Files
CHOMPStation2/code/controllers/shuttle_controller_vr.dm
Arokha Sieyes 35bcf1602a Tether Shuttle Crashing
Woooooo
2017-05-17 01:12:03 -04:00

211 lines
8.3 KiB
Plaintext

var/global/datum/shuttle_controller/shuttle_controller
/datum/shuttle_controller
var/list/shuttles //maps shuttle tags to shuttle datums, so that they can be looked up.
var/list/process_shuttles //simple list of shuttles, for processing
/datum/shuttle_controller/proc/process()
//process ferry shuttles
for (var/datum/shuttle/ferry/shuttle in process_shuttles)
if (shuttle.process_state)
shuttle.process()
//This is called by gameticker after all the machines and radio frequencies have been properly initialized
/datum/shuttle_controller/proc/setup_shuttle_docks()
for(var/shuttle_tag in shuttles)
var/datum/shuttle/shuttle = shuttles[shuttle_tag]
shuttle.init_docking_controllers()
shuttle.dock() //makes all shuttles docked to something at round start go into the docked state
for(var/obj/machinery/embedded_controller/C in machines)
if(istype(C.program, /datum/computer/file/embedded_program/docking))
C.program.tag = null //clear the tags, 'cause we don't need 'em anymore
/datum/shuttle_controller/New()
shuttles = list()
process_shuttles = list()
var/datum/shuttle/ferry/shuttle
//////////////////////////////////////////////////////////////
// Escape shuttle and pods
shuttle = new/datum/shuttle/ferry/emergency()
shuttle.location = 1 // At offsite
shuttle.warmup_time = 10
shuttle.area_offsite = locate(/area/shuttle/escape/centcom)
shuttle.area_station = locate(/area/shuttle/escape/station)
shuttle.area_transition = locate(/area/shuttle/escape/transit)
shuttle.docking_controller_tag = "escape_shuttle"
shuttle.dock_target_station = "escape_dock"
shuttle.dock_target_offsite = "centcom_dock"
shuttle.move_time = SHUTTLE_TRANSIT_DURATION_RETURN
shuttles["Escape"] = shuttle
process_shuttles += shuttle
//////////////////////////////////////////////////////////////
shuttle = new/datum/shuttle/ferry/escape_pod()
shuttle.location = 0 // At station
shuttle.warmup_time = 0
shuttle.area_station = locate(/area/shuttle/large_escape_pod1/station)
shuttle.area_offsite = locate(/area/shuttle/large_escape_pod1/centcom)
shuttle.area_transition = locate(/area/shuttle/large_escape_pod1/transit)
shuttle.docking_controller_tag = "large_escape_pod_1"
shuttle.dock_target_station = "large_escape_pod_1_berth"
shuttle.move_time = SHUTTLE_TRANSIT_DURATION_RETURN + rand(-30, 60) //randomize this so it seems like the pods are being picked up one by one
process_shuttles += shuttle
shuttles["Large Escape Pod 1"] = shuttle
//////////////////////////////////////////////////////////////
shuttle = new/datum/shuttle/ferry/escape_pod()
shuttle.location = 0 // At station
shuttle.warmup_time = 0
shuttle.area_station = locate(/area/shuttle/large_escape_pod2/station)
shuttle.area_offsite = locate(/area/shuttle/large_escape_pod2/centcom)
shuttle.area_transition = locate(/area/shuttle/large_escape_pod2/transit)
shuttle.docking_controller_tag = "large_escape_pod_2"
shuttle.dock_target_station = "large_escape_pod_2_berth"
shuttle.move_time = SHUTTLE_TRANSIT_DURATION_RETURN + rand(-30, 60) //randomize this so it seems like the pods are being picked up one by one
process_shuttles += shuttle
shuttles["Large Escape Pod 2"] = shuttle
//give the emergency shuttle controller it's shuttles
emergency_shuttle.shuttle = shuttles["Escape"]
emergency_shuttle.escape_pods = list(
shuttles["Large Escape Pod 1"],
shuttles["Large Escape Pod 2"],
)
//////////////////////////////////////////////////////////////
// Supply shuttle
shuttle = new/datum/shuttle/ferry/supply()
shuttle.location = 1
shuttle.warmup_time = 10
shuttle.area_offsite = locate(/area/supply/dock)
shuttle.area_station = locate(/area/supply/station)
shuttle.docking_controller_tag = "supply_shuttle"
shuttle.dock_target_station = "cargo_bay"
shuttles["Supply"] = shuttle
process_shuttles += shuttle
supply_controller.shuttle = shuttle
//////////////////////////////////////////////////////////////
// Trade Ship
shuttle = new()
shuttle.location = 1
shuttle.warmup_time = 10 //want some warmup time so people can cancel.
shuttle.area_offsite = locate(/area/shuttle/trade/centcom)
shuttle.area_station = locate(/area/shuttle/trade/station)
shuttle.docking_controller_tag = "trade_shuttle"
shuttle.dock_target_station = "trade_shuttle_dock_airlock"
shuttle.dock_target_offsite = "trade_shuttle_bay"
shuttles["Trade"] = shuttle
process_shuttles += shuttle
//////////////////////////////////////////////////////////////
// Away Mission Shuttle
var/datum/shuttle/multi_shuttle/AM = new/datum/shuttle/multi_shuttle()
AM.legit = 1
AM.origin = locate(/area/shuttle/awaymission/home)
AM.start_location = "NSS Adephagia (AM)"
AM.destinations = list(
"Old Engineering Base (AM)" = locate(/area/shuttle/awaymission/oldengbase)
)
AM.docking_controller_tag = "awaymission_shuttle"
AM.destination_dock_targets = list(
"NSS Adephagia (AM)" = "d1a2_dock_airlock"
)
var/area/awaym_dest = locate(/area/shuttle/awaymission/away)
if(awaym_dest.contents.len) //Otherwise this is an empty imaginary area
AM.destinations["Unknown Location [rand(1000,9999)]"] = awaym_dest
AM.announcer = "Automated Traffic Control"
//These seem backwards because they are written from the perspective of the merc and vox ships
AM.departure_message = "Attention. The away mission vessel is approaching the colony."
AM.arrival_message = "Attention. The away mission vessel is now leaving from the colony."
AM.interim = locate(/area/shuttle/awaymission/warp)
AM.move_time = 60
AM.warmup_time = 8
shuttles["AwayMission"] = AM
// TODO - Not implemented yet on new map
///////////////////////////////////////////////
//VOREStation Add - Belter Shuttle
// shuttle = new/datum/shuttle/ferry()
// shuttle.location = 0
// shuttle.warmup_time = 6
// shuttle.area_station = locate(/area/shuttle/belter/station)
// shuttle.area_offsite = locate(/area/shuttle/belter/belt/zone1)
// shuttle.area_transition = locate(/area/shuttle/belter/transit)
// shuttle.docking_controller_tag = "belter_docking"
// shuttle.dock_target_station = "belter_nodocking" //Fake tags to prevent the shuttle from opening doors.
// shuttle.dock_target_offsite = "belter_nodocking"
// shuttle.transit_direction = EAST
// shuttle.move_time = 60 + rand(10,40)
// process_shuttles += shuttle
// shuttles["Belter"] = shuttle
//VOREStation Add End - Belter Shuttle
//////////////////////////////////////////////////////////////
// Tether Shuttle
var/datum/shuttle/ferry/tether_backup/TB = new()
TB.location = 1 // At offsite
TB.warmup_time = 5
TB.move_time = 45
TB.area_offsite = locate(/area/shuttle/tether/surface)
TB.area_station = locate(/area/shuttle/tether/station)
TB.area_transition = locate(/area/shuttle/tether/transit)
TB.crash_areas = list(locate(/area/shuttle/tether/crash1), locate(/area/shuttle/tether/crash2))
TB.docking_controller_tag = "tether_shuttle"
TB.dock_target_station = "tether_dock_airlock"
TB.dock_target_offsite = "tether_pad_airlock"
shuttles["Tether Backup"] = TB
process_shuttles += TB
for(var/obj/structure/shuttle/engine/propulsion/E in TB.area_offsite)
TB.engines += E
for(var/obj/machinery/computer/shuttle_control/tether_backup/comp in TB.area_offsite)
TB.computer = comp
break
//////////////////////////////////////////////////////////////
// Antag Space "Proto Shuttle" Shuttle
AM = new/datum/shuttle/multi_shuttle()
AM.docking_controller_tag = "antag_space_shuttle"
AM.start_location = "Home Base"
AM.origin = locate(/area/shuttle/antag_space/base)
AM.interim = locate(/area/shuttle/antag_space/transit)
AM.destinations = list(
"Nearby" = locate(/area/shuttle/antag_space/north),
"Docks" = locate(/area/shuttle/antag_space/docks)
)
AM.destination_dock_targets = list("Home Base" = "antag_space_dock")
AM.move_time = 60
AM.warmup_time = 8
shuttles["Proto"] = AM
//////////////////////////////////////////////////////////////
// Antag Surface "Land Crawler" Shuttle
AM = new/datum/shuttle/multi_shuttle()
AM.docking_controller_tag = "antag_ground_shuttle"
AM.start_location = "Home Base"
AM.origin = locate(/area/shuttle/antag_ground/base)
AM.interim = locate(/area/shuttle/antag_ground/transit)
AM.destinations = list(
"Solar Array" = locate(/area/shuttle/antag_ground/solars),
"Mining Outpost" = locate(/area/shuttle/antag_ground/mining)
)
AM.destination_dock_targets = list("Home Base" = "antag_ground_dock")
AM.move_time = 60
AM.warmup_time = 8
shuttles["Land Crawler"] = AM