FRUITION!
+
+They don't care about us they only care about WEALTH and POWER... Share this message with people you trust.
+
+Be safe, friend.\" (Unable to Reply)</p>"}
+
+
+  proc/announce_ert_unavailable()
+    // I might have gotten a little carried away.
+    centcom_announce({"
+<p>The presence of [pick(
+  "political instability",
+  "quantum fluctuations",
+  "hostile raiders",
+  "derelict station debris",
+  "REDACTED",
+  "ancient alien artillery",
+  "solar magnetic storms",
+  "sentient time-travelling killbots",
+  "gravitational anomalies",
+  "wormholes to another dimension",
+  "a telescience mishap",
+  "radiation flares",
+  "supermatter dust",
+  "leaks into a negative reality",
+  "antiparticle clouds",
+  "residual bluespace energy",
+  "suspected syndicate operatives",
+  "malfunctioning von Neumann probe swarms",
+  "shadowy interlopers",
+  "a stranded Vox arkship",
+  "haywire IPC constructs",
+  "rogue Unathi exiles",
+  "artifacts of eldritch horror",
+  "a brain slug infestation",
+  "killer bugs that lay eggs in the husks of the living",
+  "a deserted transport carrying xenomorph specimens",
+  "an emissary for the gestalt requesting a security detail",
+  "a Tajaran slave rebellion",
+  "radical Skrellian transevolutionaries",
+  "classified security operations",
+  "science-defying raw elemental chaos")]
+in the region is tying up all available local emergency resources;
+<b>emergency response teams</b> can not be called at this time.</p>
+    "})
+
+  proc/announce()
+    world << "<B>The current game mode is - Mutiny!</B>"
+    world << {"
+<p>The crew will be divided by their sense of ethics when a morally turbulent emergency directive arrives with an incomplete command validation code.<br><br>
+The [loyalist_tag("Head Loyalist")] is the Captain, who carries the [loyalist_tag("Captain's Authentication Key")] at all times.<br>
+The [mutineer_tag("Head Mutineer")] is a random Head of Staff who carries the [mutineer_tag("Emergency Secondary Authentication Key")].</p>
+Both keys are required to activate the <b>Emergency Authentication Device (EAD)</b> in the vault, signalling to NanoTrasen that the directive is complete.
+<hr>
+<p>
+<b>Loyalists</b> - Follow the Head Loyalist in carrying out [loyalist_tag("NanoTrasen's directives")] then activate the <b>EAD</b>.<br>
+<b>Mutineers</b> - Prevent the completion of the [mutineer_tag("improperly validated directives")] and the activation of the <b>EAD</b>.
+</p>
+    "}
+
+  proc/loyalist_tag(text)
+    return "<font color='blue'><b>[text]</b></font>"
+
+  proc/mutineer_tag(text)
+    return "<font color='#FFA500'><b>[text]</b></font>"
+
+  proc/their(datum/mind/head)
+    if (head.current.gender == MALE)
+      return "his"
+    else if (head.current.gender == FEMALE)
+      return "her"
+
+    return "their"
+
+  proc/loyalist_major_victory()
+    return {"
+NanoTrasen has praised the efforts of Captain [mode.head_loyalist] and loyal members of [their(mode.head_loyalist)] crew, who recently managed to put down a mutiny--amid a local interstellar crisis--aboard the <b>[station_name()]</b>, a research station in Tau Ceti.
+The mutiny was spurred by a top secret directive sent to the station, presumably in response to the crisis within the system.
+Despite the mutiny, the crew was successful in implementing the directive and activating their on-board emergency authentication device.
+[mode.mutineers.len] members of the station's personnel were charged with sedition against the company and if found guilty will be sentenced to life incarceration.
+NanoTrasen will be awarding [mode.loyalists.len] members of the crew with the [loyalist_tag("Star of Loyalty")], following their successful efforts, at a ceremony this coming Thursday.
+[mode.body_count.len] are believed to have died during the coup.
+<p>NanoTrasen's image will forever be haunted by the fact that a mutiny took place on one of its own stations.</p>
+    "}
+
+  proc/loyalist_minor_victory()
+    return {"
+NanoTrasen has praised the efforts of Captain [mode.head_loyalist] and loyal members of [their(mode.head_loyalist)] crew, who recently managed to put down a mutiny--amid a local interstellar crisis--aboard the <b>[station_name()]</b>, a research station in Tau Ceti.
+The mutiny was spurred by a top secret directive sent to the station, presumably in response to the crisis within the system.
+Despite the mutiny, the crew was successful in implementing the directive. Unfortunately, they failed to notify Central Command of their successes due to a breach in the chain of command.
+[mode.mutineers.len] members of the station's personnel were charged with sedition against the Company and if found guilty will be sentenced to life incarceration.
+NanoTrasen will be awarding [mode.loyalists.len] members of the crew with the [loyalist_tag("Star of Loyalty")], following their mostly successful efforts, at a ceremony this coming Thursday.
+[mode.body_count.len] are believed to have died during the coup.
+<p>NanoTrasen's image will forever be haunted by the fact that a mutiny took place on one of its own stations.</p>
+    "}
+
+  proc/no_victory()
+    return {"
+NanoTrasen has been thrust into turmoil following an apparent mutiny by key personnel aboard the <b>[station_name()]</b>, a research station in Tau Ceti.
+The mutiny was spurred by a top secret directive sent to the station, presumably in response to the crisis within the system.
+No further information has yet emerged from the station or its crew, who are presumed to be in holding with NanoTrasen investigators.
+NanoTrasen officials refuse to comment.
+Sources indicate that [mode.mutineers.len] members of the station's personnel are currently under investigation for mutiny, and [mode.loyalists.len] crew are currently providing evidence to investigators, believed to be the 'loyal' station personnel.
+[mode.body_count.len] are believed to have died during the coup.
+<p>NanoTrasen's image will forever be haunted by the fact that a mutiny took place on one of its own stations.</p>
+    "}
+
+  proc/mutineer_minor_victory()
+    return {"
+Reports have emerged that an impromptu mutiny has taken place, amid a local interstellar crisis, aboard the <b>[station_name()]</b>, a research station in Tau Ceti.
+The mutiny was spurred by a top secret directive sent to the station, presumably in response to the crisis within the system.
+Information at present indicates that the top-secret directive--which has since been retracted--was invalid due to a broken authentication code. Members of the crew, including an unidentified Head of Staff, prevented the directive from being accomplished.
+[mode.mutineers.len] members of the station's personnel were released from interrogations today, following a mutiny investigation.
+NanoTrasen has reprimanded [mode.loyalists.len] members of the crew for failing to follow command validation procedures.
+[mode.body_count.len] are believed to have died during the coup.
+<p>Even though the directive was not successfully implemented, NanoTrasen's image will forever be haunted by the fact that its authentication protocol was breached with such magnitude and that a mutiny was the result.</p>
+    "}
+
+  proc/mutineer_major_victory()
+    return {"
+NanoTrasen has praised the efforts of [mode.head_mutineer.assigned_role] [mode.head_mutineer] and several other members of the crew, who recently seized control of a research station in Tau Ceti--<b>[station_name()]</b>--amid a local interstellar crisis.
+What appears to have been a "legitimate" mutiny was spurred by a top secret directive sent to the station, presumably in response to the crisis within the system.
+It has been revealed that the directive was invalid and fraudulent. Company officials have not released a statement about the source of the directive.
+Thanks to the efforts of the resistant members of the crew, the directive was not carried out.
+[mode.mutineers.len] members of the station's personnel were congratulated and awarded with the [mutineer_tag("Star of Bravery")], for their efforts in preventing the illegal directive's completion.
+NanoTrasen has [mode.loyalists.len] members of the crew in holding, while it investigates the circumstances that led to the acceptance and initiation of an invalid directive.
+[mode.body_count.len] are believed to have died during the coup.
+<p>Even though the directive was not successfully implemented, NanoTrasen's image will forever be haunted by the fact that its authentication protocol was breached with such magnitude and that a mutiny was the result.</p>
+    "}

code/game/gamemodes/mutiny/mutiny_hooks.dm

@@ -0,0 +1,27 @@
+/hook/death/proc/track_kills(mob/living/carbon/human/deceased, gibbed)
+  var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+  if (!mode) return 1
+
+  mode.body_count.Add(deceased.mind)
+  return 1
+
+/hook/clone/proc/update_icon(mob/living/carbon/human/H)
+  var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+  if (!mode) return 1
+
+  mode.update_icon(H.mind)
+  return 1
+
+/hook/harvest_podman/proc/update_icon(mob/living/carbon/monkey/diona/D)
+  var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+  if (!mode) return 1
+
+  mode.update_icon(D.mind)
+  return 1
+
+/hook/roundend/proc/report_mutiny_news()
+  var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+  if (!mode) return 1
+
+  mode.round_outcome()
+  return 1

code/game/machinery/cloning.dm

@@ -183,6 +183,7 @@
 	H << "<span class='notice'><b>Consciousness slowly creeps over you as your body regenerates.</b><br><i>So this is what cloning feels like?</i></span>"
 
 	// -- Mode/mind specific stuff goes here
+	callHook("clone", list(H))
 
 	switch(ticker.mode.name)
 		if("revolution")

code/game/machinery/computer/card.dm

@@ -2,247 +2,124 @@
 
 /obj/machinery/computer/card
 	name = "Identification Computer"
-	desc = "You can use this to change ID's."
+	desc = "Terminal for programming NanoTrasen employee ID cards to access parts of the station."
 	icon_state = "id"
 	req_access = list(access_change_ids)
 	circuit = "/obj/item/weapon/circuitboard/card"
 	var/obj/item/weapon/card/id/scan = null
 	var/obj/item/weapon/card/id/modify = null
-	var/authenticated = 0.0
 	var/mode = 0.0
 	var/printing = null
 
+	proc/is_centcom()
+		return istype(src, /obj/machinery/computer/card/centcom)
 
-/obj/machinery/computer/card/attackby(O as obj, user as mob)//TODO:SANITY
-	if(istype(O, /obj/item/weapon/card/id))
-		var/obj/item/weapon/card/id/idcard = O
-		if(access_change_ids in idcard.access)
-			if(!scan)
-				usr.drop_item()
-				idcard.loc = src
-				scan = idcard
-			else if(!modify)
-				usr.drop_item()
-				idcard.loc = src
-				modify = idcard
-		else
-			if(!modify)
-				usr.drop_item()
-				idcard.loc = src
-				modify = idcard
-	else
-		..()
+	proc/is_authenticated()
+		return scan ? check_access(scan) : 0
 
+	proc/get_target_rank()
+		return modify && modify.assignment ? modify.assignment : "Unassigned"
+
+	proc/format_jobs(list/jobs)
+		var/list/formatted = list()
+		for(var/job in jobs)
+			formatted.Add(list(list(
+				"display_name" = replacetext(job, " ", "&nbsp"),
+				"target_rank" = get_target_rank(),
+				"job" = job)))
+
+		return formatted
+
+/obj/machinery/computer/card/attackby(obj/item/weapon/card/id/id_card, mob/user)
+	if(!istype(id_card))
+		return ..()
+
+	if(!scan && access_change_ids in id_card.access)
+		user.drop_item()
+		id_card.loc = src
+		scan = id_card
+	else if(!modify)
+		user.drop_item()
+		id_card.loc = src
+		modify = id_card
+
+	nanomanager.update_uis(src)
+	attack_hand(user)
 
 /obj/machinery/computer/card/attack_ai(var/mob/user as mob)
 	return attack_hand(user)
 
-
 /obj/machinery/computer/card/attack_paw(var/mob/user as mob)
 	return attack_hand(user)
 
+/obj/machinery/computer/card/attack_hand(mob/user as mob)
+	if(..()) return
+	if(stat & (NOPOWER|BROKEN)) return
+	ui_interact(user)
 
-/obj/machinery/computer/card/attack_hand(var/mob/user as mob)
-	if(..())
-		return
-
+/obj/machinery/computer/card/ui_interact(mob/user, ui_key="main", datum/nanoui/ui=null)
 	user.set_machine(src)
-	var/dat
-	if (!( ticker ))
-		return
-	if (mode) // accessing crew manifest
 
-		dat += "<h4>Crew Manifest</h4>"
-		dat += "Entries cannot be modified from this terminal.<br><br>"
-		if(data_core)
-			dat += data_core.get_manifest(0) // make it monochrome
-		dat += "<br>"
-		dat += "<a href='?src=\ref[src];choice=print'>Print</a><br>"
-		dat += "<br>"
-		dat += "<a href='?src=\ref[src];choice=mode;mode_target=0'>Access ID modification console.</a><br>"
+	var/data[0]
+	data["src"] = "\ref[src]"
+	data["station_name"] = station_name()
+	data["mode"] = mode
+	data["printing"] = printing
+	data["manifest"] = data_core ? data_core.get_manifest(0) : null
+	data["target_name"] = modify ? modify.name : "-----"
+	data["target_owner"] = modify && modify.registered_name ? modify.registered_name : "-----"
+	data["target_rank"] = get_target_rank()
+	data["scan_name"] = scan ? scan.name : "-----"
+	data["authenticated"] = is_authenticated()
+	data["has_modify"] = !!modify
+	data["account_number"] = modify ? modify.associated_account_number : null
+	data["centcom_access"] = is_centcom()
+	data["all_centcom_access"] = null
+	data["regions"] = null
 
-		/*var/crew = ""
-		var/list/L = list()
-		for (var/datum/data/record/t in data_core.general)
-			var/R = t.fields["name"] + " - " + t.fields["rank"]
-			L += R
-		for(var/R in sortList(L))
-			crew += "[R]<br>"*/
-		//dat = "<tt><b>Crew Manifest:</b><br>Please use security record computer to modify entries.<br><br>[crew]<a href='?src=\ref[src];choice=print'>Print</a><br><br><a href='?src=\ref[src];choice=mode;mode_target=0'>Access ID modification console.</a><br></tt>"
-	else
-		var/header = "<div align='center'><b>Identification Card Modifier</b></div>"
+	data["engineering_jobs"] = format_jobs(engineering_positions)
+	data["medical_jobs"] = format_jobs(medical_positions)
+	data["science_jobs"] = format_jobs(science_positions)
+	data["security_jobs"] = format_jobs(security_positions)
+	data["civilian_jobs"] = format_jobs(civilian_positions)
+	data["centcom_jobs"] = format_jobs(get_all_centcom_jobs())
 
-		var/target_name
-		var/target_owner
-		var/target_rank
-		if(modify)
-			target_name = modify.name
-		else
-			target_name = "--------"
-		if(modify && modify.registered_name)
-			target_owner = modify.registered_name
-		else
-			target_owner = "--------"
-		if(modify && modify.assignment)
-			target_rank = modify.assignment
-		else
-			target_rank = "Unassigned"
+	if (modify && is_centcom())
+		var/list/all_centcom_access = list()
+		for(var/access in get_all_centcom_access())
+			all_centcom_access.Add(list(list(
+				"desc" = replacetext(get_centcom_access_desc(access), " ", "&nbsp"),
+				"ref" = access,
+				"allowed" = (access in modify.access) ? 1 : 0)))
 
-		var/scan_name
-		if(scan)
-			scan_name = scan.name
-		else
-			scan_name = "--------"
+		data["all_centcom_access"] = all_centcom_access
+	else if (modify)
+		var/list/regions = list()
+		for(var/i = 1; i <= 7; i++)
+			var/list/accesses = list()
+			for(var/access in get_region_accesses(i))
+				if (get_access_desc(access))
+					accesses.Add(list(list(
+						"desc" = replacetext(get_access_desc(access), " ", "&nbsp"),
+						"ref" = access,
+						"allowed" = (access in modify.access) ? 1 : 0)))
 
-		if(!authenticated)
-			header += "<br><i>Please insert the cards into the slots</i><br>"
-			header += "Target: <a href='?src=\ref[src];choice=modify'>[target_name]</a><br>"
-			header += "Confirm Identity: <a href='?src=\ref[src];choice=scan'>[scan_name]</a><br>"
-		else
-			header += "<div align='center'><br>"
-			header += "<a href='?src=\ref[src];choice=modify'>Remove [target_name]</a> || "
-			header += "<a href='?src=\ref[src];choice=scan'>Remove [scan_name]</a> <br> "
-			header += "<a href='?src=\ref[src];choice=mode;mode_target=1'>Access Crew Manifest</a> || "
-			header += "<a href='?src=\ref[src];choice=logout'>Log Out</a></div>"
+			regions.Add(list(list(
+				"name" = get_region_accesses_name(i),
+				"accesses" = accesses)))
 
-		header += "<hr>"
-
-		var/jobs_all = ""
-		var/counter = 0
-		jobs_all += "<table><tr><td></td><td><b>Command</b></td>"
-
-		jobs_all += "</tr><tr height='20'><td><b>Special</b></font></td>"//Captain in special because he is head of heads ~Intercross21
-		jobs_all += "<td weight='100'><a href='?src=\ref[src];choice=assign;assign_target=Captain'>Captain</a></td>"
-		jobs_all += "<td weight='100'><a href='?src=\ref[src];choice=assign;assign_target=Custom'>Custom</a></td>"
-
-		counter = 0
-		jobs_all += "</tr><tr><td><font color='#FFA500'><b>Engineering</b></font></td>"//Orange
-		for(var/job in engineering_positions)
-			counter++
-			if(counter >= 6)
-				jobs_all += "</tr><tr height='20'><td></td><td></td>"
-				counter = 0
-			jobs_all += "<td height='20' weight='100'><a href='?src=\ref[src];choice=assign;assign_target=[job]'>[replacetext(job, " ", "&nbsp")]</a></td>"
-
-		counter = 0
-		jobs_all += "</tr><tr height='20'><td><font color='#008000'><b>Medical</b></font></td>"//Green
-		for(var/job in medical_positions)
-			counter++
-			if(counter >= 6)
-				jobs_all += "</tr><tr height='20'><td></td><td></td>"
-				counter = 0
-			jobs_all += "<td weight='100'><a href='?src=\ref[src];choice=assign;assign_target=[job]'>[replacetext(job, " ", "&nbsp")]</a></td>"
-
-		counter = 0
-		jobs_all += "</tr><tr height='20'><td><font color='#800080'><b>Science</b></font></td>"//Purple
-		for(var/job in science_positions)
-			counter++
-			if(counter >= 6)
-				jobs_all += "</tr><tr height='20'><td></td><td></td>"
-				counter = 0
-			jobs_all += "<td weight='100'><a href='?src=\ref[src];choice=assign;assign_target=[job]'>[replacetext(job, " ", "&nbsp")]</a></td>"
-
-		counter = 0
-		jobs_all += "</tr><tr height='20'><td><font color='#808080'><b>Civilian</b></font></td>"//Grey
-		for(var/job in civilian_positions)
-			counter++
-			if(counter >= 6)
-				jobs_all += "</tr><tr height='20'><td></td><td></td>"
-				counter = 0
-			jobs_all += "<td weight='100'><a href='?src=\ref[src];choice=assign;assign_target=[job]'>[replacetext(job, " ", "&nbsp")]</a></td>"
-
-		if(istype(src,/obj/machinery/computer/card/centcom))
-			counter = 0
-			jobs_all += "</tr><tr><td><font color='#A52A2A'><b>CentComm</b></font></td>"//Brown
-			for(var/job in get_all_centcom_jobs())
-				if(counter >= 6)
-					jobs_all += "</tr><tr><td></td><td></td>"
-					counter = 0
-				jobs_all += "<td><a href='?src=\ref[src];choice=assign;assign_target=[job]'>[replacetext(job, " ", "&nbsp")]</a></td>"
-
-		var/body
-		if (authenticated && modify)
-			var/carddesc = {"<script type="text/javascript">
-								function markRed(){
-									var nameField = document.getElementById('namefield');
-									nameField.style.backgroundColor = "#FFDDDD";
-								}
-								function markGreen(){
-									var nameField = document.getElementById('namefield');
-									nameField.style.backgroundColor = "#DDFFDD";
-								}
-								function markAccountGreen(){
-									var nameField = document.getElementById('accountfield');
-									nameField.style.backgroundColor = "#DDFFDD";
-								}
-								function markAccountRed(){
-									var nameField = document.getElementById('accountfield');
-									nameField.style.backgroundColor = "#FFDDDD";
-								}
-								function showAll(){
-									var allJobsSlot = document.getElementById('alljobsslot');
-									allJobsSlot.innerHTML = "<a href='#' onclick='hideAll()'>hide</a><br>"+ "[jobs_all]";
-								}
-								function hideAll(){
-									var allJobsSlot = document.getElementById('alljobsslot');
-									allJobsSlot.innerHTML = "<a href='#' onclick='showAll()'>[(modify.assignment) ? modify.assignment : "Unassgied"]</a>";
-								}
-							</script>"}
-			carddesc += "<form name='cardcomp' action='?src=\ref[src]' method='get'>"
-			carddesc += "<input type='hidden' name='src' value='\ref[src]'>"
-			carddesc += "<input type='hidden' name='choice' value='reg'>"
-			carddesc += "<b>registered_name:</b> <input type='text' id='namefield' name='reg' value='[target_owner]' style='width:250px; background-color:white;' onchange='markRed()'>"
-			carddesc += "<input type='submit' value='Rename' onclick='markGreen()'>"
-			carddesc += "</form>"
-
-			carddesc += "<form name='accountnum' action='?src=\ref[src]' method='get'>"
-			carddesc += "<input type='hidden' name='src' value='\ref[src]'>"
-			carddesc += "<input type='hidden' name='choice' value='account'>"
-			carddesc += "<b>Stored account number:</b> <input type='text' id='accountfield' name='account' value='[modify.associated_account_number]' style='width:250px; background-color:white;' onchange='markAccountRed()'>"
-			carddesc += "<input type='submit' value='Modify' onclick='markAccountGreen()'>"
-			carddesc += "</form>"
-
-			carddesc += "<b>Assignment:</b> "
-			var/jobs = "<span id='alljobsslot'><a href='#' onclick='showAll()'>[target_rank]</a></span>" //CHECK THIS
-			var/accesses = ""
-			if(istype(src,/obj/machinery/computer/card/centcom))
-				accesses += "<h5>Central Command:</h5>"
-				for(var/A in get_all_centcom_access())
-					if(A in modify.access)
-						accesses += "<a href='?src=\ref[src];choice=access;access_target=[A];allowed=0'><font color=\"red\">[replacetext(get_centcom_access_desc(A), " ", "&nbsp")]</font></a> "
-					else
-						accesses += "<a href='?src=\ref[src];choice=access;access_target=[A];allowed=1'>[replacetext(get_centcom_access_desc(A), " ", "&nbsp")]</a> "
-			else
-				accesses += "<div align='center'><b>Access</b></div>"
-				accesses += "<table style='width:100%'>"
-				accesses += "<tr>"
-				for(var/i = 1; i <= 7; i++)
-					accesses += "<td style='width:14%'><b>[get_region_accesses_name(i)]:</b></td>"
-				accesses += "</tr><tr>"
-				for(var/i = 1; i <= 7; i++)
-					accesses += "<td style='width:14%' valign='top'>"
-					for(var/A in get_region_accesses(i))
-						if(A in modify.access)
-							accesses += "<a href='?src=\ref[src];choice=access;access_target=[A];allowed=0'><font color=\"red\">[replacetext(get_access_desc(A), " ", "&nbsp")]</font></a> "
-						else
-							accesses += "<a href='?src=\ref[src];choice=access;access_target=[A];allowed=1'>[replacetext(get_access_desc(A), " ", "&nbsp")]</a> "
-						accesses += "<br>"
-					accesses += "</td>"
-				accesses += "</tr></table>"
-			body = "[carddesc]<br>[jobs]<br><br>[accesses]" //CHECK THIS
-		else
-			body = "<a href='?src=\ref[src];choice=auth'>{Log in}</a> <br><hr>"
-			body += "<a href='?src=\ref[src];choice=mode;mode_target=1'>Access Crew Manifest</a>"
-		dat = "<tt>[header][body]<hr><br></tt>"
-	user << browse(dat, "window=id_com;size=900x520")
-	onclose(user, "id_com")
-	return
+		data["regions"] = regions
 
+	ui = nanomanager.try_update_ui(user, src, ui_key, ui, data)
+	if (!ui)
+		ui = new(user, src, ui_key, "identification_computer.tmpl", src.name, 600, 700)
+		ui.set_initial_data(data)
+		ui.open()
 
 /obj/machinery/computer/card/Topic(href, href_list)
 	if(..())
-		return
-	usr.set_machine(src)
+		return 1
+
 	switch(href_list["choice"])
 		if ("modify")
 			if (modify)
@@ -262,7 +139,6 @@
 					usr.drop_item()
 					I.loc = src
 					modify = I
-			authenticated = 0
 
 		if ("scan")
 			if (scan)
@@ -280,26 +156,19 @@
 					usr.drop_item()
 					I.loc = src
 					scan = I
-			authenticated = 0
-		if ("auth")
-			if ((!( authenticated ) && (scan || (istype(usr, /mob/living/silicon))) && (modify || mode)))
-				if (check_access(scan))
-					authenticated = 1
-			else if ((!( authenticated ) && (istype(usr, /mob/living/silicon))) && (!modify))
-				usr << "You can't modify an ID without an ID inserted to modify. Once one is in the modify slot on the computer, you can log in."
-		if ("logout")
-			authenticated = 0
+
 		if("access")
 			if(href_list["allowed"])
-				if(authenticated)
+				if(is_authenticated())
 					var/access_type = text2num(href_list["access_target"])
 					var/access_allowed = text2num(href_list["allowed"])
-					if(access_type in (istype(src,/obj/machinery/computer/card/centcom)?get_all_centcom_access() : get_all_accesses()))
+					if(access_type in (is_centcom() ? get_all_centcom_access() : get_all_accesses()))
 						modify.access -= access_type
-						if(access_allowed == 1)
+						if(!access_allowed)
 							modify.access += access_type
+
 		if ("assign")
-			if (authenticated)
+			if (is_authenticated() && modify)
 				var/t1 = href_list["assign_target"]
 				if(t1 == "Custom")
 					var/temp_t = copytext(sanitize(input("Enter a custom job assignment.","Assignment")),1,45)
@@ -307,69 +176,91 @@
 					if(temp_t && modify)
 						modify.assignment = temp_t
 				else
-					var/datum/job/jobdatum
-					for(var/jobtype in typesof(/datum/job))
-						var/datum/job/J = new jobtype
-						if(ckey(J.title) == ckey(t1))
-							jobdatum = J
-							break
-					if(!jobdatum)
-						usr << "\red No log exists for this job."
-						return
+					var/list/access = list()
+					if(is_centcom())
+						access = get_centcom_access(t1)
+					else
+						var/datum/job/jobdatum
+						for(var/jobtype in typesof(/datum/job))
+							var/datum/job/J = new jobtype
+							if(ckey(J.title) == ckey(t1))
+								jobdatum = J
+								break
+						if(!jobdatum)
+							usr << "\red No log exists for this job: [t1]"
+							return
+
+						access = jobdatum.get_access()
+
+					modify.access = access
+					modify.assignment = t1
+					modify.rank = t1
+
+				callHook("reassign_employee", list(modify))
 
-					modify.access = ( istype(src,/obj/machinery/computer/card/centcom) ? get_centcom_access(t1) : jobdatum.get_access() )
-					if (modify)
-						modify.assignment = t1
-						modify.rank = t1
 		if ("reg")
-			if (authenticated)
+			if (is_authenticated())
 				var/t2 = modify
-				//var/t1 = input(usr, "What name?", "ID computer", null)  as text
-				if ((authenticated && modify == t2 && (in_range(src, usr) || (istype(usr, /mob/living/silicon))) && istype(loc, /turf)))
+				if ((modify == t2 && (in_range(src, usr) || (istype(usr, /mob/living/silicon))) && istype(loc, /turf)))
 					var/temp_name = reject_bad_name(href_list["reg"])
 					if(temp_name)
 						modify.registered_name = temp_name
 					else
 						src.visible_message("<span class='notice'>[src] buzzes rudely.</span>")
+			nanomanager.update_uis(src)
+
 		if ("account")
-			if (authenticated)
+			if (is_authenticated())
 				var/t2 = modify
-				//var/t1 = input(usr, "What name?", "ID computer", null)  as text
-				if ((authenticated && modify == t2 && (in_range(src, usr) || (istype(usr, /mob/living/silicon))) && istype(loc, /turf)))
+				if ((modify == t2 && (in_range(src, usr) || (istype(usr, /mob/living/silicon))) && istype(loc, /turf)))
 					var/account_num = text2num(href_list["account"])
 					modify.associated_account_number = account_num
+			nanomanager.update_uis(src)
+
 		if ("mode")
 			mode = text2num(href_list["mode_target"])
+
 		if ("print")
-			if (!( printing ))
+			if (!printing)
 				printing = 1
-				sleep(50)
-				var/obj/item/weapon/paper/P = new /obj/item/weapon/paper( loc )
-				/*var/t1 = "<B>Crew Manifest:</B><BR>"
-				var/list/L = list()
-				for (var/datum/data/record/t in data_core.general)
-					var/R = t.fields["name"] + " - " + t.fields["rank"]
-					L += R
-				for(var/R in sortList(L))
-					t1 += "[R]<br>"*/
+				spawn(50)
+					printing = null
+					nanomanager.update_uis(src)
 
-				var/t1 = "<h4>Crew Manifest</h4>"
-				t1 += "<br>"
-				if(data_core)
-					t1 += data_core.get_manifest(0) // make it monochrome
+					var/obj/item/weapon/paper/P = new(loc)
+					if (mode)
+						P.name = text("crew manifest ([])", worldtime2text())
+						P.info = {"<h4>Crew Manifest</h4>
+							<br>
+							[data_core ? data_core.get_manifest(0) : ""]
+						"}
+					else if (modify)
+						P.name = "access report"
+						P.info = {"<h4>Access Report</h4>
+							<u>Prepared By:</u> [scan.registered_name ? scan.registered_name : "Unknown"]<br>
+							<u>For:</u> [modify.registered_name ? modify.registered_name : "Unregistered"]<br>
+							<hr>
+							<u>Assignment:</u> [modify.assignment]<br>
+							<u>Account Number:</u> #[modify.associated_account_number]<br>
+							<u>Blood Type:</u> [modify.blood_type]<br><br>
+							<u>Access:</u><br>
+						"}
+
+						for(var/A in modify.access)
+							P.info += "  [get_access_desc(A)]"
+
+		if ("terminate")
+			modify.assignment = "Terminated"
+			modify.access = list()
+
+			callHook("terminate_employee", list(modify))
 
-				P.info = t1
-				P.name = text("Crew Manifest ([])", worldtime2text())
-				printing = null
 	if (modify)
 		modify.name = text("[modify.registered_name]'s ID Card ([modify.assignment])")
-	updateUsrDialog()
-	return
-
 
+	return 1
 
 /obj/machinery/computer/card/centcom
 	name = "CentCom Identification Computer"
 	circuit = "/obj/item/weapon/circuitboard/card/centcom"
 	req_access = list(access_cent_captain)
-

code/game/machinery/podmen.dm

@@ -129,6 +129,8 @@ Growing it to term with nothing injected will grab a ghost from the observers. *
 	podman.dna.real_name = podman.real_name
 
 	// Update mode specific HUD icons.
+	callHook("harvest_podman", list(podman))
+
 	switch(ticker.mode.name)
 		if ("revolution")
 			if (podman.mind in ticker.mode:revolutionaries)

code/game/objects/items.dm

@@ -476,6 +476,12 @@
 /obj/item/proc/IsShield()
 	return 0
 
+/obj/item/proc/get_turf()
+	var/atom/L = loc
+	while(L && !istype(L, /turf/))
+		L = L.loc
+	return loc
+
 /obj/item/proc/eyestab(mob/living/carbon/M as mob, mob/living/carbon/user as mob)
 
 	var/mob/living/carbon/human/H = M

code/game/objects/items/robot/robot_parts.dm

@@ -166,7 +166,7 @@
 		var/obj/item/device/mmi/M = W
 		if(check_completion())
 			if(!istype(loc,/turf))
-				user << "\red You can't put the [W] in, the frame has to be standing on the ground to be perfectly precise."
+				user << "\red You can't put \the [W] in, the frame has to be standing on the ground to be perfectly precise."
 				return
 			if(!M.brainmob)
 				user << "\red Sticking an empty [W] into the frame would sort of defeat the purpose."
@@ -179,7 +179,7 @@
 							ghost_can_reenter = 1
 							break
 				if(!ghost_can_reenter)
-					user << "<span class='notice'>The [W] is completely unresponsive; there's no point.</span>"
+					user << "<span class='notice'>\The [W] is completely unresponsive; there's no point.</span>"
 					return
 
 			if(M.brainmob.stat == DEAD)
@@ -222,6 +222,7 @@
 				cell_component.installed = 1
 
 			feedback_inc("cyborg_birth",1)
+			callHook("borgify", list(O))
 			O.Namepick()
 
 			del(src)

code/game/supplyshuttle.dm

@@ -241,6 +241,8 @@ var/list/mechtoys = list(
 
 			// Must be in a crate!
 			if(istype(MA,/obj/structure/closet/crate))
+				callHook("sell_crate", list(MA, shuttle))
+
 				points += points_per_crate
 				var/find_slip = 1
 

code/modules/admin/player_panel.dm

@@ -1,527 +1,506 @@
 
 /datum/admins/proc/player_panel_new()//The new one
-	if (!usr.client.holder)
-		return
-	var/dat = "<html><head><title>Admin Player Panel</title></head>"
+  if (!usr.client.holder)
+    return
+  var/dat = "<html><head><title>Admin Player Panel</title></head>"
 
-	//javascript, the part that does most of the work~
-	dat += {"
+  //javascript, the part that does most of the work~
+  dat += {"
 
-		<head>
-			<script type='text/javascript'>
+    <head>
+      <script type='text/javascript'>
 
-				var locked_tabs = new Array();
+        var locked_tabs = new Array();
 
-				function updateSearch(){
+        function updateSearch(){
 
 
-					var filter_text = document.getElementById('filter');
-					var filter = filter_text.value.toLowerCase();
+          var filter_text = document.getElementById('filter');
+          var filter = filter_text.value.toLowerCase();
 
-					if(complete_list != null && complete_list != ""){
-						var mtbl = document.getElementById("maintable_data_archive");
-						mtbl.innerHTML = complete_list;
-					}
+          if(complete_list != null && complete_list != ""){
+            var mtbl = document.getElementById("maintable_data_archive");
+            mtbl.innerHTML = complete_list;
+          }
 
-					if(filter.value == ""){
-						return;
-					}else{
+          if(filter.value == ""){
+            return;
+          }else{
 
-						var maintable_data = document.getElementById('maintable_data');
-						var ltr = maintable_data.getElementsByTagName("tr");
-						for ( var i = 0; i < ltr.length; ++i )
-						{
-							try{
-								var tr = ltr\[i\];
-								if(tr.getAttribute("id").indexOf("data") != 0){
-									continue;
-								}
-								var ltd = tr.getElementsByTagName("td");
-								var td = ltd\[0\];
-								var lsearch = td.getElementsByTagName("b");
-								var search = lsearch\[0\];
-								//var inner_span = li.getElementsByTagName("span")\[1\] //Should only ever contain one element.
-								//document.write("<p>"+search.innerText+"<br>"+filter+"<br>"+search.innerText.indexOf(filter))
-								if ( search.innerText.toLowerCase().indexOf(filter) == -1 )
-								{
-									//document.write("a");
-									//ltr.removeChild(tr);
-									td.innerHTML = "";
-									i--;
-								}
-							}catch(err) {   }
-						}
-					}
-
-					var count = 0;
-					var index = -1;
-					var debug = document.getElementById("debug");
-
-					locked_tabs = new Array();
-
-				}
-
-				function expand(id,job,name,real_name,image,key,ip,antagonist,ref){
-
-					clearAll();
-
-					var span = document.getElementById(id);
-
-					body = "<table><tr><td>";
-
-					body += "</td><td align='center'>";
-
-					body += "<font size='2'><b>"+job+" "+name+"</b><br><b>Real name "+real_name+"</b><br><b>Played by "+key+" ("+ip+")</b></font>"
-
-					body += "</td><td align='center'>";
-
-					body += "<a href='?src=\ref[src];adminplayeropts="+ref+"'>PP</a> - "
-					body += "<a href='?src=\ref[src];notes=show;mob="+ref+"'>N</a> - "
-					body += "<a href='?_src_=vars;Vars="+ref+"'>VV</a> - "
-					body += "<a href='?src=\ref[src];traitor="+ref+"'>TP</a> - "
-					body += "<a href='?src=\ref[usr];priv_msg=\ref"+ref+"'>PM</a> - "
-					body += "<a href='?src=\ref[src];subtlemessage="+ref+"'>SM</a> - "
-					body += "<a href='?src=\ref[src];adminplayerobservejump="+ref+"'>JMP</a><br>"
-					if(antagonist > 0)
-						body += "<font size='2'><a href='?src=\ref[src];check_antagonist=1'><font color='red'><b>Antagonist</b></font></a></font>";
-
-					body += "</td></tr></table>";
-
-
-					span.innerHTML = body
-				}
-
-				function clearAll(){
-					var spans = document.getElementsByTagName('span');
-					for(var i = 0; i < spans.length; i++){
-						var span = spans\[i\];
-
-						var id = span.getAttribute("id");
-
-						if(!(id.indexOf("item")==0))
-							continue;
-
-						var pass = 1;
-
-						for(var j = 0; j < locked_tabs.length; j++){
-							if(locked_tabs\[j\]==id){
-								pass = 0;
-								break;
-							}
-						}
-
-						if(pass != 1)
-							continue;
-
-
-
-
-						span.innerHTML = "";
-					}
-				}
-
-				function addToLocked(id,link_id,notice_span_id){
-					var link = document.getElementById(link_id);
-					var decision = link.getAttribute("name");
-					if(decision == "1"){
-						link.setAttribute("name","2");
-					}else{
-						link.setAttribute("name","1");
-						removeFromLocked(id,link_id,notice_span_id);
-						return;
-					}
-
-					var pass = 1;
-					for(var j = 0; j < locked_tabs.length; j++){
-						if(locked_tabs\[j\]==id){
-							pass = 0;
-							break;
-						}
-					}
-					if(!pass)
-						return;
-					locked_tabs.push(id);
-					var notice_span = document.getElementById(notice_span_id);
-					notice_span.innerHTML = "<font color='red'>Locked</font> ";
-					//link.setAttribute("onClick","attempt('"+id+"','"+link_id+"','"+notice_span_id+"');");
-					//document.write("removeFromLocked('"+id+"','"+link_id+"','"+notice_span_id+"')");
-					//document.write("aa - "+link.getAttribute("onClick"));
-				}
-
-				function attempt(ab){
-					return ab;
-				}
-
-				function removeFromLocked(id,link_id,notice_span_id){
-					//document.write("a");
-					var index = 0;
-					var pass = 0;
-					for(var j = 0; j < locked_tabs.length; j++){
-						if(locked_tabs\[j\]==id){
-							pass = 1;
-							index = j;
-							break;
-						}
-					}
-					if(!pass)
-						return;
-					locked_tabs\[index\] = "";
-					var notice_span = document.getElementById(notice_span_id);
-					notice_span.innerHTML = "";
-					//var link = document.getElementById(link_id);
-					//link.setAttribute("onClick","addToLocked('"+id+"','"+link_id+"','"+notice_span_id+"')");
-				}
-
-				function selectTextField(){
-					var filter_text = document.getElementById('filter');
-					filter_text.focus();
-					filter_text.select();
-				}
-
-			</script>
-		</head>
-
-
-	"}
-
-	//body tag start + onload and onkeypress (onkeyup) javascript event calls
-	dat += "<body onload='selectTextField(); updateSearch();' onkeyup='updateSearch();'>"
-
-	//title + search bar
-	dat += {"
-
-		<table width='560' align='center' cellspacing='0' cellpadding='5' id='maintable'>
-			<tr id='title_tr'>
-				<td align='center'>
-					<font size='5'><b>Player panel</b></font><br>
-					Hover over a line to see more information - <a href='?src=\ref[src];check_antagonist=1'>Check antagonists</a>
-					<p>
-				</td>
-			</tr>
-			<tr id='search_tr'>
-				<td align='center'>
-					<b>Search:</b> <input type='text' id='filter' value='' style='width:300px;'>
-				</td>
-			</tr>
-	</table>
-
-	"}
-
-	//player table header
-	dat += {"
-		<span id='maintable_data_archive'>
-		<table width='560' align='center' cellspacing='0' cellpadding='5' id='maintable_data'>"}
-
-	var/list/mobs = sortmobs()
-	var/i = 1
-	for(var/mob/M in mobs)
-		if(M.ckey)
-
-			var/color = "#e6e6e6"
-			if(i%2 == 0)
-				color = "#f2f2f2"
-			var/is_antagonist = is_special_character(M)
-
-			var/M_job = ""
-
-			if(isliving(M))
-
-				if(iscarbon(M)) //Carbon stuff
-					if(ishuman(M))
-						M_job = M.job
-					else if(isslime(M))
-						M_job = "slime"
-					else if(ismonkey(M))
-						M_job = "Monkey"
-					else if(isalien(M)) //aliens
-						if(islarva(M))
-							M_job = "Alien larva"
-						else
-							M_job = "Alien"
-					else
-						M_job = "Carbon-based"
-
-				else if(issilicon(M)) //silicon
-					if(isAI(M))
-						M_job = "AI"
-					else if(ispAI(M))
-						M_job = "pAI"
-					else if(isrobot(M))
-						M_job = "Cyborg"
-					else
-						M_job = "Silicon-based"
-
-				else if(isanimal(M)) //simple animals
-					if(iscorgi(M))
-						M_job = "Corgi"
-					else
-						M_job = "Animal"
-
-				else
-					M_job = "Living"
-
-			else if(istype(M,/mob/new_player))
-				M_job = "New player"
-
-			else if(isobserver(M))
-				M_job = "Ghost"
-
-			M_job = replacetext(M_job, "'", "")
-			M_job = replacetext(M_job, "\"", "")
-			M_job = replacetext(M_job, "\\", "")
-
-			var/M_name = M.name
-			M_name = replacetext(M_name, "'", "")
-			M_name = replacetext(M_name, "\"", "")
-			M_name = replacetext(M_name, "\\", "")
-			var/M_rname = M.real_name
-			M_rname = replacetext(M_rname, "'", "")
-			M_rname = replacetext(M_rname, "\"", "")
-			M_rname = replacetext(M_rname, "\\", "")
-
-			var/M_key = M.key
-			M_key = replacetext(M_key, "'", "")
-			M_key = replacetext(M_key, "\"", "")
-			M_key = replacetext(M_key, "\\", "")
-
-			//output for each mob
-			dat += {"
-
-				<tr id='data[i]' name='[i]' onClick="addToLocked('item[i]','data[i]','notice_span[i]')">
-					<td align='center' bgcolor='[color]'>
-						<span id='notice_span[i]'></span>
-						<a id='link[i]'
-						onmouseover='expand("item[i]","[M_job]","[M_name]","[M_rname]","--unused--","[M_key]","[M.lastKnownIP]",[is_antagonist],"\ref[M]")'
-						>
-						<b id='search[i]'>[M_name] - [M_rname] - [M_key] ([M_job])</b>
-						</a>
-						<br><span id='item[i]'></span>
-					</td>
-				</tr>
-
-			"}
-
-			i++
-
-
-	//player table ending
-	dat += {"
-		</table>
-		</span>
-
-		<script type='text/javascript'>
-			var maintable = document.getElementById("maintable_data_archive");
-			var complete_list = maintable.innerHTML;
-		</script>
-	</body></html>
-	"}
-
-	usr << browse(dat, "window=players;size=600x480")
+            var maintable_data = document.getElementById('maintable_data');
+            var ltr = maintable_data.getElementsByTagName("tr");
+            for ( var i = 0; i < ltr.length; ++i )
+            {
+              try{
+                var tr = ltr\[i\];
+                if(tr.getAttribute("id").indexOf("data") != 0){
+                  continue;
+                }
+                var ltd = tr.getElementsByTagName("td");
+                var td = ltd\[0\];
+                var lsearch = td.getElementsByTagName("b");
+                var search = lsearch\[0\];
+                //var inner_span = li.getElementsByTagName("span")\[1\] //Should only ever contain one element.
+                //document.write("<p>"+search.innerText+"<br>"+filter+"<br>"+search.innerText.indexOf(filter))
+                if ( search.innerText.toLowerCase().indexOf(filter) == -1 )
+                {
+                  //document.write("a");
+                  //ltr.removeChild(tr);
+                  td.innerHTML = "";
+                  i--;
+                }
+              }catch(err) {   }
+            }
+          }
+
+          var count = 0;
+          var index = -1;
+          var debug = document.getElementById("debug");
+
+          locked_tabs = new Array();
+
+        }
+
+        function expand(id,job,name,real_name,image,key,ip,antagonist,ref){
+
+          clearAll();
+
+          var span = document.getElementById(id);
+
+          body = "<table><tr><td>";
+
+          body += "</td><td align='center'>";
+
+          body += "<font size='2'><b>"+job+" "+name+"</b><br><b>Real name "+real_name+"</b><br><b>Played by "+key+" ("+ip+")</b></font>"
+
+          body += "</td><td align='center'>";
+
+          body += "<a href='?src=\ref[src];adminplayeropts="+ref+"'>PP</a> - "
+          body += "<a href='?src=\ref[src];notes=show;mob="+ref+"'>N</a> - "
+          body += "<a href='?_src_=vars;Vars="+ref+"'>VV</a> - "
+          body += "<a href='?src=\ref[src];traitor="+ref+"'>TP</a> - "
+          body += "<a href='?src=\ref[usr];priv_msg=\ref"+ref+"'>PM</a> - "
+          body += "<a href='?src=\ref[src];subtlemessage="+ref+"'>SM</a> - "
+          body += "<a href='?src=\ref[src];adminplayerobservejump="+ref+"'>JMP</a><br>"
+          if(antagonist > 0)
+            body += "<font size='2'><a href='?src=\ref[src];check_antagonist=1'><font color='red'><b>Antagonist</b></font></a></font>";
+
+          body += "</td></tr></table>";
+
+
+          span.innerHTML = body
+        }
+
+        function clearAll(){
+          var spans = document.getElementsByTagName('span');
+          for(var i = 0; i < spans.length; i++){
+            var span = spans\[i\];
+
+            var id = span.getAttribute("id");
+
+            if(!(id.indexOf("item")==0))
+              continue;
+
+            var pass = 1;
+
+            for(var j = 0; j < locked_tabs.length; j++){
+              if(locked_tabs\[j\]==id){
+                pass = 0;
+                break;
+              }
+            }
+
+            if(pass != 1)
+              continue;
+
+
+
+
+            span.innerHTML = "";
+          }
+        }
+
+        function addToLocked(id,link_id,notice_span_id){
+          var link = document.getElementById(link_id);
+          var decision = link.getAttribute("name");
+          if(decision == "1"){
+            link.setAttribute("name","2");
+          }else{
+            link.setAttribute("name","1");
+            removeFromLocked(id,link_id,notice_span_id);
+            return;
+          }
+
+          var pass = 1;
+          for(var j = 0; j < locked_tabs.length; j++){
+            if(locked_tabs\[j\]==id){
+              pass = 0;
+              break;
+            }
+          }
+          if(!pass)
+            return;
+          locked_tabs.push(id);
+          var notice_span = document.getElementById(notice_span_id);
+          notice_span.innerHTML = "<font color='red'>Locked</font> ";
+          //link.setAttribute("onClick","attempt('"+id+"','"+link_id+"','"+notice_span_id+"');");
+          //document.write("removeFromLocked('"+id+"','"+link_id+"','"+notice_span_id+"')");
+          //document.write("aa - "+link.getAttribute("onClick"));
+        }
+
+        function attempt(ab){
+          return ab;
+        }
+
+        function removeFromLocked(id,link_id,notice_span_id){
+          //document.write("a");
+          var index = 0;
+          var pass = 0;
+          for(var j = 0; j < locked_tabs.length; j++){
+            if(locked_tabs\[j\]==id){
+              pass = 1;
+              index = j;
+              break;
+            }
+          }
+          if(!pass)
+            return;
+          locked_tabs\[index\] = "";
+          var notice_span = document.getElementById(notice_span_id);
+          notice_span.innerHTML = "";
+          //var link = document.getElementById(link_id);
+          //link.setAttribute("onClick","addToLocked('"+id+"','"+link_id+"','"+notice_span_id+"')");
+        }
+
+        function selectTextField(){
+          var filter_text = document.getElementById('filter');
+          filter_text.focus();
+          filter_text.select();
+        }
+
+      </script>
+    </head>
+
+
+  "}
+
+  //body tag start + onload and onkeypress (onkeyup) javascript event calls
+  dat += "<body onload='selectTextField(); updateSearch();' onkeyup='updateSearch();'>"
+
+  //title + search bar
+  dat += {"
+
+    <table width='560' align='center' cellspacing='0' cellpadding='5' id='maintable'>
+      <tr id='title_tr'>
+        <td align='center'>
+          <font size='5'><b>Player panel</b></font><br>
+          Hover over a line to see more information - <a href='?src=\ref[src];check_antagonist=1'>Check antagonists</a>
+          <p>
+        </td>
+      </tr>
+      <tr id='search_tr'>
+        <td align='center'>
+          <b>Search:</b> <input type='text' id='filter' value='' style='width:300px;'>
+        </td>
+      </tr>
+  </table>
+
+  "}
+
+  //player table header
+  dat += {"
+    <span id='maintable_data_archive'>
+    <table width='560' align='center' cellspacing='0' cellpadding='5' id='maintable_data'>"}
+
+  var/list/mobs = sortmobs()
+  var/i = 1
+  for(var/mob/M in mobs)
+    if(M.ckey)
+
+      var/color = "#e6e6e6"
+      if(i%2 == 0)
+        color = "#f2f2f2"
+      var/is_antagonist = is_special_character(M)
+
+      var/M_job = ""
+
+      if(isliving(M))
+
+        if(iscarbon(M)) //Carbon stuff
+          if(ishuman(M))
+            M_job = M.job
+          else if(isslime(M))
+            M_job = "slime"
+          else if(ismonkey(M))
+            M_job = "Monkey"
+          else if(isalien(M)) //aliens
+            if(islarva(M))
+              M_job = "Alien larva"
+            else
+              M_job = "Alien"
+          else
+            M_job = "Carbon-based"
+
+        else if(issilicon(M)) //silicon
+          if(isAI(M))
+            M_job = "AI"
+          else if(ispAI(M))
+            M_job = "pAI"
+          else if(isrobot(M))
+            M_job = "Cyborg"
+          else
+            M_job = "Silicon-based"
+
+        else if(isanimal(M)) //simple animals
+          if(iscorgi(M))
+            M_job = "Corgi"
+          else
+            M_job = "Animal"
+
+        else
+          M_job = "Living"
+
+      else if(istype(M,/mob/new_player))
+        M_job = "New player"
+
+      else if(isobserver(M))
+        M_job = "Ghost"
+
+      M_job = replacetext(M_job, "'", "")
+      M_job = replacetext(M_job, "\"", "")
+      M_job = replacetext(M_job, "\\", "")
+
+      var/M_name = M.name
+      M_name = replacetext(M_name, "'", "")
+      M_name = replacetext(M_name, "\"", "")
+      M_name = replacetext(M_name, "\\", "")
+      var/M_rname = M.real_name
+      M_rname = replacetext(M_rname, "'", "")
+      M_rname = replacetext(M_rname, "\"", "")
+      M_rname = replacetext(M_rname, "\\", "")
+
+      var/M_key = M.key
+      M_key = replacetext(M_key, "'", "")
+      M_key = replacetext(M_key, "\"", "")
+      M_key = replacetext(M_key, "\\", "")
+
+      //output for each mob
+      dat += {"
+
+        <tr id='data[i]' name='[i]' onClick="addToLocked('item[i]','data[i]','notice_span[i]')">
+          <td align='center' bgcolor='[color]'>
+            <span id='notice_span[i]'></span>
+            <a id='link[i]'
+            onmouseover='expand("item[i]","[M_job]","[M_name]","[M_rname]","--unused--","[M_key]","[M.lastKnownIP]",[is_antagonist],"\ref[M]")'
+            >
+            <b id='search[i]'>[M_name] - [M_rname] - [M_key] ([M_job])</b>
+            </a>
+            <br><span id='item[i]'></span>
+          </td>
+        </tr>
+
+      "}
+
+      i++
+
+
+  //player table ending
+  dat += {"
+    </table>
+    </span>
+
+    <script type='text/javascript'>
+      var maintable = document.getElementById("maintable_data_archive");
+      var complete_list = maintable.innerHTML;
+    </script>
+  </body></html>
+  "}
+
+  usr << browse(dat, "window=players;size=600x480")
 
 //The old one
 /datum/admins/proc/player_panel_old()
-	if (!usr.client.holder)
-		return
-	var/dat = "<html><head><title>Player Menu</title></head>"
-	dat += "<body><table border=1 cellspacing=5><B><tr><th>Name</th><th>Real Name</th><th>Assigned Job</th><th>Key</th><th>Options</th><th>PM</th><th>Traitor?</th></tr></B>"
-	//add <th>IP:</th> to this if wanting to add back in IP checking
-	//add <td>(IP: [M.lastKnownIP])</td> if you want to know their ip to the lists below
-	var/list/mobs = sortmobs()
+  if (!usr.client.holder)
+    return
+  var/dat = "<html><head><title>Player Menu</title></head>"
+  dat += "<body><table border=1 cellspacing=5><B><tr><th>Name</th><th>Real Name</th><th>Assigned Job</th><th>Key</th><th>Options</th><th>PM</th><th>Traitor?</th></tr></B>"
+  //add <th>IP:</th> to this if wanting to add back in IP checking
+  //add <td>(IP: [M.lastKnownIP])</td> if you want to know their ip to the lists below
+  var/list/mobs = sortmobs()
 
-	for(var/mob/M in mobs)
-		if(!M.ckey)	continue
+  for(var/mob/M in mobs)
+    if(!M.ckey) continue
 
-		dat += "<tr><td>[M.name]</td>"
-		if(isAI(M))
-			dat += "<td>AI</td>"
-		else if(isrobot(M))
-			dat += "<td>Cyborg</td>"
-		else if(ishuman(M))
-			dat += "<td>[M.real_name]</td>"
-		else if(istype(M, /mob/living/silicon/pai))
-			dat += "<td>pAI</td>"
-		else if(istype(M, /mob/new_player))
-			dat += "<td>New Player</td>"
-		else if(isobserver(M))
-			dat += "<td>Ghost</td>"
-		else if(ismonkey(M))
-			dat += "<td>Monkey</td>"
-		else if(isalien(M))
-			dat += "<td>Alien</td>"
-		else
-			dat += "<td>Unknown</td>"
+    dat += "<tr><td>[M.name]</td>"
+    if(isAI(M))
+      dat += "<td>AI</td>"
+    else if(isrobot(M))
+      dat += "<td>Cyborg</td>"
+    else if(ishuman(M))
+      dat += "<td>[M.real_name]</td>"
+    else if(istype(M, /mob/living/silicon/pai))
+      dat += "<td>pAI</td>"
+    else if(istype(M, /mob/new_player))
+      dat += "<td>New Player</td>"
+    else if(isobserver(M))
+      dat += "<td>Ghost</td>"
+    else if(ismonkey(M))
+      dat += "<td>Monkey</td>"
+    else if(isalien(M))
+      dat += "<td>Alien</td>"
+    else
+      dat += "<td>Unknown</td>"
 
 
-		if(istype(M,/mob/living/carbon/human))
-			var/mob/living/carbon/human/H = M
-			if(H.mind && H.mind.assigned_role)
-				dat += "<td>[H.mind.assigned_role]</td>"
-		else
-			dat += "<td>NA</td>"
+    if(istype(M,/mob/living/carbon/human))
+      var/mob/living/carbon/human/H = M
+      if(H.mind && H.mind.assigned_role)
+        dat += "<td>[H.mind.assigned_role]</td>"
+    else
+      dat += "<td>NA</td>"
 
 
-		dat += {"<td>[(M.client ? "[M.client]" : "No client")]</td>
-		<td align=center><A HREF='?src=\ref[src];adminplayeropts=\ref[M]'>X</A></td>
-		<td align=center><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>
-		"}
-		switch(is_special_character(M))
-			if(0)
-				dat += {"<td align=center><A HREF='?src=\ref[src];traitor=\ref[M]'>Traitor?</A></td>"}
-			if(1)
-				dat += {"<td align=center><A HREF='?src=\ref[src];traitor=\ref[M]'><font color=red>Traitor?</font></A></td>"}
-			if(2)
-				dat += {"<td align=center><A HREF='?src=\ref[src];traitor=\ref[M]'><font color=red><b>Traitor?</b></font></A></td>"}
+    dat += {"<td>[(M.client ? "[M.client]" : "No client")]</td>
+    <td align=center><A HREF='?src=\ref[src];adminplayeropts=\ref[M]'>X</A></td>
+    <td align=center><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>
+    "}
+    switch(is_special_character(M))
+      if(0)
+        dat += {"<td align=center><A HREF='?src=\ref[src];traitor=\ref[M]'>Traitor?</A></td>"}
+      if(1)
+        dat += {"<td align=center><A HREF='?src=\ref[src];traitor=\ref[M]'><font color=red>Traitor?</font></A></td>"}
+      if(2)
+        dat += {"<td align=center><A HREF='?src=\ref[src];traitor=\ref[M]'><font color=red><b>Traitor?</b></font></A></td>"}
 
-	dat += "</table></body></html>"
+  dat += "</table></body></html>"
 
-	usr << browse(dat, "window=players;size=640x480")
+  usr << browse(dat, "window=players;size=640x480")
 
 
 
 /datum/admins/proc/check_antagonists()
-	if (ticker && ticker.current_state >= GAME_STATE_PLAYING)
-		var/dat = "<html><head><title>Round Status</title></head><body><h1><B>Round Status</B></h1>"
-		dat += "Current Game Mode: <B>[ticker.mode.name]</B><BR>"
-		dat += "Round Duration: <B>[round(world.time / 36000)]:[add_zero(world.time / 600 % 60, 2)]:[world.time / 100 % 6][world.time / 100 % 10]</B><BR>"
-		dat += "<B>Emergency shuttle</B><BR>"
-		if (!emergency_shuttle.online)
-			dat += "<a href='?src=\ref[src];call_shuttle=1'>Call Shuttle</a><br>"
-		else
-			var/timeleft = emergency_shuttle.timeleft()
-			switch(emergency_shuttle.location)
-				if(0)
-					dat += "ETA: <a href='?src=\ref[src];edit_shuttle_time=1'>[(timeleft / 60) % 60]:[add_zero(num2text(timeleft % 60), 2)]</a><BR>"
-					dat += "<a href='?src=\ref[src];call_shuttle=2'>Send Back</a><br>"
-				if(1)
-					dat += "ETA: <a href='?src=\ref[src];edit_shuttle_time=1'>[(timeleft / 60) % 60]:[add_zero(num2text(timeleft % 60), 2)]</a><BR>"
-		dat += "<a href='?src=\ref[src];delay_round_end=1'>[ticker.delay_end ? "End Round Normally" : "Delay Round End"]</a><br>"
-		if(ticker.mode.syndicates.len)
-			dat += "<br><table cellspacing=5><tr><td><B>Syndicates</B></td><td></td></tr>"
-			for(var/datum/mind/N in ticker.mode.syndicates)
-				var/mob/M = N.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
-				else
-					dat += "<tr><td><i>Nuclear Operative not found!</i></td></tr>"
-			dat += "</table><br><table><tr><td><B>Nuclear Disk(s)</B></td></tr>"
-			for(var/obj/item/weapon/disk/nuclear/N in world)
-				dat += "<tr><td>[N.name], "
-				var/atom/disk_loc = N.loc
-				while(!istype(disk_loc, /turf))
-					if(istype(disk_loc, /mob))
-						var/mob/M = disk_loc
-						dat += "carried by <a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a> "
-					if(istype(disk_loc, /obj))
-						var/obj/O = disk_loc
-						dat += "in \a [O.name] "
-					disk_loc = disk_loc.loc
-				dat += "in [disk_loc.loc] at ([disk_loc.x], [disk_loc.y], [disk_loc.z])</td></tr>"
-			dat += "</table>"
+  if (ticker && ticker.current_state >= GAME_STATE_PLAYING)
+    var/dat = "<html><head><title>Round Status</title></head><body><h1><B>Round Status</B></h1>"
+    dat += "Current Game Mode: <B>[ticker.mode.name]</B><BR>"
+    dat += "Round Duration: <B>[round(world.time / 36000)]:[add_zero(world.time / 600 % 60, 2)]:[world.time / 100 % 6][world.time / 100 % 10]</B><BR>"
+    dat += "<B>Emergency shuttle</B><BR>"
+    if (!emergency_shuttle.online)
+      dat += "<a href='?src=\ref[src];call_shuttle=1'>Call Shuttle</a><br>"
+    else
+      var/timeleft = emergency_shuttle.timeleft()
+      switch(emergency_shuttle.location)
+        if(0)
+          dat += "ETA: <a href='?src=\ref[src];edit_shuttle_time=1'>[(timeleft / 60) % 60]:[add_zero(num2text(timeleft % 60), 2)]</a><BR>"
+          dat += "<a href='?src=\ref[src];call_shuttle=2'>Send Back</a><br>"
+        if(1)
+          dat += "ETA: <a href='?src=\ref[src];edit_shuttle_time=1'>[(timeleft / 60) % 60]:[add_zero(num2text(timeleft % 60), 2)]</a><BR>"
+    dat += "<a href='?src=\ref[src];delay_round_end=1'>[ticker.delay_end ? "End Round Normally" : "Delay Round End"]</a><br>"
+    if(ticker.mode.syndicates.len)
+      dat += "<br><table cellspacing=5><tr><td><B>Syndicates</B></td><td></td></tr>"
+      for(var/datum/mind/N in ticker.mode.syndicates)
+        var/mob/M = N.current
+        if(M)
+          dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
+          dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
+        else
+          dat += "<tr><td><i>Nuclear Operative not found!</i></td></tr>"
+      dat += "</table><br><table><tr><td><B>Nuclear Disk(s)</B></td></tr>"
+      for(var/obj/item/weapon/disk/nuclear/N in world)
+        dat += "<tr><td>[N.name], "
+        var/atom/disk_loc = N.loc
+        while(!istype(disk_loc, /turf))
+          if(istype(disk_loc, /mob))
+            var/mob/M = disk_loc
+            dat += "carried by <a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a> "
+          if(istype(disk_loc, /obj))
+            var/obj/O = disk_loc
+            dat += "in \a [O.name] "
+          disk_loc = disk_loc.loc
+        dat += "in [disk_loc.loc] at ([disk_loc.x], [disk_loc.y], [disk_loc.z])</td></tr>"
+      dat += "</table>"
 
-		if(ticker.mode.head_revolutionaries.len || ticker.mode.revolutionaries.len)
-			dat += "<br><table cellspacing=5><tr><td><B>Revolutionaries</B></td><td></td></tr>"
-			for(var/datum/mind/N in ticker.mode.head_revolutionaries)
-				var/mob/M = N.current
-				if(!M)
-					dat += "<tr><td><i>Head Revolutionary not found!</i></td></tr>"
-				else
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a> <b>(Leader)</b>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
-			for(var/datum/mind/N in ticker.mode.revolutionaries)
-				var/mob/M = N.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
-			dat += "</table><table cellspacing=5><tr><td><B>Target(s)</B></td><td></td><td><B>Location</B></td></tr>"
-			for(var/datum/mind/N in ticker.mode.get_living_heads())
-				var/mob/M = N.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>"
-					var/turf/mob_loc = get_turf_loc(M)
-					dat += "<td>[mob_loc.loc]</td></tr>"
-				else
-					dat += "<tr><td><i>Head not found!</i></td></tr>"
-			dat += "</table>"
+    if(ticker.mode.head_revolutionaries.len || ticker.mode.revolutionaries.len)
+      dat += "<br><table cellspacing=5><tr><td><B>Revolutionaries</B></td><td></td></tr>"
+      for(var/datum/mind/N in ticker.mode.head_revolutionaries)
+        var/mob/M = N.current
+        if(!M)
+          dat += "<tr><td><i>Head Revolutionary not found!</i></td></tr>"
+        else
+          dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a> <b>(Leader)</b>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
+          dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
+      for(var/datum/mind/N in ticker.mode.revolutionaries)
+        var/mob/M = N.current
+        if(M)
+          dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
+          dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
+      dat += "</table><table cellspacing=5><tr><td><B>Target(s)</B></td><td></td><td><B>Location</B></td></tr>"
+      for(var/datum/mind/N in ticker.mode.get_living_heads())
+        var/mob/M = N.current
+        if(M)
+          dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
+          dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>"
+          var/turf/mob_loc = get_turf_loc(M)
+          dat += "<td>[mob_loc.loc]</td></tr>"
+        else
+          dat += "<tr><td><i>Head not found!</i></td></tr>"
+      dat += "</table>"
 
-		if(ticker.mode.changelings.len > 0)
-			dat += "<br><table cellspacing=5><tr><td><B>Changelings</B></td><td></td><td></td></tr>"
-			for(var/datum/mind/changeling in ticker.mode.changelings)
-				var/mob/M = changeling.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>"
-					dat += "<td><A HREF='?src=\ref[src];traitor=\ref[M]'>Show Objective</A></td></tr>"
-				else
-					dat += "<tr><td><i>Changeling not found!</i></td></tr>"
-			dat += "</table>"
+    if(ticker.mode.changelings.len)
+      dat += check_role_table("Changelings", ticker.mode.changelings, src)
 
-		if(ticker.mode.wizards.len > 0)
-			dat += "<br><table cellspacing=5><tr><td><B>Wizards</B></td><td></td><td></td></tr>"
-			for(var/datum/mind/wizard in ticker.mode.wizards)
-				var/mob/M = wizard.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>"
-					dat += "<td><A HREF='?src=\ref[src];traitor=\ref[M]'>Show Objective</A></td></tr>"
-				else
-					dat += "<tr><td><i>Wizard not found!</i></td></tr>"
-			dat += "</table>"
+    if(ticker.mode.wizards.len)
+      dat += check_role_table("Wizards", ticker.mode.wizards, src)
 
-		if(ticker.mode.raiders.len > 0)
-			dat += "<br><table cellspacing=5><tr><td><B>Raiders</B></td><td></td><td></td></tr>"
-			for(var/datum/mind/raider in ticker.mode.raiders)
-				var/mob/M = raider.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>"
-					dat += "<td><A HREF='?src=\ref[src];traitor=\ref[M]'>Show Objective</A></td></tr>"
-			dat += "</table>"
+    if(ticker.mode.raiders.len)
+      dat += check_role_table("Raiders", ticker.mode.raiders, src)
 
-		if(ticker.mode.ninjas.len > 0)
-			dat += "<br><table cellspacing=5><tr><td><B>Ninjas</B></td><td></td><td></td></tr>"
-			for(var/datum/mind/ninja in ticker.mode.ninjas)
-				var/mob/M = ninja.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>"
-					dat += "<td><A HREF='?src=\ref[src];traitor=\ref[M]'>Show Objective</A></td></tr>"
-				else
-					dat += "<tr><td><i>Ninja not found!</i></td></tr>"
-			dat += "</table>"
+    if(ticker.mode.ninjas.len)
+      dat += check_role_table("Ninjas", ticker.mode.ninjas, src)
 
-		if(ticker.mode.cult.len)
-			dat += "<br><table cellspacing=5><tr><td><B>Cultists</B></td><td></td></tr>"
-			for(var/datum/mind/N in ticker.mode.cult)
-				var/mob/M = N.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
-			dat += "</table>"
+    if(ticker.mode.cult.len)
+      dat += check_role_table("Cultists", ticker.mode.cult, src, 0)
 
-		/*if(istype(ticker.mode, /datum/game_mode/anti_revolution) && ticker.mode:heads.len)	//comment out anti-revolution
-			dat += "<br><table cellspacing=5><tr><td><B>Corrupt Heads</B></td><td></td></tr>"
-			for(var/datum/mind/N in ticker.mode:heads)
-				var/mob/M = N.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td></tr>"
-			dat += "</table>"
-*/
-		if(ticker.mode.traitors.len > 0)
-			dat += "<br><table cellspacing=5><tr><td><B>Traitors</B></td><td></td><td></td></tr>"
-			for(var/datum/mind/traitor in ticker.mode.traitors)
-				var/mob/M = traitor.current
-				if(M)
-					dat += "<tr><td><a href='?src=\ref[src];adminplayeropts=\ref[M]'>[M.real_name]</a>[M.client ? "" : " <i>(logged out)</i>"][M.stat == 2 ? " <b><font color=red>(DEAD)</font></b>" : ""]</td>"
-					dat += "<td><A href='?src=\ref[usr];priv_msg=\ref[M]'>PM</A></td>"
-					dat += "<td><A HREF='?src=\ref[src];traitor=\ref[M]'>Show Objective</A></td></tr>"
-				else
-					dat += "<tr><td><i>Traitor not found!</i></td></tr>"
-			dat += "</table>"
+    if(ticker.mode.traitors.len)
+      dat += check_role_table("Traitors", ticker.mode.traitors, src)
 
-		dat += "</body></html>"
-		usr << browse(dat, "window=roundstatus;size=400x500")
-	else
-		alert("The game hasn't started yet!")
+    var/datum/game_mode/mutiny/mutiny = get_mutiny_mode()
+    if(mutiny)
+      dat += mutiny.check_antagonists_ui(src)
+
+    dat += "</body></html>"
+    usr << browse(dat, "window=roundstatus;size=400x500")
+  else
+    alert("The game hasn't started yet!")
+
+/proc/check_role_table(name, list/members, admins, show_objectives=1)
+  var/txt = "<br><table cellspacing=5><tr><td><b>[name]</b></td><td></td></tr>"
+  for(var/datum/mind/M in members)
+    txt += check_role_table_row(M.current, admins, show_objectives)
+  txt += "</table>"
+  return txt
+
+/proc/check_role_table_row(mob/M, admins=src, show_objectives)
+  if (!istype(M))
+    return "<tr><td><i>Not found!</i></td></tr>"
+
+  var/txt = {"
+    <tr>
+      <td>
+        <a href='?src=\ref[admins];adminplayeropts=\ref[M]'>[M.real_name]</a>
+        [M.client ? "" : " <i>(logged out)</i>"]
+        [M.is_dead() ? " <b><font color='red'>(DEAD)</font></b>" : ""]
+      </td>
+      <td>
+        <a href='?src=\ref[usr];priv_msg=\ref[M]'>PM</a>
+      </td>
+  "}
+
+  if (show_objectives)
+    txt += {"
+      <td>
+        <a href='?src=\ref[admins];traitor=\ref[M]'>Show Objective</a>
+      </td>
+    "}
+
+  txt += "</tr>"
+  return txt

code/modules/admin/topic.dm

@@ -6,6 +6,10 @@
 		message_admins("[usr.key] has attempted to override the admin panel!")
 		return
 
+	if(ticker.mode && ticker.mode.check_antagonists_topic(href, href_list))
+		check_antagonists()
+		return
+
 	if(href_list["makeAntag"])
 		switch(href_list["makeAntag"])
 			if("1")

code/modules/client/preferences.dm

@@ -14,9 +14,10 @@ var/global/list/special_roles = list( //keep synced with the defines BE_* in set
 	"pAI candidate" = 1, // -- TLE                       // 7
 	"cultist" = IS_MODE_COMPILED("cult"),                // 8
 	"infested monkey" = IS_MODE_COMPILED("monkey"),      // 9
-	"ninja" = "true",									 // 10
-	"vox raider" = IS_MODE_COMPILED("heist"),			 // 11
+	"ninja" = "true",                                    // 10
+	"vox raider" = IS_MODE_COMPILED("heist"),            // 11
 	"diona" = 1,                                         // 12
+	"mutineer" = IS_MODE_COMPILED("mutiny"),             // 13
 )
 
 var/const/MAX_SAVE_SLOTS = 10

code/modules/economy/Accounts_DB.dm

@@ -1,6 +1,6 @@
 
 /obj/machinery/account_database
-	name = "Accounts uplink console"
+	name = "Accounts uplink terminal"
 	desc = "Access transaction logs, account data and all kinds of other financial records."
 	icon = 'icons/obj/computer.dmi'
 	icon_state = "aiupload"
@@ -9,115 +9,134 @@
 	var/receipt_num
 	var/machine_id = ""
 	var/obj/item/weapon/card/id/held_card
-	var/access_level = 0
 	var/datum/money_account/detailed_account_view
 	var/creating_new_account = 0
 
+	proc/get_access_level()
+		if (!held_card)
+			return 0
+		if(access_cent_captain in held_card.access)
+			return 2
+		else if(access_hop in held_card.access || access_captain in held_card.access)
+			return 1
+
+	proc/create_transation(target, reason, amount)
+		var/datum/transaction/T = new()
+		T.target_name = target
+		T.purpose = reason
+		T.amount = amount
+		T.date = current_date_string
+		T.time = worldtime2text()
+		T.source_terminal = machine_id
+		return T
+
+	proc/accounting_letterhead(report_name)
+		return {"
+			<center><h1><b>[report_name]</b></h1></center>
+			<center><small><i>[station_name()] Accounting Report</i></small></center>
+			<hr>
+			<u>Generated By:</u> [held_card.registered_name], [held_card.assignment]<br>
+		"}
+
 /obj/machinery/account_database/New()
-	..()
 	machine_id = "[station_name()] Acc. DB #[num_financial_terminals++]"
+	..()
+
+/obj/machinery/account_database/attackby(obj/O, mob/user)
+	if(!istype(O, /obj/item/weapon/card/id))
+		return ..()
+
+	if(!held_card)
+		user.drop_item()
+		O.loc = src
+		held_card = O
+
+		nanomanager.update_uis(src)
+
+	attack_hand(user)
 
 /obj/machinery/account_database/attack_hand(mob/user as mob)
-	if(get_dist(src,user) <= 1)
-		var/dat = "<b>Accounts Database</b><br>"
-		dat += "<i>[machine_id]</i><br>"
-		dat += "Confirm identity: <a href='?src=\ref[src];choice=insert_card'>[held_card ? held_card : "-----"]</a><br>"
+	if(stat & (NOPOWER|BROKEN)) return
+	ui_interact(user)
 
-		if(access_level > 0)
-			dat += "You may not edit accounts at this terminal, only create and view them.<br>"
-			if(creating_new_account)
-				dat += "<br>"
-				dat += "<a href='?src=\ref[src];choice=view_accounts_list;'>Return to accounts list</a>"
-				dat += "<form name='create_account' action='?src=\ref[src]' method='get'>"
-				dat += "<input type='hidden' name='src' value='\ref[src]'>"
-				dat += "<input type='hidden' name='choice' value='finalise_create_account'>"
-				dat += "<b>Holder name:</b> <input type='text' id='holder_name' name='holder_name' style='width:250px; background-color:white;'><br>"
-				dat += "<b>Initial funds:</b> <input type='text' id='starting_funds' name='starting_funds' style='width:250px; background-color:white;'> (subtracted from station account)<br>"
-				dat += "<i>New accounts are automatically assigned a secret number and pin, which are printed separately in a sealed package.</i><br>"
-				dat += "<input type='submit' value='Create'><br>"
-				dat += "</form>"
-			else
-				if(detailed_account_view)
-					dat += "<br>"
-					dat += "<a href='?src=\ref[src];choice=view_accounts_list;'>Return to accounts list</a><hr>"
-					dat += "<b>Account number:</b> #[detailed_account_view.account_number]<br>"
-					dat += "<b>Account holder:</b> [detailed_account_view.owner_name]<br>"
-					dat += "<b>Account balance:</b> $[detailed_account_view.money]<br>"
-					if(access_level > 1)
-						dat += "<b><a href='?src=\ref[src];choice=add_funds'>Silently add funds (no transaction log)</a><br>"
-						dat += "<b><a href='?src=\ref[src];choice=remove_funds'>Silently remove funds (no transaction log)</a><br>"
-					dat += "<b><a href='?src=\ref[src];choice=toggle_suspension'>[detailed_account_view.suspended ? "Unsuspend account" : "Suspend account"]</a><br>"
-					dat += "<table border=1 style='width:100%'>"
-					dat += "<tr>"
-					dat += "<td><b>Date</b></td>"
-					dat += "<td><b>Time</b></td>"
-					dat += "<td><b>Target</b></td>"
-					dat += "<td><b>Purpose</b></td>"
-					dat += "<td><b>Value</b></td>"
-					dat += "<td><b>Source terminal ID</b></td>"
-					dat += "</tr>"
-					for(var/datum/transaction/T in detailed_account_view.transaction_log)
-						dat += "<tr>"
-						dat += "<td>[T.date]</td>"
-						dat += "<td>[T.time]</td>"
-						dat += "<td>[T.target_name]</td>"
-						dat += "<td>[T.purpose]</td>"
-						dat += "<td>$[T.amount]</td>"
-						dat += "<td>[T.source_terminal]</td>"
-						dat += "</tr>"
-					dat += "</table>"
-				else
-					dat += "<a href='?src=\ref[src];choice=create_account;'>Create new account</a><br><br>"
-					dat += "<table border=1 style='width:100%'>"
-					for(var/i=1, i<=all_money_accounts.len, i++)
-						var/datum/money_account/D = all_money_accounts[i]
-						dat += "<tr>"
-						dat += "<td>#[D.account_number]</td>"
-						dat += "<td>[D.owner_name]</td>"
-						dat += "<td>[D.suspended ? "SUSPENDED" : ""]</td>"
-						dat += "<td><a href='?src=\ref[src];choice=view_account_detail;account_index=[i]'>View in detail</a></td>"
-						dat += "</tr>"
-					dat += "</table>"
+/obj/machinery/account_database/ui_interact(mob/user, ui_key="main", datum/nanoui/ui=null)
+	user.set_machine(src)
 
-		user << browse(dat,"window=account_db;size=700x650")
-	else
-		user << browse(null,"window=account_db")
+	var/data[0]
+	data["src"] = "\ref[src]"
+	data["id_inserted"] = !!held_card
+	data["id_card"] = held_card ? text("[held_card.registered_name], [held_card.assignment]") : "-----"
+	data["access_level"] = get_access_level()
+	data["machine_id"] = machine_id
+	data["creating_new_account"] = creating_new_account
+	data["detailed_account_view"] = !!detailed_account_view
+	data["station_account_number"] = station_account.account_number
+	data["transactions"] = null
+	data["accounts"] = null
 
-/obj/machinery/account_database/attackby(O as obj, user as mob)//TODO:SANITY
-	if(istype(O, /obj/item/weapon/card))
-		var/obj/item/weapon/card/id/idcard = O
-		if(!held_card)
-			usr.drop_item()
-			idcard.loc = src
-			held_card = idcard
+	if (detailed_account_view)
+		data["account_number"] = detailed_account_view.account_number
+		data["owner_name"] = detailed_account_view.owner_name
+		data["money"] = detailed_account_view.money
+		data["suspended"] = detailed_account_view.suspended
 
-			if(access_cent_captain in idcard.access)
-				access_level = 2
-			else if(access_hop in idcard.access || access_captain in idcard.access)
-				access_level = 1
-	else
-		..()
+		var/list/trx[0]
+		for (var/datum/transaction/T in detailed_account_view.transaction_log)
+			trx.Add(list(list(\
+				"date" = T.date, \
+				"time" = T.time, \
+				"target_name" = T.target_name, \
+				"purpose" = T.purpose, \
+				"amount" = T.amount, \
+				"source_terminal" = T.source_terminal)))
 
-/obj/machinery/account_database/Topic(var/href, var/href_list)
+		if (trx.len > 0)
+			data["transactions"] = trx
+
+	var/list/accounts[0]
+	for(var/i=1, i<=all_money_accounts.len, i++)
+		var/datum/money_account/D = all_money_accounts[i]
+		accounts.Add(list(list(\
+			"account_number"=D.account_number,\
+			"owner_name"=D.owner_name,\
+			"suspended"=D.suspended ? "SUSPENDED" : "",\
+			"account_index"=i)))
+
+	if (accounts.len > 0)
+		data["accounts"] = accounts
+
+	ui = nanomanager.try_update_ui(user, src, ui_key, ui, data)
+	if (!ui)
+		ui = new(user, src, ui_key, "accounts_terminal.tmpl", src.name, 400, 640)
+		ui.set_initial_data(data)
+		ui.open()
+
+/obj/machinery/account_database/Topic(href, href_list)
+	if(..())
+		return 1
+
+	var/datum/nanoui/ui = nanomanager.get_open_ui(usr, src, "main")
 
 	if(href_list["choice"])
 		switch(href_list["choice"])
 			if("create_account")
 				creating_new_account = 1
+
 			if("add_funds")
 				var/amount = input("Enter the amount you wish to add", "Silently add funds") as num
 				if(detailed_account_view)
 					detailed_account_view.money += amount
+
 			if("remove_funds")
 				var/amount = input("Enter the amount you wish to remove", "Silently remove funds") as num
 				if(detailed_account_view)
 					detailed_account_view.money -= amount
+
 			if("toggle_suspension")
 				if(detailed_account_view)
-					if(detailed_account_view.suspended)
-						detailed_account_view.suspended = 0
-					else
-						detailed_account_view.suspended = 1
+					detailed_account_view.suspended = !detailed_account_view.suspended
+					callHook("change_account_status", list(detailed_account_view))
+
 			if("finalise_create_account")
 				var/account_name = href_list["holder_name"]
 				var/starting_funds = max(text2num(href_list["starting_funds"]), 0)
@@ -127,14 +146,11 @@
 					station_account.money -= starting_funds
 
 					//create a transaction log entry
-					var/datum/transaction/T = new()
-					T.target_name = account_name
-					T.purpose = "New account funds initialisation"
-					T.amount = "([starting_funds])"
-					T.date = current_date_string
-					T.time = worldtime2text()
-					T.source_terminal = machine_id
-					station_account.transaction_log.Add(T)
+					var/trx = create_transation(account_name, "New account activation", "([starting_funds])")
+					station_account.transaction_log.Add(trx)
+
+					creating_new_account = 0
+					ui.close()
 
 				creating_new_account = 0
 			if("insert_card")
@@ -144,7 +160,6 @@
 					if(ishuman(usr) && !usr.get_active_hand())
 						usr.put_in_hands(held_card)
 					held_card = null
-					access_level = 0
 
 				else
 					var/obj/item/I = usr.get_active_hand()
@@ -154,16 +169,103 @@
 						C.loc = src
 						held_card = C
 
-						if(access_cent_captain in C.access)
-							access_level = 2
-						else if(access_hop in C.access || access_captain in C.access)
-							access_level = 1
 			if("view_account_detail")
 				var/index = text2num(href_list["account_index"])
 				if(index && index <= all_money_accounts.len)
 					detailed_account_view = all_money_accounts[index]
+
 			if("view_accounts_list")
 				detailed_account_view = null
 				creating_new_account = 0
 
-	src.attack_hand(usr)
+			if("revoke_payroll")
+				var/funds = detailed_account_view.money
+				var/account_trx = create_transation(station_account.owner_name, "Revoke payroll", "([funds])")
+				var/station_trx = create_transation(detailed_account_view.owner_name, "Revoke payroll", funds)
+
+				station_account.money += funds
+				detailed_account_view.money = 0
+
+				detailed_account_view.transaction_log.Add(account_trx)
+				station_account.transaction_log.Add(station_trx)
+
+				callHook("revoke_payroll", list(detailed_account_view))
+
+			if("print")
+				var/text
+				var/obj/item/weapon/paper/P = new(loc)
+				if (detailed_account_view)
+					P.name = "account #[detailed_account_view.account_number] details"
+					var/title = "Account #[detailed_account_view.account_number] Details"
+					text = {"
+						[accounting_letterhead(title)]
+						<u>Holder:</u> [detailed_account_view.owner_name]<br>
+						<u>Balance:</u> $[detailed_account_view.money]<br>
+						<u>Status:</u> [detailed_account_view.suspended ? "Suspended" : "Active"]<br>
+						<u>Transactions:</u> ([detailed_account_view.transaction_log.len])<br>
+						<table>
+							<thead>
+								<tr>
+									<td>Timestamp</td>
+									<td>Target</td>
+									<td>Reason</td>
+									<td>Value</td>
+									<td>Terminal</td>
+								</tr>
+							</thead>
+							<tbody>
+						"}
+
+					for (var/datum/transaction/T in detailed_account_view.transaction_log)
+						text += {"
+									<tr>
+										<td>[T.date] [T.time]</td>
+										<td>[T.target_name]</td>
+										<td>[T.purpose]</td>
+										<td>[T.amount]</td>
+										<td>[T.source_terminal]</td>
+									</tr>
+							"}
+
+					text += {"
+							</tbody>
+						</table>
+						"}
+
+				else
+					P.name = "financial account list"
+					text = {"
+						[accounting_letterhead("Financial Account List")]
+
+						<table>
+							<thead>
+								<tr>
+									<td>Account Number</td>
+									<td>Holder</td>
+									<td>Balance</td>
+									<td>Status</td>
+								</tr>
+							</thead>
+							<tbody>
+					"}
+
+					for(var/i=1, i<=all_money_accounts.len, i++)
+						var/datum/money_account/D = all_money_accounts[i]
+						text += {"
+								<tr>
+									<td>#[D.account_number]</td>
+									<td>[D.owner_name]</td>
+									<td>$[D.money]</td>
+									<td>[D.suspended ? "Suspended" : "Active"]</td>
+								</tr>
+						"}
+
+					text += {"
+							</tbody>
+						</table>
+					"}
+
+				P.info = text
+				state("The terminal prints out a report.")
+
+	return 1

code/modules/mob/living/carbon/brain/brain_item.dm

@@ -32,8 +32,9 @@
 			brainmob.timeofhostdeath = H.timeofdeath
 			if(H.mind)
 				H.mind.transfer_to(brainmob)
+
 			brainmob << "\blue You feel slightly disoriented. That's normal when you're just a brain."
-			return
+			callHook("debrain", list(brainmob))
 
 /obj/item/brain/examine() // -- TLE
 	set src in oview(12)

code/modules/mob/living/carbon/human/death.dm

@@ -86,6 +86,8 @@
 
 		verbs -= /mob/living/carbon/proc/release_control
 
+	callHook("death", list(src, gibbed))
+
 	//Check for heist mode kill count.
 	if(ticker.mode && ( istype( ticker.mode,/datum/game_mode/heist) ) )
 		//Check for last assailant's mutantrace.

code/modules/mob/living/login.dm

@@ -17,41 +17,8 @@
 			if("nuclear emergency")
 				if(mind in ticker.mode:syndicates)
 					ticker.mode.update_all_synd_icons()
+			if("mutiny")
+				var/datum/game_mode/mutiny/mode = get_mutiny_mode()
+				if(mode)
+					mode.update_all_icons()
 	return .
-
-//This stuff needs to be merged from cloning.dm but I'm not in the mood to be shouted at for breaking all the things :< ~Carn
-	/* clones
-	switch(ticker.mode.name)
-		if("revolution")
-			if(src.occupant.mind in ticker.mode:revolutionaries)
-				ticker.mode:update_all_rev_icons() //So the icon actually appears
-			if(src.occupant.mind in ticker.mode:head_revolutionaries)
-				ticker.mode:update_all_rev_icons()
-		if("nuclear emergency")
-			if (src.occupant.mind in ticker.mode:syndicates)
-				ticker.mode:update_all_synd_icons()
-		if("cult")
-			if (src.occupant.mind in ticker.mode:cult)
-				ticker.mode:add_cultist(src.occupant.mind)
-				ticker.mode:update_all_cult_icons() //So the icon actually appears
-	*/
-
-	/*	Plantpeople
-	switch(ticker.mode.name)
-		if ("revolution")
-			if (podman.mind in ticker.mode:revolutionaries)
-				ticker.mode:add_revolutionary(podman.mind)
-				ticker.mode:update_all_rev_icons() //So the icon actually appears
-			if (podman.mind in ticker.mode:head_revolutionaries)
-				ticker.mode:update_all_rev_icons()
-		if ("nuclear emergency")
-			if (podman.mind in ticker.mode:syndicates)
-				ticker.mode:update_all_synd_icons()
-		if ("cult")
-			if (podman.mind in ticker.mode:cult)
-				ticker.mode:add_cultist(podman.mind)
-				ticker.mode:update_all_cult_icons() //So the icon actually appears
-		if ("changeling")
-			if (podman.mind in ticker.mode:changelings)
-				podman.make_changeling()
-	*/

code/modules/mob/mob.dm

@@ -600,6 +600,9 @@ var/list/slot_equipment_priority = list( \
 /mob/proc/is_active()
 	return (0 >= usr.stat)
 
+/mob/proc/is_dead()
+	return stat == DEAD
+
 /mob/proc/see(message)
 	if(!is_active())
 		return 0

code/modules/mob/transform_procs.dm

@@ -181,6 +181,8 @@
 		O.mmi = new /obj/item/device/mmi(O)
 		O.mmi.transfer_identity(src)//Does not transfer key/client.
 
+	callHook("borgify", list(O))
+
 	O.Namepick()
 
 	spawn(0)//To prevent the proc from returning null.

code/modules/security levels/keycard authentication.dm

@@ -154,9 +154,16 @@
 			revoke_maint_all_access()
 			feedback_inc("alert_keycard_auth_maintRevoke",1)
 		if("Emergency Response Team")
-			if(!config.ert_admin_call_only)
-				trigger_armed_response_team(1)
-				feedback_inc("alert_keycard_auth_ert",1)
+			if(is_ert_blocked())
+				usr << "\red All emergency response teams are dispatched and can not be called at this time."
+				return
+
+			trigger_armed_response_team(1)
+			feedback_inc("alert_keycard_auth_ert",1)
+
+/obj/machinery/keycard_auth/proc/is_ert_blocked()
+	if(config.ert_admin_call_only) return 1
+	return ticker.mode && ticker.mode.ert_disabled
 
 var/global/maint_all_access = 0
 

code/setup.dm

@@ -647,19 +647,20 @@ var/list/TAGGERLOCATIONS = list("Disposals",
 
 #define TOGGLES_DEFAULT (SOUND_ADMINHELP|SOUND_MIDI|SOUND_AMBIENCE|SOUND_LOBBY|CHAT_OOC|CHAT_DEAD|CHAT_GHOSTEARS|CHAT_GHOSTSIGHT|CHAT_PRAYER|CHAT_RADIO|CHAT_ATTACKLOGS|CHAT_LOOC)
 
-#define BE_TRAITOR		1
-#define BE_OPERATIVE	2
-#define BE_CHANGELING	4
-#define BE_WIZARD		8
-#define BE_MALF			16
-#define BE_REV			32
-#define BE_ALIEN		64
-#define BE_PAI			128
-#define BE_CULTIST		256
-#define BE_MONKEY		512
-#define BE_NINJA		1024
-#define BE_RAIDER		2048
-#define BE_PLANT		4096
+#define BE_TRAITOR    1
+#define BE_OPERATIVE  2
+#define BE_CHANGELING 4
+#define BE_WIZARD     8
+#define BE_MALF       16
+#define BE_REV        32
+#define BE_ALIEN      64
+#define BE_PAI        128
+#define BE_CULTIST    256
+#define BE_MONKEY     512
+#define BE_NINJA      1024
+#define BE_RAIDER     2048
+#define BE_PLANT      4096
+#define BE_MUTINEER   8192
 
 var/list/be_special_flags = list(
 	"Traitor" = BE_TRAITOR,
@@ -674,7 +675,8 @@ var/list/be_special_flags = list(
 	"Monkey" = BE_MONKEY,
 	"Ninja" = BE_NINJA,
 	"Raider" = BE_RAIDER,
-	"Diona" = BE_PLANT
+	"Diona" = BE_PLANT,
+	"Mutineer" = BE_MUTINEER
 	)
 
 #define AGE_MIN 17			//youngest a character can be

nano/css/shared.css

@@ -70,6 +70,15 @@ a.icon img, .linkOn.icon img, .linkOff.icon img, .selected.icon img, .disabled.i
     width: 18px;
     height: 18px;
 }
+.linkDanger, a.linkDanger:link, a.linkDanger:visited, a.linkDanger:active {
+    color: #ffffff;
+    background-color: #ff0000;
+    border-color: #aa0000;
+}
+.linkDanger:hover {
+    background-color: #ff6666;
+}
+
 ul {
     padding: 4px 0 0 10px;
     margin: 0;

nano/templates/accounts_terminal.tmpl

@@ -0,0 +1,168 @@
+<div class="item">
+  <div class="itemLabelNarrow">
+    <b>Machine</b>:
+  </div>
+  <div class="itemContent">
+    <span class="average">{{:machine_id}}</span>
+  </div>
+</div>
+<div class="item">
+  <div class="itemLabelNarrow">
+    <b>ID</b>:
+  </div>
+  <div class="itemContent">
+    {{:~link(id_card, 'eject', {'choice' : "insert_card"}, null, id_inserted ? 'fixedLeftWidest' : 'fixedLeft')}}
+  </div>
+</div>
+
+{{if access_level > 0}}
+  <div class='item'>
+    <h2>Menu</h2>
+  </div>
+  {{:~link('Home', 'home', {'choice' : 'view_accounts_list'}, !creating_new_account && !detailed_account_view ? 'disabled' : null, 'fixedLeft')}}
+  {{:~link('New Account', 'gear', {'choice' : 'create_account'}, creating_new_account ? 'disabled' : null, 'fixedLeft')}}
+  {{:~link('Print', 'print', {'choice' : 'print'}, creating_new_account ? 'disabled' : null, 'fixedLeft')}}
+
+  {{if creating_new_account}}
+    <div class='item'>
+      <h2>Create Account</h2>
+    </div>
+
+    <form name='create_account' action='?src={{:src}}' method='get'>
+      <input type='hidden' name='src' value='{{:src}}'>
+      <input type='hidden' name='choice' value='finalise_create_account'>
+      <div class='item'>
+        <div class='itemLabel'>
+          <b>Account Holder</b>:
+        </div>
+        <div class='itemContent'>
+          <input type='text' id='holder_name' name='holder_name'>
+        </div>
+      </div>
+      <div class='item'>
+        <div class='itemLabel'>
+          <b>Initial Deposit</b>:
+        </div>
+        <div class='itemContent'>
+          <input type='text' id='starting_funds' name='starting_funds'>
+        </div>
+      </div>
+      <div class='item'>
+        <input type='submit' value='Create'>
+      </div>
+    </form>
+  {{else}}
+    {{if detailed_account_view}}
+      <div class='item'>
+        <h2>Account Details</h2>
+      </div>
+
+      <div class='item'>
+        <div class="itemLabel">
+          <span class='average'><b>Account Number</b>:</span>
+        </div>
+        <div class="itemContent">
+          #{{:account_number}}
+        </div>
+      </div>
+
+      <div class='item'>
+        <div class="itemLabel">
+          <span class='average'><b>Holder</b>:</span>
+        </div>
+        <div class="itemContent">
+          {{:owner_name}}
+        </div>
+      </div>
+
+      <div class='item'>
+        <div class="itemLabel">
+          <span class='average'><b>Balance</b>:</span>
+        </div>
+        <div class="itemContent">
+          ${{:~formatNumber(money)}}
+        </div>
+      </div>
+
+      <div class='item'>
+        <div class="itemLabel">
+          <span class='average'><b>Status</b>:</span>
+        </div>
+        <div class="itemContent">
+          <span class='{{: suspended ? "bad" : "good"}}'>
+            {{: suspended ? "Suspended" : "Active"}}
+          </span>
+        </div>
+      </div>
+      <div class='item'>
+        {{:~link(suspended ? "Unsuspend" : "Suspend", 'gear', {'choice' : 'toggle_suspension'})}}
+      </div>
+
+      <div class="statusDisplay" style="overflow: auto;">
+        {{if transactions}}
+        <table style='width: 100%'>
+          <thead>
+            <tr>
+              <th><b>Timestamp</b></th>
+              <th><b>Target</b></th>
+              <th><b>Reason</b></th>
+              <th><b>Value</b></th>
+              <th><b>Terminal</b></th>
+            </th>
+          </thead>
+          <tbody>
+              {{for transactions}}
+                <tr>
+                    <td>{{:date}} {{:time}}</td>
+                    <td>{{:target_name}}</td>
+                    <td>{{:purpose}}</td>
+                    <td>{{:amount}}</td>
+                    <td>{{:source_terminal}}</td>
+                </tr>
+              {{/for}}
+          </tbody>
+        </table>
+        {{else}}
+          <span class='alert'>This account has no financial transactions on record for today.</span>
+        {{/if}}
+      </div>
+
+        <div class='item'>
+          <h2>CentCom Administrator</h2>
+        </div>
+        <div class='item'>
+          <div class='fixedLeft'>
+            Payroll:
+          </div>
+          {{:~link('Revoke', 'transferthick-e-w', {'choice' : 'revoke_payroll'}, account_number == station_account_number ? 'disabled' : null, 'linkDanger')}}
+        </div>
+        {{if access_level >= 2}}
+        <div class='item'>
+          <div class='fixedLeft'>
+            Silent Fund Adjustment:
+          </div>
+          {{:~link('Add', 'plus', {'choice' : 'add_funds'})}}
+          {{:~link('Remove', 'minus', {'choice' : 'remove_funds'})}}
+        </div>
+        {{/if}}
+    {{else}}
+
+      <div class='item'>
+        <h2>NanoTrasen Accounts</h2>
+      </div>
+      {{if accounts}}
+        <table style="width: 100%">
+          {{for accounts}}
+            <tr class='{{: suspended ? "bad" : ""}}'>
+              <td><b>{{:~link('#' + account_number, '', {'choice' : 'view_account_detail', 'account_index' : account_index})}}</b></td>
+              <td>{{:owner_name}}</td>
+              <td>{{:suspended}}</td>
+            </tr>
+          {{/for}}
+        </table>
+      {{else}}
+        <span class='alert'>There are no accounts available.</span>
+      {{/if}}
+    {{/if}}
+  {{/if}}
+{{/if}}

nano/templates/identification_computer.tmpl

@@ -0,0 +1,236 @@
+{{if printing}}
+  <h5 class='average'>The computer is currently busy.</h5>
+  <div class='notice'>
+    <center><span class='bad'>Printing...</span></center>
+  </div>
+  <p>
+    Thank you for your patience!
+  </p>
+{{else}}
+  {{:~link('Access Modification', 'home', {'choice' : 'mode', 'mode_target' : 0}, !mode ? 'disabled' : null)}}
+  {{:~link('Crew Manifest', 'folder-open', {'choice' : 'mode', 'mode_target' : 1}, mode ? 'disabled' : null)}}
+  {{:~link('Print', 'print', {'choice' : 'print'}, (mode || has_modify) ? null : 'disabled')}}
+
+  {{if mode}}
+    <div class='item'>
+      <h2>Crew Manifest</h2>
+    </div>
+    <div class='item'>
+      {{:manifest}}
+    </div>
+  {{else}}
+    <div class='item'>
+      <h2>Access Modification</h2>
+    </div>
+
+    {{if !authenticated}}
+      <span class='alert'><i>Please insert the IDs into the terminal to proceed.</i></span><br>
+    {{/if}}
+
+    <div class='item'>
+      <div class='itemLabel'>
+        Target Identity:
+      </div>
+      <div class='itemContent'>
+        {{:~link(target_name, 'eject', {'choice' : 'modify'})}}
+      </div>
+    </div>
+    <div class='item'>
+      <div class='itemLabel'>
+        Authorized Identity:
+      </div>
+      <div class='itemContent'>
+        {{:~link(scan_name, 'eject', {'choice' : 'scan'})}}
+      </div>
+    </div>
+    <hr>
+
+    {{if authenticated}}
+      <script type="text/javascript">
+        function markRed(){
+          var nameField = document.getElementById('namefield');
+          nameField.style.backgroundColor = "#FFDDDD";
+        }
+        function markGreen(){
+          var nameField = document.getElementById('namefield');
+          nameField.style.backgroundColor = "#DDFFDD";
+        }
+        function markAccountGreen(){
+          var nameField = document.getElementById('accountfield');
+          nameField.style.backgroundColor = "#DDFFDD";
+        }
+        function markAccountRed(){
+          var nameField = document.getElementById('accountfield');
+          nameField.style.backgroundColor = "#FFDDDD";
+        }
+        function showAll(){
+          var allJobsSlot = document.getElementById('alljobsslot');
+          allJobsSlot.innerHTML = "<a href='#' onclick='hideAll()'>Hide</a><br>";
+          var allJobs = document.getElementById('all-jobs');
+          allJobs.style.display = 'block';
+        }
+        function hideAll(){
+          var allJobsSlot = document.getElementById('alljobsslot');
+          allJobsSlot.innerHTML = "<a href='#' onclick='showAll()'>{{:target_rank}}</a>";
+          var allJobs = document.getElementById('all-jobs');
+          allJobs.style.display = 'none';
+        }
+      </script>
+
+      {{if has_modify}}
+        <div class='item'>
+          <h2>Details</h2>
+        </div>
+
+        <form name='cardcomp' action='?src={{:src}}' method='get'>
+          <div class='item'>
+            <div class='itemLabel'>
+              <input type='hidden' name='src' value='{{:src}}'>
+              <input type='hidden' name='choice' value='reg'>
+              Registered Name:
+            </div>
+            <div class='itemContent'>
+              <input type='text' id='namefield' name='reg' value='{{:target_owner}}' onchange='markRed()'>
+              <input type='submit' value='Rename' onclick='markGreen()'>
+            </div>
+          </div>
+        </form>
+
+        <form name='accountnum' action='?src={{:src}}' method='get'>
+          <div class='item'>
+            <div class='itemLabel'>
+              <input type='hidden' name='src' value='{{:src}}'>
+              <input type='hidden' name='choice' value='account'>
+              Account Number:
+            </div>
+            <div class='itemContent'>
+              <input type='text' id='accountfield' name='account' value='{{:account_number}}' onchange='markAccountRed()'>
+              <input type='submit' value='Modify' onclick='markAccountGreen()'>
+            </div>
+          </div>
+        </form>
+
+        <div class='item'>
+          <div class='itemLabel'>
+            Terminations:
+          </div>
+          <div class='itemContent'>
+            {{:~link('Terminate ' + target_owner, 'gear', {'choice' : 'terminate'}, target_rank == "Terminated" ? 'disabled' : null, target_rank == "Terminated" ? 'disabled' : 'linkDanger')}}
+          </div>
+        </div>
+
+        <div class='item'>
+          <h2>Assignment</h2>
+        </div>
+
+        <div class='item'>
+          <span id='alljobsslot'>
+            <a href='#' onclick='showAll()'>{{:target_rank}}</a>
+          </span>
+        </div>
+        <div class='item'>
+          <div id="all-jobs" style='display: none;'>
+            <table>
+              <tr>
+                <th></th><th>Command</th>
+              </tr>
+              <tr>
+                <th>Special</th>
+                <td>
+                  {{:~link("Captain", '', {'choice' : 'assign', 'assign_target' : 'Captain'}, target_rank == 'Captain' ? 'disabled' : null)}}
+                  {{:~link("Custom", '', {'choice' : 'assign', 'assign_target' : 'Custom'})}}
+                </td>
+              </tr>
+              <tr>
+                <th style="color: '#FFA500';">Engineering</th>
+                <td>
+                  {{for engineering_jobs}}
+                    {{:~link(display_name, '', {'choice' : 'assign', 'assign_target' : job}, target_rank == job ? 'disabled' : null)}}
+                  {{/for}}
+                </td>
+              </tr>
+              <tr>
+                <th style="color: '#008000';">Medical</th>
+                <td>
+                  {{for medical_jobs}}
+                    {{:~link(display_name, '', {'choice' : 'assign', 'assign_target' : job}, target_rank == job ? 'disabled' : null)}}
+                  {{/for}}
+                </td>
+              </tr>
+              <tr>
+                <th style="color: '#800080';">Science</th>
+                <td>
+                  {{for science_jobs}}
+                    {{:~link(display_name, '', {'choice' : 'assign', 'assign_target' : job}, target_rank == job ? 'disabled' : null)}}
+                  {{/for}}
+                </td>
+              </tr>
+              <tr>
+                <th style="color: '#DD0000';">Security</th>
+                <td>
+                  {{for security_jobs}}
+                    {{:~link(display_name, '', {'choice' : 'assign', 'assign_target' : job}, target_rank == job ? 'disabled' : null)}}
+                  {{/for}}
+                </td>
+              </tr>
+              <tr>
+                <th style="color: '#808080';">Civilian</th>
+                <td>
+                  {{for civilian_jobs}}
+                    {{if #index && #index % 6 === 0}}
+                      </td></tr><tr><th></th><td>
+                    {{/if}}
+                    {{:~link(display_name, '', {'choice' : 'assign', 'assign_target' : job}, target_rank == job ? 'disabled' : null)}}
+                  {{/for}}
+                </td>
+              </tr>
+              {{if centcom_access}}
+                <tr>
+                  <th style="color: '#A52A2A';">CentCom</th>
+                  <td>
+                    {{for centcom_jobs}}
+                      {{if #index % 6 === 0}}
+                        </td></tr><tr><th></th><td>
+                      {{/if}}
+
+                      {{:~link(display_name, '', {'choice' : 'assign', 'assign_target' : job}, target_rank == job ? 'disabled' : null)}}
+                    {{/for}}
+                  </td>
+                </tr>
+              {{/if}}
+            </table>
+          </div>
+        </div>
+
+        {{if centcom_access}}
+          <div class='item'>
+            <h2>Central Command</h2>
+          </div>
+          <div class='item' style='width: 100%'>
+            {{for all_centcom_access}}
+              <div class='itemContentWide'>
+              {{:~link(desc, '', {'choice' : 'access', 'access_target' : ref, 'allowed' : allowed}, null, allowed ? 'selected' : null)}}
+              </div>
+            {{/for}}
+          </div>
+        {{else}}
+          <div class='item'>
+            <h2>{{:station_name}}</h2>
+          </div>
+          <div class='item' style='width: 100%'>
+            {{for regions}}
+              <div style='float: left; width: 175px; min-height: 250px'>
+                <div class='average'><b>{{:name}}</b></div>
+                {{for accesses}}
+                  <div class='itemContentWide'>
+                    {{:~link(desc, '', {'choice' : 'access', 'access_target' : ref, 'allowed' : allowed}, null, allowed ? 'selected' : null)}}
+                  </div>
+                {{/for}}
+              </div>
+            {{/for}}
+          </div>
+        {{/if}}
+      {{/if}}
+    {{/if}}
+  {{/if}}
+{{/if}}