Basic main structure for centralized alarm handling.

baystation12.dme

@@ -93,8 +93,10 @@
 #include "code\controllers\lighting_controller.dm"
 #include "code\controllers\master_controller.dm"
 #include "code\controllers\shuttle_controller.dm"
+#include "code\controllers\subsystems.dm"
 #include "code\controllers\verbs.dm"
 #include "code\controllers\voting.dm"
+#include "code\controllers\subsystem\alarms.dm"
 #include "code\datums\ai_laws.dm"
 #include "code\datums\browser.dm"
 #include "code\datums\computerfiles.dm"
@@ -806,6 +808,13 @@
 #include "code\modules\admin\verbs\ticklag.dm"
 #include "code\modules\admin\verbs\tripAI.dm"
 #include "code\modules\admin\verbs\vox_raiders.dm"
+#include "code\modules\alarm\alarm.dm"
+#include "code\modules\alarm\alarm_handler.dm"
+#include "code\modules\alarm\atmosphere_alarm.dm"
+#include "code\modules\alarm\camera_alarm.dm"
+#include "code\modules\alarm\fire_alarm.dm"
+#include "code\modules\alarm\motion_alarm.dm"
+#include "code\modules\alarm\power_alarm.dm"
 #include "code\modules\assembly\assembly.dm"
 #include "code\modules\assembly\bomb.dm"
 #include "code\modules\assembly\helpers.dm"
@@ -1115,7 +1124,6 @@
 #include "code\modules\mob\living\carbon\monkey\login.dm"
 #include "code\modules\mob\living\carbon\monkey\monkey.dm"
 #include "code\modules\mob\living\carbon\monkey\update_icons.dm"
-#include "code\modules\mob\living\silicon\alarm.dm"
 #include "code\modules\mob\living\silicon\death.dm"
 #include "code\modules\mob\living\silicon\laws.dm"
 #include "code\modules\mob\living\silicon\login.dm"

code/__HELPERS/game.dm

@@ -484,5 +484,8 @@ datum/projectile_data
 		temps[direction] = rstats
 	return temps
 
-/proc/MinutesToTicks(var/minutes as num)
-	return minutes * 60 * 10
+/proc/MinutesToTicks(var/minutes)
+	return SecondsToTicks(60 * minutes)
+	
+/proc/SecondsToTicks(var/seconds)
+	return seconds * 10

code/controllers/master_controller.dm

@@ -26,6 +26,7 @@ datum/controller/game_controller
 	var/powernets_cost	= 0
 	var/nano_cost		= 0
 	var/events_cost		= 0
+	var/alarms_cost		= 0
 	var/ticker_cost		= 0
 	var/total_cost		= 0
 
@@ -231,6 +232,11 @@ datum/controller/game_controller/proc/process()
 				process_events()
 				events_cost = (world.timeofday - timer) / 10
 
+				//ALARMS
+				timer = world.timeofday
+				process_alarms()
+				alarms_cost = (world.timeofday - timer) / 10
+
 				//TICKER
 				timer = world.timeofday
 				last_thing_processed = ticker.type
@@ -238,7 +244,7 @@ datum/controller/game_controller/proc/process()
 				ticker_cost = (world.timeofday - timer) / 10
 
 				//TIMING
-				total_cost = air_cost + sun_cost + mobs_cost + diseases_cost + machines_cost + objects_cost + networks_cost + powernets_cost + nano_cost + events_cost + ticker_cost
+				total_cost = air_cost + sun_cost + mobs_cost + diseases_cost + machines_cost + objects_cost + networks_cost + powernets_cost + nano_cost + events_cost + alarms_cost + ticker_cost
 
 				var/end_time = world.timeofday
 				if(end_time < start_time)	//why not just use world.time instead?
@@ -333,9 +339,13 @@ datum/controller/game_controller/proc/process_nano()
 		nanomanager.processing_uis.Cut(i,i+1)
 
 datum/controller/game_controller/proc/process_events()
-	last_thing_processed = /datum/event
+	last_thing_processed = /datum/event_manager
 	event_manager.process()
 
+datum/controller/game_controller/proc/process_alarms()
+	last_thing_processed = /datum/subsystem/alarm
+	alarm_manager.fire()
+
 datum/controller/game_controller/proc/Recover()		//Mostly a placeholder for now.
 	var/msg = "## DEBUG: [time2text(world.timeofday)] MC restarted. Reports:\n"
 	for(var/varname in master_controller.vars)

code/controllers/subsystem/alarms.dm

@@ -0,0 +1,27 @@
+/* /var/global/datum/alarm_handler/atmosphere_alarm	= new()*/
+/var/global/datum/alarm_handler/camera_alarm		= new()
+/* /var/global/datum/alarm_handler/fire_alarm		= new()*/
+/var/global/datum/alarm_handler/motion_alarm		= new()
+/* /var/global/datum/alarm_handler/power_alarm			= new() */
+
+/datum/subsystem/alarm
+	name = "Alarm"
+	var/list/datum/alarm/all_handlers
+
+/datum/subsystem/alarm/New()
+	all_handlers = list(camera_alarm)
+
+/datum/subsystem/alarm/stat_entry()
+	stat(null,"Alarm-[master_controller.alarms_cost]\t# [active_alarms()]")
+
+/datum/subsystem/alarm/fire()
+	for(var/datum/alarm_handler/AH in all_handlers)
+		AH.process()
+
+/datum/subsystem/alarm/proc/active_alarms()
+	var/total = 0
+	for(var/datum/alarm_handler/AH in all_handlers)
+		var/list/alarms = AH.alarms
+		total += alarms.len
+
+	return total

code/controllers/subsystems.dm

@@ -0,0 +1,46 @@
+#define NEW_SS_GLOBAL(varname) if(varname != src){if(istype(varname)){Recover();qdel(varname);}varname = src;}
+
+/datum/subsystem
+	//things you will want to define
+	var/name			//name of the subsystem
+	var/priority = 0	//priority affects order of initialization. Higher priorities are initialized first, lower priorities later. Can be decimal and negative values.
+	var/wait = 20		//time to wait (in deciseconds) between each call to fire(). Must be a positive integer.
+
+	//things you will probably want to leave alone
+	var/can_fire = 0	//prevent fire() calls
+	var/last_fire = 0	//last world.time we called fire()
+	var/next_fire = 0	//scheduled world.time for next fire()
+	var/cpu = 0			//cpu-usage stats (somewhat vague)
+	var/cost = 0		//average time to execute
+	var/times_fired = 0	//number of times we have called fire()
+
+//used to initialize the subsystem BEFORE the map has loaded
+/datum/subsystem/New()
+
+//previously, this would have been named 'process()' but that name is used everywhere for different things!
+//fire() seems more suitable. This is the procedure that gets called every 'wait' deciseconds.
+//fire(), and the procs it calls, SHOULD NOT HAVE ANY SLEEP OPERATIONS in them!
+//YE BE WARNED!
+/datum/subsystem/proc/fire()
+	can_fire = 0
+
+//used to initialize the subsystem AFTER the map has loaded
+/datum/subsystem/proc/Initialize(start_timeofday)
+	var/time = (world.timeofday - start_timeofday) / 10
+	var/msg = "Initialized [name] SubSystem within [time] seconds"
+	world << "<span class='userdanger'>[msg]</span>"
+	world.log << msg
+
+//hook for printing stats to the "MC" statuspanel for admins to see performance and related stats etc.
+/datum/subsystem/proc/stat_entry()
+	stat(name, "[round(cost,0.001)]ds\t(CPU:[round(cpu,1)]%)")
+
+//could be used to postpone a costly subsystem for one cycle
+//for instance, during cpu intensive operations like explosions
+/datum/subsystem/proc/postpone()
+	if(next_fire - world.time < wait)
+		next_fire += wait
+
+//usually called via datum/subsystem/New() when replacing a subsystem (i.e. due to a recurring crash)
+//should attempt to salvage what it can from the old instance of subsystem
+/datum/subsystem/proc/Recover()

code/controllers/verbs.dm

@@ -56,7 +56,7 @@
 	message_admins("Admin [key_name_admin(usr)] has restarted the [controller] controller.")
 	return
 
-/client/proc/debug_controller(controller in list("Master","Failsafe","Ticker","Lighting","Air","Jobs","Sun","Radio","Supply","Shuttles","Emergency Shuttle","Configuration","pAI", "Cameras", "Transfer Controller", "Gas Data","Event"))
+/client/proc/debug_controller(controller in list("Master","Failsafe","Ticker","Lighting","Air","Jobs","Sun","Radio","Supply","Shuttles","Emergency Shuttle","Configuration","pAI", "Cameras", "Transfer Controller", "Gas Data","Event","Alarm"))
 	set category = "Debug"
 	set name = "Debug Controller"
 	set desc = "Debug the various periodic loop controllers for the game (be careful!)"
@@ -114,5 +114,8 @@
 		if("Event")
 			debug_variables(event_manager)
 			feedback_add_details("admin_verb", "DEvent")
+		if("Alarm")
+			debug_variables(alarm_manager)
+			feedback_add_details("admin_verb", "DAlarm")
 	message_admins("Admin [key_name_admin(usr)] is debugging the [controller] controller.")
 	return

code/game/area/areas.dm

@@ -30,11 +30,17 @@
 	power_change()		// all machines set to current power level, also updates lighting icon
 	InitializeLighting()
 
+/area/proc/get_cameras()
+	var/list/cameras = list()
+	for (var/area/RA in related)
+		for (var/obj/machinery/camera/C in RA)
+			cameras += C
+	return cameras
 
 /area/proc/poweralert(var/state, var/obj/source as obj)
 	if (state != poweralm)
 		poweralm = state
-		if(istype(source))	//Only report power alarms on the z-level where the source is located.
+		/*if(istype(source))	//Only report power alarms on the z-level where the source is located.
 			var/list/cameras = list()
 			for (var/area/RA in related)
 				for (var/obj/machinery/camera/C in RA)
@@ -54,7 +60,7 @@
 					if(state == 1)
 						a.cancelAlarm("Power", src, source)
 					else
-						a.triggerAlarm("Power", src, cameras, source)
+						a.triggerAlarm("Power", src, cameras, source) */
 	return
 
 /area/proc/atmosalert(danger_level, var/set_firelocks=1)
@@ -71,7 +77,7 @@
 		if (set_firelocks && danger_level < 1 && atmosalm >= 1)
 			//closing the doors on red and opening on green provides a bit of hysteresis that will hopefully prevent fire doors from opening and closing repeatedly due to noise
 			air_doors_open()
-
+		/*
 		if (danger_level < 2 && atmosalm >= 2)
 			for(var/area/RA in related)
 				for(var/obj/machinery/camera/C in RA)
@@ -98,7 +104,7 @@
 		atmosalm = danger_level
 		for(var/area/RA in related)
 			for (var/obj/machinery/alarm/AA in RA)
-				AA.update_icon()
+				AA.update_icon() */
 
 		return 1
 	return 0
@@ -141,15 +147,6 @@
 				else if(!D.density)
 					spawn()
 						D.close()
-		var/list/cameras = list()
-		for(var/area/RA in related)
-			for (var/obj/machinery/camera/C in RA)
-				cameras.Add(C)
-				C.network.Add("Fire Alarms")
-		for (var/mob/living/silicon/ai/aiPlayer in player_list)
-			aiPlayer.triggerAlarm("Fire", src, cameras, src)
-		for (var/obj/machinery/computer/station_alert/a in machines)
-			a.triggerAlarm("Fire", src, cameras, src)
 
 /area/proc/firereset()
 	if (fire)
@@ -164,13 +161,13 @@
 				else if(D.density)
 					spawn(0)
 					D.open()
-		for(var/area/RA in related)
+		/*for(var/area/RA in related)
 			for (var/obj/machinery/camera/C in RA)
 				C.network.Remove("Fire Alarms")
 		for (var/mob/living/silicon/ai/aiPlayer in player_list)
 			aiPlayer.cancelAlarm("Fire", src, src)
 		for (var/obj/machinery/computer/station_alert/a in machines)
-			a.cancelAlarm("Fire", src, src)
+			a.cancelAlarm("Fire", src, src)*/
 
 /area/proc/readyalert()
 	if(!eject)

code/game/machinery/camera/camera.dm

@@ -57,7 +57,7 @@
 /obj/machinery/camera/Del()
 	if(!alarm_on)
 		triggerCameraAlarm()
-	
+
 	cancelCameraAlarm()
 	..()
 
@@ -70,7 +70,7 @@
 			kick_viewers()
 			triggerCameraAlarm()
 			update_icon()
-			
+
 			spawn(900)
 				stat &= ~EMPED
 				cancelCameraAlarm()
@@ -85,11 +85,11 @@
 /obj/machinery/camera/ex_act(severity)
 	if(src.invuln)
 		return
-	
+
 	//camera dies if an explosion touches it!
 	if(severity <= 2 || prob(50))
 		destroy()
-	
+
 	..() //and give it the regular chance of being deleted outright
 
 
@@ -174,7 +174,7 @@
 				if (S.current == src)
 					O << "[U] holds \a [itemname] up to one of the cameras ..."
 					O << browse(text("<HTML><HEAD><TITLE>[]</TITLE></HEAD><BODY><TT>[]</TT></BODY></HTML>", itemname, info), text("window=[]", itemname))
-	
+
 	else if (istype(W, /obj/item/weapon/camera_bug))
 		if (!src.can_use())
 			user << "\blue Camera non-functional"
@@ -185,7 +185,7 @@
 		else
 			user << "\blue Camera bugged."
 			src.bugged = 1
-			
+
 	else if(W.damtype == BRUTE || W.damtype == BURN) //bashing cameras
 		if (W.force >= src.toughness)
 			visible_message("<span class='warning'><b>[src] has been [pick(W.attack_verb)] with [W] by [user]!</b></span>")
@@ -194,7 +194,7 @@
 				if (I.hitsound)
 					playsound(loc, I.hitsound, 50, 1, -1)
 		take_damage(W.force)
-	
+
 	else
 		..()
 
@@ -221,14 +221,14 @@
 	if (force >= toughness && (force > toughness*4 || prob(25)))
 		destroy()
 
-//Used when someone breaks a camera 
+//Used when someone breaks a camera
 /obj/machinery/camera/proc/destroy()
 	invalidateCameraCache()
 	stat |= BROKEN
 	kick_viewers()
 	triggerCameraAlarm()
 	update_icon()
-	
+
 	//sparks
 	var/datum/effect/effect/system/spark_spread/spark_system = new /datum/effect/effect/system/spark_spread()
 	spark_system.set_up(5, 0, loc)
@@ -264,20 +264,14 @@
 
 /obj/machinery/camera/proc/triggerCameraAlarm()
 	alarm_on = 1
-	if(!get_area(src))
-		return
-	
-	for(var/mob/living/silicon/S in mob_list)
-		S.triggerAlarm("Camera", get_area(src), list(src), src)
-
+	camera_alarm.triggerAlarm(loc, src)
 
 /obj/machinery/camera/proc/cancelCameraAlarm()
-	alarm_on = 0
-	if(!get_area(src))
+	if(wires.IsIndexCut(CAMERA_WIRE_ALARM))
 		return
-	
-	for(var/mob/living/silicon/S in mob_list)
-		S.cancelAlarm("Camera", get_area(src), src)
+
+	alarm_on = 0
+	camera_alarm.cancelAlarm(loc, src)
 
 //if false, then the camera is listed as DEACTIVATED and cannot be used
 /obj/machinery/camera/proc/can_use()
@@ -355,7 +349,7 @@
 /obj/machinery/camera/interact(mob/living/user as mob)
 	if(!panel_open || istype(user, /mob/living/silicon/ai))
 		return
-	
+
 	if(stat & BROKEN)
 		user << "<span class='warning'>\The [src] is broken.</span>"
 		return

code/game/machinery/camera/motion.dm

@@ -45,8 +45,7 @@
 	if (!status || (stat & NOPOWER))
 		return 0
 	if (detectTime == -1)
-		for (var/mob/living/silicon/aiPlayer in player_list)
-			aiPlayer.cancelAlarm("Motion", get_area(src), src)
+		motion_alarm.cancelAlarm(loc, src)
 	detectTime = 0
 	return 1
 
@@ -54,8 +53,7 @@
 	if (!status || (stat & NOPOWER))
 		return 0
 	if (!detectTime) return 0
-	for (var/mob/living/silicon/aiPlayer in player_list)
-		aiPlayer.triggerAlarm("Motion", get_area(src), list(src), src)
+	motion_alarm.triggerAlarm(loc, src)
 	detectTime = -1
 	return 1
 

code/game/machinery/computer/camera.dm

@@ -3,6 +3,8 @@
 /proc/invalidateCameraCache()
 	for(var/obj/machinery/computer/security/s in world)
 		s.camera_cache = null
+	for(var/datum/alarm/A in alarm_manager.active_alarms())
+		A.cameras = null
 
 /obj/machinery/computer/security
 	name = "security camera monitor"

code/global.dm

@@ -174,8 +174,9 @@ var/gravity_is_on = 1
 var/join_motd = null
 var/forceblob = 0
 
-var/datum/nanomanager/nanomanager     = new() // NanoManager, the manager for Nano UIs.
-var/datum/event_manager/event_manager = new() // Event Manager, the manager for events.
+var/datum/nanomanager/nanomanager		= new() // NanoManager, the manager for Nano UIs.
+var/datum/event_manager/event_manager	= new() // Event Manager, the manager for events.
+var/datum/subsystem/alarm/alarm_manager	= new() // Alarm Manager, the manager for alarms.
 
 var/list/awaydestinations = list() // Away missions. A list of landmarks that the warpgate can take you to.
 

code/modules/alarm/alarm.dm

@@ -0,0 +1,78 @@
+/datum/alarm_source
+	var/source		= null	// The source trigger
+	var/source_name = ""	// The name of the source should it be lost (for example a destroyed camera)
+	var/duration	= 0		// How long this source will be alarming, 0 for indefinetely.
+	var/start_time	= 0		// When this source began alarming.
+	var/end_time	= 0		// Use to set when this trigger should clear, in case the source is lost.
+
+/datum/alarm_source/New(var/atom/source)
+	src.source = source
+	source_name = source.name
+	start_time = world.time
+
+/datum/alarm
+	var/atom/origin					//Used to identify the alarm area.
+	var/list/sources = new()		//List of sources triggering the alarm. Used to determine when the alarm should be cleared.
+	var/list/sources_assoc = new()	//Associative list of source triggers. Used to efficiently acquire the alarm source.
+	var/list/cameras				//List of cameras that can be switched to, if the player has that capability.
+	var/area/last_area				//The last acquired area, used should origin be lost (for example a destroyed borg containing an alarming camera).
+
+/datum/alarm/New(var/atom/origin, var/atom/source, var/duration)
+	src.origin = origin
+	last_area = alarm_area()
+	set_duration(source, duration)
+
+/datum/alarm/proc/set_duration(var/atom/source, var/duration)
+	var/datum/alarm_source/AS = sources[source]
+	if(!AS)
+		AS = new/datum/alarm_source(source)
+		sources += AS
+		sources_assoc[source] = AS
+	// Currently only non-0 durations can be altered (normal alarms VS EMP blasts)
+	if(AS.duration)
+		AS.duration = duration
+
+/datum/alarm/proc/clear(var/source)
+	var/datum/alarm_source/AS = sources[source]
+	sources -= AS
+	sources_assoc -= source
+
+/datum/alarm/proc/alarm_area()
+	if(!origin)
+		return last_area
+
+	last_area = origin.get_alarm_area()
+	return last_area
+
+/datum/alarm/proc/cameras()
+	if(!origin)
+		return list()
+
+	if(!cameras)
+		cameras = origin.get_alarm_cameras()
+
+	return cameras
+
+
+/atom/proc/get_alarm_area()
+	return get_area(src)
+
+/area/get_alarm_area()
+	return src
+
+/atom/proc/get_alarm_cameras()
+	var/area/A = get_area(src)
+	return A.get_cameras()
+
+/area/get_alarm_cameras()
+	return get_cameras()
+
+/mob/living/silicon/robot/get_alarm_cameras()
+	var/list/cameras = ..()
+	if(camera)
+		cameras += camera
+
+	return cameras
+
+/mob/living/silicon/robot/syndicate/get_alarm_cameras()
+	return list()

code/modules/alarm/alarm_handler.dm

@@ -0,0 +1,112 @@
+#define ALARM_ORIGIN_LOST "Origin Lost"
+
+/datum/alarm_handler
+	var/category = ""
+	var/list/datum/alarm/alarms = new			// All alarms, to handle cases when origin has been deleted with one or more active alarms
+	var/list/datum/alarm/alarms_assoc = new		// Associative list of alarms, to efficiently acquire them based on origin.
+
+/datum/alarm_handler/proc/process()
+	/*
+	for(var/datum/alarm/A in alarms)
+		var/datum/alarm_source/AS = A.source
+		// Alarm owner has been deleted. Clean up in at most 15 seconds
+		if(!AS.owner && !AS.end_time)
+			AS.end_time = world.time + SecondsToTicks(15)
+		if(AS.duration || AS.end_time)
+			if(world.time > (AS.start_time + AS.duration) || world.time > AS.end_time)
+				//Somethingthing..
+	*/
+
+/datum/alarm_handler/proc/triggerAlarm(var/atom/origin, var/atom/source, var/duration = 0)
+	//Proper origin and source mandatory
+	if(!origin || !source)
+		return
+
+	//see if there is already an alarm of this origin
+	var/alarm_key = origin.get_alarm_key()
+	var/datum/alarm/existing = alarms_assoc[alarm_key]
+	if(existing)
+		existing.set_duration(source, duration)
+	else
+		existing = new/datum/alarm(origin, source, duration)
+
+	alarms |= existing
+	alarms_assoc[alarm_key] = existing
+
+/datum/alarm_handler/proc/cancelAlarm(var/atom/origin, var/source)
+	//Proper origin and source mandatory
+	if(!origin || !source)
+		return
+
+	var/alarm_key = origin.get_alarm_key()
+
+	var/datum/alarm/existing = alarms_assoc[alarm_key]
+	if(existing)
+		existing.clear(source)
+		if (!existing.sources.len)
+			alarms -= existing
+			alarms_assoc -= alarm_key
+
+/atom/proc/get_alarm_key()
+	return src
+
+/turf/get_alarm_key()
+	return get_area(src)
+
+/obj/item/device/alarm_debug
+	name = "An alarm debug tool - Self"
+	desc = "Alarm Up. Alarm Reset."
+	icon = 'icons/obj/radio.dmi'
+	icon_state = "beacon"
+	item_state = "signaler"
+
+/obj/item/device/alarm_debug/loc
+	name = "An alarm debug tool - Loc"
+
+/obj/item/device/alarm_debug/verb/alarm()
+	set name = "Alarm"
+	set category = "Debug"
+	usr << "Raising alarm"
+	camera_alarm.triggerAlarm(src, src)
+
+/obj/item/device/alarm_debug/verb/reset()
+	set name = "Reset"
+	set category = "Debug"
+	usr << "Raising alarm"
+	camera_alarm.triggerAlarm(src, src)
+
+/obj/item/device/alarm_debug/verb/tell_me()
+	set name = "Tell"
+	set category = "Debug"
+	usr << "Telling about alarms"
+
+	var/list/datum/alarm/alarms = camera_alarm.alarms
+	var/list/datum/alarm/alarms_assoc = camera_alarm.alarms_assoc
+
+	world << "List"
+	for(var/datum/alarm/A in alarms)
+		world << "Origin: [A.origin ? A.origin : ALARM_ORIGIN_LOST]"
+		world << "Alarm area: [A.alarm_area()]"
+		for(var/source in A.sources)
+			world << "Source: [source]"
+
+	world << "Assoc"
+
+	for(var/atom/origin in alarms_assoc)
+		world << "Origin: [origin ? origin : ALARM_ORIGIN_LOST]"
+		var/datum/alarm/A = alarms_assoc[origin]
+		world << "Alarm area: [A.alarm_area()]"
+		for(var/source in A.sources)
+			world << "Source: [source]"
+
+/obj/item/device/alarm_debug/loc/alarm()
+	set name = "Alarm"
+	set category = "Debug"
+	usr << "Raising alarm"
+	camera_alarm.triggerAlarm(src.loc, src)
+
+/obj/item/device/alarm_debug/loc/reset()
+	set name = "Reset"
+	set category = "Debug"
+	usr << "Clearing alarm"
+	camera_alarm.cancelAlarm(src.loc, src)

code/modules/alarm/atmosphere_alarm.dm

@@ -0,0 +1,2 @@
+/datum/alarm_handler/atmosphere
+	category = "Atmosphere"

code/modules/alarm/camera_alarm.dm

@@ -0,0 +1,2 @@
+/datum/alarm_handler/camera
+	category = "Camera"

code/modules/alarm/fire_alarm.dm

@@ -0,0 +1,2 @@
+/datum/alarm_handler/fire_alarm
+	category = "Fire"

code/modules/alarm/motion_alarm.dm

@@ -0,0 +1,2 @@
+/datum/alarm_handler/motion
+	category = "Motion"

code/modules/alarm/power_alarm.dm

@@ -0,0 +1,2 @@
+/datum/alarm_handler/power
+	category = "Power"

code/modules/mob/living/silicon/ai/ai.dm

@@ -324,31 +324,8 @@ var/list/ai_verbs_default = list(
 	set category = "AI Commands"
 	set name = "Show Alerts"
 
-	var/dat = "<HEAD><TITLE>Current Station Alerts</TITLE><META HTTP-EQUIV='Refresh' CONTENT='10'></HEAD><BODY>\n"
-	dat += "<A HREF='?src=\ref[src];mach_close=aialerts'>Close</A><BR><BR>"
-	for (var/cat in alarms)
-		dat += text("<B>[]</B><BR>\n", cat)
-		var/list/alarmlist = alarms[cat]
-		if (alarmlist.len)
-			for (var/area_name in alarmlist)
-				var/datum/alarm/alarm = alarmlist[area_name]
-				dat += "<NOBR>"
-
-				var/cameratext = ""
-				if (alarm.cameras)
-					for (var/obj/machinery/camera/I in alarm.cameras)
-						cameratext += text("[]<A HREF=?src=\ref[];switchcamera=\ref[]>[]</A>", (cameratext=="") ? "" : " | ", src, I, I.c_tag)
-				dat += text("-- [] ([])", alarm.area.name, (cameratext)? cameratext : "No Camera")
-
-				if (alarm.sources.len > 1)
-					dat += text(" - [] sources", alarm.sources.len)
-				dat += "</NOBR><BR>\n"
-		else
-			dat += "-- All Systems Nominal<BR>\n"
-		dat += "<BR>\n"
-
-	viewalerts = 1
-	src << browse(dat, "window=aialerts&can_close=0")
+	//PsiFix
+	//nano_alarm.ui_interact(usr)
 
 // this verb lets the ai see the stations manifest
 /mob/living/silicon/ai/proc/ai_roster()
@@ -521,29 +498,6 @@ var/list/ai_verbs_default = list(
 
 	return 1
 
-/mob/living/silicon/ai/triggerAlarm(var/class, area/A, list/cameralist, var/source)
-	if (stat == 2)
-		return 1
-
-	..()
-
-	var/cameratext = ""
-	for (var/obj/machinery/camera/C in cameralist)
-		cameratext += "[(cameratext == "")? "" : "|"]<A HREF=?src=\ref[src];switchcamera=\ref[C]>[C.c_tag]</A>"
-
-	queueAlarm("--- [class] alarm detected in [A.name]! ([(cameratext)? cameratext : "No Camera"])", class)
-
-	if (viewalerts) ai_alerts()
-
-/mob/living/silicon/ai/cancelAlarm(var/class, area/A as area, var/source)
-	var/has_alarm = ..()
-
-	if (!has_alarm)
-		queueAlarm(text("--- [] alarm in [] has been cleared.", class, A.name), class, 0)
-		if (viewalerts) ai_alerts()
-
-	return has_alarm
-
 /mob/living/silicon/ai/cancel_camera()
 	set category = "AI Commands"
 	set name = "Cancel Camera View"

code/modules/mob/living/silicon/alarm.dm

@@ -1,111 +0,0 @@
-/datum/alarm
-	var/area/area		//the area associated with the alarm. Used to identify the alarm
-	var/list/sources	//list of things triggering the alarm. Used to determine when the alarm should be cleared.
-	var/list/cameras	//list of cameras that can be switched to, if the player has that capability.
-
-/datum/alarm/New(area/A, list/sourcelist=list(), list/cameralist=list())
-	area = A
-	sources = sourcelist
-	cameras = cameralist
-	
-/mob/living/silicon
-	var/alarms = list("Motion"=list(), "Fire"=list(), "Atmosphere"=list(), "Power"=list(), "Camera"=list())	//each sublist stores alarms keyed by the area name
-	var/list/alarms_to_show = list()
-	var/list/alarms_to_clear = list()
-	var/list/alarm_types_show = list("Motion" = 0, "Fire" = 0, "Atmosphere" = 0, "Power" = 0, "Camera" = 0)
-	var/list/alarm_types_clear = list("Motion" = 0, "Fire" = 0, "Atmosphere" = 0, "Power" = 0, "Camera" = 0)
-
-/mob/living/silicon/proc/triggerAlarm(var/class, area/A, list/cameralist, var/source)
-	var/list/alarmlist = alarms[class]
-	
-	//see if there is already an alarm of this class for this area
-	if (A.name in alarmlist)
-		var/datum/alarm/existing = alarmlist[A.name]
-		existing.sources += source
-		existing.cameras |= cameralist
-	else
-		alarmlist[A.name] = new /datum/alarm(A, list(source), cameralist)
-
-/mob/living/silicon/proc/cancelAlarm(var/class, area/A as area, var/source)
-	var/cleared = 0
-	var/list/alarmlist = alarms[class]
-	
-	if (A.name in alarmlist)
-		var/datum/alarm/alarm = alarmlist[A.name]
-		alarm.sources -= source
-		
-		if (!(alarm.sources.len))
-			cleared = 1
-			alarmlist -= A.name
-
-	return !cleared
-
-/mob/living/silicon/proc/queueAlarm(var/message, var/type, var/incoming = 1)
-	var/in_cooldown = (alarms_to_show.len > 0 || alarms_to_clear.len > 0)
-	if(incoming)
-		alarms_to_show += message
-		alarm_types_show[type] += 1
-	else
-		alarms_to_clear += message
-		alarm_types_clear[type] += 1
-
-	if(!in_cooldown)
-		spawn(10 * 10) // 10 seconds
-
-			if(alarms_to_show.len < 5)
-				for(var/msg in alarms_to_show)
-					src << msg
-			else if(alarms_to_show.len)
-
-				var/msg = "--- "
-
-				if(alarm_types_show["Motion"])
-					msg += "MOTION: [alarm_types_show["Motion"]] alarms detected. - "
-
-				if(alarm_types_show["Fire"])
-					msg += "FIRE: [alarm_types_show["Fire"]] alarms detected. - "
-
-				if(alarm_types_show["Atmosphere"])
-					msg += "ATMOSPHERE: [alarm_types_show["Atmosphere"]] alarms detected. - "
-
-				if(alarm_types_show["Power"])
-					msg += "POWER: [alarm_types_show["Power"]] alarms detected. - "
-
-				if(alarm_types_show["Camera"])
-					msg += "CAMERA: [alarm_types_show["Power"]] alarms detected. - "
-
-				msg += "<A href=?src=\ref[src];showalerts=1'>\[Show Alerts\]</a>"
-				src << msg
-
-			if(alarms_to_clear.len < 3)
-				for(var/msg in alarms_to_clear)
-					src << msg
-
-			else if(alarms_to_clear.len)
-				var/msg = "--- "
-
-				if(alarm_types_clear["Motion"])
-					msg += "MOTION: [alarm_types_clear["Motion"]] alarms cleared. - "
-
-				if(alarm_types_clear["Fire"])
-					msg += "FIRE: [alarm_types_clear["Fire"]] alarms cleared. - "
-
-				if(alarm_types_clear["Atmosphere"])
-					msg += "ATMOSPHERE: [alarm_types_clear["Atmosphere"]] alarms cleared. - "
-
-				if(alarm_types_clear["Power"])
-					msg += "POWER: [alarm_types_clear["Power"]] alarms cleared. - "
-
-				if(alarm_types_show["Camera"])
-					msg += "CAMERA: [alarm_types_show["Power"]] alarms detected. - "
-
-				msg += "<A href=?src=\ref[src];showalerts=1'>\[Show Alerts\]</a>"
-				src << msg
-
-
-			alarms_to_show = list()
-			alarms_to_clear = list()
-			for(var/i = 1; i < alarm_types_show.len; i++)
-				alarm_types_show[i] = 0
-			for(var/i = 1; i < alarm_types_clear.len; i++)
-				alarm_types_clear[i] = 0

code/modules/mob/living/silicon/robot/robot.dm

@@ -450,25 +450,8 @@ var/list/robot_verbs_default = list(
 
 
 /mob/living/silicon/robot/proc/robot_alerts()
-	var/dat = "<HEAD><TITLE>Current Station Alerts</TITLE><META HTTP-EQUIV='Refresh' CONTENT='10'></HEAD><BODY>\n"
-	dat += "<A HREF='?src=\ref[src];mach_close=robotalerts'>Close</A><BR><BR>"
-	for (var/cat in alarms)
-		dat += text("<B>[cat]</B><BR>\n")
-		var/list/alarmlist = alarms[cat]
-		if (alarmlist.len)
-			for (var/area_name in alarmlist)
-				var/datum/alarm/alarm = alarmlist[area_name]
-				dat += "<NOBR>"
-				dat += text("-- [area_name]")
-				if (alarm.sources.len > 1)
-					dat += text("- [alarm.sources.len] sources")
-				dat += "</NOBR><BR>\n"
-		else
-			dat += "-- All Systems Nominal<BR>\n"
-		dat += "<BR>\n"
-
-	viewalerts = 1
-	src << browse(dat, "window=robotalerts&can_close=0")
+	//PsiFix
+	//nano_alarm.ui_interact(usr)
 
 /mob/living/silicon/robot/proc/self_diagnosis()
 	if(!is_component_functioning("diagnosis unit"))
@@ -636,25 +619,6 @@ var/list/robot_verbs_default = list(
 		return
 	return
 
-
-/mob/living/silicon/robot/triggerAlarm(var/class, area/A, list/cameralist, var/source)
-	if (stat == 2)
-		return 1
-
-	..()
-
-	queueAlarm(text("--- [class] alarm detected in [A.name]!"), class)
-
-
-/mob/living/silicon/robot/cancelAlarm(var/class, area/A as area, obj/origin)
-	var/has_alarm = ..()
-
-	if (!has_alarm)
-		queueAlarm(text("--- [class] alarm in [A.name] has been cleared."), class, 0)
-//		if (viewalerts) robot_alerts()
-	return has_alarm
-
-
 /mob/living/silicon/robot/attackby(obj/item/weapon/W as obj, mob/user as mob)
 	if (istype(W, /obj/item/weapon/handcuffs)) // fuck i don't even know why isrobot() in handcuff code isn't working so this will have to do
 		return

code/modules/mob/living/silicon/silicon.dm

@@ -23,6 +23,7 @@
 	var/local_transmit //If set, can only speak to others of the same type within a short range.
 
 	var/sensor_mode = 0 //Determines the current HUD.
+
 	#define SEC_HUD 1 //Security HUD mode
 	#define MED_HUD 2 //Medical HUD mode
 

code/modules/mob/mob.dm

@@ -808,6 +808,8 @@ note dizziness decrements automatically in the mob's Life() proc.
 				stat(null,"Obj-[master_controller.objects_cost]\t#[processing_objects.len]")
 				stat(null,"Net-[master_controller.networks_cost]\tPnet-[master_controller.powernets_cost]")
 				stat(null,"NanoUI-[master_controller.nano_cost]\t#[nanomanager.processing_uis.len]")
+				stat(null,"Event-[master_controller.events_cost]\t# [event_manager.active_events.len]")
+				alarm_manager.stat_entry()
 				stat(null,"Tick-[master_controller.ticker_cost]\tALL-[master_controller.total_cost]")
 			else
 				stat(null,"MasterController-ERROR")
@@ -1210,4 +1212,4 @@ mob/proc/yank_out_object()
 /mob/verb/westfaceperm()
 	set hidden = 1
 	facing_dir = null
-	set_face_dir(WEST)
+	set_face_dir(WEST)