Merge remote-tracking branch 'Upstream/master' into TGUI-3.0

_maps/RandomRuins/SpaceRuins/cloning_facility.dmm

@@ -69,7 +69,7 @@
 /turf/open/floor/plasteel/white,
 /area/ruin/space/has_grav/powered/ancient_shuttle)
 "j" = (
-/obj/machinery/computer/prototype_cloning,
+/obj/machinery/computer/cloning/prototype,
 /obj/machinery/light{
 	dir = 1
 	},

code/game/machinery/cloning.dm

@@ -109,7 +109,7 @@
 /obj/machinery/clonepod/attack_ai(mob/user)
 	return examine(user)
 
-//Start growing a clone in the pod!
+//Start growing a human clone in the pod!
 /obj/machinery/clonepod/proc/growclone(ckey, clonename, ui, mutation_index, mindref, blood_type, datum/species/mrace, list/features, factions, list/quirks, datum/bank_account/insurance, list/traumas)
 	if(panel_open)
 		return FALSE

code/game/machinery/computer/cloning.dm

@@ -8,6 +8,7 @@
 	circuit = /obj/item/circuitboard/computer/cloning
 	req_access = list(ACCESS_HEADS) //ONLY USED FOR RECORD DELETION RIGHT NOW.
 	var/obj/machinery/dna_scannernew/scanner = null //Linked scanner. For scanning.
+	var/clonepod_type = /obj/machinery/clonepod
 	var/list/pods //Linked cloning pods
 	var/temp = "Inactive"
 	var/scantemp_ckey
@@ -17,6 +18,7 @@
 	var/obj/item/disk/data/diskette = null //Mostly so the geneticist can steal everything.
 	var/loading = 0 // Nice loading text
 	var/autoprocess = 0
+	var/use_records = TRUE // Old experimental cloner.
 	var/list/records = list()
 
 	light_color = LIGHT_COLOR_BLUE
@@ -36,29 +38,32 @@
 	return ..()
 
 /obj/machinery/computer/cloning/proc/GetAvailablePod(mind = null)
-	if(pods)
-		for(var/P in pods)
-			var/obj/machinery/clonepod/pod = P
-			if(pod.occupant && pod.clonemind == mind)
-				return null
-			if(pod.is_operational() && !(pod.occupant || pod.mess))
-				return pod
+	if(!pods)
+		return
+	for(var/P in pods)
+		var/obj/machinery/clonepod/pod = P
+		if(pod.occupant && pod.get_clone_mind == CLONEPOD_GET_MIND && pod.clonemind == mind)
+			return null
+		if(pod.is_operational() && !(pod.occupant || pod.mess))
+			return pod
 
 /obj/machinery/computer/cloning/proc/HasEfficientPod()
-	if(pods)
-		for(var/P in pods)
-			var/obj/machinery/clonepod/pod = P
-			if(pod.is_operational() && pod.efficiency > 5)
-				return TRUE
+	if(!pods)
+		return
+	for(var/P in pods)
+		var/obj/machinery/clonepod/pod = P
+		if(pod.is_operational() && pod.efficiency > 5)
+			return TRUE
 
 /obj/machinery/computer/cloning/proc/GetAvailableEfficientPod(mind = null)
-	if(pods)
-		for(var/P in pods)
-			var/obj/machinery/clonepod/pod = P
-			if(pod.occupant && pod.clonemind == mind)
-				return pod
-			else if(!. && pod.is_operational() && !(pod.occupant || pod.mess) && pod.efficiency > 5)
-				. = pod
+	if(!pods)
+		return
+	for(var/P in pods)
+		var/obj/machinery/clonepod/pod = P
+		if(pod.occupant && pod.clonemind == mind)
+			return pod
+		else if(!. && pod.is_operational() && !(pod.occupant || pod.mess) && pod.efficiency > 5)
+			. = pod
 
 /obj/machinery/computer/cloning/process()
 	if(!(scanner && LAZYLEN(pods) && autoprocess))
@@ -73,7 +78,7 @@
 		if(pod.occupant)
 			continue	//how though?
 
-		if(pod.growclone(R.fields["ckey"], R.fields["name"], R.fields["UI"], R.fields["SE"], R.fields["mind"], R.fields["mrace"], R.fields["features"], R.fields["factions"], R.fields["quirks"], R.fields["bank_account"], R.fields["traumas"]))
+		if(pod.growclone(R.fields["ckey"], R.fields["name"], R.fields["UI"], R.fields["SE"], R.fields["mind"], R.fields["blood_type"], R.fields["mrace"], R.fields["features"], R.fields["factions"], R.fields["quirks"], R.fields["bank_account"], R.fields["traumas"]))
 			temp = "[R.fields["name"]] => <font class='good'>Cloning cycle in progress...</font>"
 			records -= R
 
@@ -103,12 +108,10 @@
 	return null
 
 /obj/machinery/computer/cloning/proc/findcloner()
-	var/obj/machinery/clonepod/podf = null
-
+	var/obj/machinery/clonepod/podf
 	for(var/direction in GLOB.cardinals)
-
-		podf = locate(/obj/machinery/clonepod, get_step(src, direction))
-		if (!isnull(podf) && podf.is_operational())
+		podf = locate(clonepod_type, get_step(src, direction))
+		if(podf?.is_operational())
 			AttachCloner(podf)
 
 /obj/machinery/computer/cloning/proc/AttachCloner(obj/machinery/clonepod/pod)
@@ -132,7 +135,7 @@
 	else if(istype(W, /obj/item/multitool))
 		var/obj/item/multitool/P = W
 
-		if(istype(P.buffer, /obj/machinery/clonepod))
+		if(istype(P.buffer, clonepod_type))
 			if(get_area(P.buffer) != get_area(src))
 				to_chat(user, "<font color = #666633>-% Cannot link machines across power zones. Buffer cleared %-</font color>")
 				P.buffer = null
@@ -157,13 +160,14 @@
 	var/dat = ""
 	dat += "<a href='byond://?src=[REF(src)];refresh=1'>Refresh</a>"
 
-	if(scanner && HasEfficientPod() && scanner.scan_level >= AUTOCLONING_MINIMAL_LEVEL)
-		if(!autoprocess)
-			dat += "<a href='byond://?src=[REF(src)];task=autoprocess'>Autoclone</a>"
+	if(use_records)
+		if(scanner && HasEfficientPod() && scanner.scan_level >= AUTOCLONING_MINIMAL_LEVEL)
+			if(!autoprocess)
+				dat += "<a href='byond://?src=[REF(src)];task=autoprocess'>Autoclone</a>"
+			else
+				dat += "<a href='byond://?src=[REF(src)];task=stopautoprocess'>Stop autoclone</a>"
 		else
-			dat += "<a href='byond://?src=[REF(src)];task=stopautoprocess'>Stop autoclone</a>"
-	else
-		dat += "<span class='linkOff'>Autoclone</span>"
+			dat += "<span class='linkOff'>Autoclone</span>"
 	dat += "<h3>Cloning Pod Status</h3>"
 	dat += "<div class='statusDisplay'>[temp]&nbsp;</div>"
 
@@ -190,26 +194,29 @@
 				else if(loading)
 					dat += "[scanner_occupant] => Scanning..."
 				else
-					if(scanner_occupant.ckey != scantemp_ckey)
-						scantemp = "Ready to Scan"
-						scantemp_ckey = scanner_occupant.ckey
+					if(use_records)
+						if(scanner_occupant.ckey != scantemp_ckey)
+							scantemp = "Ready to Scan"
+							scantemp_ckey = scanner_occupant.ckey
+					else
+						scantemp = "Ready to Clone"
 					dat += "[scanner_occupant] => [scantemp]"
 				dat += "</div>"
 
 				if(scanner_occupant)
-					dat += "<a href='byond://?src=[REF(src)];scan=1'>Start Scan</a>"
-					dat += "<br><a href='byond://?src=[REF(src)];lock=1'>[src.scanner.locked ? "Unlock Scanner" : "Lock Scanner"]</a>"
+					dat += "<a href='byond://?src=[REF(src)];scan=1'>[use_records ? "Start Scan" : "Clone"]</a>"
+					dat += "<br><a href='byond://?src=[REF(src)];lock=1'>[scanner.locked ? "Unlock Scanner" : "Lock Scanner"]</a>"
 				else
-					dat += "<span class='linkOff'>Start Scan</span>"
-
-			// Database
-			dat += "<h3>Database Functions</h3>"
-			if (src.records.len && src.records.len > 0)
-				dat += "<a href='byond://?src=[REF(src)];menu=2'>View Records ([src.records.len])</a><br>"
-			else
-				dat += "<span class='linkOff'>View Records (0)</span><br>"
-			if (src.diskette)
-				dat += "<a href='byond://?src=[REF(src)];disk=eject'>Eject Disk</a><br>"
+					dat += "<span class='linkOff'>[use_records ? "Start Scan" : "Clone"]</span>"
+			if(use_records)
+				// Database
+				dat += "<h3>Database Functions</h3>"
+				if (src.records.len && src.records.len > 0)
+					dat += "<a href='byond://?src=[REF(src)];menu=2'>View Records ([src.records.len])</a><br>"
+				else
+					dat += "<span class='linkOff'>View Records (0)</span><br>"
+				if (src.diskette)
+					dat += "<a href='byond://?src=[REF(src)];disk=eject'>Eject Disk</a><br>"
 
 
 
@@ -290,24 +297,19 @@
 				autoprocess = FALSE
 				STOP_PROCESSING(SSmachines, src)
 				playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+		. = TRUE
 
 	else if ((href_list["scan"]) && !isnull(scanner) && scanner.is_operational())
 		scantemp = ""
 
-		loading = 1
+		loading = TRUE
 		src.updateUsrDialog()
 		playsound(src, 'sound/machines/terminal_prompt.ogg', 50, 0)
 		say("Initiating scan...")
 		var/prev_locked = scanner.locked
 		scanner.locked = TRUE
-		spawn(20)
-			src.scan_occupant(scanner.occupant)
-
-			loading = 0
-			src.updateUsrDialog()
-			playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
-			scanner.locked = prev_locked
-
+		addtimer(CALLBACK(src, .proc/finish_scan, scanner.occupant, prev_locked), 2 SECONDS)
+		. = TRUE
 
 		//No locking an open scanner.
 	else if ((href_list["lock"]) && !isnull(scanner) && scanner.is_operational())
@@ -317,8 +319,17 @@
 		else
 			scanner.locked = FALSE
 			playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
+		. = TRUE
 
-	else if(href_list["view_rec"])
+
+	else if (href_list["refresh"])
+		src.updateUsrDialog()
+		playsound(src, "terminal_type", 25, 0)
+		. = TRUE
+
+	if(. || !use_records)
+		return
+	if(href_list["view_rec"])
 		playsound(src, "terminal_type", 25, 0)
 		src.active_record = find_record("id", href_list["view_rec"], records)
 		if(active_record)
@@ -330,6 +341,7 @@
 				src.menu = 3
 		else
 			src.temp = "Record missing."
+		. = TRUE
 
 	else if (href_list["del_rec"])
 		if ((!src.active_record) || (src.menu < 3))
@@ -353,8 +365,9 @@
 				else
 					src.temp = "<font class='bad'>Access Denied.</font>"
 					playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+		. = TRUE
 
-	else if (href_list["disk"]) //Load or eject.
+	else if (href_list["disk"] && use_records) //Load or eject.
 		switch(href_list["disk"])
 			if("load")
 				if (!diskette || !istype(diskette.fields) || !diskette.fields["name"] || !diskette.fields)
@@ -392,10 +405,7 @@
 				diskette.name = "data disk - '[src.diskette.fields["name"]]'"
 				src.temp = "Save successful."
 				playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
-
-	else if (href_list["refresh"])
-		src.updateUsrDialog()
-		playsound(src, "terminal_type", 25, 0)
+		. = TRUE
 
 	else if (href_list["clone"])
 		var/datum/data/record/C = find_record("id", href_list["clone"], records)
@@ -415,7 +425,7 @@
 			else if(pod.occupant)
 				temp = "<font class='bad'>Cloning cycle already in progress.</font>"
 				playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-			else if(pod.growclone(C.fields["ckey"], C.fields["name"], C.fields["UI"], C.fields["SE"], C.fields["mind"], C.fields["mrace"], C.fields["features"], C.fields["factions"], C.fields["quirks"], C.fields["bank_account"]))
+			else if(pod.growclone(C.fields["ckey"], C.fields["name"], C.fields["UI"], C.fields["SE"], C.fields["mind"], C.fields["blood_type"], C.fields["mrace"], C.fields["features"], C.fields["factions"], C.fields["quirks"], C.fields["bank_account"], C.fields["traumas"]))
 				temp = "[C.fields["name"]] => <font class='good'>Cloning cycle in progress...</font>"
 				playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
 				records.Remove(C)
@@ -429,14 +439,28 @@
 		else
 			temp = "<font class='bad'>Data corruption.</font>"
 			playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+		. = TRUE
 
-	else if (href_list["menu"])
-		src.menu = text2num(href_list["menu"])
+	else if (href_list["menu"] && use_records)
+		menu = text2num(href_list["menu"])
 		playsound(src, "terminal_type", 25, 0)
+		. = TRUE
 
+/obj/machinery/computer/cloning/proc/finish_scan(mob/living/L, prev_locked)
+	if(!scanner || !L)
+		return
 	src.add_fingerprint(usr)
 	src.updateUsrDialog()
-	return
+
+	if(use_records)
+		scan_occupant(L)
+	else
+		clone_occupant(L)
+
+	loading = FALSE
+	src.updateUsrDialog()
+	playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
+	scanner.locked = prev_locked
 
 /obj/machinery/computer/cloning/proc/scan_occupant(occupant)
 	var/mob/living/mob_occupant = get_mob_or_brainmob(occupant)
@@ -455,30 +479,9 @@
 	if(isbrain(mob_occupant))
 		dna = B.stored_dna
 
-	if(!istype(dna))
-		scantemp = "<font class='bad'>Unable to locate valid genetic data.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-		return
-	if(mob_occupant.suiciding || mob_occupant.hellbound)
-		scantemp = "<font class='bad'>Subject's brain is not responding to scanning stimuli.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-		return
-	if((HAS_TRAIT(mob_occupant, TRAIT_NOCLONE)) && (src.scanner.scan_level < 2))
-		scantemp = "<font class='bad'>Subject no longer contains the fundamental materials required to create a living clone.</font>"
-		playsound(src, 'sound/machines/terminal_alert.ogg', 50, 0)
-		return
-	if ((!mob_occupant.ckey) || (!mob_occupant.client))
-		scantemp = "<font class='bad'>Mental interface failure.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-		return
-	if (find_record("ckey", mob_occupant.ckey, records))
-		scantemp = "<font class='average'>Subject already in database.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-		return
-	if(SSeconomy.full_ancap && !has_bank_account)
-		scantemp = "<font class='average'>Subject is either missing an ID card with a bank account on it, or does not have an account to begin with. Please ensure the ID card is on the body before attempting to scan.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+	if(!can_scan(dna, mob_occupant, FALSE, has_bank_account))
 		return
+
 	var/datum/data/record/R = new()
 	if(dna.species)
 		// We store the instance rather than the path, because some
@@ -529,3 +532,78 @@
 	board.records = records
 	scantemp = "Subject successfully scanned."
 	playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
+
+//Used by the experimental cloning computer.
+/obj/machinery/computer/cloning/proc/clone_occupant(occupant)
+	var/mob/living/mob_occupant = get_mob_or_brainmob(occupant)
+	var/datum/dna/dna
+	if(ishuman(mob_occupant))
+		var/mob/living/carbon/C = mob_occupant
+		dna = C.has_dna()
+	if(isbrain(mob_occupant))
+		var/mob/living/brain/B = mob_occupant
+		dna = B.stored_dna
+
+	if(!can_scan(dna, mob_occupant, TRUE))
+		return
+
+	var/clone_species
+	if(dna.species)
+		clone_species = dna.species
+	else
+		var/datum/species/rando_race = pick(GLOB.roundstart_races)
+		clone_species = rando_race.type
+
+	var/obj/machinery/clonepod/pod = GetAvailablePod()
+	//Can't clone without someone to clone.  Or a pod.  Or if the pod is busy. Or full of gibs.
+	if(!LAZYLEN(pods))
+		temp = "<font class='bad'>No Clonepods detected.</font>"
+		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+	else if(!pod)
+		temp = "<font class='bad'>No Clonepods available.</font>"
+		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+	else if(pod.occupant)
+		temp = "<font class='bad'>Cloning cycle already in progress.</font>"
+		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+	else
+		pod.growclone(null, mob_occupant.real_name, dna.uni_identity, dna.mutation_index, null, dna.blood_type, clone_species, dna.features, mob_occupant.faction)
+		temp = "[mob_occupant.real_name] => <font class='good'>Cloning data sent to pod.</font>"
+		playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
+
+/obj/machinery/computer/cloning/proc/can_scan(datum/dna/dna, mob/living/mob_occupant, experimental = FALSE, datum/bank_account/account)
+	if(!istype(dna))
+		scantemp = "<font class='bad'>Unable to locate valid genetic data.</font>"
+		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+		return
+	if(!experimental)
+		if(mob_occupant.suiciding || mob_occupant.hellbound)
+			scantemp = "<font class='bad'>Subject's brain is not responding to scanning stimuli.</font>"
+			playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+			return
+	if((HAS_TRAIT(mob_occupant, TRAIT_NOCLONE)) && (src.scanner.scan_level < 2))
+		scantemp = "<font class='bad'>Subject no longer contains the fundamental materials required to create a living clone.</font>"
+		playsound(src, 'sound/machines/terminal_alert.ogg', 50, 0)
+		return
+	if (!experimental)
+		if(!mob_occupant.ckey || !mob_occupant.client)
+			scantemp = "<font class='bad'>Mental interface failure.</font>"
+			playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+			return
+		if (find_record("ckey", mob_occupant.ckey, records))
+			scantemp = "<font class='average'>Subject already in database.</font>"
+			playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+			return
+		if(SSeconomy.full_ancap && !account)
+			scantemp = "<font class='average'>Subject is either missing an ID card with a bank account on it, or does not have an account to begin with. Please ensure the ID card is on the body before attempting to scan.</font>"
+			playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
+			return
+	return TRUE
+
+//Prototype cloning console, much more rudimental and lacks modern functions such as saving records, autocloning, or safety checks.
+/obj/machinery/computer/cloning/prototype
+	name = "prototype cloning console"
+	desc = "Used to operate an experimental cloner."
+	icon_screen = "dna"
+	icon_keyboard = "med_key"
+	circuit = /obj/item/circuitboard/computer/cloning/prototype
+	clonepod_type = /obj/machinery/clonepod/experimental

code/game/machinery/exp_cloner.dm

@@ -1,298 +0,0 @@
-//Experimental cloner; clones a body regardless of the owner's status, letting a ghost control it instead
-/obj/machinery/clonepod/experimental
-	name = "experimental cloning pod"
-	desc = "An ancient cloning pod. It seems to be an early prototype of the experimental cloners used in Nanotrasen Stations."
-	icon = 'icons/obj/machines/cloning.dmi'
-	icon_state = "pod_0"
-	req_access = null
-	circuit = /obj/item/circuitboard/machine/clonepod/experimental
-	internal_radio = FALSE
-
-//Start growing a human clone in the pod!
-/obj/machinery/clonepod/experimental/growclone(clonename, ui, mutation_index, mindref, last_death, blood_type, datum/species/mrace, list/features, factions, list/quirks)
-	if(panel_open)
-		return FALSE
-	if(mess || attempting)
-		return FALSE
-
-	attempting = TRUE //One at a time!!
-	countdown.start()
-
-	var/mob/living/carbon/human/H = new /mob/living/carbon/human(src)
-
-	H.hardset_dna(ui, mutation_index, H.real_name, blood_type, mrace, features)
-
-	if(efficiency > 2)
-		var/list/unclean_mutations = (GLOB.not_good_mutations|GLOB.bad_mutations)
-		H.dna.remove_mutation_group(unclean_mutations)
-	if(efficiency > 5 && prob(20))
-		H.easy_randmut(POSITIVE)
-	if(efficiency < 3 && prob(50))
-		var/mob/M = H.easy_randmut(NEGATIVE+MINOR_NEGATIVE)
-		if(ismob(M))
-			H = M
-
-	H.silent = 20 //Prevents an extreme edge case where clones could speak if they said something at exactly the right moment.
-	occupant = H
-
-	if(!clonename)	//to prevent null names
-		clonename = "clone ([rand(1,999)])"
-	H.real_name = clonename
-
-	icon_state = "pod_1"
-	//Get the clone body ready
-	maim_clone(H)
-	ADD_TRAIT(H, TRAIT_STABLEHEART, "cloning")
-	ADD_TRAIT(H, TRAIT_EMOTEMUTE, "cloning")
-	ADD_TRAIT(H, TRAIT_MUTE, "cloning")
-	ADD_TRAIT(H, TRAIT_NOBREATH, "cloning")
-	ADD_TRAIT(H, TRAIT_NOCRITDAMAGE, "cloning")
-	H.Unconscious(80)
-
-	var/list/candidates = pollCandidatesForMob("Do you want to play as [clonename]'s defective clone?", null, null, null, 100, H)
-	if(LAZYLEN(candidates))
-		var/mob/C = pick(candidates)
-		H.key = C.key
-
-	if(grab_ghost_when == CLONER_FRESH_CLONE)
-		H.grab_ghost()
-		to_chat(H, "<span class='notice'><b>Consciousness slowly creeps over you as your body regenerates.</b><br><i>So this is what cloning feels like?</i></span>")
-
-	if(grab_ghost_when == CLONER_MATURE_CLONE)
-		H.ghostize(TRUE)	//Only does anything if they were still in their old body and not already a ghost
-		to_chat(H.get_ghost(TRUE), "<span class='notice'>Your body is beginning to regenerate in a cloning pod. You will become conscious when it is complete.</span>")
-
-	if(H)
-		H.faction |= factions
-
-		H.set_cloned_appearance()
-
-		H.suiciding = FALSE
-	attempting = FALSE
-	return TRUE
-
-
-//Prototype cloning console, much more rudimental and lacks modern functions such as saving records, autocloning, or safety checks.
-/obj/machinery/computer/prototype_cloning
-	name = "prototype cloning console"
-	desc = "Used to operate an experimental cloner."
-	icon_screen = "dna"
-	icon_keyboard = "med_key"
-	circuit = /obj/item/circuitboard/computer/prototype_cloning
-	var/obj/machinery/dna_scannernew/scanner = null //Linked scanner. For scanning.
-	var/list/pods //Linked experimental cloning pods
-	var/temp = "Inactive"
-	var/scantemp = "Ready to Scan"
-	var/loading = FALSE // Nice loading text
-
-	light_color = LIGHT_COLOR_BLUE
-
-/obj/machinery/computer/prototype_cloning/Initialize()
-	. = ..()
-	updatemodules(TRUE)
-
-/obj/machinery/computer/prototype_cloning/Destroy()
-	if(pods)
-		for(var/P in pods)
-			DetachCloner(P)
-		pods = null
-	return ..()
-
-/obj/machinery/computer/prototype_cloning/proc/GetAvailablePod(mind = null)
-	if(pods)
-		for(var/P in pods)
-			var/obj/machinery/clonepod/experimental/pod = P
-			if(pod.is_operational() && !(pod.occupant || pod.mess))
-				return pod
-
-/obj/machinery/computer/prototype_cloning/proc/updatemodules(findfirstcloner)
-	scanner = findscanner()
-	if(findfirstcloner && !LAZYLEN(pods))
-		findcloner()
-
-/obj/machinery/computer/prototype_cloning/proc/findscanner()
-	var/obj/machinery/dna_scannernew/scannerf = null
-
-	// Loop through every direction
-	for(var/direction in GLOB.cardinals)
-		// Try to find a scanner in that direction
-		scannerf = locate(/obj/machinery/dna_scannernew, get_step(src, direction))
-		// If found and operational, return the scanner
-		if (!isnull(scannerf) && scannerf.is_operational())
-			return scannerf
-
-	// If no scanner was found, it will return null
-	return null
-
-/obj/machinery/computer/prototype_cloning/proc/findcloner()
-	var/obj/machinery/clonepod/experimental/podf = null
-	for(var/direction in GLOB.cardinals)
-		podf = locate(/obj/machinery/clonepod/experimental, get_step(src, direction))
-		if (!isnull(podf) && podf.is_operational())
-			AttachCloner(podf)
-
-/obj/machinery/computer/prototype_cloning/proc/AttachCloner(obj/machinery/clonepod/experimental/pod)
-	if(!pod.connected)
-		pod.connected = src
-		LAZYADD(pods, pod)
-
-/obj/machinery/computer/prototype_cloning/proc/DetachCloner(obj/machinery/clonepod/experimental/pod)
-	pod.connected = null
-	LAZYREMOVE(pods, pod)
-
-/obj/machinery/computer/prototype_cloning/attackby(obj/item/W, mob/user, params)
-	if(istype(W, /obj/item/multitool))
-		var/obj/item/multitool/P = W
-
-		if(istype(P.buffer, /obj/machinery/clonepod/experimental))
-			if(get_area(P.buffer) != get_area(src))
-				to_chat(user, "<font color = #666633>-% Cannot link machines across power zones. Buffer cleared %-</font color>")
-				P.buffer = null
-				return
-			to_chat(user, "<font color = #666633>-% Successfully linked [P.buffer] with [src] %-</font color>")
-			var/obj/machinery/clonepod/experimental/pod = P.buffer
-			if(pod.connected)
-				pod.connected.DetachCloner(pod)
-			AttachCloner(pod)
-		else
-			P.buffer = src
-			to_chat(user, "<font color = #666633>-% Successfully stored [REF(P.buffer)] [P.buffer.name] in buffer %-</font color>")
-		return
-	else
-		return ..()
-
-/obj/machinery/computer/prototype_cloning/attack_hand(mob/user)
-	if(..())
-		return
-	interact(user)
-
-/obj/machinery/computer/prototype_cloning/interact(mob/user)
-	user.set_machine(src)
-	add_fingerprint(user)
-
-	if(..())
-		return
-
-	updatemodules(TRUE)
-
-	var/dat = ""
-	dat += "<a href='byond://?src=[REF(src)];refresh=1'>Refresh</a>"
-
-	dat += "<h3>Cloning Pod Status</h3>"
-	dat += "<div class='statusDisplay'>[temp]&nbsp;</div>"
-
-	if (isnull(src.scanner) || !LAZYLEN(pods))
-		dat += "<h3>Modules</h3>"
-		//dat += "<a href='byond://?src=[REF(src)];relmodules=1'>Reload Modules</a>"
-		if (isnull(src.scanner))
-			dat += "<font class='bad'>ERROR: No Scanner detected!</font><br>"
-		if (!LAZYLEN(pods))
-			dat += "<font class='bad'>ERROR: No Pod detected</font><br>"
-
-	// Scan-n-Clone
-	if (!isnull(src.scanner))
-		var/mob/living/scanner_occupant = get_mob_or_brainmob(scanner.occupant)
-
-		dat += "<h3>Cloning</h3>"
-
-		dat += "<div class='statusDisplay'>"
-		if(!scanner_occupant)
-			dat += "Scanner Unoccupied"
-		else if(loading)
-			dat += "[scanner_occupant] => Scanning..."
-		else
-			scantemp = "Ready to Clone"
-			dat += "[scanner_occupant] => [scantemp]"
-		dat += "</div>"
-
-		if(scanner_occupant)
-			dat += "<a href='byond://?src=[REF(src)];clone=1'>Clone</a>"
-			dat += "<br><a href='byond://?src=[REF(src)];lock=1'>[src.scanner.locked ? "Unlock Scanner" : "Lock Scanner"]</a>"
-		else
-			dat += "<span class='linkOff'>Clone</span>"
-
-	var/datum/browser/popup = new(user, "cloning", "Prototype Cloning System Control")
-	popup.set_content(dat)
-	popup.set_title_image(user.browse_rsc_icon(src.icon, src.icon_state))
-	popup.open()
-
-/obj/machinery/computer/prototype_cloning/Topic(href, href_list)
-	if(..())
-		return
-
-	if(loading)
-		return
-
-	else if ((href_list["clone"]) && !isnull(scanner) && scanner.is_operational())
-		scantemp = ""
-
-		loading = TRUE
-		updateUsrDialog()
-		playsound(src, 'sound/machines/terminal_prompt.ogg', 50, 0)
-		say("Initiating scan...")
-
-		spawn(20)
-			clone_occupant(scanner.occupant)
-			loading = FALSE
-			updateUsrDialog()
-			playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
-
-		//No locking an open scanner.
-	else if ((href_list["lock"]) && !isnull(scanner) && scanner.is_operational())
-		if ((!scanner.locked) && (scanner.occupant))
-			scanner.locked = TRUE
-			playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-		else
-			scanner.locked = FALSE
-			playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
-
-	else if (href_list["refresh"])
-		updateUsrDialog()
-		playsound(src, "terminal_type", 25, 0)
-
-	add_fingerprint(usr)
-	updateUsrDialog()
-	return
-
-/obj/machinery/computer/prototype_cloning/proc/clone_occupant(occupant)
-	var/mob/living/mob_occupant = get_mob_or_brainmob(occupant)
-	var/datum/dna/dna
-	if(ishuman(mob_occupant))
-		var/mob/living/carbon/C = mob_occupant
-		dna = C.has_dna()
-	if(isbrain(mob_occupant))
-		var/mob/living/brain/B = mob_occupant
-		dna = B.stored_dna
-
-	if(!istype(dna))
-		scantemp = "<font class='bad'>Unable to locate valid genetic data.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-		return
-	if((HAS_TRAIT(mob_occupant, TRAIT_NOCLONE)) && (src.scanner.scan_level < 2))
-		scantemp = "<font class='bad'>Subject no longer contains the fundamental materials required to create a living clone.</font>"
-		playsound(src, 'sound/machines/terminal_alert.ogg', 50, 0)
-		return
-
-	var/clone_species
-	if(dna.species)
-		clone_species = dna.species
-	else
-		var/datum/species/rando_race = pick(GLOB.roundstart_races)
-		clone_species = rando_race.type
-
-	var/obj/machinery/clonepod/pod = GetAvailablePod()
-	//Can't clone without someone to clone.  Or a pod.  Or if the pod is busy. Or full of gibs.
-	if(!LAZYLEN(pods))
-		temp = "<font class='bad'>No Clonepods detected.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-	else if(!pod)
-		temp = "<font class='bad'>No Clonepods available.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-	else if(pod.occupant)
-		temp = "<font class='bad'>Cloning cycle already in progress.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_deny.ogg', 50, 0)
-	else
-		pod.growclone(mob_occupant.real_name, dna.uni_identity, dna.mutation_index, null, null, dna.blood_type, clone_species, dna.features, mob_occupant.faction)
-		temp = "[mob_occupant.real_name] => <font class='good'>Cloning data sent to pod.</font>"
-		playsound(src, 'sound/machines/terminal_prompt_confirm.ogg', 50, 0)
-

code/game/objects/effects/contraband.dm

@@ -212,6 +212,11 @@
 	desc = "A heretical poster depicting the titular star of an equally heretical book."
 	icon_state = "poster4"
 
+/obj/structure/sign/poster/contraband/post_ratvar
+	name = "Post This Ratvar"
+	desc = "Oh what in the hell? Those cultists have animated paper technology and they use it for a meme?"
+	icon_state = "postvar"
+
 /obj/structure/sign/poster/contraband/syndicate_recruitment
 	name = "Syndicate Recruitment"
 	desc = "See the galaxy! Shatter corrupt megacorporations! Join today!"

code/game/objects/items/circuitboards/computer_circuitboards.dm

@@ -116,9 +116,9 @@
 	build_path = /obj/machinery/computer/cloning
 	var/list/records = list()
 
-/obj/item/circuitboard/computer/prototype_cloning
+/obj/item/circuitboard/computer/cloning/prototype
 	name = "Prototype Cloning (Computer Board)"
-	build_path = /obj/machinery/computer/prototype_cloning
+	build_path = /obj/machinery/computer/cloning/prototype
 
 /obj/item/circuitboard/computer/arcade/battle
 	name = "Arcade Battle (Computer Board)"

code/game/objects/items/pet_carrier.dm

@@ -22,6 +22,11 @@
 	var/occupant_weight = 0
 	var/max_occupants = 3 //Hard-cap so you can't have infinite mice or something in one carrier
 	var/max_occupant_weight = MOB_SIZE_SMALL //This is calculated from the mob sizes of occupants
+	var/entrance_name = "door" //name of the entrance to the item
+	var/escape_time = 200 //how long it takes for mobs above small sizes to escape (for small sizes, its randomly 1.5 to 2x this)
+	var/load_time = 30 //how long it takes for mobs to be loaded into the pet carrier
+	var/has_lock_sprites = TRUE //whether to load the lock overlays or not
+	var/allows_hostiles = FALSE //does the pet carrier allow hostile entities to be held within it?
 
 /obj/item/pet_carrier/Destroy()
 	if(occupants.len)
@@ -51,20 +56,20 @@
 	else
 		. += "<span class='notice'>It has nothing inside.</span>"
 	if(user.canUseTopic(src))
-		. += "<span class='notice'>Activate it in your hand to [open ? "close" : "open"] its door.</span>"
+		. += "<span class='notice'>Activate it in your hand to [open ? "close" : "open"] its [entrance_name].</span>"
 		if(!open)
-			. += "<span class='notice'>Alt-click to [locked ? "unlock" : "lock"] its door.</span>"
+			. += "<span class='notice'>Alt-click to [locked ? "unlock" : "lock"] its [entrance_name].</span>"
 
 /obj/item/pet_carrier/attack_self(mob/living/user)
 	if(open)
-		to_chat(user, "<span class='notice'>You close [src]'s door.</span>")
+		to_chat(user, "<span class='notice'>You close [src]'s [entrance_name].</span>")
 		playsound(user, 'sound/effects/bin_close.ogg', 50, TRUE)
 		open = FALSE
 	else
 		if(locked)
 			to_chat(user, "<span class='warning'>[src] is locked!</span>")
 			return
-		to_chat(user, "<span class='notice'>You open [src]'s door.</span>")
+		to_chat(user, "<span class='notice'>You open [src]'s [entrance_name].</span>")
 		playsound(user, 'sound/effects/bin_open.ogg', 50, TRUE)
 		open = TRUE
 	update_icon()
@@ -86,7 +91,7 @@
 	if(user.a_intent == INTENT_HARM)
 		return ..()
 	if(!open)
-		to_chat(user, "<span class='warning'>You need to open [src]'s door!</span>")
+		to_chat(user, "<span class='warning'>You need to open [src]'s [entrance_name]!</span>")
 		return
 	if(target.mob_size > max_occupant_weight)
 		if(ishuman(target))
@@ -94,13 +99,15 @@
 			if(iscatperson(H))
 				to_chat(user, "<span class='warning'>You'd need a lot of catnip and treats, plus maybe a laser pointer, for that to work.</span>")
 			else
-				to_chat(user, "<span class='warning'>Humans, generally, do not fit into pet carriers.</span>")
+				to_chat(user, "<span class='warning'>Humans, generally, do not fit into [name]s.</span>")
 		else
 			to_chat(user, "<span class='warning'>You get the feeling [target] isn't meant for a [name].</span>")
 		return
 	if(user == target)
 		to_chat(user, "<span class='warning'>Why would you ever do that?</span>")
 		return
+	if(ishostile(target) && !allows_hostiles && target.move_resist < MOVE_FORCE_VERY_STRONG) //don't allow goliaths into pet carriers
+		to_chat(user, "<span class='warning'>You have a feeling you shouldn't keep this as a pet.</span>")
 	load_occupant(user, target)
 
 /obj/item/pet_carrier/relaymove(mob/living/user, direction)
@@ -110,8 +117,8 @@
 		remove_occupant(user)
 		return
 	else if(!locked)
-		loc.visible_message("<span class='notice'>[user] pushes open the door to [src]!</span>", \
-		"<span class='warning'>[user] pushes open the door of [src]!</span>")
+		loc.visible_message("<span class='notice'>[user] pushes open the [entrance_name] to [src]!</span>", \
+		"<span class='warning'>[user] pushes open the [entrance_name] of [src]!</span>")
 		open = TRUE
 		update_icon()
 		return
@@ -119,12 +126,19 @@
 		container_resist(user)
 
 /obj/item/pet_carrier/container_resist(mob/living/user)
+	//don't do the whole resist timer thing if it's open!
+	if(open)
+		loc.visible_message("<span class='notice'>[user] climbs out of [src]!</span>", \
+		"<span class='warning'>[user] jumps out of [src]!</span>")
+		remove_occupant(user)
+		return
+
 	user.changeNext_move(CLICK_CD_BREAKOUT)
 	user.last_special = world.time + CLICK_CD_BREAKOUT
 	if(user.mob_size <= MOB_SIZE_SMALL)
-		to_chat(user, "<span class='notice'>You poke a limb through [src]'s bars and start fumbling for the lock switch... (This will take some time.)</span>")
-		to_chat(loc, "<span class='warning'>You see [user] reach through the bars and fumble for the lock switch!</span>")
-		if(!do_after(user, rand(300, 400), target = user) || open || !locked || !(user in occupants))
+		to_chat(user, "<span class='notice'>You begin to try escaping the [src] and start fumbling for the lock switch... (This will take some time.)</span>")
+		to_chat(loc, "<span class='warning'>You see [user] attempting to unlock the [src]!</span>")
+		if(!do_after(user, rand(escape_time * 1.5, escape_time * 2), target = user) || open || !locked || !(user in occupants))
 			return
 		loc.visible_message("<span class='warning'>[user] flips the lock switch on [src] by reaching through!</span>", null, null, null, user)
 		to_chat(user, "<span class='boldannounce'>Bingo! The lock pops open!</span>")
@@ -132,12 +146,12 @@
 		playsound(src, 'sound/machines/boltsup.ogg', 30, TRUE)
 		update_icon()
 	else
-		loc.visible_message("<span class='warning'>[src] starts rattling as something pushes against the door!</span>", null, null, null, user)
+		loc.visible_message("<span class='warning'>[src] starts rattling as something pushes against the [entrance_name]!</span>", null, null, null, user)
 		to_chat(user, "<span class='notice'>You start pushing out of [src]... (This will take about 20 seconds.)</span>")
-		if(!do_after(user, 200, target = user) || open || !locked || !(user in occupants))
+		if(!do_after(user, escape_time, target = user) || open || !locked || !(user in occupants))
 			return
 		loc.visible_message("<span class='warning'>[user] shoves out of	[src]!</span>", null, null, null, user)
-		to_chat(user, "<span class='notice'>You shove open [src]'s door against the lock's resistance and fall out!</span>")
+		to_chat(user, "<span class='notice'>You shove open [src]'s [entrance_name] against the lock's resistance and fall out!</span>")
 		locked = FALSE
 		open = TRUE
 		update_icon()
@@ -151,7 +165,7 @@
 
 /obj/item/pet_carrier/update_overlays()
 	. = ..()
-	if(!open)
+	if(!open && has_lock_sprites)
 		. += "[locked ? "" : "un"]locked"
 
 /obj/item/pet_carrier/MouseDrop(atom/over_atom)
@@ -170,7 +184,7 @@
 	user.visible_message("<span class='notice'>[user] starts loading [target] into [src].</span>", \
 	"<span class='notice'>You start loading [target] into [src]...</span>", null, null, target)
 	to_chat(target, "<span class='userdanger'>[user] starts loading you into [user.p_their()] [name]!</span>")
-	if(!do_mob(user, target, 30))
+	if(!do_mob(user, target, load_time))
 		return
 	if(target in occupants)
 		return
@@ -192,9 +206,74 @@
 /obj/item/pet_carrier/proc/remove_occupant(mob/living/occupant, turf/new_turf)
 	if(!(occupant in occupants) || !istype(occupant))
 		return
-	occupant.forceMove(new_turf ? new_turf : drop_location())
+	occupant.forceMove(new_turf ? new_turf : get_turf(src))
 	occupants -= occupant
 	occupant_weight -= occupant.mob_size
 	occupant.setDir(SOUTH)
 
+//bluespace jar, a reskin of the pet carrier that can fit people and smashes when thrown
+/obj/item/pet_carrier/bluespace
+	name = "bluespace jar"
+	desc = "A jar, that seems to be bigger on the inside, somehow allowing lifeforms to fit through its narrow entrance."
+	open = FALSE //starts closed so it looks better on menus
+	icon_state = "bluespace_jar"
+	item_state = "bluespace_jar"
+	lefthand_file = ""
+	righthand_file = ""
+	max_occupant_weight = MOB_SIZE_HUMAN //can fit people, like a bluespace bodybag!
+	load_time = 40 //loading things into a jar takes longer than a regular pet carrier
+	entrance_name = "lid"
+	w_class = WEIGHT_CLASS_SMALL //it's a jar
+	throw_speed = 3
+	throw_range = 7
+	max_occupants = 1 //far less than a regular carrier or bluespace bodybag, because it can be thrown to release the contents
+	allows_hostiles = TRUE //can fit hostile creatures, with the move resist restrictions in place, this means they still cannot take things like legions/goliaths/etc regardless
+	has_lock_sprites = FALSE //jar doesn't show the regular lock overlay
+	custom_materials = list(/datum/material/glass = 1000, /datum/material/bluespace = 600)
+	escape_time = 10 //half the time of a bluespace bodybag
+	var/datum/gas_mixture/occupant_gas_supply
+
+/obj/item/pet_carrier/bluespace/update_icon_state()
+	if(open)
+		icon_state = "bluespace_jar_open"
+	else
+		icon_state = "bluespace_jar"
+
+/obj/item/pet_carrier/bluespace/throw_impact()
+	. = ..()
+	//delete the item upon impact, releasing the creature inside (this is handled by its deletion)
+	if(occupants.len)
+		loc.visible_message("<span class='warning'>The bluespace jar smashes, releasing [occupants[1]]!</span>")
+	playsound(src, "shatter", 70, 1)
+	qdel(src)
+
+/obj/item/pet_carrier/bluespace/add_occupant(mob/living/occupant) //update the gas supply as required, this acts like magical internals
+	. = ..()
+	if(!occupant_gas_supply)
+		occupant_gas_supply = new
+	if(isanimal(occupant))
+		var/mob/living/simple_animal/animal = occupant
+		occupant_gas_supply.temperature = animal.minbodytemp //simple animals only care about temperature when their turf isnt a location
+	else
+		if(ishuman(occupant)) //humans require resistance to cold/heat and living in no air while inside, and lose this when outside
+			ADD_TRAIT(occupant, TRAIT_RESISTCOLD, "bluespace_container_cold_resist")
+			ADD_TRAIT(occupant, TRAIT_RESISTHEAT, "bluespace_container_heat_resist")
+			ADD_TRAIT(occupant, TRAIT_NOBREATH, "bluespace_container_no_breath")
+			ADD_TRAIT(occupant, TRAIT_RESISTHIGHPRESSURE, "bluespace_container_resist_high_pressure")
+			ADD_TRAIT(occupant, TRAIT_RESISTLOWPRESSURE, "bluespace_container_resist_low_pressure")
+
+/obj/item/pet_carrier/bluespace/remove_occupant(mob/living/occupant)
+	. = ..()
+	if(ishuman(occupant))
+		REMOVE_TRAIT(occupant, TRAIT_RESISTCOLD, "bluespace_container_cold_resist")
+		REMOVE_TRAIT(occupant, TRAIT_RESISTHEAT, "bluespace_container_heat_resist")
+		REMOVE_TRAIT(occupant, TRAIT_NOBREATH, "bluespace_container_no_breath")
+		REMOVE_TRAIT(occupant, TRAIT_RESISTHIGHPRESSURE, "bluespace_container_resist_high_pressure")
+		REMOVE_TRAIT(occupant, TRAIT_RESISTLOWPRESSURE, "bluespace_container_resist_low_pressure")
+
+/obj/item/pet_carrier/bluespace/return_air()
+	if(!occupant_gas_supply)
+		occupant_gas_supply = new
+	return occupant_gas_supply
+
 #undef pet_carrier_full

code/game/objects/items/storage/bags.dm

@@ -326,6 +326,7 @@
 	w_class = WEIGHT_CLASS_BULKY
 	flags_1 = CONDUCT_1
 	custom_materials = list(/datum/material/iron=3000)
+	var/max_items = 7
 
 /obj/item/storage/bag/tray/ComponentInitialize()
 	. = ..()
@@ -333,6 +334,7 @@
 	STR.max_w_class = WEIGHT_CLASS_NORMAL
 	STR.can_hold = typecacheof(list(/obj/item/reagent_containers/food, /obj/item/reagent_containers/glass, /datum/reagent/consumable, /obj/item/kitchen/knife, /obj/item/kitchen/rollingpin, /obj/item/kitchen/fork, /obj/item/storage/box)) //Should cover: Bottles, Beakers, Bowls, Booze, Glasses, Food, Kitchen Tools, and ingredient boxes.
 	STR.insert_preposition = "on"
+	STR.max_items = max_items
 
 /obj/item/storage/bag/tray/attack(mob/living/M, mob/living/user)
 	. = ..()
@@ -373,6 +375,14 @@
 	. = ..()
 	update_icon()
 
+//bluespace tray, holds more items
+/obj/item/storage/bag/tray/bluespace
+	name = "bluespace tray"
+	icon_state = "bluespace_tray"
+	desc = "A tray created using bluespace technology to fit more food on it."
+	max_items = 30 // far more items
+	custom_materials = list(/datum/material/iron = 2000, /datum/material/bluespace = 500)
+
 /*
  *	Chemistry bag
  */

code/modules/atmospherics/machinery/portable/canister.dm

@@ -268,6 +268,7 @@ obj/machinery/portable_atmospherics/canister/welder_act(mob/living/user, obj/ite
 /obj/machinery/portable_atmospherics/canister/obj_break(damage_flag)
 	if((stat & BROKEN) || (flags_1 & NODECONSTRUCT_1))
 		return
+	stat |= BROKEN
 	canister_break()
 
 /obj/machinery/portable_atmospherics/canister/proc/canister_break()

code/modules/clothing/suits/toggles.dm

@@ -76,6 +76,7 @@
 
 /obj/item/clothing/head/hooded
 	var/obj/item/clothing/suit/hooded/suit
+	dynamic_hair_suffix = ""
 
 /obj/item/clothing/head/hooded/Destroy()
 	suit = null

code/modules/hydroponics/grown/peas.dm

@@ -61,6 +61,7 @@
 	filling_color = "#ee7bee"
 	bitesize_mod = 2
 	foodtype = VEGETABLES
+	juice_results = list (/datum/reagent/consumable/laughsyrup = 0)
 	tastes = list ("a prancing rabbit" = 1) //Vib Ribbon sends her regards.. wherever she is.
 	wine_power = 90
 	wine_flavor = "a vector-graphic rabbit dancing on your tongue"

code/modules/mob/living/carbon/human/species_types/jellypeople.dm

@@ -23,6 +23,13 @@
 	heatmod = 0.5 // = 1/4x heat damage
 	burnmod = 0.5 // = 1/2x generic burn damage
 	species_language_holder = /datum/language_holder/jelly
+	mutant_brain = /obj/item/organ/brain/jelly
+
+/obj/item/organ/brain/jelly
+	name = "slime nucleus"
+	desc = "A slimey membranous mass from a slime person"
+	icon_state = "brain-slime"
+
 
 /datum/species/jelly/on_species_loss(mob/living/carbon/C)
 	if(regenerate_limbs)

code/modules/research/designs/bluespace_designs.dm

@@ -95,3 +95,23 @@
 	build_path = /obj/item/storage/bag/ore/holding
 	category = list("Bluespace Designs")
 	departmental_flags = DEPARTMENTAL_FLAG_CARGO
+
+/datum/design/bluespace_tray
+	name = "Bluespace Tray"
+	desc = "A tray created using bluespace technology to fit more food on it."
+	id = "bluespace_tray"
+	build_type = PROTOLATHE
+	build_path = /obj/item/storage/bag/tray/bluespace
+	materials = list(/datum/material/iron = 2000, /datum/material/bluespace = 500)
+	category = list("Bluespace Designs")
+	departmental_flags = DEPARTMENTAL_FLAG_SERVICE
+
+/datum/design/bluespace_carrier
+	name = "Bluespace Jar"
+	desc = "A jar used to contain creatures, using the power of bluespace."
+	id = "bluespace_carrier"
+	build_type = PROTOLATHE
+	build_path = /obj/item/pet_carrier/bluespace
+	materials = list(/datum/material/glass = 1000, /datum/material/bluespace = 600)
+	category = list("Bluespace Designs")
+	departmental_flags = DEPARTMENTAL_FLAG_SCIENCE

code/modules/research/techweb/nodes/bluespace_nodes.dm

@@ -13,7 +13,7 @@
 	display_name = "Applied Bluespace Research"
 	description = "Using bluespace to make things faster and better."
 	prereq_ids = list("bluespace_basic", "engineering")
-	design_ids = list("bs_rped","biobag_holding","minerbag_holding", "bluespacebeaker", "bluespacesyringe", "phasic_scanning", "bluespacesmartdart", "xenobio_slimebasic")
+	design_ids = list("bs_rped","biobag_holding","minerbag_holding", "bluespacebeaker", "bluespacesyringe", "phasic_scanning", "bluespacesmartdart", "xenobio_slimebasic", "bluespace_tray", "bluespace_carrier")
 	research_costs = list(TECHWEB_POINT_TYPE_GENERIC = 5000)
 
 /datum/techweb_node/adv_bluespace

html/changelog.html

@@ -50,6 +50,36 @@
 		-->
 		<div class="commit sansserif">
 
+			<h2 class="date">09 July 2020</h2>
+			<h3 class="author">timothyteakettle updated:</h3>
+			<ul class="changes bgimages16">
+				<li class="rscadd">bluespace tray added, allowing twice as many items as the regular tray, printable at the service lathe, researched through science</li>
+				<li class="rscadd">bluespace jar added, a kind of pet carrier that allows human sized mobs inside, and smashes when thrown, researched and printed through science</li>
+			</ul>
+
+			<h2 class="date">08 July 2020</h2>
+			<h3 class="author">DeltaFire15 updated:</h3>
+			<ul class="changes bgimages16">
+				<li class="bugfix">The kill-once objective now works properly.</li>
+			</ul>
+			<h3 class="author">EmeraldSundisk updated:</h3>
+			<ul class="changes bgimages16">
+				<li class="rscadd">CogStation now has an apothecary</li>
+				<li class="rscdel">Removes an outdated note on sleepers</li>
+				<li class="tweak">Readjusts CogStation's chemistry lab</li>
+				<li class="tweak">Slight area designation adjustments for Robotics</li>
+				<li class="bugfix">The arrivals plaque should be readable now</li>
+			</ul>
+			<h3 class="author">Owai-Seek updated:</h3>
+			<ul class="changes bgimages16">
+				<li class="rscadd">Margarine, Chili Cheese Fries.</li>
+				<li class="tweak">Egg Wraps are now categorized under egg foods.</li>
+				<li class="bugfix">Tuna Sandwich crafting/sprite is now visible.</li>
+				<li class="imageadd">Icons for chicken, cooked chicken, steak, grilled carp, corndogs</li>
+				<li class="imageadd">Icons for chili cheese fries, margarine, BLT sandwich</li>
+				<li class="imageadd">(Unused) icons for raw meatballs, and lard</li>
+			</ul>
+
 			<h2 class="date">07 July 2020</h2>
 			<h3 class="author">KasparoVy updated:</h3>
 			<ul class="changes bgimages16">

html/changelogs/.all_changelog.yml

@@ -26274,3 +26274,25 @@ DO NOT EDIT THIS FILE BY HAND!  AUTOMATICALLY GENERATED BY ss13_genchangelog.py.
       use custom sprite sizes so just ignore these changes.
   - bugfix: Fixed the "Move it to the threshold" button; it now does what it says.
   - tweak: Reworded some text to be clearer.
+2020-07-08:
+  DeltaFire15:
+  - bugfix: The kill-once objective now works properly.
+  EmeraldSundisk:
+  - rscadd: CogStation now has an apothecary
+  - rscdel: Removes an outdated note on sleepers
+  - tweak: Readjusts CogStation's chemistry lab
+  - tweak: Slight area designation adjustments for Robotics
+  - bugfix: The arrivals plaque should be readable now
+  Owai-Seek:
+  - rscadd: Margarine, Chili Cheese Fries.
+  - tweak: Egg Wraps are now categorized under egg foods.
+  - bugfix: Tuna Sandwich crafting/sprite is now visible.
+  - imageadd: Icons for chicken, cooked chicken, steak, grilled carp, corndogs
+  - imageadd: Icons for chili cheese fries, margarine, BLT sandwich
+  - imageadd: (Unused) icons for raw meatballs, and lard
+2020-07-09:
+  timothyteakettle:
+  - rscadd: bluespace tray added, allowing twice as many items as the regular tray,
+      printable at the service lathe, researched through science
+  - rscadd: bluespace jar added, a kind of pet carrier that allows human sized mobs
+      inside, and smashes when thrown, researched and printed through science

html/changelogs/AutoChangeLog-pr-12684.yml

@@ -1,9 +0,0 @@
-author: "Owai-Seek"
-delete-after: True
-changes: 
-  - rscadd: "Margarine, Chili Cheese Fries."
-  - tweak: "Egg Wraps are now categorized under egg foods."
-  - bugfix: "Tuna Sandwich crafting/sprite is now visible."
-  - imageadd: "Icons for chicken, cooked chicken, steak, grilled carp, corndogs"
-  - imageadd: "Icons for chili cheese fries, margarine, BLT sandwich"
-  - imageadd: "(Unused) icons for raw meatballs, and lard"

html/changelogs/AutoChangeLog-pr-12697.yml

@@ -1,8 +0,0 @@
-author: "EmeraldSundisk"
-delete-after: True
-changes: 
-  - rscadd: "CogStation now has an apothecary"
-  - rscdel: "Removes an outdated note on sleepers"
-  - tweak: "Readjusts CogStation's chemistry lab"
-  - tweak: "Slight area designation adjustments for Robotics"
-  - bugfix: "The arrivals plaque should be readable now"

html/changelogs/AutoChangeLog-pr-12702.yml

@@ -1,4 +0,0 @@
-author: "DeltaFire15"
-delete-after: True
-changes: 
-  - bugfix: "The kill-once objective now works properly."

html/changelogs/AutoChangeLog-pr-12707.yml

@@ -0,0 +1,5 @@
+author: "Chiirno"
+delete-after: True
+changes: 
+  - code_imp: "Gave jellypeople a unique brain object /obj/item/organ/brain/jelly"
+  - imageadd: "added an icon for jellypeople brains."

html/changelogs/AutoChangeLog-pr-12708.yml

@@ -0,0 +1,5 @@
+author: "EmeraldSundisk"
+delete-after: True
+changes: 
+  - rscadd: "Adds a pool to PubbyStation"
+  - tweak: "Slight adjustments to the surrounding area as to fit said pool"

html/changelogs/AutoChangeLog-pr-12710.yml

@@ -0,0 +1,4 @@
+author: "Sneakyrat6"
+delete-after: True
+changes: 
+  - bugfix: "Fixes hair falling out of hoodies."

html/changelogs/AutoChangeLog-pr-12712.yml

@@ -0,0 +1,4 @@
+author: "TheObserver-sys"
+delete-after: True
+changes: 
+  - bugfix: "Actually adds the juice reagent to make laugh peas donuts."

modular_citadel/code/modules/reagents/chemistry/reagents/SDGF.dm

@@ -63,7 +63,7 @@ IMPORTANT FACTORS TO CONSIDER WHILE BALANCING
 			startHunger = M.nutrition
 			if(pollStarted == FALSE)
 				pollStarted = TRUE
-				candies = pollGhostCandidates("Do you want and agree to play as a clone of [M], respect their character and not engage in ERP without permission from the original?", ignore_category = POLL_IGNORE_CLONE)
+				candies = pollGhostCandidates("Do you want to play as [M]'s defective clone? (Don't ERP without permission from the original)", ignore_category = POLL_IGNORE_CLONE)
 				log_reagent("FERMICHEM: [M] ckey: [M.key] has taken SDGF, and ghosts have been polled.")
 		if(20 to INFINITY)
 			if(LAZYLEN(candies) && playerClone == FALSE) //If there's candidates, clone the person and put them in there!

tgstation.dme

@@ -745,7 +745,6 @@
 #include "code\game\machinery\dna_scanner.dm"
 #include "code\game\machinery\doppler_array.dm"
 #include "code\game\machinery\droneDispenser.dm"
-#include "code\game\machinery\exp_cloner.dm"
 #include "code\game\machinery\firealarm.dm"
 #include "code\game\machinery\flasher.dm"
 #include "code\game\machinery\gulag_item_reclaimer.dm"